(function webpackUniversalModuleDefinition(root, factory) { if(typeof exports === 'object' && typeof module === 'object') module.exports = factory(); else if(typeof define === 'function' && define.amd) define([], factory); else { var a = factory(); for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i]; } })(typeof self !== 'undefined' ? self : this, function() { return /******/ (function(modules) { // webpackBootstrap /******/ // The module cache /******/ var installedModules = {}; /******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { /******/ /******/ // Check if module is in cache /******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; /******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { /******/ i: moduleId, /******/ l: false, /******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); /******/ /******/ // Flag the module as loaded /******/ module.l = true; /******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } /******/ /******/ /******/ // expose the modules object (__webpack_modules__) /******/ __webpack_require__.m = modules; /******/ /******/ // expose the module cache /******/ __webpack_require__.c = installedModules; /******/ /******/ // define getter function for harmony exports /******/ __webpack_require__.d = function(exports, name, getter) { /******/ if(!__webpack_require__.o(exports, name)) { /******/ Object.defineProperty(exports, name, { /******/ configurable: false, /******/ enumerable: true, /******/ get: getter /******/ }); /******/ } /******/ }; /******/ /******/ // getDefaultExport function for compatibility with non-harmony modules /******/ __webpack_require__.n = function(module) { /******/ var getter = module && module.__esModule ? /******/ function getDefault() { return module['default']; } : /******/ function getModuleExports() { return module; }; /******/ __webpack_require__.d(getter, 'a', getter); /******/ return getter; /******/ }; /******/ /******/ // Object.prototype.hasOwnProperty.call /******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; /******/ /******/ // __webpack_public_path__ /******/ __webpack_require__.p = ""; /******/ /******/ // Load entry module and return exports /******/ return __webpack_require__(__webpack_require__.s = 176); /******/ }) /************************************************************************/ /******/ ([ /* 0 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function __export(m) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } Object.defineProperty(exports, "__esModule", { value: true }); __export(__webpack_require__(177)); __export(__webpack_require__(178)); __export(__webpack_require__(88)); __export(__webpack_require__(179)); /***/ }), /* 1 */ /***/ (function(module, exports) { module.exports = require("util"); /***/ }), /* 2 */ /***/ (function(module, exports, __webpack_require__) { // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(23); var Stream = __webpack_require__(11).Stream; var util = __webpack_require__(1); ///--- Globals /* JSSTYLED */ var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; ///--- Internal function _capitalize(str) { return (str.charAt(0).toUpperCase() + str.slice(1)); } function _toss(name, expected, oper, arg, actual) { throw new assert.AssertionError({ message: util.format('%s (%s) is required', name, expected), actual: (actual === undefined) ? typeof (arg) : actual(arg), expected: expected, operator: oper || '===', stackStartFunction: _toss.caller }); } function _getClass(arg) { return (Object.prototype.toString.call(arg).slice(8, -1)); } function noop() { // Why even bother with asserts? } ///--- Exports var types = { bool: { check: function (arg) { return typeof (arg) === 'boolean'; } }, func: { check: function (arg) { return typeof (arg) === 'function'; } }, string: { check: function (arg) { return typeof (arg) === 'string'; } }, object: { check: function (arg) { return typeof (arg) === 'object' && arg !== null; } }, number: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg); } }, finite: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); } }, buffer: { check: function (arg) { return Buffer.isBuffer(arg); }, operator: 'Buffer.isBuffer' }, array: { check: function (arg) { return Array.isArray(arg); }, operator: 'Array.isArray' }, stream: { check: function (arg) { return arg instanceof Stream; }, operator: 'instanceof', actual: _getClass }, date: { check: function (arg) { return arg instanceof Date; }, operator: 'instanceof', actual: _getClass }, regexp: { check: function (arg) { return arg instanceof RegExp; }, operator: 'instanceof', actual: _getClass }, uuid: { check: function (arg) { return typeof (arg) === 'string' && UUID_REGEXP.test(arg); }, operator: 'isUUID' } }; function _setExports(ndebug) { var keys = Object.keys(types); var out; /* re-export standard assert */ if (process.env.NODE_NDEBUG) { out = noop; } else { out = function (arg, msg) { if (!arg) { _toss(msg, 'true', arg); } }; } /* standard checks */ keys.forEach(function (k) { if (ndebug) { out[k] = noop; return; } var type = types[k]; out[k] = function (arg, msg) { if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* optional checks */ keys.forEach(function (k) { var name = 'optional' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* arrayOf checks */ keys.forEach(function (k) { var name = 'arrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* optionalArrayOf checks */ keys.forEach(function (k) { var name = 'optionalArrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* re-export built-in assertions */ Object.keys(assert).forEach(function (k) { if (k === 'AssertionError') { out[k] = assert[k]; return; } if (ndebug) { out[k] = noop; return; } out[k] = assert[k]; }); /* export ourselves (for unit tests _only_) */ out._setExports = _setExports; return out; } module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), /* 3 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; var es5 = __webpack_require__(31); var canEvaluate = typeof navigator == "undefined"; var errorObj = {e: {}}; var tryCatchTarget; var globalObject = typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : this !== undefined ? this : null; function tryCatcher() { try { var target = tryCatchTarget; tryCatchTarget = null; return target.apply(this, arguments); } catch (e) { errorObj.e = e; return errorObj; } } function tryCatch(fn) { tryCatchTarget = fn; return tryCatcher; } var inherits = function(Child, Parent) { var hasProp = {}.hasOwnProperty; function T() { this.constructor = Child; this.constructor$ = Parent; for (var propertyName in Parent.prototype) { if (hasProp.call(Parent.prototype, propertyName) && propertyName.charAt(propertyName.length-1) !== "$" ) { this[propertyName + "$"] = Parent.prototype[propertyName]; } } } T.prototype = Parent.prototype; Child.prototype = new T(); return Child.prototype; }; function isPrimitive(val) { return val == null || val === true || val === false || typeof val === "string" || typeof val === "number"; } function isObject(value) { return typeof value === "function" || typeof value === "object" && value !== null; } function maybeWrapAsError(maybeError) { if (!isPrimitive(maybeError)) return maybeError; return new Error(safeToString(maybeError)); } function withAppended(target, appendee) { var len = target.length; var ret = new Array(len + 1); var i; for (i = 0; i < len; ++i) { ret[i] = target[i]; } ret[i] = appendee; return ret; } function getDataPropertyOrDefault(obj, key, defaultValue) { if (es5.isES5) { var desc = Object.getOwnPropertyDescriptor(obj, key); if (desc != null) { return desc.get == null && desc.set == null ? desc.value : defaultValue; } } else { return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined; } } function notEnumerableProp(obj, name, value) { if (isPrimitive(obj)) return obj; var descriptor = { value: value, configurable: true, enumerable: false, writable: true }; es5.defineProperty(obj, name, descriptor); return obj; } function thrower(r) { throw r; } var inheritedDataKeys = (function() { var excludedPrototypes = [ Array.prototype, Object.prototype, Function.prototype ]; var isExcludedProto = function(val) { for (var i = 0; i < excludedPrototypes.length; ++i) { if (excludedPrototypes[i] === val) { return true; } } return false; }; if (es5.isES5) { var getKeys = Object.getOwnPropertyNames; return function(obj) { var ret = []; var visitedKeys = Object.create(null); while (obj != null && !isExcludedProto(obj)) { var keys; try { keys = getKeys(obj); } catch (e) { return ret; } for (var i = 0; i < keys.length; ++i) { var key = keys[i]; if (visitedKeys[key]) continue; visitedKeys[key] = true; var desc = Object.getOwnPropertyDescriptor(obj, key); if (desc != null && desc.get == null && desc.set == null) { ret.push(key); } } obj = es5.getPrototypeOf(obj); } return ret; }; } else { var hasProp = {}.hasOwnProperty; return function(obj) { if (isExcludedProto(obj)) return []; var ret = []; /*jshint forin:false */ enumeration: for (var key in obj) { if (hasProp.call(obj, key)) { ret.push(key); } else { for (var i = 0; i < excludedPrototypes.length; ++i) { if (hasProp.call(excludedPrototypes[i], key)) { continue enumeration; } } ret.push(key); } } return ret; }; } })(); var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/; function isClass(fn) { try { if (typeof fn === "function") { var keys = es5.names(fn.prototype); var hasMethods = es5.isES5 && keys.length > 1; var hasMethodsOtherThanConstructor = keys.length > 0 && !(keys.length === 1 && keys[0] === "constructor"); var hasThisAssignmentAndStaticMethods = thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0; if (hasMethods || hasMethodsOtherThanConstructor || hasThisAssignmentAndStaticMethods) { return true; } } return false; } catch (e) { return false; } } function toFastProperties(obj) { /*jshint -W027,-W055,-W031*/ function FakeConstructor() {} FakeConstructor.prototype = obj; var l = 8; while (l--) new FakeConstructor(); return obj; eval(obj); } var rident = /^[a-z$_][a-z$_0-9]*$/i; function isIdentifier(str) { return rident.test(str); } function filledRange(count, prefix, suffix) { var ret = new Array(count); for(var i = 0; i < count; ++i) { ret[i] = prefix + i + suffix; } return ret; } function safeToString(obj) { try { return obj + ""; } catch (e) { return "[no string representation]"; } } function isError(obj) { return obj instanceof Error || (obj !== null && typeof obj === "object" && typeof obj.message === "string" && typeof obj.name === "string"); } function markAsOriginatingFromRejection(e) { try { notEnumerableProp(e, "isOperational", true); } catch(ignore) {} } function originatesFromRejection(e) { if (e == null) return false; return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) || e["isOperational"] === true); } function canAttachTrace(obj) { return isError(obj) && es5.propertyIsWritable(obj, "stack"); } var ensureErrorObject = (function() { if (!("stack" in new Error())) { return function(value) { if (canAttachTrace(value)) return value; try {throw new Error(safeToString(value));} catch(err) {return err;} }; } else { return function(value) { if (canAttachTrace(value)) return value; return new Error(safeToString(value)); }; } })(); function classString(obj) { return {}.toString.call(obj); } function copyDescriptors(from, to, filter) { var keys = es5.names(from); for (var i = 0; i < keys.length; ++i) { var key = keys[i]; if (filter(key)) { try { es5.defineProperty(to, key, es5.getDescriptor(from, key)); } catch (ignore) {} } } } var asArray = function(v) { if (es5.isArray(v)) { return v; } return null; }; if (typeof Symbol !== "undefined" && Symbol.iterator) { var ArrayFrom = typeof Array.from === "function" ? function(v) { return Array.from(v); } : function(v) { var ret = []; var it = v[Symbol.iterator](); var itResult; while (!((itResult = it.next()).done)) { ret.push(itResult.value); } return ret; }; asArray = function(v) { if (es5.isArray(v)) { return v; } else if (v != null && typeof v[Symbol.iterator] === "function") { return ArrayFrom(v); } return null; }; } var isNode = typeof process !== "undefined" && classString(process).toLowerCase() === "[object process]"; var hasEnvVariables = typeof process !== "undefined" && typeof process.env !== "undefined"; function env(key) { return hasEnvVariables ? process.env[key] : undefined; } function getNativePromise() { if (typeof Promise === "function") { try { var promise = new Promise(function(){}); if ({}.toString.call(promise) === "[object Promise]") { return Promise; } } catch (e) {} } } function domainBind(self, cb) { return self.bind(cb); } var ret = { isClass: isClass, isIdentifier: isIdentifier, inheritedDataKeys: inheritedDataKeys, getDataPropertyOrDefault: getDataPropertyOrDefault, thrower: thrower, isArray: es5.isArray, asArray: asArray, notEnumerableProp: notEnumerableProp, isPrimitive: isPrimitive, isObject: isObject, isError: isError, canEvaluate: canEvaluate, errorObj: errorObj, tryCatch: tryCatch, inherits: inherits, withAppended: withAppended, maybeWrapAsError: maybeWrapAsError, toFastProperties: toFastProperties, filledRange: filledRange, toString: safeToString, canAttachTrace: canAttachTrace, ensureErrorObject: ensureErrorObject, originatesFromRejection: originatesFromRejection, markAsOriginatingFromRejection: markAsOriginatingFromRejection, classString: classString, copyDescriptors: copyDescriptors, hasDevTools: typeof chrome !== "undefined" && chrome && typeof chrome.loadTimes === "function", isNode: isNode, hasEnvVariables: hasEnvVariables, env: env, global: globalObject, getNativePromise: getNativePromise, domainBind: domainBind }; ret.isRecentNode = ret.isNode && (function() { var version = process.versions.node.split(".").map(Number); return (version[0] === 0 && version[1] > 10) || (version[0] > 0); })(); if (ret.isNode) ret.toFastProperties(process); try {throw new Error(); } catch (e) {ret.lastLineError = e;} module.exports = ret; /***/ }), /* 4 */ /***/ (function(module, exports) { module.exports = require("crypto"); /***/ }), /* 5 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { bufferSplit: bufferSplit, addRSAMissing: addRSAMissing, calculateDSAPublic: calculateDSAPublic, calculateED25519Public: calculateED25519Public, calculateX25519Public: calculateX25519Public, mpNormalize: mpNormalize, mpDenormalize: mpDenormalize, ecNormalize: ecNormalize, countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, opensslKeyDeriv: opensslKeyDeriv, opensshCipherInfo: opensshCipherInfo, publicFromPrivateECDSA: publicFromPrivateECDSA, zeroPadToLength: zeroPadToLength, writeBitString: writeBitString, readBitString: readBitString }; var assert = __webpack_require__(2); var PrivateKey = __webpack_require__(8); var Key = __webpack_require__(6); var crypto = __webpack_require__(4); var algs = __webpack_require__(7); var asn1 = __webpack_require__(21); var ec, jsbn; var nacl; var MAX_CLASS_DEPTH = 3; function isCompatible(obj, klass, needVer) { if (obj === null || typeof (obj) !== 'object') return (false); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return (true); var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); if (!proto || ++depth > MAX_CLASS_DEPTH) return (false); } if (proto.constructor.name !== klass.name) return (false); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); if (ver[0] != needVer[0] || ver[1] < needVer[1]) return (false); return (true); } function assertCompatible(obj, klass, needVer, name) { if (name === undefined) name = 'object'; assert.ok(obj, name + ' must not be null'); assert.object(obj, name + ' must be an object'); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return; var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, name + ' must be a ' + klass.name + ' instance'); } assert.strictEqual(proto.constructor.name, klass.name, name + ' must be a ' + klass.name + ' instance'); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], name + ' must be compatible with ' + klass.name + ' klass ' + 'version ' + needVer[0] + '.' + needVer[1]); } var CIPHER_LEN = { 'des-ede3-cbc': { key: 7, iv: 8 }, 'aes-128-cbc': { key: 16, iv: 16 } }; var PKCS5_SALT_LEN = 8; function opensslKeyDeriv(cipher, salt, passphrase, count) { assert.buffer(salt, 'salt'); assert.buffer(passphrase, 'passphrase'); assert.number(count, 'iteration count'); var clen = CIPHER_LEN[cipher]; assert.object(clen, 'supported cipher'); salt = salt.slice(0, PKCS5_SALT_LEN); var D, D_prev, bufs; var material = new Buffer(0); while (material.length < clen.key + clen.iv) { bufs = []; if (D_prev) bufs.push(D_prev); bufs.push(passphrase); bufs.push(salt); D = Buffer.concat(bufs); for (var j = 0; j < count; ++j) D = crypto.createHash('md5').update(D).digest(); material = Buffer.concat([material, D]); D_prev = D; } return ({ key: material.slice(0, clen.key), iv: material.slice(clen.key, clen.key + clen.iv) }); } /* Count leading zero bits on a buffer */ function countZeros(buf) { var o = 0, obit = 8; while (o < buf.length) { var mask = (1 << obit); if ((buf[o] & mask) === mask) break; obit--; if (obit < 0) { o++; obit = 8; } } return (o*8 + (8 - obit) - 1); } function bufferSplit(buf, chr) { assert.buffer(buf); assert.string(chr); var parts = []; var lastPart = 0; var matches = 0; for (var i = 0; i < buf.length; ++i) { if (buf[i] === chr.charCodeAt(matches)) ++matches; else if (buf[i] === chr.charCodeAt(0)) matches = 1; else matches = 0; if (matches >= chr.length) { var newPart = i + 1; parts.push(buf.slice(lastPart, newPart - matches)); lastPart = newPart; matches = 0; } } if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); return (parts); } function ecNormalize(buf, addZero) { assert.buffer(buf); if (buf[0] === 0x00 && buf[1] === 0x04) { if (addZero) return (buf); return (buf.slice(1)); } else if (buf[0] === 0x04) { if (!addZero) return (buf); } else { while (buf[0] === 0x00) buf = buf.slice(1); if (buf[0] === 0x02 || buf[0] === 0x03) throw (new Error('Compressed elliptic curve points ' + 'are not supported')); if (buf[0] !== 0x04) throw (new Error('Not a valid elliptic curve point')); if (!addZero) return (buf); } var b = new Buffer(buf.length + 1); b[0] = 0x0; buf.copy(b, 1); return (b); } function readBitString(der, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var buf = der.readString(tag, true); assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + 'not supported (0x' + buf[0].toString(16) + ')'); return (buf.slice(1)); } function writeBitString(der, buf, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var b = new Buffer(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); der.writeBuffer(b, tag); } function mpNormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) buf = buf.slice(1); if ((buf[0] & 0x80) === 0x80) { var b = new Buffer(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function mpDenormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); return (buf); } function zeroPadToLength(buf, len) { assert.buffer(buf); assert.number(len); while (buf.length > len) { assert.equal(buf[0], 0x00); buf = buf.slice(1); } while (buf.length < len) { var b = new Buffer(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function bigintToMpBuf(bigint) { var buf = new Buffer(bigint.toByteArray()); buf = mpNormalize(buf); return (buf); } function calculateDSAPublic(g, p, x) { assert.buffer(g); assert.buffer(p); assert.buffer(x); try { var bigInt = __webpack_require__(25).BigInteger; } catch (e) { throw (new Error('To load a PKCS#8 format DSA private key, ' + 'the node jsbn library is required.')); } g = new bigInt(g); p = new bigInt(p); x = new bigInt(x); var y = g.modPow(x, p); var ybuf = bigintToMpBuf(y); return (ybuf); } function calculateED25519Public(k) { assert.buffer(k); if (nacl === undefined) nacl = __webpack_require__(20); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (new Buffer(kp.publicKey)); } function calculateX25519Public(k) { assert.buffer(k); if (nacl === undefined) nacl = __webpack_require__(20); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (new Buffer(kp.publicKey)); } function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); try { var bigInt = __webpack_require__(25).BigInteger; } catch (e) { throw (new Error('To write a PEM private key from ' + 'this source, the node jsbn lib is required.')); } var d = new bigInt(key.part.d.data); var buf; if (!key.part.dmodp) { var p = new bigInt(key.part.p.data); var dmodp = d.mod(p.subtract(1)); buf = bigintToMpBuf(dmodp); key.part.dmodp = {name: 'dmodp', data: buf}; key.parts.push(key.part.dmodp); } if (!key.part.dmodq) { var q = new bigInt(key.part.q.data); var dmodq = d.mod(q.subtract(1)); buf = bigintToMpBuf(dmodq); key.part.dmodq = {name: 'dmodq', data: buf}; key.parts.push(key.part.dmodq); } } function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); if (ec === undefined) ec = __webpack_require__(41); if (jsbn === undefined) jsbn = __webpack_require__(25).BigInteger; var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); var d = new jsbn(mpNormalize(priv)); var pub = G.multiply(d); pub = new Buffer(curve.encodePointHex(pub), 'hex'); var parts = []; parts.push({name: 'curve', data: new Buffer(curveName)}); parts.push({name: 'Q', data: pub}); var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); return (key); } function opensshCipherInfo(cipher) { var inf = {}; switch (cipher) { case '3des-cbc': inf.keySize = 24; inf.blockSize = 8; inf.opensslName = 'des-ede3-cbc'; break; case 'blowfish-cbc': inf.keySize = 16; inf.blockSize = 8; inf.opensslName = 'bf-cbc'; break; case 'aes128-cbc': case 'aes128-ctr': case 'aes128-gcm@openssh.com': inf.keySize = 16; inf.blockSize = 16; inf.opensslName = 'aes-128-' + cipher.slice(7, 10); break; case 'aes192-cbc': case 'aes192-ctr': case 'aes192-gcm@openssh.com': inf.keySize = 24; inf.blockSize = 16; inf.opensslName = 'aes-192-' + cipher.slice(7, 10); break; case 'aes256-cbc': case 'aes256-ctr': case 'aes256-gcm@openssh.com': inf.keySize = 32; inf.blockSize = 16; inf.opensslName = 'aes-256-' + cipher.slice(7, 10); break; default: throw (new Error( 'Unsupported openssl cipher "' + cipher + '"')); } return (inf); } /***/ }), /* 6 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Key; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var Fingerprint = __webpack_require__(39); var Signature = __webpack_require__(19); var DiffieHellman = __webpack_require__(75).DiffieHellman; var errs = __webpack_require__(18); var utils = __webpack_require__(5); var PrivateKey = __webpack_require__(8); var edCompat; try { edCompat = __webpack_require__(147); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var formats = {}; formats['auto'] = __webpack_require__(148); formats['pem'] = __webpack_require__(26); formats['pkcs1'] = __webpack_require__(78); formats['pkcs8'] = __webpack_require__(42); formats['rfc4253'] = __webpack_require__(27); formats['ssh'] = __webpack_require__(150); formats['ssh-private'] = __webpack_require__(54); formats['openssh'] = formats['ssh-private']; formats['dnssec'] = __webpack_require__(79); function Key(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); assert.optionalString(opts.comment, 'options.comment'); var algInfo = algs.info[opts.type]; if (typeof (algInfo) !== 'object') throw (new InvalidAlgorithmError(opts.type)); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.parts = opts.parts; this.part = partLookup; this.comment = undefined; this.source = opts.source; /* for speeding up hashing/fingerprint operations */ this._rfc4253Cache = opts._rfc4253Cache; this._hashCache = {}; var sz; this.curve = undefined; if (this.type === 'ecdsa') { var curve = this.part.curve.data.toString(); this.curve = curve; sz = algs.curves[curve].size; } else if (this.type === 'ed25519' || this.type === 'curve25519') { sz = 256; this.curve = 'curve25519'; } else { var szPart = this.part[algInfo.sizePart]; sz = szPart.data.length; sz = sz * 8 - utils.countZeros(szPart.data); } this.size = sz; } Key.formats = formats; Key.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'ssh'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); if (format === 'rfc4253') { if (this._rfc4253Cache === undefined) this._rfc4253Cache = formats['rfc4253'].write(this); return (this._rfc4253Cache); } return (formats[format].write(this, options)); }; Key.prototype.toString = function (format, options) { return (this.toBuffer(format, options).toString()); }; Key.prototype.hash = function (algo) { assert.string(algo, 'algorithm'); algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); if (this._hashCache[algo]) return (this._hashCache[algo]); var hash = crypto.createHash(algo). update(this.toBuffer('rfc4253')).digest(); this._hashCache[algo] = hash; return (hash); }; Key.prototype.fingerprint = function (algo) { if (algo === undefined) algo = 'sha256'; assert.string(algo, 'algorithm'); var opts = { type: 'key', hash: this.hash(algo), algorithm: algo }; return (new Fingerprint(opts)); }; Key.prototype.defaultHashAlgorithm = function () { var hashAlgo = 'sha1'; if (this.type === 'rsa') hashAlgo = 'sha256'; if (this.type === 'dsa' && this.size > 1024) hashAlgo = 'sha256'; if (this.type === 'ed25519') hashAlgo = 'sha512'; if (this.type === 'ecdsa') { if (this.size <= 256) hashAlgo = 'sha256'; else if (this.size <= 384) hashAlgo = 'sha384'; else hashAlgo = 'sha512'; } return (hashAlgo); }; Key.prototype.createVerify = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Verifier(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } assert.ok(v, 'failed to create verifier'); var oldVerify = v.verify.bind(v); var key = this.toBuffer('pkcs8'); var curve = this.curve; var self = this; v.verify = function (signature, fmt) { if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== self.type) return (false); if (signature.hashAlgorithm && signature.hashAlgorithm !== hashAlgo) return (false); if (signature.curve && self.type === 'ecdsa' && signature.curve !== curve) return (false); return (oldVerify(key, signature.toBuffer('asn1'))); } else if (typeof (signature) === 'string' || Buffer.isBuffer(signature)) { return (oldVerify(key, signature, fmt)); /* * Avoid doing this on valid arguments, walking the prototype * chain can be quite slow. */ } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } else { throw (new TypeError('signature must be a string, ' + 'Buffer, or Signature object')); } }; return (v); }; Key.prototype.createDiffieHellman = function () { if (this.type === 'rsa') throw (new Error('RSA keys do not support Diffie-Hellman')); return (new DiffieHellman(this)); }; Key.prototype.createDH = Key.prototype.createDiffieHellman; Key.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); if (k instanceof PrivateKey) k = k.toPublic(); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; Key.isKey = function (obj, ver) { return (utils.isCompatible(obj, Key, ver)); }; /* * API versions for Key: * [1,0] -- initial ver, may take Signature for createVerify or may not * [1,1] -- added pkcs1, pkcs8 formats * [1,2] -- added auto, ssh-private, openssh formats * [1,3] -- added defaultHashAlgorithm * [1,4] -- added ed support, createDH * [1,5] -- first explicitly tagged version * [1,6] -- changed ed25519 part names */ Key.prototype._sshpkApiVersion = [1, 6]; Key._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); assert.func(obj.fingerprint); if (obj.createDH) return ([1, 4]); if (obj.defaultHashAlgorithm) return ([1, 3]); if (obj.formats['auto']) return ([1, 2]); if (obj.formats['pkcs1']) return ([1, 1]); return ([1, 0]); }; /***/ }), /* 7 */ /***/ (function(module, exports) { // Copyright 2015 Joyent, Inc. var algInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y'], sizePart: 'p' }, 'rsa': { parts: ['e', 'n'], sizePart: 'n' }, 'ecdsa': { parts: ['curve', 'Q'], sizePart: 'Q' }, 'ed25519': { parts: ['A'], sizePart: 'A' } }; algInfo['curve25519'] = algInfo['ed25519']; var algPrivInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y', 'x'] }, 'rsa': { parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] }, 'ecdsa': { parts: ['curve', 'Q', 'd'] }, 'ed25519': { parts: ['A', 'k'] } }; algPrivInfo['curve25519'] = algPrivInfo['ed25519']; var hashAlgs = { 'md5': true, 'sha1': true, 'sha256': true, 'sha384': true, 'sha512': true }; /* * Taken from * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf */ var curves = { 'nistp256': { size: 256, pkcs8oid: '1.2.840.10045.3.1.7', p: new Buffer(('00' + 'ffffffff 00000001 00000000 00000000' + '00000000 ffffffff ffffffff ffffffff'). replace(/ /g, ''), 'hex'), a: new Buffer(('00' + 'FFFFFFFF 00000001 00000000 00000000' + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: new Buffer(( '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). replace(/ /g, ''), 'hex'), s: new Buffer(('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90'). replace(/ /g, ''), 'hex'), n: new Buffer(('00' + 'ffffffff 00000000 ffffffff ffffffff' + 'bce6faad a7179e84 f3b9cac2 fc632551'). replace(/ /g, ''), 'hex'), G: new Buffer(('04' + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + '77037d81 2deb33a0 f4a13945 d898c296' + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + '2bce3357 6b315ece cbb64068 37bf51f5'). replace(/ /g, ''), 'hex') }, 'nistp384': { size: 384, pkcs8oid: '1.3.132.0.34', p: new Buffer(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffe' + 'ffffffff 00000000 00000000 ffffffff'). replace(/ /g, ''), 'hex'), a: new Buffer(('00' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). replace(/ /g, ''), 'hex'), b: new Buffer(( 'b3312fa7 e23ee7e4 988e056b e3f82d19' + '181d9c6e fe814112 0314088f 5013875a' + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). replace(/ /g, ''), 'hex'), s: new Buffer(('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73'). replace(/ /g, ''), 'hex'), n: new Buffer(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff c7634d81 f4372ddf' + '581a0db2 48b0a77a ecec196a ccc52973'). replace(/ /g, ''), 'hex'), G: new Buffer(('04' + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + '6e1d3b62 8ba79b98 59f741e0 82542a38' + '5502f25d bf55296c 3a545e38 72760ab7' + '3617de4a 96262c6f 5d9e98bf 9292dc29' + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). replace(/ /g, ''), 'hex') }, 'nistp521': { size: 521, pkcs8oid: '1.3.132.0.35', p: new Buffer(( '01ffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffff').replace(/ /g, ''), 'hex'), a: new Buffer(('01FF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: new Buffer(('51' + '953eb961 8e1c9a1f 929a21a0 b68540ee' + 'a2da725b 99b315f3 b8b48991 8ef109e1' + '56193951 ec7e937b 1652c0bd 3bb1bf07' + '3573df88 3d2c34f1 ef451fd4 6b503f00'). replace(/ /g, ''), 'hex'), s: new Buffer(('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace(/ /g, ''), 'hex'), n: new Buffer(('01ff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffa' + '51868783 bf2f966b 7fcc0148 f709a5d0' + '3bb5c9b8 899c47ae bb6fb71e 91386409'). replace(/ /g, ''), 'hex'), G: new Buffer(('04' + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + '9c648139 053fb521 f828af60 6b4d3dba' + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + '3348b3c1 856a429b f97e7e31 c2e5bd66' + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + '98f54449 579b4468 17afbd17 273e662c' + '97ee7299 5ef42640 c550b901 3fad0761' + '353c7086 a272c240 88be9476 9fd16650'). replace(/ /g, ''), 'hex') } }; module.exports = { info: algInfo, privInfo: algPrivInfo, hashAlgs: hashAlgs, curves: curves }; /***/ }), /* 8 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = PrivateKey; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var Fingerprint = __webpack_require__(39); var Signature = __webpack_require__(19); var errs = __webpack_require__(18); var util = __webpack_require__(1); var utils = __webpack_require__(5); var dhe = __webpack_require__(75); var generateECDSA = dhe.generateECDSA; var generateED25519 = dhe.generateED25519; var edCompat; var nacl; try { edCompat = __webpack_require__(147); } catch (e) { /* Just continue through, and bail out if we try to use it. */ } var Key = __webpack_require__(6); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var KeyEncryptedError = errs.KeyEncryptedError; var formats = {}; formats['auto'] = __webpack_require__(148); formats['pem'] = __webpack_require__(26); formats['pkcs1'] = __webpack_require__(78); formats['pkcs8'] = __webpack_require__(42); formats['rfc4253'] = __webpack_require__(27); formats['ssh-private'] = __webpack_require__(54); formats['openssh'] = formats['ssh-private']; formats['ssh'] = formats['ssh-private']; formats['dnssec'] = __webpack_require__(79); function PrivateKey(opts) { assert.object(opts, 'options'); Key.call(this, opts); this._pubCache = undefined; } util.inherits(PrivateKey, Key); PrivateKey.formats = formats; PrivateKey.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'pkcs1'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; PrivateKey.prototype.hash = function (algo) { return (this.toPublic().hash(algo)); }; PrivateKey.prototype.toPublic = function () { if (this._pubCache) return (this._pubCache); var algInfo = algs.info[this.type]; var pubParts = []; for (var i = 0; i < algInfo.parts.length; ++i) { var p = algInfo.parts[i]; pubParts.push(this.part[p]); } this._pubCache = new Key({ type: this.type, source: this, parts: pubParts }); if (this.comment) this._pubCache.comment = this.comment; return (this._pubCache); }; PrivateKey.prototype.derive = function (newType) { assert.string(newType, 'type'); var priv, pub, pair; if (this.type === 'ed25519' && newType === 'curve25519') { if (nacl === undefined) nacl = __webpack_require__(20); priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); pub = new Buffer(pair.publicKey); return (new PrivateKey({ type: 'curve25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } else if (this.type === 'curve25519' && newType === 'ed25519') { if (nacl === undefined) nacl = __webpack_require__(20); priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); pub = new Buffer(pair.publicKey); return (new PrivateKey({ type: 'ed25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } throw (new Error('Key derivation not supported from ' + this.type + ' to ' + newType)); }; PrivateKey.prototype.createVerify = function (hashAlgo) { return (this.toPublic().createVerify(hashAlgo)); }; PrivateKey.prototype.createSign = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Signer(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createSign(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createSign(nm); } assert.ok(v, 'failed to create verifier'); var oldSign = v.sign.bind(v); var key = this.toBuffer('pkcs1'); var type = this.type; var curve = this.curve; v.sign = function () { var sig = oldSign(key); if (typeof (sig) === 'string') sig = new Buffer(sig, 'binary'); sig = Signature.parse(sig, type, 'asn1'); sig.hashAlgorithm = hashAlgo; sig.curve = curve; return (sig); }; return (v); }; PrivateKey.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); assert.ok(k instanceof PrivateKey, 'key is not a private key'); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; PrivateKey.isPrivateKey = function (obj, ver) { return (utils.isCompatible(obj, PrivateKey, ver)); }; PrivateKey.generate = function (type, options) { if (options === undefined) options = {}; assert.object(options, 'options'); switch (type) { case 'ecdsa': if (options.curve === undefined) options.curve = 'nistp256'; assert.string(options.curve, 'options.curve'); return (generateECDSA(options.curve)); case 'ed25519': return (generateED25519()); default: throw (new Error('Key generation not supported with key ' + 'type "' + type + '"')); } }; /* * API versions for PrivateKey: * [1,0] -- initial ver * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats * [1,2] -- added defaultHashAlgorithm * [1,3] -- added derive, ed, createDH * [1,4] -- first tagged version * [1,5] -- changed ed25519 part names and format */ PrivateKey.prototype._sshpkApiVersion = [1, 5]; PrivateKey._oldVersionDetect = function (obj) { assert.func(obj.toPublic); assert.func(obj.createSign); if (obj.derive) return ([1, 3]); if (obj.defaultHashAlgorithm) return ([1, 2]); if (obj.formats['auto']) return ([1, 1]); return ([1, 0]); }; /***/ }), /* 9 */ /***/ (function(module, exports) { module.exports = require("fs"); /***/ }), /* 10 */ /***/ (function(module, exports) { module.exports = require("path"); /***/ }), /* 11 */ /***/ (function(module, exports) { module.exports = require("stream"); /***/ }), /* 12 */ /***/ (function(module, exports) { module.exports = require("buffer"); /***/ }), /* 13 */ /***/ (function(module, exports, __webpack_require__) { var Stream = __webpack_require__(11); if (process.env.READABLE_STREAM === 'disable' && Stream) { module.exports = Stream; exports = module.exports = Stream.Readable; exports.Readable = Stream.Readable; exports.Writable = Stream.Writable; exports.Duplex = Stream.Duplex; exports.Transform = Stream.Transform; exports.PassThrough = Stream.PassThrough; exports.Stream = Stream; } else { exports = module.exports = __webpack_require__(114); exports.Stream = Stream || exports; exports.Readable = exports; exports.Writable = __webpack_require__(117); exports.Duplex = __webpack_require__(30); exports.Transform = __webpack_require__(119); exports.PassThrough = __webpack_require__(316); } /***/ }), /* 14 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var _buffer = __webpack_require__(12); var createBuffer = _buffer.Buffer.from && _buffer.Buffer.alloc && _buffer.Buffer.allocUnsafe && _buffer.Buffer.allocUnsafeSlow ? _buffer.Buffer.from // support for Node < 5.10 : function (val) { return new _buffer.Buffer(val); }; exports.default = createBuffer; /***/ }), /* 15 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.default = function (model, calc) { var fn = function fn(buf, previous) { return calc(buf, previous) >>> 0; }; fn.signed = calc; fn.unsigned = fn; fn.model = model; return fn; }; /***/ }), /* 16 */ /***/ (function(module, exports) { module.exports = require("url"); /***/ }), /* 17 */ /***/ (function(module, exports, __webpack_require__) { /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(12) var Buffer = buffer.Buffer // alternative to using Object.keys for old browsers function copyProps (src, dst) { for (var key in src) { dst[key] = src[key] } } if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { module.exports = buffer } else { // Copy properties from require('buffer') copyProps(buffer, exports) exports.Buffer = SafeBuffer } function SafeBuffer (arg, encodingOrOffset, length) { return Buffer(arg, encodingOrOffset, length) } // Copy static methods from Buffer copyProps(Buffer, SafeBuffer) SafeBuffer.from = function (arg, encodingOrOffset, length) { if (typeof arg === 'number') { throw new TypeError('Argument must not be a number') } return Buffer(arg, encodingOrOffset, length) } SafeBuffer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } var buf = Buffer(size) if (fill !== undefined) { if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } } else { buf.fill(0) } return buf } SafeBuffer.allocUnsafe = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return Buffer(size) } SafeBuffer.allocUnsafeSlow = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return buffer.SlowBuffer(size) } /***/ }), /* 18 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(2); var util = __webpack_require__(1); function FingerprintFormatError(fp, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, FingerprintFormatError); this.name = 'FingerprintFormatError'; this.fingerprint = fp; this.format = format; this.message = 'Fingerprint format is not supported, or is invalid: '; if (fp !== undefined) this.message += ' fingerprint = ' + fp; if (format !== undefined) this.message += ' format = ' + format; } util.inherits(FingerprintFormatError, Error); function InvalidAlgorithmError(alg) { if (Error.captureStackTrace) Error.captureStackTrace(this, InvalidAlgorithmError); this.name = 'InvalidAlgorithmError'; this.algorithm = alg; this.message = 'Algorithm "' + alg + '" is not supported'; } util.inherits(InvalidAlgorithmError, Error); function KeyParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyParseError); this.name = 'KeyParseError'; this.format = format; this.keyName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format key: ' + innerErr.message; } util.inherits(KeyParseError, Error); function SignatureParseError(type, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, SignatureParseError); this.name = 'SignatureParseError'; this.type = type; this.format = format; this.innerErr = innerErr; this.message = 'Failed to parse the given data as a ' + type + ' signature in ' + format + ' format: ' + innerErr.message; } util.inherits(SignatureParseError, Error); function CertificateParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, CertificateParseError); this.name = 'CertificateParseError'; this.format = format; this.certName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format certificate: ' + innerErr.message; } util.inherits(CertificateParseError, Error); function KeyEncryptedError(name, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyEncryptedError); this.name = 'KeyEncryptedError'; this.format = format; this.keyName = name; this.message = 'The ' + format + ' format key ' + name + ' is ' + 'encrypted (password-protected), and no passphrase was ' + 'provided in `options`'; } util.inherits(KeyEncryptedError, Error); module.exports = { FingerprintFormatError: FingerprintFormatError, InvalidAlgorithmError: InvalidAlgorithmError, KeyParseError: KeyParseError, SignatureParseError: SignatureParseError, KeyEncryptedError: KeyEncryptedError, CertificateParseError: CertificateParseError }; /***/ }), /* 19 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = Signature; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var errs = __webpack_require__(18); var utils = __webpack_require__(5); var asn1 = __webpack_require__(21); var SSHBuffer = __webpack_require__(43); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var SignatureParseError = errs.SignatureParseError; function Signature(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.hashAlgorithm = opts.hashAlgo; this.curve = opts.curve; this.parts = opts.parts; this.part = partLookup; } Signature.prototype.toBuffer = function (format) { if (format === undefined) format = 'asn1'; assert.string(format, 'format'); var buf; var stype = 'ssh-' + this.type; switch (this.type) { case 'rsa': switch (this.hashAlgorithm) { case 'sha256': stype = 'rsa-sha2-256'; break; case 'sha512': stype = 'rsa-sha2-512'; break; case 'sha1': case undefined: break; default: throw (new Error('SSH signature ' + 'format does not support hash ' + 'algorithm ' + this.hashAlgorithm)); } if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'ed25519': if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'dsa': case 'ecdsa': var r, s; if (format === 'asn1') { var der = new asn1.BerWriter(); der.startSequence(); r = utils.mpNormalize(this.part.r.data); s = utils.mpNormalize(this.part.s.data); der.writeBuffer(r, asn1.Ber.Integer); der.writeBuffer(s, asn1.Ber.Integer); der.endSequence(); return (der.buffer); } else if (format === 'ssh' && this.type === 'dsa') { buf = new SSHBuffer({}); buf.writeString('ssh-dss'); r = this.part.r.data; if (r.length > 20 && r[0] === 0x00) r = r.slice(1); s = this.part.s.data; if (s.length > 20 && s[0] === 0x00) s = s.slice(1); if ((this.hashAlgorithm && this.hashAlgorithm !== 'sha1') || r.length + s.length !== 40) { throw (new Error('OpenSSH only supports ' + 'DSA signatures with SHA1 hash')); } buf.writeBuffer(Buffer.concat([r, s])); return (buf.toBuffer()); } else if (format === 'ssh' && this.type === 'ecdsa') { var inner = new SSHBuffer({}); r = this.part.r.data; inner.writeBuffer(r); inner.writePart(this.part.s); buf = new SSHBuffer({}); /* XXX: find a more proper way to do this? */ var curve; if (r[0] === 0x00) r = r.slice(1); var sz = r.length * 8; if (sz === 256) curve = 'nistp256'; else if (sz === 384) curve = 'nistp384'; else if (sz === 528) curve = 'nistp521'; buf.writeString('ecdsa-sha2-' + curve); buf.writeBuffer(inner.toBuffer()); return (buf.toBuffer()); } throw (new Error('Invalid signature format')); default: throw (new Error('Invalid signature data')); } }; Signature.prototype.toString = function (format) { assert.optionalString(format, 'format'); return (this.toBuffer(format).toString('base64')); }; Signature.parse = function (data, type, format) { if (typeof (data) === 'string') data = new Buffer(data, 'base64'); assert.buffer(data, 'data'); assert.string(format, 'format'); assert.string(type, 'type'); var opts = {}; opts.type = type.toLowerCase(); opts.parts = []; try { assert.ok(data.length > 0, 'signature must not be empty'); switch (opts.type) { case 'rsa': return (parseOneNum(data, type, format, opts)); case 'ed25519': return (parseOneNum(data, type, format, opts)); case 'dsa': case 'ecdsa': if (format === 'asn1') return (parseDSAasn1(data, type, format, opts)); else if (opts.type === 'dsa') return (parseDSA(data, type, format, opts)); else return (parseECDSA(data, type, format, opts)); default: throw (new InvalidAlgorithmError(type)); } } catch (e) { if (e instanceof InvalidAlgorithmError) throw (e); throw (new SignatureParseError(type, format, e)); } }; function parseOneNum(data, type, format, opts) { if (format === 'ssh') { try { var buf = new SSHBuffer({buffer: data}); var head = buf.readString(); } catch (e) { /* fall through */ } if (buf !== undefined) { var msg = 'SSH signature does not match expected ' + 'type (expected ' + type + ', got ' + head + ')'; switch (head) { case 'ssh-rsa': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha1'; break; case 'rsa-sha2-256': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha256'; break; case 'rsa-sha2-512': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha512'; break; case 'ssh-ed25519': assert.strictEqual(type, 'ed25519', msg); opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unknown SSH signature ' + 'type: ' + head)); } var sig = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); sig.name = 'sig'; opts.parts.push(sig); return (new Signature(opts)); } } opts.parts.push({name: 'sig', data: data}); return (new Signature(opts)); } function parseDSAasn1(data, type, format, opts) { var der = new asn1.BerReader(data); der.readSequence(); var r = der.readString(asn1.Ber.Integer, true); var s = der.readString(asn1.Ber.Integer, true); opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); opts.parts.push({name: 's', data: utils.mpNormalize(s)}); return (new Signature(opts)); } function parseDSA(data, type, format, opts) { if (data.length != 40) { var buf = new SSHBuffer({buffer: data}); var d = buf.readBuffer(); if (d.toString('ascii') === 'ssh-dss') d = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes'); assert.strictEqual(d.length, 40, 'invalid inner length'); data = d; } opts.parts.push({name: 'r', data: data.slice(0, 20)}); opts.parts.push({name: 's', data: data.slice(20, 40)}); return (new Signature(opts)); } function parseECDSA(data, type, format, opts) { var buf = new SSHBuffer({buffer: data}); var r, s; var inner = buf.readBuffer(); var stype = inner.toString('ascii'); if (stype.slice(0, 6) === 'ecdsa-') { var parts = stype.split('-'); assert.strictEqual(parts[0], 'ecdsa'); assert.strictEqual(parts[1], 'sha2'); opts.curve = parts[2]; switch (opts.curve) { case 'nistp256': opts.hashAlgo = 'sha256'; break; case 'nistp384': opts.hashAlgo = 'sha384'; break; case 'nistp521': opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unsupported ECDSA curve: ' + opts.curve)); } inner = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); buf = new SSHBuffer({buffer: inner}); r = buf.readPart(); } else { r = {data: inner}; } s = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); r.name = 'r'; s.name = 's'; opts.parts.push(r); opts.parts.push(s); return (new Signature(opts)); } Signature.isSignature = function (obj, ver) { return (utils.isCompatible(obj, Signature, ver)); }; /* * API versions for Signature: * [1,0] -- initial ver * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent * hashAlgorithm property * [2,1] -- first tagged version */ Signature.prototype._sshpkApiVersion = [2, 1]; Signature._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); if (obj.hasOwnProperty('hashAlgorithm')) return ([2, 0]); return ([1, 0]); }; /***/ }), /* 20 */ /***/ (function(module, exports, __webpack_require__) { (function(nacl) { 'use strict'; // Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. // Public domain. // // Implementation derived from TweetNaCl version 20140427. // See for details: http://tweetnacl.cr.yp.to/ var gf = function(init) { var i, r = new Float64Array(16); if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; return r; }; // Pluggable, initialized in high-level API below. var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; var _0 = new Uint8Array(16); var _9 = new Uint8Array(32); _9[0] = 9; var gf0 = gf(), gf1 = gf([1]), _121665 = gf([0xdb41, 1]), D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); function ts64(x, i, h, l) { x[i] = (h >> 24) & 0xff; x[i+1] = (h >> 16) & 0xff; x[i+2] = (h >> 8) & 0xff; x[i+3] = h & 0xff; x[i+4] = (l >> 24) & 0xff; x[i+5] = (l >> 16) & 0xff; x[i+6] = (l >> 8) & 0xff; x[i+7] = l & 0xff; } function vn(x, xi, y, yi, n) { var i,d = 0; for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; return (1 & ((d - 1) >>> 8)) - 1; } function crypto_verify_16(x, xi, y, yi) { return vn(x,xi,y,yi,16); } function crypto_verify_32(x, xi, y, yi) { return vn(x,xi,y,yi,32); } function core_salsa20(o, p, k, c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } x0 = x0 + j0 | 0; x1 = x1 + j1 | 0; x2 = x2 + j2 | 0; x3 = x3 + j3 | 0; x4 = x4 + j4 | 0; x5 = x5 + j5 | 0; x6 = x6 + j6 | 0; x7 = x7 + j7 | 0; x8 = x8 + j8 | 0; x9 = x9 + j9 | 0; x10 = x10 + j10 | 0; x11 = x11 + j11 | 0; x12 = x12 + j12 | 0; x13 = x13 + j13 | 0; x14 = x14 + j14 | 0; x15 = x15 + j15 | 0; o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x1 >>> 0 & 0xff; o[ 5] = x1 >>> 8 & 0xff; o[ 6] = x1 >>> 16 & 0xff; o[ 7] = x1 >>> 24 & 0xff; o[ 8] = x2 >>> 0 & 0xff; o[ 9] = x2 >>> 8 & 0xff; o[10] = x2 >>> 16 & 0xff; o[11] = x2 >>> 24 & 0xff; o[12] = x3 >>> 0 & 0xff; o[13] = x3 >>> 8 & 0xff; o[14] = x3 >>> 16 & 0xff; o[15] = x3 >>> 24 & 0xff; o[16] = x4 >>> 0 & 0xff; o[17] = x4 >>> 8 & 0xff; o[18] = x4 >>> 16 & 0xff; o[19] = x4 >>> 24 & 0xff; o[20] = x5 >>> 0 & 0xff; o[21] = x5 >>> 8 & 0xff; o[22] = x5 >>> 16 & 0xff; o[23] = x5 >>> 24 & 0xff; o[24] = x6 >>> 0 & 0xff; o[25] = x6 >>> 8 & 0xff; o[26] = x6 >>> 16 & 0xff; o[27] = x6 >>> 24 & 0xff; o[28] = x7 >>> 0 & 0xff; o[29] = x7 >>> 8 & 0xff; o[30] = x7 >>> 16 & 0xff; o[31] = x7 >>> 24 & 0xff; o[32] = x8 >>> 0 & 0xff; o[33] = x8 >>> 8 & 0xff; o[34] = x8 >>> 16 & 0xff; o[35] = x8 >>> 24 & 0xff; o[36] = x9 >>> 0 & 0xff; o[37] = x9 >>> 8 & 0xff; o[38] = x9 >>> 16 & 0xff; o[39] = x9 >>> 24 & 0xff; o[40] = x10 >>> 0 & 0xff; o[41] = x10 >>> 8 & 0xff; o[42] = x10 >>> 16 & 0xff; o[43] = x10 >>> 24 & 0xff; o[44] = x11 >>> 0 & 0xff; o[45] = x11 >>> 8 & 0xff; o[46] = x11 >>> 16 & 0xff; o[47] = x11 >>> 24 & 0xff; o[48] = x12 >>> 0 & 0xff; o[49] = x12 >>> 8 & 0xff; o[50] = x12 >>> 16 & 0xff; o[51] = x12 >>> 24 & 0xff; o[52] = x13 >>> 0 & 0xff; o[53] = x13 >>> 8 & 0xff; o[54] = x13 >>> 16 & 0xff; o[55] = x13 >>> 24 & 0xff; o[56] = x14 >>> 0 & 0xff; o[57] = x14 >>> 8 & 0xff; o[58] = x14 >>> 16 & 0xff; o[59] = x14 >>> 24 & 0xff; o[60] = x15 >>> 0 & 0xff; o[61] = x15 >>> 8 & 0xff; o[62] = x15 >>> 16 & 0xff; o[63] = x15 >>> 24 & 0xff; } function core_hsalsa20(o,p,k,c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x5 >>> 0 & 0xff; o[ 5] = x5 >>> 8 & 0xff; o[ 6] = x5 >>> 16 & 0xff; o[ 7] = x5 >>> 24 & 0xff; o[ 8] = x10 >>> 0 & 0xff; o[ 9] = x10 >>> 8 & 0xff; o[10] = x10 >>> 16 & 0xff; o[11] = x10 >>> 24 & 0xff; o[12] = x15 >>> 0 & 0xff; o[13] = x15 >>> 8 & 0xff; o[14] = x15 >>> 16 & 0xff; o[15] = x15 >>> 24 & 0xff; o[16] = x6 >>> 0 & 0xff; o[17] = x6 >>> 8 & 0xff; o[18] = x6 >>> 16 & 0xff; o[19] = x6 >>> 24 & 0xff; o[20] = x7 >>> 0 & 0xff; o[21] = x7 >>> 8 & 0xff; o[22] = x7 >>> 16 & 0xff; o[23] = x7 >>> 24 & 0xff; o[24] = x8 >>> 0 & 0xff; o[25] = x8 >>> 8 & 0xff; o[26] = x8 >>> 16 & 0xff; o[27] = x8 >>> 24 & 0xff; o[28] = x9 >>> 0 & 0xff; o[29] = x9 >>> 8 & 0xff; o[30] = x9 >>> 16 & 0xff; o[31] = x9 >>> 24 & 0xff; } function crypto_core_salsa20(out,inp,k,c) { core_salsa20(out,inp,k,c); } function crypto_core_hsalsa20(out,inp,k,c) { core_hsalsa20(out,inp,k,c); } var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); // "expand 32-byte k" function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; mpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; } return 0; } function crypto_stream_salsa20(c,cpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = x[i]; } return 0; } function crypto_stream(c,cpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20(c,cpos,d,sn,s); } function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); } /* * Port of Andrew Moon's Poly1305-donna-16. Public domain. * https://github.com/floodyberry/poly1305-donna */ var poly1305 = function(key) { this.buffer = new Uint8Array(16); this.r = new Uint16Array(10); this.h = new Uint16Array(10); this.pad = new Uint16Array(8); this.leftover = 0; this.fin = 0; var t0, t1, t2, t3, t4, t5, t6, t7; t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; this.r[5] = ((t4 >>> 1)) & 0x1ffe; t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; this.r[9] = ((t7 >>> 5)) & 0x007f; this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; }; poly1305.prototype.blocks = function(m, mpos, bytes) { var hibit = this.fin ? 0 : (1 << 11); var t0, t1, t2, t3, t4, t5, t6, t7, c; var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; var h0 = this.h[0], h1 = this.h[1], h2 = this.h[2], h3 = this.h[3], h4 = this.h[4], h5 = this.h[5], h6 = this.h[6], h7 = this.h[7], h8 = this.h[8], h9 = this.h[9]; var r0 = this.r[0], r1 = this.r[1], r2 = this.r[2], r3 = this.r[3], r4 = this.r[4], r5 = this.r[5], r6 = this.r[6], r7 = this.r[7], r8 = this.r[8], r9 = this.r[9]; while (bytes >= 16) { t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; h5 += ((t4 >>> 1)) & 0x1fff; t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; h9 += ((t7 >>> 5)) | hibit; c = 0; d0 = c; d0 += h0 * r0; d0 += h1 * (5 * r9); d0 += h2 * (5 * r8); d0 += h3 * (5 * r7); d0 += h4 * (5 * r6); c = (d0 >>> 13); d0 &= 0x1fff; d0 += h5 * (5 * r5); d0 += h6 * (5 * r4); d0 += h7 * (5 * r3); d0 += h8 * (5 * r2); d0 += h9 * (5 * r1); c += (d0 >>> 13); d0 &= 0x1fff; d1 = c; d1 += h0 * r1; d1 += h1 * r0; d1 += h2 * (5 * r9); d1 += h3 * (5 * r8); d1 += h4 * (5 * r7); c = (d1 >>> 13); d1 &= 0x1fff; d1 += h5 * (5 * r6); d1 += h6 * (5 * r5); d1 += h7 * (5 * r4); d1 += h8 * (5 * r3); d1 += h9 * (5 * r2); c += (d1 >>> 13); d1 &= 0x1fff; d2 = c; d2 += h0 * r2; d2 += h1 * r1; d2 += h2 * r0; d2 += h3 * (5 * r9); d2 += h4 * (5 * r8); c = (d2 >>> 13); d2 &= 0x1fff; d2 += h5 * (5 * r7); d2 += h6 * (5 * r6); d2 += h7 * (5 * r5); d2 += h8 * (5 * r4); d2 += h9 * (5 * r3); c += (d2 >>> 13); d2 &= 0x1fff; d3 = c; d3 += h0 * r3; d3 += h1 * r2; d3 += h2 * r1; d3 += h3 * r0; d3 += h4 * (5 * r9); c = (d3 >>> 13); d3 &= 0x1fff; d3 += h5 * (5 * r8); d3 += h6 * (5 * r7); d3 += h7 * (5 * r6); d3 += h8 * (5 * r5); d3 += h9 * (5 * r4); c += (d3 >>> 13); d3 &= 0x1fff; d4 = c; d4 += h0 * r4; d4 += h1 * r3; d4 += h2 * r2; d4 += h3 * r1; d4 += h4 * r0; c = (d4 >>> 13); d4 &= 0x1fff; d4 += h5 * (5 * r9); d4 += h6 * (5 * r8); d4 += h7 * (5 * r7); d4 += h8 * (5 * r6); d4 += h9 * (5 * r5); c += (d4 >>> 13); d4 &= 0x1fff; d5 = c; d5 += h0 * r5; d5 += h1 * r4; d5 += h2 * r3; d5 += h3 * r2; d5 += h4 * r1; c = (d5 >>> 13); d5 &= 0x1fff; d5 += h5 * r0; d5 += h6 * (5 * r9); d5 += h7 * (5 * r8); d5 += h8 * (5 * r7); d5 += h9 * (5 * r6); c += (d5 >>> 13); d5 &= 0x1fff; d6 = c; d6 += h0 * r6; d6 += h1 * r5; d6 += h2 * r4; d6 += h3 * r3; d6 += h4 * r2; c = (d6 >>> 13); d6 &= 0x1fff; d6 += h5 * r1; d6 += h6 * r0; d6 += h7 * (5 * r9); d6 += h8 * (5 * r8); d6 += h9 * (5 * r7); c += (d6 >>> 13); d6 &= 0x1fff; d7 = c; d7 += h0 * r7; d7 += h1 * r6; d7 += h2 * r5; d7 += h3 * r4; d7 += h4 * r3; c = (d7 >>> 13); d7 &= 0x1fff; d7 += h5 * r2; d7 += h6 * r1; d7 += h7 * r0; d7 += h8 * (5 * r9); d7 += h9 * (5 * r8); c += (d7 >>> 13); d7 &= 0x1fff; d8 = c; d8 += h0 * r8; d8 += h1 * r7; d8 += h2 * r6; d8 += h3 * r5; d8 += h4 * r4; c = (d8 >>> 13); d8 &= 0x1fff; d8 += h5 * r3; d8 += h6 * r2; d8 += h7 * r1; d8 += h8 * r0; d8 += h9 * (5 * r9); c += (d8 >>> 13); d8 &= 0x1fff; d9 = c; d9 += h0 * r9; d9 += h1 * r8; d9 += h2 * r7; d9 += h3 * r6; d9 += h4 * r5; c = (d9 >>> 13); d9 &= 0x1fff; d9 += h5 * r4; d9 += h6 * r3; d9 += h7 * r2; d9 += h8 * r1; d9 += h9 * r0; c += (d9 >>> 13); d9 &= 0x1fff; c = (((c << 2) + c)) | 0; c = (c + d0) | 0; d0 = c & 0x1fff; c = (c >>> 13); d1 += c; h0 = d0; h1 = d1; h2 = d2; h3 = d3; h4 = d4; h5 = d5; h6 = d6; h7 = d7; h8 = d8; h9 = d9; mpos += 16; bytes -= 16; } this.h[0] = h0; this.h[1] = h1; this.h[2] = h2; this.h[3] = h3; this.h[4] = h4; this.h[5] = h5; this.h[6] = h6; this.h[7] = h7; this.h[8] = h8; this.h[9] = h9; }; poly1305.prototype.finish = function(mac, macpos) { var g = new Uint16Array(10); var c, mask, f, i; if (this.leftover) { i = this.leftover; this.buffer[i++] = 1; for (; i < 16; i++) this.buffer[i] = 0; this.fin = 1; this.blocks(this.buffer, 0, 16); } c = this.h[1] >>> 13; this.h[1] &= 0x1fff; for (i = 2; i < 10; i++) { this.h[i] += c; c = this.h[i] >>> 13; this.h[i] &= 0x1fff; } this.h[0] += (c * 5); c = this.h[0] >>> 13; this.h[0] &= 0x1fff; this.h[1] += c; c = this.h[1] >>> 13; this.h[1] &= 0x1fff; this.h[2] += c; g[0] = this.h[0] + 5; c = g[0] >>> 13; g[0] &= 0x1fff; for (i = 1; i < 10; i++) { g[i] = this.h[i] + c; c = g[i] >>> 13; g[i] &= 0x1fff; } g[9] -= (1 << 13); mask = (c ^ 1) - 1; for (i = 0; i < 10; i++) g[i] &= mask; mask = ~mask; for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; f = this.h[0] + this.pad[0]; this.h[0] = f & 0xffff; for (i = 1; i < 8; i++) { f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; this.h[i] = f & 0xffff; } mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; mac[macpos+10] = (this.h[5] >>> 0) & 0xff; mac[macpos+11] = (this.h[5] >>> 8) & 0xff; mac[macpos+12] = (this.h[6] >>> 0) & 0xff; mac[macpos+13] = (this.h[6] >>> 8) & 0xff; mac[macpos+14] = (this.h[7] >>> 0) & 0xff; mac[macpos+15] = (this.h[7] >>> 8) & 0xff; }; poly1305.prototype.update = function(m, mpos, bytes) { var i, want; if (this.leftover) { want = (16 - this.leftover); if (want > bytes) want = bytes; for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos+i]; bytes -= want; mpos += want; this.leftover += want; if (this.leftover < 16) return; this.blocks(this.buffer, 0, 16); this.leftover = 0; } if (bytes >= 16) { want = bytes - (bytes % 16); this.blocks(m, mpos, want); mpos += want; bytes -= want; } if (bytes) { for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos+i]; this.leftover += bytes; } }; function crypto_onetimeauth(out, outpos, m, mpos, n, k) { var s = new poly1305(k); s.update(m, mpos, n); s.finish(out, outpos); return 0; } function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { var x = new Uint8Array(16); crypto_onetimeauth(x,0,m,mpos,n,k); return crypto_verify_16(h,hpos,x,0); } function crypto_secretbox(c,m,d,n,k) { var i; if (d < 32) return -1; crypto_stream_xor(c,0,m,0,d,n,k); crypto_onetimeauth(c, 16, c, 32, d - 32, c); for (i = 0; i < 16; i++) c[i] = 0; return 0; } function crypto_secretbox_open(m,c,d,n,k) { var i; var x = new Uint8Array(32); if (d < 32) return -1; crypto_stream(x,0,32,n,k); if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; crypto_stream_xor(m,0,c,0,d,n,k); for (i = 0; i < 32; i++) m[i] = 0; return 0; } function set25519(r, a) { var i; for (i = 0; i < 16; i++) r[i] = a[i]|0; } function car25519(o) { var i, v, c = 1; for (i = 0; i < 16; i++) { v = o[i] + c + 65535; c = Math.floor(v / 65536); o[i] = v - c * 65536; } o[0] += c-1 + 37 * (c-1); } function sel25519(p, q, b) { var t, c = ~(b-1); for (var i = 0; i < 16; i++) { t = c & (p[i] ^ q[i]); p[i] ^= t; q[i] ^= t; } } function pack25519(o, n) { var i, j, b; var m = gf(), t = gf(); for (i = 0; i < 16; i++) t[i] = n[i]; car25519(t); car25519(t); car25519(t); for (j = 0; j < 2; j++) { m[0] = t[0] - 0xffed; for (i = 1; i < 15; i++) { m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); m[i-1] &= 0xffff; } m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); b = (m[15]>>16) & 1; m[14] &= 0xffff; sel25519(t, m, 1-b); } for (i = 0; i < 16; i++) { o[2*i] = t[i] & 0xff; o[2*i+1] = t[i]>>8; } } function neq25519(a, b) { var c = new Uint8Array(32), d = new Uint8Array(32); pack25519(c, a); pack25519(d, b); return crypto_verify_32(c, 0, d, 0); } function par25519(a) { var d = new Uint8Array(32); pack25519(d, a); return d[0] & 1; } function unpack25519(o, n) { var i; for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); o[15] &= 0x7fff; } function A(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; } function Z(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; } function M(o, a, b) { var v, c, t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, b0 = b[0], b1 = b[1], b2 = b[2], b3 = b[3], b4 = b[4], b5 = b[5], b6 = b[6], b7 = b[7], b8 = b[8], b9 = b[9], b10 = b[10], b11 = b[11], b12 = b[12], b13 = b[13], b14 = b[14], b15 = b[15]; v = a[0]; t0 += v * b0; t1 += v * b1; t2 += v * b2; t3 += v * b3; t4 += v * b4; t5 += v * b5; t6 += v * b6; t7 += v * b7; t8 += v * b8; t9 += v * b9; t10 += v * b10; t11 += v * b11; t12 += v * b12; t13 += v * b13; t14 += v * b14; t15 += v * b15; v = a[1]; t1 += v * b0; t2 += v * b1; t3 += v * b2; t4 += v * b3; t5 += v * b4; t6 += v * b5; t7 += v * b6; t8 += v * b7; t9 += v * b8; t10 += v * b9; t11 += v * b10; t12 += v * b11; t13 += v * b12; t14 += v * b13; t15 += v * b14; t16 += v * b15; v = a[2]; t2 += v * b0; t3 += v * b1; t4 += v * b2; t5 += v * b3; t6 += v * b4; t7 += v * b5; t8 += v * b6; t9 += v * b7; t10 += v * b8; t11 += v * b9; t12 += v * b10; t13 += v * b11; t14 += v * b12; t15 += v * b13; t16 += v * b14; t17 += v * b15; v = a[3]; t3 += v * b0; t4 += v * b1; t5 += v * b2; t6 += v * b3; t7 += v * b4; t8 += v * b5; t9 += v * b6; t10 += v * b7; t11 += v * b8; t12 += v * b9; t13 += v * b10; t14 += v * b11; t15 += v * b12; t16 += v * b13; t17 += v * b14; t18 += v * b15; v = a[4]; t4 += v * b0; t5 += v * b1; t6 += v * b2; t7 += v * b3; t8 += v * b4; t9 += v * b5; t10 += v * b6; t11 += v * b7; t12 += v * b8; t13 += v * b9; t14 += v * b10; t15 += v * b11; t16 += v * b12; t17 += v * b13; t18 += v * b14; t19 += v * b15; v = a[5]; t5 += v * b0; t6 += v * b1; t7 += v * b2; t8 += v * b3; t9 += v * b4; t10 += v * b5; t11 += v * b6; t12 += v * b7; t13 += v * b8; t14 += v * b9; t15 += v * b10; t16 += v * b11; t17 += v * b12; t18 += v * b13; t19 += v * b14; t20 += v * b15; v = a[6]; t6 += v * b0; t7 += v * b1; t8 += v * b2; t9 += v * b3; t10 += v * b4; t11 += v * b5; t12 += v * b6; t13 += v * b7; t14 += v * b8; t15 += v * b9; t16 += v * b10; t17 += v * b11; t18 += v * b12; t19 += v * b13; t20 += v * b14; t21 += v * b15; v = a[7]; t7 += v * b0; t8 += v * b1; t9 += v * b2; t10 += v * b3; t11 += v * b4; t12 += v * b5; t13 += v * b6; t14 += v * b7; t15 += v * b8; t16 += v * b9; t17 += v * b10; t18 += v * b11; t19 += v * b12; t20 += v * b13; t21 += v * b14; t22 += v * b15; v = a[8]; t8 += v * b0; t9 += v * b1; t10 += v * b2; t11 += v * b3; t12 += v * b4; t13 += v * b5; t14 += v * b6; t15 += v * b7; t16 += v * b8; t17 += v * b9; t18 += v * b10; t19 += v * b11; t20 += v * b12; t21 += v * b13; t22 += v * b14; t23 += v * b15; v = a[9]; t9 += v * b0; t10 += v * b1; t11 += v * b2; t12 += v * b3; t13 += v * b4; t14 += v * b5; t15 += v * b6; t16 += v * b7; t17 += v * b8; t18 += v * b9; t19 += v * b10; t20 += v * b11; t21 += v * b12; t22 += v * b13; t23 += v * b14; t24 += v * b15; v = a[10]; t10 += v * b0; t11 += v * b1; t12 += v * b2; t13 += v * b3; t14 += v * b4; t15 += v * b5; t16 += v * b6; t17 += v * b7; t18 += v * b8; t19 += v * b9; t20 += v * b10; t21 += v * b11; t22 += v * b12; t23 += v * b13; t24 += v * b14; t25 += v * b15; v = a[11]; t11 += v * b0; t12 += v * b1; t13 += v * b2; t14 += v * b3; t15 += v * b4; t16 += v * b5; t17 += v * b6; t18 += v * b7; t19 += v * b8; t20 += v * b9; t21 += v * b10; t22 += v * b11; t23 += v * b12; t24 += v * b13; t25 += v * b14; t26 += v * b15; v = a[12]; t12 += v * b0; t13 += v * b1; t14 += v * b2; t15 += v * b3; t16 += v * b4; t17 += v * b5; t18 += v * b6; t19 += v * b7; t20 += v * b8; t21 += v * b9; t22 += v * b10; t23 += v * b11; t24 += v * b12; t25 += v * b13; t26 += v * b14; t27 += v * b15; v = a[13]; t13 += v * b0; t14 += v * b1; t15 += v * b2; t16 += v * b3; t17 += v * b4; t18 += v * b5; t19 += v * b6; t20 += v * b7; t21 += v * b8; t22 += v * b9; t23 += v * b10; t24 += v * b11; t25 += v * b12; t26 += v * b13; t27 += v * b14; t28 += v * b15; v = a[14]; t14 += v * b0; t15 += v * b1; t16 += v * b2; t17 += v * b3; t18 += v * b4; t19 += v * b5; t20 += v * b6; t21 += v * b7; t22 += v * b8; t23 += v * b9; t24 += v * b10; t25 += v * b11; t26 += v * b12; t27 += v * b13; t28 += v * b14; t29 += v * b15; v = a[15]; t15 += v * b0; t16 += v * b1; t17 += v * b2; t18 += v * b3; t19 += v * b4; t20 += v * b5; t21 += v * b6; t22 += v * b7; t23 += v * b8; t24 += v * b9; t25 += v * b10; t26 += v * b11; t27 += v * b12; t28 += v * b13; t29 += v * b14; t30 += v * b15; t0 += 38 * t16; t1 += 38 * t17; t2 += 38 * t18; t3 += 38 * t19; t4 += 38 * t20; t5 += 38 * t21; t6 += 38 * t22; t7 += 38 * t23; t8 += 38 * t24; t9 += 38 * t25; t10 += 38 * t26; t11 += 38 * t27; t12 += 38 * t28; t13 += 38 * t29; t14 += 38 * t30; // t15 left as is // first car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); // second car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); o[ 0] = t0; o[ 1] = t1; o[ 2] = t2; o[ 3] = t3; o[ 4] = t4; o[ 5] = t5; o[ 6] = t6; o[ 7] = t7; o[ 8] = t8; o[ 9] = t9; o[10] = t10; o[11] = t11; o[12] = t12; o[13] = t13; o[14] = t14; o[15] = t15; } function S(o, a) { M(o, a, a); } function inv25519(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 253; a >= 0; a--) { S(c, c); if(a !== 2 && a !== 4) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function pow2523(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 250; a >= 0; a--) { S(c, c); if(a !== 1) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function crypto_scalarmult(q, n, p) { var z = new Uint8Array(32); var x = new Float64Array(80), r, i; var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(); for (i = 0; i < 31; i++) z[i] = n[i]; z[31]=(n[31]&127)|64; z[0]&=248; unpack25519(x,p); for (i = 0; i < 16; i++) { b[i]=x[i]; d[i]=a[i]=c[i]=0; } a[0]=d[0]=1; for (i=254; i>=0; --i) { r=(z[i>>>3]>>>(i&7))&1; sel25519(a,b,r); sel25519(c,d,r); A(e,a,c); Z(a,a,c); A(c,b,d); Z(b,b,d); S(d,e); S(f,a); M(a,c,a); M(c,b,e); A(e,a,c); Z(a,a,c); S(b,a); Z(c,d,f); M(a,c,_121665); A(a,a,d); M(c,c,a); M(a,d,f); M(d,b,x); S(b,e); sel25519(a,b,r); sel25519(c,d,r); } for (i = 0; i < 16; i++) { x[i+16]=a[i]; x[i+32]=c[i]; x[i+48]=b[i]; x[i+64]=d[i]; } var x32 = x.subarray(32); var x16 = x.subarray(16); inv25519(x32,x32); M(x16,x16,x32); pack25519(q,x16); return 0; } function crypto_scalarmult_base(q, n) { return crypto_scalarmult(q, n, _9); } function crypto_box_keypair(y, x) { randombytes(x, 32); return crypto_scalarmult_base(y, x); } function crypto_box_beforenm(k, y, x) { var s = new Uint8Array(32); crypto_scalarmult(s, x, y); return crypto_core_hsalsa20(k, _0, s, sigma); } var crypto_box_afternm = crypto_secretbox; var crypto_box_open_afternm = crypto_secretbox_open; function crypto_box(c, m, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_afternm(c, m, d, n, k); } function crypto_box_open(m, c, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_open_afternm(m, c, d, n, k); } var K = [ 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 ]; function crypto_hashblocks_hl(hh, hl, m, n) { var wh = new Int32Array(16), wl = new Int32Array(16), bh0, bh1, bh2, bh3, bh4, bh5, bh6, bh7, bl0, bl1, bl2, bl3, bl4, bl5, bl6, bl7, th, tl, i, j, h, l, a, b, c, d; var ah0 = hh[0], ah1 = hh[1], ah2 = hh[2], ah3 = hh[3], ah4 = hh[4], ah5 = hh[5], ah6 = hh[6], ah7 = hh[7], al0 = hl[0], al1 = hl[1], al2 = hl[2], al3 = hl[3], al4 = hl[4], al5 = hl[5], al6 = hl[6], al7 = hl[7]; var pos = 0; while (n >= 128) { for (i = 0; i < 16; i++) { j = 8 * i + pos; wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; } for (i = 0; i < 80; i++) { bh0 = ah0; bh1 = ah1; bh2 = ah2; bh3 = ah3; bh4 = ah4; bh5 = ah5; bh6 = ah6; bh7 = ah7; bl0 = al0; bl1 = al1; bl2 = al2; bl3 = al3; bl4 = al4; bl5 = al5; bl6 = al6; bl7 = al7; // add h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma1 h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Ch h = (ah4 & ah5) ^ (~ah4 & ah6); l = (al4 & al5) ^ (~al4 & al6); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // K h = K[i*2]; l = K[i*2+1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // w h = wh[i%16]; l = wl[i%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; th = c & 0xffff | d << 16; tl = a & 0xffff | b << 16; // add h = th; l = tl; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma0 h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Maj h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh7 = (c & 0xffff) | (d << 16); bl7 = (a & 0xffff) | (b << 16); // add h = bh3; l = bl3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = th; l = tl; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh3 = (c & 0xffff) | (d << 16); bl3 = (a & 0xffff) | (b << 16); ah1 = bh0; ah2 = bh1; ah3 = bh2; ah4 = bh3; ah5 = bh4; ah6 = bh5; ah7 = bh6; ah0 = bh7; al1 = bl0; al2 = bl1; al3 = bl2; al4 = bl3; al5 = bl4; al6 = bl5; al7 = bl6; al0 = bl7; if (i%16 === 15) { for (j = 0; j < 16; j++) { // add h = wh[j]; l = wl[j]; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = wh[(j+9)%16]; l = wl[(j+9)%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma0 th = wh[(j+1)%16]; tl = wl[(j+1)%16]; h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma1 th = wh[(j+14)%16]; tl = wl[(j+14)%16]; h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; wh[j] = (c & 0xffff) | (d << 16); wl[j] = (a & 0xffff) | (b << 16); } } } // add h = ah0; l = al0; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[0]; l = hl[0]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[0] = ah0 = (c & 0xffff) | (d << 16); hl[0] = al0 = (a & 0xffff) | (b << 16); h = ah1; l = al1; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[1]; l = hl[1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[1] = ah1 = (c & 0xffff) | (d << 16); hl[1] = al1 = (a & 0xffff) | (b << 16); h = ah2; l = al2; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[2]; l = hl[2]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[2] = ah2 = (c & 0xffff) | (d << 16); hl[2] = al2 = (a & 0xffff) | (b << 16); h = ah3; l = al3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[3]; l = hl[3]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[3] = ah3 = (c & 0xffff) | (d << 16); hl[3] = al3 = (a & 0xffff) | (b << 16); h = ah4; l = al4; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[4]; l = hl[4]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[4] = ah4 = (c & 0xffff) | (d << 16); hl[4] = al4 = (a & 0xffff) | (b << 16); h = ah5; l = al5; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[5]; l = hl[5]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[5] = ah5 = (c & 0xffff) | (d << 16); hl[5] = al5 = (a & 0xffff) | (b << 16); h = ah6; l = al6; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[6]; l = hl[6]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[6] = ah6 = (c & 0xffff) | (d << 16); hl[6] = al6 = (a & 0xffff) | (b << 16); h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[7]; l = hl[7]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[7] = ah7 = (c & 0xffff) | (d << 16); hl[7] = al7 = (a & 0xffff) | (b << 16); pos += 128; n -= 128; } return n; } function crypto_hash(out, m, n) { var hh = new Int32Array(8), hl = new Int32Array(8), x = new Uint8Array(256), i, b = n; hh[0] = 0x6a09e667; hh[1] = 0xbb67ae85; hh[2] = 0x3c6ef372; hh[3] = 0xa54ff53a; hh[4] = 0x510e527f; hh[5] = 0x9b05688c; hh[6] = 0x1f83d9ab; hh[7] = 0x5be0cd19; hl[0] = 0xf3bcc908; hl[1] = 0x84caa73b; hl[2] = 0xfe94f82b; hl[3] = 0x5f1d36f1; hl[4] = 0xade682d1; hl[5] = 0x2b3e6c1f; hl[6] = 0xfb41bd6b; hl[7] = 0x137e2179; crypto_hashblocks_hl(hh, hl, m, n); n %= 128; for (i = 0; i < n; i++) x[i] = m[b-n+i]; x[n] = 128; n = 256-128*(n<112?1:0); x[n-9] = 0; ts64(x, n-8, (b / 0x20000000) | 0, b << 3); crypto_hashblocks_hl(hh, hl, x, n); for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); return 0; } function add(p, q) { var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(), g = gf(), h = gf(), t = gf(); Z(a, p[1], p[0]); Z(t, q[1], q[0]); M(a, a, t); A(b, p[0], p[1]); A(t, q[0], q[1]); M(b, b, t); M(c, p[3], q[3]); M(c, c, D2); M(d, p[2], q[2]); A(d, d, d); Z(e, b, a); Z(f, d, c); A(g, d, c); A(h, b, a); M(p[0], e, f); M(p[1], h, g); M(p[2], g, f); M(p[3], e, h); } function cswap(p, q, b) { var i; for (i = 0; i < 4; i++) { sel25519(p[i], q[i], b); } } function pack(r, p) { var tx = gf(), ty = gf(), zi = gf(); inv25519(zi, p[2]); M(tx, p[0], zi); M(ty, p[1], zi); pack25519(r, ty); r[31] ^= par25519(tx) << 7; } function scalarmult(p, q, s) { var b, i; set25519(p[0], gf0); set25519(p[1], gf1); set25519(p[2], gf1); set25519(p[3], gf0); for (i = 255; i >= 0; --i) { b = (s[(i/8)|0] >> (i&7)) & 1; cswap(p, q, b); add(q, p); add(p, p); cswap(p, q, b); } } function scalarbase(p, s) { var q = [gf(), gf(), gf(), gf()]; set25519(q[0], X); set25519(q[1], Y); set25519(q[2], gf1); M(q[3], X, Y); scalarmult(p, q, s); } function crypto_sign_keypair(pk, sk, seeded) { var d = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()]; var i; if (!seeded) randombytes(sk, 32); crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; scalarbase(p, d); pack(pk, p); for (i = 0; i < 32; i++) sk[i+32] = pk[i]; return 0; } var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); function modL(r, x) { var carry, i, j, k; for (i = 63; i >= 32; --i) { carry = 0; for (j = i - 32, k = i - 12; j < k; ++j) { x[j] += carry - 16 * x[i] * L[j - (i - 32)]; carry = (x[j] + 128) >> 8; x[j] -= carry * 256; } x[j] += carry; x[i] = 0; } carry = 0; for (j = 0; j < 32; j++) { x[j] += carry - (x[31] >> 4) * L[j]; carry = x[j] >> 8; x[j] &= 255; } for (j = 0; j < 32; j++) x[j] -= carry * L[j]; for (i = 0; i < 32; i++) { x[i+1] += x[i] >> 8; r[i] = x[i] & 255; } } function reduce(r) { var x = new Float64Array(64), i; for (i = 0; i < 64; i++) x[i] = r[i]; for (i = 0; i < 64; i++) r[i] = 0; modL(r, x); } // Note: difference from C - smlen returned, not passed as argument. function crypto_sign(sm, m, n, sk) { var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); var i, j, x = new Float64Array(64); var p = [gf(), gf(), gf(), gf()]; crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; var smlen = n + 64; for (i = 0; i < n; i++) sm[64 + i] = m[i]; for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; crypto_hash(r, sm.subarray(32), n+32); reduce(r); scalarbase(p, r); pack(sm, p); for (i = 32; i < 64; i++) sm[i] = sk[i]; crypto_hash(h, sm, n + 64); reduce(h); for (i = 0; i < 64; i++) x[i] = 0; for (i = 0; i < 32; i++) x[i] = r[i]; for (i = 0; i < 32; i++) { for (j = 0; j < 32; j++) { x[i+j] += h[i] * d[j]; } } modL(sm.subarray(32), x); return smlen; } function unpackneg(r, p) { var t = gf(), chk = gf(), num = gf(), den = gf(), den2 = gf(), den4 = gf(), den6 = gf(); set25519(r[2], gf1); unpack25519(r[1], p); S(num, r[1]); M(den, num, D); Z(num, num, r[2]); A(den, r[2], den); S(den2, den); S(den4, den2); M(den6, den4, den2); M(t, den6, num); M(t, t, den); pow2523(t, t); M(t, t, num); M(t, t, den); M(t, t, den); M(r[0], t, den); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) M(r[0], r[0], I); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) return -1; if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); M(r[3], r[0], r[1]); return 0; } function crypto_sign_open(m, sm, n, pk) { var i, mlen; var t = new Uint8Array(32), h = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()], q = [gf(), gf(), gf(), gf()]; mlen = -1; if (n < 64) return -1; if (unpackneg(q, pk)) return -1; for (i = 0; i < n; i++) m[i] = sm[i]; for (i = 0; i < 32; i++) m[i+32] = pk[i]; crypto_hash(h, m, n); reduce(h); scalarmult(p, q, h); scalarbase(q, sm.subarray(32)); add(p, q); pack(t, p); n -= 64; if (crypto_verify_32(sm, 0, t, 0)) { for (i = 0; i < n; i++) m[i] = 0; return -1; } for (i = 0; i < n; i++) m[i] = sm[i + 64]; mlen = n; return mlen; } var crypto_secretbox_KEYBYTES = 32, crypto_secretbox_NONCEBYTES = 24, crypto_secretbox_ZEROBYTES = 32, crypto_secretbox_BOXZEROBYTES = 16, crypto_scalarmult_BYTES = 32, crypto_scalarmult_SCALARBYTES = 32, crypto_box_PUBLICKEYBYTES = 32, crypto_box_SECRETKEYBYTES = 32, crypto_box_BEFORENMBYTES = 32, crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, crypto_sign_BYTES = 64, crypto_sign_PUBLICKEYBYTES = 32, crypto_sign_SECRETKEYBYTES = 64, crypto_sign_SEEDBYTES = 32, crypto_hash_BYTES = 64; nacl.lowlevel = { crypto_core_hsalsa20: crypto_core_hsalsa20, crypto_stream_xor: crypto_stream_xor, crypto_stream: crypto_stream, crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, crypto_stream_salsa20: crypto_stream_salsa20, crypto_onetimeauth: crypto_onetimeauth, crypto_onetimeauth_verify: crypto_onetimeauth_verify, crypto_verify_16: crypto_verify_16, crypto_verify_32: crypto_verify_32, crypto_secretbox: crypto_secretbox, crypto_secretbox_open: crypto_secretbox_open, crypto_scalarmult: crypto_scalarmult, crypto_scalarmult_base: crypto_scalarmult_base, crypto_box_beforenm: crypto_box_beforenm, crypto_box_afternm: crypto_box_afternm, crypto_box: crypto_box, crypto_box_open: crypto_box_open, crypto_box_keypair: crypto_box_keypair, crypto_hash: crypto_hash, crypto_sign: crypto_sign, crypto_sign_keypair: crypto_sign_keypair, crypto_sign_open: crypto_sign_open, crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, crypto_sign_BYTES: crypto_sign_BYTES, crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, crypto_hash_BYTES: crypto_hash_BYTES }; /* High-level API */ function checkLengths(k, n) { if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); } function checkBoxLengths(pk, sk) { if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); } function checkArrayTypes() { var t, i; for (i = 0; i < arguments.length; i++) { if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') throw new TypeError('unexpected type ' + t + ', use Uint8Array'); } } function cleanup(arr) { for (var i = 0; i < arr.length; i++) arr[i] = 0; } // TODO: Completely remove this in v0.15. if (!nacl.util) { nacl.util = {}; nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); }; } nacl.randomBytes = function(n) { var b = new Uint8Array(n); randombytes(b, n); return b; }; nacl.secretbox = function(msg, nonce, key) { checkArrayTypes(msg, nonce, key); checkLengths(key, nonce); var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); var c = new Uint8Array(m.length); for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; crypto_secretbox(c, m, m.length, nonce, key); return c.subarray(crypto_secretbox_BOXZEROBYTES); }; nacl.secretbox.open = function(box, nonce, key) { checkArrayTypes(box, nonce, key); checkLengths(key, nonce); var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); var m = new Uint8Array(c.length); for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; if (c.length < 32) return false; if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; return m.subarray(crypto_secretbox_ZEROBYTES); }; nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; nacl.scalarMult = function(n, p) { checkArrayTypes(n, p); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult(q, n, p); return q; }; nacl.scalarMult.base = function(n) { checkArrayTypes(n); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult_base(q, n); return q; }; nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; nacl.box = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox(msg, nonce, k); }; nacl.box.before = function(publicKey, secretKey) { checkArrayTypes(publicKey, secretKey); checkBoxLengths(publicKey, secretKey); var k = new Uint8Array(crypto_box_BEFORENMBYTES); crypto_box_beforenm(k, publicKey, secretKey); return k; }; nacl.box.after = nacl.secretbox; nacl.box.open = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox.open(msg, nonce, k); }; nacl.box.open.after = nacl.secretbox.open; nacl.box.keyPair = function() { var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); crypto_box_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.box.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); crypto_scalarmult_base(pk, secretKey); return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; nacl.box.nonceLength = crypto_box_NONCEBYTES; nacl.box.overheadLength = nacl.secretbox.overheadLength; nacl.sign = function(msg, secretKey) { checkArrayTypes(msg, secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); crypto_sign(signedMsg, msg, msg.length, secretKey); return signedMsg; }; nacl.sign.open = function(signedMsg, publicKey) { if (arguments.length !== 2) throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); checkArrayTypes(signedMsg, publicKey); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var tmp = new Uint8Array(signedMsg.length); var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); if (mlen < 0) return null; var m = new Uint8Array(mlen); for (var i = 0; i < m.length; i++) m[i] = tmp[i]; return m; }; nacl.sign.detached = function(msg, secretKey) { var signedMsg = nacl.sign(msg, secretKey); var sig = new Uint8Array(crypto_sign_BYTES); for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; return sig; }; nacl.sign.detached.verify = function(msg, sig, publicKey) { checkArrayTypes(msg, sig, publicKey); if (sig.length !== crypto_sign_BYTES) throw new Error('bad signature size'); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var sm = new Uint8Array(crypto_sign_BYTES + msg.length); var m = new Uint8Array(crypto_sign_BYTES + msg.length); var i; for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); }; nacl.sign.keyPair = function() { var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); crypto_sign_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.sign.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.sign.keyPair.fromSeed = function(seed) { checkArrayTypes(seed); if (seed.length !== crypto_sign_SEEDBYTES) throw new Error('bad seed size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); for (var i = 0; i < 32; i++) sk[i] = seed[i]; crypto_sign_keypair(pk, sk, true); return {publicKey: pk, secretKey: sk}; }; nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; nacl.sign.seedLength = crypto_sign_SEEDBYTES; nacl.sign.signatureLength = crypto_sign_BYTES; nacl.hash = function(msg) { checkArrayTypes(msg); var h = new Uint8Array(crypto_hash_BYTES); crypto_hash(h, msg, msg.length); return h; }; nacl.hash.hashLength = crypto_hash_BYTES; nacl.verify = function(x, y) { checkArrayTypes(x, y); // Zero length arguments are considered not equal. if (x.length === 0 || y.length === 0) return false; if (x.length !== y.length) return false; return (vn(x, 0, y, 0, x.length) === 0) ? true : false; }; nacl.setPRNG = function(fn) { randombytes = fn; }; (function() { // Initialize PRNG if environment provides CSPRNG. // If not, methods calling randombytes will throw. var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; if (crypto && crypto.getRandomValues) { // Browsers. var QUOTA = 65536; nacl.setPRNG(function(x, n) { var i, v = new Uint8Array(n); for (i = 0; i < n; i += QUOTA) { crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); } for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } else if (true) { // Node.js. crypto = __webpack_require__(4); if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } } })(); })(typeof module !== 'undefined' && module.exports ? module.exports : (self.nacl = self.nacl || {})); /***/ }), /* 21 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. // If you have no idea what ASN.1 or BER is, see this: // ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc var Ber = __webpack_require__(413); ///--- Exported API module.exports = { Ber: Ber, BerReader: Ber.Reader, BerWriter: Ber.Writer }; /***/ }), /* 22 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function __export(m) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } Object.defineProperty(exports, "__esModule", { value: true }); __export(__webpack_require__(55)); __export(__webpack_require__(230)); __export(__webpack_require__(47)); __export(__webpack_require__(33)); /***/ }), /* 23 */ /***/ (function(module, exports) { module.exports = require("assert"); /***/ }), /* 24 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; var es5 = __webpack_require__(31); var Objectfreeze = es5.freeze; var util = __webpack_require__(3); var inherits = util.inherits; var notEnumerableProp = util.notEnumerableProp; function subError(nameProperty, defaultMessage) { function SubError(message) { if (!(this instanceof SubError)) return new SubError(message); notEnumerableProp(this, "message", typeof message === "string" ? message : defaultMessage); notEnumerableProp(this, "name", nameProperty); if (Error.captureStackTrace) { Error.captureStackTrace(this, this.constructor); } else { Error.call(this); } } inherits(SubError, Error); return SubError; } var _TypeError, _RangeError; var Warning = subError("Warning", "warning"); var CancellationError = subError("CancellationError", "cancellation error"); var TimeoutError = subError("TimeoutError", "timeout error"); var AggregateError = subError("AggregateError", "aggregate error"); try { _TypeError = TypeError; _RangeError = RangeError; } catch(e) { _TypeError = subError("TypeError", "type error"); _RangeError = subError("RangeError", "range error"); } var methods = ("join pop push shift unshift slice filter forEach some " + "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" "); for (var i = 0; i < methods.length; ++i) { if (typeof Array.prototype[methods[i]] === "function") { AggregateError.prototype[methods[i]] = Array.prototype[methods[i]]; } } es5.defineProperty(AggregateError.prototype, "length", { value: 0, configurable: false, writable: true, enumerable: true }); AggregateError.prototype["isOperational"] = true; var level = 0; AggregateError.prototype.toString = function() { var indent = Array(level * 4 + 1).join(" "); var ret = "\n" + indent + "AggregateError of:" + "\n"; level++; indent = Array(level * 4 + 1).join(" "); for (var i = 0; i < this.length; ++i) { var str = this[i] === this ? "[Circular AggregateError]" : this[i] + ""; var lines = str.split("\n"); for (var j = 0; j < lines.length; ++j) { lines[j] = indent + lines[j]; } str = lines.join("\n"); ret += str + "\n"; } level--; return ret; }; function OperationalError(message) { if (!(this instanceof OperationalError)) return new OperationalError(message); notEnumerableProp(this, "name", "OperationalError"); notEnumerableProp(this, "message", message); this.cause = message; this["isOperational"] = true; if (message instanceof Error) { notEnumerableProp(this, "message", message.message); notEnumerableProp(this, "stack", message.stack); } else if (Error.captureStackTrace) { Error.captureStackTrace(this, this.constructor); } } inherits(OperationalError, Error); var errorTypes = Error["__BluebirdErrorTypes__"]; if (!errorTypes) { errorTypes = Objectfreeze({ CancellationError: CancellationError, TimeoutError: TimeoutError, OperationalError: OperationalError, RejectionError: OperationalError, AggregateError: AggregateError }); es5.defineProperty(Error, "__BluebirdErrorTypes__", { value: errorTypes, writable: false, enumerable: false, configurable: false }); } module.exports = { Error: Error, TypeError: _TypeError, RangeError: _RangeError, CancellationError: errorTypes.CancellationError, OperationalError: errorTypes.OperationalError, TimeoutError: errorTypes.TimeoutError, AggregateError: errorTypes.AggregateError, Warning: Warning }; /***/ }), /* 25 */ /***/ (function(module, exports, __webpack_require__) { (function(){ // Copyright (c) 2005 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Basic JavaScript BN library - subset useful for RSA encryption. // Bits per digit var dbits; // JavaScript engine analysis var canary = 0xdeadbeefcafe; var j_lm = ((canary&0xffffff)==0xefcafe); // (public) Constructor function BigInteger(a,b,c) { if(a != null) if("number" == typeof a) this.fromNumber(a,b,c); else if(b == null && "string" != typeof a) this.fromString(a,256); else this.fromString(a,b); } // return new, unset BigInteger function nbi() { return new BigInteger(null); } // am: Compute w_j += (x*this_i), propagate carries, // c is initial carry, returns final carry. // c < 3*dvalue, x < 2*dvalue, this_i < dvalue // We need to select the fastest one that works in this environment. // am1: use a single mult and divide to get the high bits, // max digit bits should be 26 because // max internal value = 2*dvalue^2-2*dvalue (< 2^53) function am1(i,x,w,j,c,n) { while(--n >= 0) { var v = x*this[i++]+w[j]+c; c = Math.floor(v/0x4000000); w[j++] = v&0x3ffffff; } return c; } // am2 avoids a big mult-and-extract completely. // Max digit bits should be <= 30 because we do bitwise ops // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) function am2(i,x,w,j,c,n) { var xl = x&0x7fff, xh = x>>15; while(--n >= 0) { var l = this[i]&0x7fff; var h = this[i++]>>15; var m = xh*l+h*xl; l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); w[j++] = l&0x3fffffff; } return c; } // Alternately, set max digit bits to 28 since some // browsers slow down when dealing with 32-bit numbers. function am3(i,x,w,j,c,n) { var xl = x&0x3fff, xh = x>>14; while(--n >= 0) { var l = this[i]&0x3fff; var h = this[i++]>>14; var m = xh*l+h*xl; l = xl*l+((m&0x3fff)<<14)+w[j]+c; c = (l>>28)+(m>>14)+xh*h; w[j++] = l&0xfffffff; } return c; } var inBrowser = typeof navigator !== "undefined"; if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { BigInteger.prototype.am = am2; dbits = 30; } else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { BigInteger.prototype.am = am1; dbits = 26; } else { // Mozilla/Netscape seems to prefer am3 BigInteger.prototype.am = am3; dbits = 28; } BigInteger.prototype.DB = dbits; BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; r.t = this.t; r.s = this.s; } // (protected) set from integer value x, -DV <= x < DV function bnpFromInt(x) { this.t = 1; this.s = (x<0)?-1:0; if(x > 0) this[0] = x; else if(x < -1) this[0] = x+this.DV; else this.t = 0; } // return bigint initialized to value function nbv(i) { var r = nbi(); r.fromInt(i); return r; } // (protected) set from string and radix function bnpFromString(s,b) { var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 256) k = 8; // byte array else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else { this.fromRadix(s,b); return; } this.t = 0; this.s = 0; var i = s.length, mi = false, sh = 0; while(--i >= 0) { var x = (k==8)?s[i]&0xff:intAt(s,i); if(x < 0) { if(s.charAt(i) == "-") mi = true; continue; } mi = false; if(sh == 0) this[this.t++] = x; else if(sh+k > this.DB) { this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); } else this[this.t-1] |= x<= this.DB) sh -= this.DB; } if(k == 8 && (s[0]&0x80) != 0) { this.s = -1; if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; } // (public) return string representation in given radix function bnToString(b) { if(this.s < 0) return "-"+this.negate().toString(b); var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else return this.toRadix(b); var km = (1< 0) { if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } while(i >= 0) { if(p < k) { d = (this[i]&((1<>(p+=this.DB-k); } else { d = (this[i]>>(p-=k))&km; if(p <= 0) { p += this.DB; --i; } } if(d > 0) m = true; if(m) r += int2char(d); } } return m?r:"0"; } // (public) -this function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } // (public) |this| function bnAbs() { return (this.s<0)?this.negate():this; } // (public) return + if this > a, - if this < a, 0 if equal function bnCompareTo(a) { var r = this.s-a.s; if(r != 0) return r; var i = this.t; r = i-a.t; if(r != 0) return (this.s<0)?-r:r; while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; return 0; } // returns bit length of the integer x function nbits(x) { var r = 1, t; if((t=x>>>16) != 0) { x = t; r += 16; } if((t=x>>8) != 0) { x = t; r += 8; } if((t=x>>4) != 0) { x = t; r += 4; } if((t=x>>2) != 0) { x = t; r += 2; } if((t=x>>1) != 0) { x = t; r += 1; } return r; } // (public) return the number of bits in "this" function bnBitLength() { if(this.t <= 0) return 0; return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); } // (protected) r = this << n*DB function bnpDLShiftTo(n,r) { var i; for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; for(i = n-1; i >= 0; --i) r[i] = 0; r.t = this.t+n; r.s = this.s; } // (protected) r = this >> n*DB function bnpDRShiftTo(n,r) { for(var i = n; i < this.t; ++i) r[i-n] = this[i]; r.t = Math.max(this.t-n,0); r.s = this.s; } // (protected) r = this << n function bnpLShiftTo(n,r) { var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<= 0; --i) { r[i+ds+1] = (this[i]>>cbs)|c; c = (this[i]&bm)<= 0; --i) r[i] = 0; r[ds] = c; r.t = this.t+ds+1; r.s = this.s; r.clamp(); } // (protected) r = this >> n function bnpRShiftTo(n,r) { r.s = this.s; var ds = Math.floor(n/this.DB); if(ds >= this.t) { r.t = 0; return; } var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<>bs; for(var i = ds+1; i < this.t; ++i) { r[i-ds-1] |= (this[i]&bm)<>bs; } if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; } if(a.t < this.t) { c -= a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c -= a[i]; r[i++] = c&this.DM; c >>= this.DB; } c -= a.s; } r.s = (c<0)?-1:0; if(c < -1) r[i++] = this.DV+c; else if(c > 0) r[i++] = c; r.t = i; r.clamp(); } // (protected) r = this * a, r != this,a (HAC 14.12) // "this" should be the larger one if appropriate. function bnpMultiplyTo(a,r) { var x = this.abs(), y = a.abs(); var i = x.t; r.t = i+y.t; while(--i >= 0) r[i] = 0; for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); r.s = 0; r.clamp(); if(this.s != a.s) BigInteger.ZERO.subTo(r,r); } // (protected) r = this^2, r != this (HAC 14.16) function bnpSquareTo(r) { var x = this.abs(); var i = r.t = 2*x.t; while(--i >= 0) r[i] = 0; for(i = 0; i < x.t-1; ++i) { var c = x.am(i,x[i],r,2*i,0,1); if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { r[i+x.t] -= x.DV; r[i+x.t+1] = 1; } } if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); r.s = 0; r.clamp(); } // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) // r != q, this != m. q or r may be null. function bnpDivRemTo(m,q,r) { var pm = m.abs(); if(pm.t <= 0) return; var pt = this.abs(); if(pt.t < pm.t) { if(q != null) q.fromInt(0); if(r != null) this.copyTo(r); return; } if(r == null) r = nbi(); var y = nbi(), ts = this.s, ms = m.s; var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } else { pm.copyTo(y); pt.copyTo(r); } var ys = y.t; var y0 = y[ys-1]; if(y0 == 0) return; var yt = y0*(1<1)?y[ys-2]>>this.F2:0); var d1 = this.FV/yt, d2 = (1<= 0) { r[r.t++] = 1; r.subTo(t,r); } BigInteger.ONE.dlShiftTo(ys,t); t.subTo(y,y); // "negative" y so we can replace sub with am later while(y.t < ys) y[y.t++] = 0; while(--j >= 0) { // Estimate quotient digit var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out y.dlShiftTo(j,t); r.subTo(t,r); while(r[i] < --qd) r.subTo(t,r); } } if(q != null) { r.drShiftTo(ys,q); if(ts != ms) BigInteger.ZERO.subTo(q,q); } r.t = ys; r.clamp(); if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder if(ts < 0) BigInteger.ZERO.subTo(r,r); } // (public) this mod a function bnMod(a) { var r = nbi(); this.abs().divRemTo(a,null,r); if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); return r; } // Modular reduction using "classic" algorithm function Classic(m) { this.m = m; } function cConvert(x) { if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); else return x; } function cRevert(x) { return x; } function cReduce(x) { x.divRemTo(this.m,null,x); } function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } Classic.prototype.convert = cConvert; Classic.prototype.revert = cRevert; Classic.prototype.reduce = cReduce; Classic.prototype.mulTo = cMulTo; Classic.prototype.sqrTo = cSqrTo; // (protected) return "-1/this % 2^DB"; useful for Mont. reduction // justification: // xy == 1 (mod m) // xy = 1+km // xy(2-xy) = (1+km)(1-km) // x[y(2-xy)] = 1-k^2m^2 // x[y(2-xy)] == 1 (mod m^2) // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. // JS multiply "overflows" differently from C/C++, so care is needed here. function bnpInvDigit() { if(this.t < 1) return 0; var x = this[0]; if((x&1) == 0) return 0; var y = x&3; // y == 1/x mod 2^2 y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 // last step - calculate inverse mod DV directly; // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits // we really want the negative inverse, and -DV < y < DV return (y>0)?this.DV-y:-y; } // Montgomery reduction function Montgomery(m) { this.m = m; this.mp = m.invDigit(); this.mpl = this.mp&0x7fff; this.mph = this.mp>>15; this.um = (1<<(m.DB-15))-1; this.mt2 = 2*m.t; } // xR mod m function montConvert(x) { var r = nbi(); x.abs().dlShiftTo(this.m.t,r); r.divRemTo(this.m,null,r); if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); return r; } // x/R mod m function montRevert(x) { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } // x = x/R mod m (HAC 14.32) function montReduce(x) { while(x.t <= this.mt2) // pad x so am has enough room later x[x.t++] = 0; for(var i = 0; i < this.m.t; ++i) { // faster way of calculating u0 = x[i]*mp mod DV var j = x[i]&0x7fff; var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; // use am to combine the multiply-shift-add into one call j = i+this.m.t; x[j] += this.m.am(0,u0,x,i,0,this.m.t); // propagate carry while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } } x.clamp(); x.drShiftTo(this.m.t,x); if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = "x^2/R mod m"; x != r function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = "xy/R mod m"; x,y != r function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Montgomery.prototype.convert = montConvert; Montgomery.prototype.revert = montRevert; Montgomery.prototype.reduce = montReduce; Montgomery.prototype.mulTo = montMulTo; Montgomery.prototype.sqrTo = montSqrTo; // (protected) true iff this is even function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) function bnpExp(e,z) { if(e > 0xffffffff || e < 1) return BigInteger.ONE; var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; g.copyTo(r); while(--i >= 0) { z.sqrTo(r,r2); if((e&(1< 0) z.mulTo(r2,g,r); else { var t = r; r = r2; r2 = t; } } return z.revert(r); } // (public) this^e % m, 0 <= e < 2^32 function bnModPowInt(e,m) { var z; if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); return this.exp(e,z); } // protected BigInteger.prototype.copyTo = bnpCopyTo; BigInteger.prototype.fromInt = bnpFromInt; BigInteger.prototype.fromString = bnpFromString; BigInteger.prototype.clamp = bnpClamp; BigInteger.prototype.dlShiftTo = bnpDLShiftTo; BigInteger.prototype.drShiftTo = bnpDRShiftTo; BigInteger.prototype.lShiftTo = bnpLShiftTo; BigInteger.prototype.rShiftTo = bnpRShiftTo; BigInteger.prototype.subTo = bnpSubTo; BigInteger.prototype.multiplyTo = bnpMultiplyTo; BigInteger.prototype.squareTo = bnpSquareTo; BigInteger.prototype.divRemTo = bnpDivRemTo; BigInteger.prototype.invDigit = bnpInvDigit; BigInteger.prototype.isEven = bnpIsEven; BigInteger.prototype.exp = bnpExp; // public BigInteger.prototype.toString = bnToString; BigInteger.prototype.negate = bnNegate; BigInteger.prototype.abs = bnAbs; BigInteger.prototype.compareTo = bnCompareTo; BigInteger.prototype.bitLength = bnBitLength; BigInteger.prototype.mod = bnMod; BigInteger.prototype.modPowInt = bnModPowInt; // "constants" BigInteger.ZERO = nbv(0); BigInteger.ONE = nbv(1); // Copyright (c) 2005-2009 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Extended JavaScript BN functions, required for RSA private ops. // Version 1.1: new BigInteger("0", 10) returns "proper" zero // Version 1.2: square() API, isProbablePrime fix // (public) function bnClone() { var r = nbi(); this.copyTo(r); return r; } // (public) return value as integer function bnIntValue() { if(this.s < 0) { if(this.t == 1) return this[0]-this.DV; else if(this.t == 0) return -1; } else if(this.t == 1) return this[0]; else if(this.t == 0) return 0; // assumes 16 < DB < 32 return ((this[1]&((1<<(32-this.DB))-1))<>24; } // (public) return value as short (assumes DB>=16) function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } // (protected) return x s.t. r^x < DV function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } // (public) 0 if this == 0, 1 if this > 0 function bnSigNum() { if(this.s < 0) return -1; else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; else return 1; } // (protected) convert to radix string function bnpToRadix(b) { if(b == null) b = 10; if(this.signum() == 0 || b < 2 || b > 36) return "0"; var cs = this.chunkSize(b); var a = Math.pow(b,cs); var d = nbv(a), y = nbi(), z = nbi(), r = ""; this.divRemTo(d,y,z); while(y.signum() > 0) { r = (a+z.intValue()).toString(b).substr(1) + r; y.divRemTo(d,y,z); } return z.intValue().toString(b) + r; } // (protected) convert from radix string function bnpFromRadix(s,b) { this.fromInt(0); if(b == null) b = 10; var cs = this.chunkSize(b); var d = Math.pow(b,cs), mi = false, j = 0, w = 0; for(var i = 0; i < s.length; ++i) { var x = intAt(s,i); if(x < 0) { if(s.charAt(i) == "-" && this.signum() == 0) mi = true; continue; } w = b*w+x; if(++j >= cs) { this.dMultiply(d); this.dAddOffset(w,0); j = 0; w = 0; } } if(j > 0) { this.dMultiply(Math.pow(b,j)); this.dAddOffset(w,0); } if(mi) BigInteger.ZERO.subTo(this,this); } // (protected) alternate constructor function bnpFromNumber(a,b,c) { if("number" == typeof b) { // new BigInteger(int,int,RNG) if(a < 2) this.fromInt(1); else { this.fromNumber(a,c); if(!this.testBit(a-1)) // force MSB set this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); if(this.isEven()) this.dAddOffset(1,0); // force odd while(!this.isProbablePrime(b)) { this.dAddOffset(2,0); if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); } } } else { // new BigInteger(int,RNG) var x = new Array(), t = a&7; x.length = (a>>3)+1; b.nextBytes(x); if(t > 0) x[0] &= ((1< 0) { if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) r[k++] = d|(this.s<<(this.DB-p)); while(i >= 0) { if(p < 8) { d = (this[i]&((1<>(p+=this.DB-8); } else { d = (this[i]>>(p-=8))&0xff; if(p <= 0) { p += this.DB; --i; } } if((d&0x80) != 0) d |= -256; if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; if(k > 0 || d != this.s) r[k++] = d; } } return r; } function bnEquals(a) { return(this.compareTo(a)==0); } function bnMin(a) { return(this.compareTo(a)<0)?this:a; } function bnMax(a) { return(this.compareTo(a)>0)?this:a; } // (protected) r = this op a (bitwise) function bnpBitwiseTo(a,op,r) { var i, f, m = Math.min(a.t,this.t); for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); if(a.t < this.t) { f = a.s&this.DM; for(i = m; i < this.t; ++i) r[i] = op(this[i],f); r.t = this.t; } else { f = this.s&this.DM; for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); r.t = a.t; } r.s = op(this.s,a.s); r.clamp(); } // (public) this & a function op_and(x,y) { return x&y; } function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } // (public) this | a function op_or(x,y) { return x|y; } function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } // (public) this ^ a function op_xor(x,y) { return x^y; } function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } // (public) this & ~a function op_andnot(x,y) { return x&~y; } function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } // (public) ~this function bnNot() { var r = nbi(); for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; r.t = this.t; r.s = ~this.s; return r; } // (public) this << n function bnShiftLeft(n) { var r = nbi(); if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); return r; } // (public) this >> n function bnShiftRight(n) { var r = nbi(); if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); return r; } // return index of lowest 1-bit in x, x < 2^31 function lbit(x) { if(x == 0) return -1; var r = 0; if((x&0xffff) == 0) { x >>= 16; r += 16; } if((x&0xff) == 0) { x >>= 8; r += 8; } if((x&0xf) == 0) { x >>= 4; r += 4; } if((x&3) == 0) { x >>= 2; r += 2; } if((x&1) == 0) ++r; return r; } // (public) returns index of lowest 1-bit (or -1 if none) function bnGetLowestSetBit() { for(var i = 0; i < this.t; ++i) if(this[i] != 0) return i*this.DB+lbit(this[i]); if(this.s < 0) return this.t*this.DB; return -1; } // return number of 1 bits in x function cbit(x) { var r = 0; while(x != 0) { x &= x-1; ++r; } return r; } // (public) return number of set bits function bnBitCount() { var r = 0, x = this.s&this.DM; for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); return r; } // (public) true iff nth bit is set function bnTestBit(n) { var j = Math.floor(n/this.DB); if(j >= this.t) return(this.s!=0); return((this[j]&(1<<(n%this.DB)))!=0); } // (protected) this op (1<>= this.DB; } if(a.t < this.t) { c += a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c += a[i]; r[i++] = c&this.DM; c >>= this.DB; } c += a.s; } r.s = (c<0)?-1:0; if(c > 0) r[i++] = c; else if(c < -1) r[i++] = this.DV+c; r.t = i; r.clamp(); } // (public) this + a function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } // (public) this - a function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } // (public) this * a function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } // (public) this^2 function bnSquare() { var r = nbi(); this.squareTo(r); return r; } // (public) this / a function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } // (public) this % a function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } // (public) [this/a,this%a] function bnDivideAndRemainder(a) { var q = nbi(), r = nbi(); this.divRemTo(a,q,r); return new Array(q,r); } // (protected) this *= n, this >= 0, 1 < n < DV function bnpDMultiply(n) { this[this.t] = this.am(0,n-1,this,0,0,this.t); ++this.t; this.clamp(); } // (protected) this += n << w words, this >= 0 function bnpDAddOffset(n,w) { if(n == 0) return; while(this.t <= w) this[this.t++] = 0; this[w] += n; while(this[w] >= this.DV) { this[w] -= this.DV; if(++w >= this.t) this[this.t++] = 0; ++this[w]; } } // A "null" reducer function NullExp() {} function nNop(x) { return x; } function nMulTo(x,y,r) { x.multiplyTo(y,r); } function nSqrTo(x,r) { x.squareTo(r); } NullExp.prototype.convert = nNop; NullExp.prototype.revert = nNop; NullExp.prototype.mulTo = nMulTo; NullExp.prototype.sqrTo = nSqrTo; // (public) this^e function bnPow(e) { return this.exp(e,new NullExp()); } // (protected) r = lower n words of "this * a", a.t <= n // "this" should be the larger one if appropriate. function bnpMultiplyLowerTo(a,n,r) { var i = Math.min(this.t+a.t,n); r.s = 0; // assumes a,this >= 0 r.t = i; while(i > 0) r[--i] = 0; var j; for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); r.clamp(); } // (protected) r = "this * a" without lower n words, n > 0 // "this" should be the larger one if appropriate. function bnpMultiplyUpperTo(a,n,r) { --n; var i = r.t = this.t+a.t-n; r.s = 0; // assumes a,this >= 0 while(--i >= 0) r[i] = 0; for(i = Math.max(n-this.t,0); i < a.t; ++i) r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); r.clamp(); r.drShiftTo(1,r); } // Barrett modular reduction function Barrett(m) { // setup Barrett this.r2 = nbi(); this.q3 = nbi(); BigInteger.ONE.dlShiftTo(2*m.t,this.r2); this.mu = this.r2.divide(m); this.m = m; } function barrettConvert(x) { if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); else if(x.compareTo(this.m) < 0) return x; else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } } function barrettRevert(x) { return x; } // x = x mod m (HAC 14.42) function barrettReduce(x) { x.drShiftTo(this.m.t-1,this.r2); if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); x.subTo(this.r2,x); while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = x^2 mod m; x != r function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = x*y mod m; x,y != r function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Barrett.prototype.convert = barrettConvert; Barrett.prototype.revert = barrettRevert; Barrett.prototype.reduce = barrettReduce; Barrett.prototype.mulTo = barrettMulTo; Barrett.prototype.sqrTo = barrettSqrTo; // (public) this^e % m (HAC 14.85) function bnModPow(e,m) { var i = e.bitLength(), k, r = nbv(1), z; if(i <= 0) return r; else if(i < 18) k = 1; else if(i < 48) k = 3; else if(i < 144) k = 4; else if(i < 768) k = 5; else k = 6; if(i < 8) z = new Classic(m); else if(m.isEven()) z = new Barrett(m); else z = new Montgomery(m); // precomputation var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { var g2 = nbi(); z.sqrTo(g[1],g2); while(n <= km) { g[n] = nbi(); z.mulTo(g2,g[n-2],g[n]); n += 2; } } var j = e.t-1, w, is1 = true, r2 = nbi(), t; i = nbits(e[j])-1; while(j >= 0) { if(i >= k1) w = (e[j]>>(i-k1))&km; else { w = (e[j]&((1<<(i+1))-1))<<(k1-i); if(j > 0) w |= e[j-1]>>(this.DB+i-k1); } n = k; while((w&1) == 0) { w >>= 1; --n; } if((i -= n) < 0) { i += this.DB; --j; } if(is1) { // ret == 1, don't bother squaring or multiplying it g[w].copyTo(r); is1 = false; } else { while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } z.mulTo(r2,g[w],r); } while(j >= 0 && (e[j]&(1< 0) { x.rShiftTo(g,x); y.rShiftTo(g,y); } while(x.signum() > 0) { if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); if(x.compareTo(y) >= 0) { x.subTo(y,x); x.rShiftTo(1,x); } else { y.subTo(x,y); y.rShiftTo(1,y); } } if(g > 0) y.lShiftTo(g,y); return y; } // (protected) this % n, n < 2^26 function bnpModInt(n) { if(n <= 0) return 0; var d = this.DV%n, r = (this.s<0)?n-1:0; if(this.t > 0) if(d == 0) r = this[0]%n; else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; return r; } // (public) 1/this % m (HAC 14.61) function bnModInverse(m) { var ac = m.isEven(); if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; var u = m.clone(), v = this.clone(); var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); while(u.signum() != 0) { while(u.isEven()) { u.rShiftTo(1,u); if(ac) { if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } a.rShiftTo(1,a); } else if(!b.isEven()) b.subTo(m,b); b.rShiftTo(1,b); } while(v.isEven()) { v.rShiftTo(1,v); if(ac) { if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } c.rShiftTo(1,c); } else if(!d.isEven()) d.subTo(m,d); d.rShiftTo(1,d); } if(u.compareTo(v) >= 0) { u.subTo(v,u); if(ac) a.subTo(c,a); b.subTo(d,b); } else { v.subTo(u,v); if(ac) c.subTo(a,c); d.subTo(b,d); } } if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; if(d.compareTo(m) >= 0) return d.subtract(m); if(d.signum() < 0) d.addTo(m,d); else return d; if(d.signum() < 0) return d.add(m); else return d; } var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; var lplim = (1<<26)/lowprimes[lowprimes.length-1]; // (public) test primality with certainty >= 1-.5^t function bnIsProbablePrime(t) { var i, x = this.abs(); if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { for(i = 0; i < lowprimes.length; ++i) if(x[0] == lowprimes[i]) return true; return false; } if(x.isEven()) return false; i = 1; while(i < lowprimes.length) { var m = lowprimes[i], j = i+1; while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; m = x.modInt(m); while(i < j) if(m%lowprimes[i++] == 0) return false; } return x.millerRabin(t); } // (protected) true if probably prime (HAC 4.24, Miller-Rabin) function bnpMillerRabin(t) { var n1 = this.subtract(BigInteger.ONE); var k = n1.getLowestSetBit(); if(k <= 0) return false; var r = n1.shiftRight(k); t = (t+1)>>1; if(t > lowprimes.length) t = lowprimes.length; var a = nbi(); for(var i = 0; i < t; ++i) { //Pick bases at random, instead of starting at 2 a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); var y = a.modPow(r,this); if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { var j = 1; while(j++ < k && y.compareTo(n1) != 0) { y = y.modPowInt(2,this); if(y.compareTo(BigInteger.ONE) == 0) return false; } if(y.compareTo(n1) != 0) return false; } } return true; } // protected BigInteger.prototype.chunkSize = bnpChunkSize; BigInteger.prototype.toRadix = bnpToRadix; BigInteger.prototype.fromRadix = bnpFromRadix; BigInteger.prototype.fromNumber = bnpFromNumber; BigInteger.prototype.bitwiseTo = bnpBitwiseTo; BigInteger.prototype.changeBit = bnpChangeBit; BigInteger.prototype.addTo = bnpAddTo; BigInteger.prototype.dMultiply = bnpDMultiply; BigInteger.prototype.dAddOffset = bnpDAddOffset; BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; BigInteger.prototype.modInt = bnpModInt; BigInteger.prototype.millerRabin = bnpMillerRabin; // public BigInteger.prototype.clone = bnClone; BigInteger.prototype.intValue = bnIntValue; BigInteger.prototype.byteValue = bnByteValue; BigInteger.prototype.shortValue = bnShortValue; BigInteger.prototype.signum = bnSigNum; BigInteger.prototype.toByteArray = bnToByteArray; BigInteger.prototype.equals = bnEquals; BigInteger.prototype.min = bnMin; BigInteger.prototype.max = bnMax; BigInteger.prototype.and = bnAnd; BigInteger.prototype.or = bnOr; BigInteger.prototype.xor = bnXor; BigInteger.prototype.andNot = bnAndNot; BigInteger.prototype.not = bnNot; BigInteger.prototype.shiftLeft = bnShiftLeft; BigInteger.prototype.shiftRight = bnShiftRight; BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; BigInteger.prototype.bitCount = bnBitCount; BigInteger.prototype.testBit = bnTestBit; BigInteger.prototype.setBit = bnSetBit; BigInteger.prototype.clearBit = bnClearBit; BigInteger.prototype.flipBit = bnFlipBit; BigInteger.prototype.add = bnAdd; BigInteger.prototype.subtract = bnSubtract; BigInteger.prototype.multiply = bnMultiply; BigInteger.prototype.divide = bnDivide; BigInteger.prototype.remainder = bnRemainder; BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; BigInteger.prototype.modPow = bnModPow; BigInteger.prototype.modInverse = bnModInverse; BigInteger.prototype.pow = bnPow; BigInteger.prototype.gcd = bnGCD; BigInteger.prototype.isProbablePrime = bnIsProbablePrime; // JSBN-specific extension BigInteger.prototype.square = bnSquare; // Expose the Barrett function BigInteger.prototype.Barrett = Barrett // BigInteger interfaces not implemented in jsbn: // BigInteger(int signum, byte[] magnitude) // double doubleValue() // float floatValue() // int hashCode() // long longValue() // static BigInteger valueOf(long val) // Random number generator - requires a PRNG backend, e.g. prng4.js // For best results, put code like // // in your main HTML document. var rng_state; var rng_pool; var rng_pptr; // Mix in a 32-bit integer into the pool function rng_seed_int(x) { rng_pool[rng_pptr++] ^= x & 255; rng_pool[rng_pptr++] ^= (x >> 8) & 255; rng_pool[rng_pptr++] ^= (x >> 16) & 255; rng_pool[rng_pptr++] ^= (x >> 24) & 255; if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; } // Mix in the current time (w/milliseconds) into the pool function rng_seed_time() { rng_seed_int(new Date().getTime()); } // Initialize the pool with junk if needed. if(rng_pool == null) { rng_pool = new Array(); rng_pptr = 0; var t; if(typeof window !== "undefined" && window.crypto) { if (window.crypto.getRandomValues) { // Use webcrypto if available var ua = new Uint8Array(32); window.crypto.getRandomValues(ua); for(t = 0; t < 32; ++t) rng_pool[rng_pptr++] = ua[t]; } else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { // Extract entropy (256 bits) from NS4 RNG if available var z = window.crypto.random(32); for(t = 0; t < z.length; ++t) rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; } } while(rng_pptr < rng_psize) { // extract some randomness from Math.random() t = Math.floor(65536 * Math.random()); rng_pool[rng_pptr++] = t >>> 8; rng_pool[rng_pptr++] = t & 255; } rng_pptr = 0; rng_seed_time(); //rng_seed_int(window.screenX); //rng_seed_int(window.screenY); } function rng_get_byte() { if(rng_state == null) { rng_seed_time(); rng_state = prng_newstate(); rng_state.init(rng_pool); for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) rng_pool[rng_pptr] = 0; rng_pptr = 0; //rng_pool = null; } // TODO: allow reseeding after first request return rng_state.next(); } function rng_get_bytes(ba) { var i; for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); } function SecureRandom() {} SecureRandom.prototype.nextBytes = rng_get_bytes; // prng4.js - uses Arcfour as a PRNG function Arcfour() { this.i = 0; this.j = 0; this.S = new Array(); } // Initialize arcfour context from key, an array of ints, each from [0..255] function ARC4init(key) { var i, j, t; for(i = 0; i < 256; ++i) this.S[i] = i; j = 0; for(i = 0; i < 256; ++i) { j = (j + this.S[i] + key[i % key.length]) & 255; t = this.S[i]; this.S[i] = this.S[j]; this.S[j] = t; } this.i = 0; this.j = 0; } function ARC4next() { var t; this.i = (this.i + 1) & 255; this.j = (this.j + this.S[this.i]) & 255; t = this.S[this.i]; this.S[this.i] = this.S[this.j]; this.S[this.j] = t; return this.S[(t + this.S[this.i]) & 255]; } Arcfour.prototype.init = ARC4init; Arcfour.prototype.next = ARC4next; // Plug in your RNG constructor here function prng_newstate() { return new Arcfour(); } // Pool size must be a multiple of 4 and greater than 32. // An array of bytes the size of the pool will be passed to init() var rng_psize = 256; BigInteger.SecureRandom = SecureRandom; BigInteger.BigInteger = BigInteger; if (true) { exports = module.exports = BigInteger; } else { this.BigInteger = BigInteger; this.SecureRandom = SecureRandom; } }).call(this); /***/ }), /* 26 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(2); var asn1 = __webpack_require__(21); var crypto = __webpack_require__(4); var algs = __webpack_require__(7); var utils = __webpack_require__(5); var Key = __webpack_require__(6); var PrivateKey = __webpack_require__(8); var pkcs1 = __webpack_require__(78); var pkcs8 = __webpack_require__(42); var sshpriv = __webpack_require__(54); var rfc4253 = __webpack_require__(27); var errors = __webpack_require__(18); /* * For reading we support both PKCS#1 and PKCS#8. If we find a private key, * we just take the public component of it and use that. */ function read(buf, options, forceType) { var input = buf; if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.trim().split('\n'); var m = lines[0].match(/*JSSTYLED*/ /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); assert.ok(m, 'invalid PEM header'); var m2 = lines[lines.length - 1].match(/*JSSTYLED*/ /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); assert.ok(m2, 'invalid PEM footer'); /* Begin and end banners must match key type */ assert.equal(m[2], m2[2]); var type = m[2].toLowerCase(); var alg; if (m[1]) { /* They also must match algorithms, if given */ assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); alg = m[1].trim(); } var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } var cipher, key, iv; if (headers['proc-type']) { var parts = headers['proc-type'].split(','); if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { if (typeof (options.passphrase) === 'string') { options.passphrase = new Buffer( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } else { parts = headers['dek-info'].split(','); assert.ok(parts.length === 2); cipher = parts[0].toLowerCase(); iv = new Buffer(parts[1], 'hex'); key = utils.opensslKeyDeriv(cipher, iv, options.passphrase, 1).key; } } } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = new Buffer(lines, 'base64'); if (cipher && key && iv) { var cipherStream = crypto.createDecipheriv(cipher, key, iv); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(buf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); buf = Buffer.concat(chunks); } /* The new OpenSSH internal format abuses PEM headers */ if (alg && alg.toLowerCase() === 'openssh') return (sshpriv.readSSHPrivate(type, buf, options)); if (alg && alg.toLowerCase() === 'ssh2') return (rfc4253.readType(type, buf, options)); var der = new asn1.BerReader(buf); der.originalInput = input; /* * All of the PEM file types start with a sequence tag, so chop it * off here */ der.readSequence(); /* PKCS#1 type keys name an algorithm in the banner explicitly */ if (alg) { if (forceType) assert.strictEqual(forceType, 'pkcs1'); return (pkcs1.readPkcs1(alg, type, der)); } else { if (forceType) assert.strictEqual(forceType, 'pkcs8'); return (pkcs8.readPkcs8(alg, type, der)); } } function write(key, options, type) { assert.object(key); var alg = { 'ecdsa': 'EC', 'rsa': 'RSA', 'dsa': 'DSA', 'ed25519': 'EdDSA' }[key.type]; var header; var der = new asn1.BerWriter(); if (PrivateKey.isPrivateKey(key)) { if (type && type === 'pkcs8') { header = 'PRIVATE KEY'; pkcs8.writePkcs8(der, key); } else { if (type) assert.strictEqual(type, 'pkcs1'); header = alg + ' PRIVATE KEY'; pkcs1.writePkcs1(der, key); } } else if (Key.isKey(key)) { if (type && type === 'pkcs1') { header = alg + ' PUBLIC KEY'; pkcs1.writePkcs1(der, key); } else { if (type) assert.strictEqual(type, 'pkcs8'); header = 'PUBLIC KEY'; pkcs8.writePkcs8(der, key); } } else { throw (new Error('key is not a Key or PrivateKey')); } var tmp = der.buffer.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = new Buffer(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /* 27 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read.bind(undefined, false, undefined), readType: read.bind(undefined, false), write: write, /* semi-private api, used by sshpk-agent */ readPartial: read.bind(undefined, true), /* shared with ssh format */ readInternal: read, keyTypeToAlg: keyTypeToAlg, algToKeyType: algToKeyType }; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var utils = __webpack_require__(5); var Key = __webpack_require__(6); var PrivateKey = __webpack_require__(8); var SSHBuffer = __webpack_require__(43); function algToKeyType(alg) { assert.string(alg); if (alg === 'ssh-dss') return ('dsa'); else if (alg === 'ssh-rsa') return ('rsa'); else if (alg === 'ssh-ed25519') return ('ed25519'); else if (alg === 'ssh-curve25519') return ('curve25519'); else if (alg.match(/^ecdsa-sha2-/)) return ('ecdsa'); else throw (new Error('Unknown algorithm ' + alg)); } function keyTypeToAlg(key) { assert.object(key); if (key.type === 'dsa') return ('ssh-dss'); else if (key.type === 'rsa') return ('ssh-rsa'); else if (key.type === 'ed25519') return ('ssh-ed25519'); else if (key.type === 'curve25519') return ('ssh-curve25519'); else if (key.type === 'ecdsa') return ('ecdsa-sha2-' + key.part.curve.data.toString()); else throw (new Error('Unknown key type ' + key.type)); } function read(partial, type, buf, options) { if (typeof (buf) === 'string') buf = new Buffer(buf); assert.buffer(buf, 'buf'); var key = {}; var parts = key.parts = []; var sshbuf = new SSHBuffer({buffer: buf}); var alg = sshbuf.readString(); assert.ok(!sshbuf.atEnd(), 'key must have at least one part'); key.type = algToKeyType(alg); var partCount = algs.info[key.type].parts.length; if (type && type === 'private') partCount = algs.privInfo[key.type].parts.length; while (!sshbuf.atEnd() && parts.length < partCount) parts.push(sshbuf.readPart()); while (!partial && !sshbuf.atEnd()) parts.push(sshbuf.readPart()); assert.ok(parts.length >= 1, 'key must have at least one part'); assert.ok(partial || sshbuf.atEnd(), 'leftover bytes at end of key'); var Constructor = Key; var algInfo = algs.info[key.type]; if (type === 'private' || algInfo.parts.length !== parts.length) { algInfo = algs.privInfo[key.type]; Constructor = PrivateKey; } assert.strictEqual(algInfo.parts.length, parts.length); if (key.type === 'ecdsa') { var res = /^ecdsa-sha2-(.+)$/.exec(alg); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } var normalized = true; for (var i = 0; i < algInfo.parts.length; ++i) { var p = parts[i]; p.name = algInfo.parts[i]; /* * OpenSSH stores ed25519 "private" keys as seed + public key * concat'd together (k followed by A). We want to keep them * separate for other formats that don't do this. */ if (key.type === 'ed25519' && p.name === 'k') p.data = p.data.slice(0, 32); if (p.name !== 'curve' && algInfo.normalize !== false) { var nd; if (key.type === 'ed25519') { nd = utils.zeroPadToLength(p.data, 32); } else { nd = utils.mpNormalize(p.data); } if (nd.toString('binary') !== p.data.toString('binary')) { p.data = nd; normalized = false; } } } if (normalized) key._rfc4253Cache = sshbuf.toBuffer(); if (partial && typeof (partial) === 'object') { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Constructor(key)); } function write(key, options) { assert.object(key); var alg = keyTypeToAlg(key); var i; var algInfo = algs.info[key.type]; if (PrivateKey.isPrivateKey(key)) algInfo = algs.privInfo[key.type]; var parts = algInfo.parts; var buf = new SSHBuffer({}); buf.writeString(alg); for (i = 0; i < parts.length; ++i) { var data = key.part[parts[i]].data; if (algInfo.normalize !== false) { if (key.type === 'ed25519') data = utils.zeroPadToLength(data, 32); else data = utils.mpNormalize(data); } if (key.type === 'ed25519' && parts[i] === 'k') data = Buffer.concat([data, key.part.A.data]); buf.writeBuffer(data); } return (buf.toBuffer()); } /***/ }), /* 28 */ /***/ (function(module, exports, __webpack_require__) { try { var util = __webpack_require__(1); if (typeof util.inherits !== 'function') throw ''; module.exports = util.inherits; } catch (e) { module.exports = __webpack_require__(305); } /***/ }), /* 29 */ /***/ (function(module, exports) { // Copyright Joyent, Inc. and other Node contributors. // // Permission is hereby granted, free of charge, to any person obtaining a // copy of this software and associated documentation files (the // "Software"), to deal in the Software without restriction, including // without limitation the rights to use, copy, modify, merge, publish, // distribute, sublicense, and/or sell copies of the Software, and to permit // persons to whom the Software is furnished to do so, subject to the // following conditions: // // The above copyright notice and this permission notice shall be included // in all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE // USE OR OTHER DEALINGS IN THE SOFTWARE. // NOTE: These type checking functions intentionally don't use `instanceof` // because it is fragile and can be easily faked with `Object.create()`. function isArray(arg) { if (Array.isArray) { return Array.isArray(arg); } return objectToString(arg) === '[object Array]'; } exports.isArray = isArray; function isBoolean(arg) { return typeof arg === 'boolean'; } exports.isBoolean = isBoolean; function isNull(arg) { return arg === null; } exports.isNull = isNull; function isNullOrUndefined(arg) { return arg == null; } exports.isNullOrUndefined = isNullOrUndefined; function isNumber(arg) { return typeof arg === 'number'; } exports.isNumber = isNumber; function isString(arg) { return typeof arg === 'string'; } exports.isString = isString; function isSymbol(arg) { return typeof arg === 'symbol'; } exports.isSymbol = isSymbol; function isUndefined(arg) { return arg === void 0; } exports.isUndefined = isUndefined; function isRegExp(re) { return objectToString(re) === '[object RegExp]'; } exports.isRegExp = isRegExp; function isObject(arg) { return typeof arg === 'object' && arg !== null; } exports.isObject = isObject; function isDate(d) { return objectToString(d) === '[object Date]'; } exports.isDate = isDate; function isError(e) { return (objectToString(e) === '[object Error]' || e instanceof Error); } exports.isError = isError; function isFunction(arg) { return typeof arg === 'function'; } exports.isFunction = isFunction; function isPrimitive(arg) { return arg === null || typeof arg === 'boolean' || typeof arg === 'number' || typeof arg === 'string' || typeof arg === 'symbol' || // ES6 symbol typeof arg === 'undefined'; } exports.isPrimitive = isPrimitive; exports.isBuffer = Buffer.isBuffer; function objectToString(o) { return Object.prototype.toString.call(o); } /***/ }), /* 30 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; // Copyright Joyent, Inc. and other Node contributors. // // Permission is hereby granted, free of charge, to any person obtaining a // copy of this software and associated documentation files (the // "Software"), to deal in the Software without restriction, including // without limitation the rights to use, copy, modify, merge, publish, // distribute, sublicense, and/or sell copies of the Software, and to permit // persons to whom the Software is furnished to do so, subject to the // following conditions: // // The above copyright notice and this permission notice shall be included // in all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE // USE OR OTHER DEALINGS IN THE SOFTWARE. // a duplex stream is just a stream that is both readable and writable. // Since JS doesn't have multiple prototypal inheritance, this class // prototypally inherits from Readable, and then parasitically from // Writable. /**/ var pna = __webpack_require__(49); /**/ /**/ var objectKeys = Object.keys || function (obj) { var keys = []; for (var key in obj) { keys.push(key); }return keys; }; /**/ module.exports = Duplex; /**/ var util = __webpack_require__(29); util.inherits = __webpack_require__(28); /**/ var Readable = __webpack_require__(114); var Writable = __webpack_require__(117); util.inherits(Duplex, Readable); var keys = objectKeys(Writable.prototype); for (var v = 0; v < keys.length; v++) { var method = keys[v]; if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method]; } function Duplex(options) { if (!(this instanceof Duplex)) return new Duplex(options); Readable.call(this, options); Writable.call(this, options); if (options && options.readable === false) this.readable = false; if (options && options.writable === false) this.writable = false; this.allowHalfOpen = true; if (options && options.allowHalfOpen === false) this.allowHalfOpen = false; this.once('end', onend); } // the no-half-open enforcer function onend() { // if we allow half-open state, or if the writable side ended, // then we're ok. if (this.allowHalfOpen || this._writableState.ended) return; // no more data can be written. // But allow more writes to happen in this tick. pna.nextTick(onEndNT, this); } function onEndNT(self) { self.end(); } Object.defineProperty(Duplex.prototype, 'destroyed', { get: function () { if (this._readableState === undefined || this._writableState === undefined) { return false; } return this._readableState.destroyed && this._writableState.destroyed; }, set: function (value) { // we ignore the value if the stream // has not been initialized yet if (this._readableState === undefined || this._writableState === undefined) { return; } // backward compatibility, the user is explicitly // managing destroyed this._readableState.destroyed = value; this._writableState.destroyed = value; } }); Duplex.prototype._destroy = function (err, cb) { this.push(null); this.end(); pna.nextTick(cb, err); }; function forEach(xs, f) { for (var i = 0, l = xs.length; i < l; i++) { f(xs[i], i); } } /***/ }), /* 31 */ /***/ (function(module, exports) { var isES5 = (function(){ "use strict"; return this === undefined; })(); if (isES5) { module.exports = { freeze: Object.freeze, defineProperty: Object.defineProperty, getDescriptor: Object.getOwnPropertyDescriptor, keys: Object.keys, names: Object.getOwnPropertyNames, getPrototypeOf: Object.getPrototypeOf, isArray: Array.isArray, isES5: isES5, propertyIsWritable: function(obj, prop) { var descriptor = Object.getOwnPropertyDescriptor(obj, prop); return !!(!descriptor || descriptor.writable || descriptor.set); } }; } else { var has = {}.hasOwnProperty; var str = {}.toString; var proto = {}.constructor.prototype; var ObjectKeys = function (o) { var ret = []; for (var key in o) { if (has.call(o, key)) { ret.push(key); } } return ret; }; var ObjectGetDescriptor = function(o, key) { return {value: o[key]}; }; var ObjectDefineProperty = function (o, key, desc) { o[key] = desc.value; return o; }; var ObjectFreeze = function (obj) { return obj; }; var ObjectGetPrototypeOf = function (obj) { try { return Object(obj).constructor.prototype; } catch (e) { return proto; } }; var ArrayIsArray = function (obj) { try { return str.call(obj) === "[object Array]"; } catch(e) { return false; } }; module.exports = { isArray: ArrayIsArray, keys: ObjectKeys, names: ObjectKeys, defineProperty: ObjectDefineProperty, getDescriptor: ObjectGetDescriptor, freeze: ObjectFreeze, getPrototypeOf: ObjectGetPrototypeOf, isES5: isES5, propertyIsWritable: function() { return true; } }; } /***/ }), /* 32 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; module.exports = { copy: copy, checkDataType: checkDataType, checkDataTypes: checkDataTypes, coerceToTypes: coerceToTypes, toHash: toHash, getProperty: getProperty, escapeQuotes: escapeQuotes, equal: __webpack_require__(82), ucs2length: __webpack_require__(444), varOccurences: varOccurences, varReplace: varReplace, cleanUpCode: cleanUpCode, finalCleanUpCode: finalCleanUpCode, schemaHasRules: schemaHasRules, schemaHasRulesExcept: schemaHasRulesExcept, toQuotedString: toQuotedString, getPathExpr: getPathExpr, getPath: getPath, getData: getData, unescapeFragment: unescapeFragment, unescapeJsonPointer: unescapeJsonPointer, escapeFragment: escapeFragment, escapeJsonPointer: escapeJsonPointer }; function copy(o, to) { to = to || {}; for (var key in o) to[key] = o[key]; return to; } function checkDataType(dataType, data, negate) { var EQUAL = negate ? ' !== ' : ' === ' , AND = negate ? ' || ' : ' && ' , OK = negate ? '!' : '' , NOT = negate ? '' : '!'; switch (dataType) { case 'null': return data + EQUAL + 'null'; case 'array': return OK + 'Array.isArray(' + data + ')'; case 'object': return '(' + OK + data + AND + 'typeof ' + data + EQUAL + '"object"' + AND + NOT + 'Array.isArray(' + data + '))'; case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + NOT + '(' + data + ' % 1)' + AND + data + EQUAL + data + ')'; default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; } } function checkDataTypes(dataTypes, data) { switch (dataTypes.length) { case 1: return checkDataType(dataTypes[0], data, true); default: var code = ''; var types = toHash(dataTypes); if (types.array && types.object) { code = types.null ? '(': '(!' + data + ' || '; code += 'typeof ' + data + ' !== "object")'; delete types.null; delete types.array; delete types.object; } if (types.number) delete types.integer; for (var t in types) code += (code ? ' && ' : '' ) + checkDataType(t, data, true); return code; } } var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); function coerceToTypes(optionCoerceTypes, dataTypes) { if (Array.isArray(dataTypes)) { var types = []; for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); return paths[lvl - up]; } if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); data = 'data' + ((lvl - up) || ''); if (!jsonPointer) return data; } var expr = data; var segments = jsonPointer.split('/'); for (var i=0; i { let result; if (key) { result = []; const index = new Set(); array.forEach((item) => { const identifier = item[key]; if (!index.has(identifier)) { index.add(identifier); result.push(item); } }); } else { result = Array.from(new Set(array)); } return result; }; // Convert array into object exports.mapToObject = function (array, key) { if (!array) { return null; } const obj = {}; for (let i = 0; i < array.length; ++i) { if (key) { if (array[i][key]) { obj[array[i][key]] = true; } } else { obj[array[i]] = true; } } return obj; }; // Find the common unique items in two arrays exports.intersect = function (array1, array2, justFirst) { if (!array1 || !array2) { return []; } const common = []; const hash = (Array.isArray(array1) ? exports.mapToObject(array1) : array1); const found = {}; for (let i = 0; i < array2.length; ++i) { if (hash[array2[i]] && !found[array2[i]]) { if (justFirst) { return array2[i]; } common.push(array2[i]); found[array2[i]] = true; } } return (justFirst ? null : common); }; // Test if the reference contains the values exports.contain = function (ref, values, options) { /* string -> string(s) array -> item(s) object -> key(s) object -> object (key:value) */ let valuePairs = null; if (typeof ref === 'object' && typeof values === 'object' && !Array.isArray(ref) && !Array.isArray(values)) { valuePairs = values; values = Object.keys(values); } else { values = [].concat(values); } options = options || {}; // deep, once, only, part exports.assert(arguments.length >= 2, 'Insufficient arguments'); exports.assert(typeof ref === 'string' || typeof ref === 'object', 'Reference must be string or an object'); exports.assert(values.length, 'Values array cannot be empty'); let compare; let compareFlags; if (options.deep) { compare = exports.deepEqual; const hasOnly = options.hasOwnProperty('only'); const hasPart = options.hasOwnProperty('part'); compareFlags = { prototype: hasOnly ? options.only : hasPart ? !options.part : false, part: hasOnly ? !options.only : hasPart ? options.part : true }; } else { compare = (a, b) => a === b; } let misses = false; const matches = new Array(values.length); for (let i = 0; i < matches.length; ++i) { matches[i] = 0; } if (typeof ref === 'string') { let pattern = '('; for (let i = 0; i < values.length; ++i) { const value = values[i]; exports.assert(typeof value === 'string', 'Cannot compare string reference to non-string value'); pattern += (i ? '|' : '') + exports.escapeRegex(value); } const regex = new RegExp(pattern + ')', 'g'); const leftovers = ref.replace(regex, ($0, $1) => { const index = values.indexOf($1); ++matches[index]; return ''; // Remove from string }); misses = !!leftovers; } else if (Array.isArray(ref)) { for (let i = 0; i < ref.length; ++i) { let matched = false; for (let j = 0; j < values.length && matched === false; ++j) { matched = compare(values[j], ref[i], compareFlags) && j; } if (matched !== false) { ++matches[matched]; } else { misses = true; } } } else { const keys = Object.getOwnPropertyNames(ref); for (let i = 0; i < keys.length; ++i) { const key = keys[i]; const pos = values.indexOf(key); if (pos !== -1) { if (valuePairs && !compare(valuePairs[key], ref[key], compareFlags)) { return false; } ++matches[pos]; } else { misses = true; } } } let result = false; for (let i = 0; i < matches.length; ++i) { result = result || !!matches[i]; if ((options.once && matches[i] > 1) || (!options.part && !matches[i])) { return false; } } if (options.only && misses) { return false; } return result; }; // Flatten array exports.flatten = function (array, target) { const result = target || []; for (let i = 0; i < array.length; ++i) { if (Array.isArray(array[i])) { exports.flatten(array[i], result); } else { result.push(array[i]); } } return result; }; // Convert an object key chain string ('a.b.c') to reference (object[a][b][c]) exports.reach = function (obj, chain, options) { if (chain === false || chain === null || typeof chain === 'undefined') { return obj; } options = options || {}; if (typeof options === 'string') { options = { separator: options }; } const path = chain.split(options.separator || '.'); let ref = obj; for (let i = 0; i < path.length; ++i) { let key = path[i]; if (key[0] === '-' && Array.isArray(ref)) { key = key.slice(1, key.length); key = ref.length - key; } if (!ref || !((typeof ref === 'object' || typeof ref === 'function') && key in ref) || (typeof ref !== 'object' && options.functions === false)) { // Only object and function can have properties exports.assert(!options.strict || i + 1 === path.length, 'Missing segment', key, 'in reach path ', chain); exports.assert(typeof ref === 'object' || options.functions === true || typeof ref !== 'function', 'Invalid segment', key, 'in reach path ', chain); ref = options.default; break; } ref = ref[key]; } return ref; }; exports.reachTemplate = function (obj, template, options) { return template.replace(/{([^}]+)}/g, ($0, chain) => { const value = exports.reach(obj, chain, options); return (value === undefined || value === null ? '' : value); }); }; exports.formatStack = function (stack) { const trace = []; for (let i = 0; i < stack.length; ++i) { const item = stack[i]; trace.push([item.getFileName(), item.getLineNumber(), item.getColumnNumber(), item.getFunctionName(), item.isConstructor()]); } return trace; }; exports.formatTrace = function (trace) { const display = []; for (let i = 0; i < trace.length; ++i) { const row = trace[i]; display.push((row[4] ? 'new ' : '') + row[3] + ' (' + row[0] + ':' + row[1] + ':' + row[2] + ')'); } return display; }; exports.callStack = function (slice) { // http://code.google.com/p/v8/wiki/JavaScriptStackTraceApi const v8 = Error.prepareStackTrace; Error.prepareStackTrace = function (_, stack) { return stack; }; const capture = {}; Error.captureStackTrace(capture, this); // arguments.callee is not supported in strict mode so we use this and slice the trace of this off the result const stack = capture.stack; Error.prepareStackTrace = v8; const trace = exports.formatStack(stack); return trace.slice(1 + slice); }; exports.displayStack = function (slice) { const trace = exports.callStack(slice === undefined ? 1 : slice + 1); return exports.formatTrace(trace); }; exports.abortThrow = false; exports.abort = function (message, hideStack) { if (process.env.NODE_ENV === 'test' || exports.abortThrow === true) { throw new Error(message || 'Unknown error'); } let stack = ''; if (!hideStack) { stack = exports.displayStack(1).join('\n\t'); } console.log('ABORT: ' + message + '\n\t' + stack); process.exit(1); }; exports.assert = function (condition /*, msg1, msg2, msg3 */) { if (condition) { return; } if (arguments.length === 2 && arguments[1] instanceof Error) { throw arguments[1]; } let msgs = []; for (let i = 1; i < arguments.length; ++i) { if (arguments[i] !== '') { msgs.push(arguments[i]); // Avoids Array.slice arguments leak, allowing for V8 optimizations } } msgs = msgs.map((msg) => { return typeof msg === 'string' ? msg : msg instanceof Error ? msg.message : exports.stringify(msg); }); throw new Error(msgs.join(' ') || 'Unknown error'); }; exports.Timer = function () { this.ts = 0; this.reset(); }; exports.Timer.prototype.reset = function () { this.ts = Date.now(); }; exports.Timer.prototype.elapsed = function () { return Date.now() - this.ts; }; exports.Bench = function () { this.ts = 0; this.reset(); }; exports.Bench.prototype.reset = function () { this.ts = exports.Bench.now(); }; exports.Bench.prototype.elapsed = function () { return exports.Bench.now() - this.ts; }; exports.Bench.now = function () { const ts = process.hrtime(); return (ts[0] * 1e3) + (ts[1] / 1e6); }; // Escape string for Regex construction exports.escapeRegex = function (string) { // Escape ^$.*+-?=!:|\/()[]{}, return string.replace(/[\^\$\.\*\+\-\?\=\!\:\|\\\/\(\)\[\]\{\}\,]/g, '\\$&'); }; // Base64url (RFC 4648) encode exports.base64urlEncode = function (value, encoding) { exports.assert(typeof value === 'string' || Buffer.isBuffer(value), 'value must be string or buffer'); const buf = (Buffer.isBuffer(value) ? value : new Buffer(value, encoding || 'binary')); return buf.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/\=/g, ''); }; // Base64url (RFC 4648) decode exports.base64urlDecode = function (value, encoding) { if (typeof value !== 'string') { return new Error('Value not a string'); } if (!/^[\w\-]*$/.test(value)) { return new Error('Invalid character'); } const buf = new Buffer(value, 'base64'); return (encoding === 'buffer' ? buf : buf.toString(encoding || 'binary')); }; // Escape attribute value for use in HTTP header exports.escapeHeaderAttribute = function (attribute) { // Allowed value characters: !#$%&'()*+,-./:;<=>?@[]^_`{|}~ and space, a-z, A-Z, 0-9, \, " exports.assert(/^[ \w\!#\$%&'\(\)\*\+,\-\.\/\:;<\=>\?@\[\]\^`\{\|\}~\"\\]*$/.test(attribute), 'Bad attribute value (' + attribute + ')'); return attribute.replace(/\\/g, '\\\\').replace(/\"/g, '\\"'); // Escape quotes and slash }; exports.escapeHtml = function (string) { return Escape.escapeHtml(string); }; exports.escapeJavaScript = function (string) { return Escape.escapeJavaScript(string); }; exports.escapeJson = function (string) { return Escape.escapeJson(string); }; exports.nextTick = function (callback) { return function () { const args = arguments; process.nextTick(() => { callback.apply(null, args); }); }; }; exports.once = function (method) { if (method._hoekOnce) { return method; } let once = false; const wrapped = function () { if (!once) { once = true; method.apply(null, arguments); } }; wrapped._hoekOnce = true; return wrapped; }; exports.isInteger = Number.isSafeInteger; exports.ignore = function () { }; exports.inherits = Util.inherits; exports.format = Util.format; exports.transform = function (source, transform, options) { exports.assert(source === null || source === undefined || typeof source === 'object' || Array.isArray(source), 'Invalid source object: must be null, undefined, an object, or an array'); const separator = (typeof options === 'object' && options !== null) ? (options.separator || '.') : '.'; if (Array.isArray(source)) { const results = []; for (let i = 0; i < source.length; ++i) { results.push(exports.transform(source[i], transform, options)); } return results; } const result = {}; const keys = Object.keys(transform); for (let i = 0; i < keys.length; ++i) { const key = keys[i]; const path = key.split(separator); const sourcePath = transform[key]; exports.assert(typeof sourcePath === 'string', 'All mappings must be "." delineated strings'); let segment; let res = result; while (path.length > 1) { segment = path.shift(); if (!res[segment]) { res[segment] = {}; } res = res[segment]; } segment = path.shift(); res[segment] = exports.reach(source, sourcePath, options); } return result; }; exports.uniqueFilename = function (path, extension) { if (extension) { extension = extension[0] !== '.' ? '.' + extension : extension; } else { extension = ''; } path = Path.resolve(path); const name = [Date.now(), process.pid, Crypto.randomBytes(8).toString('hex')].join('-') + extension; return Path.join(path, name); }; exports.stringify = function () { try { return JSON.stringify.apply(null, arguments); } catch (err) { return '[Cannot display object: ' + err.message + ']'; } }; exports.shallow = function (source) { const target = {}; const keys = Object.keys(source); for (let i = 0; i < keys.length; ++i) { const key = keys[i]; target[key] = source[key]; } return target; }; /***/ }), /* 39 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = Fingerprint; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var errs = __webpack_require__(18); var Key = __webpack_require__(6); var Certificate = __webpack_require__(40); var utils = __webpack_require__(5); var FingerprintFormatError = errs.FingerprintFormatError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Fingerprint(opts) { assert.object(opts, 'options'); assert.string(opts.type, 'options.type'); assert.buffer(opts.hash, 'options.hash'); assert.string(opts.algorithm, 'options.algorithm'); this.algorithm = opts.algorithm.toLowerCase(); if (algs.hashAlgs[this.algorithm] !== true) throw (new InvalidAlgorithmError(this.algorithm)); this.hash = opts.hash; this.type = opts.type; } Fingerprint.prototype.toString = function (format) { if (format === undefined) { if (this.algorithm === 'md5') format = 'hex'; else format = 'base64'; } assert.string(format); switch (format) { case 'hex': return (addColons(this.hash.toString('hex'))); case 'base64': return (sshBase64Format(this.algorithm, this.hash.toString('base64'))); default: throw (new FingerprintFormatError(undefined, format)); } }; Fingerprint.prototype.matches = function (other) { assert.object(other, 'key or certificate'); if (this.type === 'key') { utils.assertCompatible(other, Key, [1, 0], 'key'); } else { utils.assertCompatible(other, Certificate, [1, 0], 'certificate'); } var theirHash = other.hash(this.algorithm); var theirHash2 = crypto.createHash(this.algorithm). update(theirHash).digest('base64'); if (this.hash2 === undefined) this.hash2 = crypto.createHash(this.algorithm). update(this.hash).digest('base64'); return (this.hash2 === theirHash2); }; Fingerprint.parse = function (fp, options) { assert.string(fp, 'fingerprint'); var alg, hash, enAlgs; if (Array.isArray(options)) { enAlgs = options; options = {}; } assert.optionalObject(options, 'options'); if (options === undefined) options = {}; if (options.enAlgs !== undefined) enAlgs = options.enAlgs; assert.optionalArrayOfString(enAlgs, 'algorithms'); var parts = fp.split(':'); if (parts.length == 2) { alg = parts[0].toLowerCase(); /*JSSTYLED*/ var base64RE = /^[A-Za-z0-9+\/=]+$/; if (!base64RE.test(parts[1])) throw (new FingerprintFormatError(fp)); try { hash = new Buffer(parts[1], 'base64'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else if (parts.length > 2) { alg = 'md5'; if (parts[0].toLowerCase() === 'md5') parts = parts.slice(1); parts = parts.join(''); /*JSSTYLED*/ var md5RE = /^[a-fA-F0-9]+$/; if (!md5RE.test(parts)) throw (new FingerprintFormatError(fp)); try { hash = new Buffer(parts, 'hex'); } catch (e) { throw (new FingerprintFormatError(fp)); } } if (alg === undefined) throw (new FingerprintFormatError(fp)); if (algs.hashAlgs[alg] === undefined) throw (new InvalidAlgorithmError(alg)); if (enAlgs !== undefined) { enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); if (enAlgs.indexOf(alg) === -1) throw (new InvalidAlgorithmError(alg)); } return (new Fingerprint({ algorithm: alg, hash: hash, type: options.type || 'key' })); }; function addColons(s) { /*JSSTYLED*/ return (s.replace(/(.{2})(?=.)/g, '$1:')); } function base64Strip(s) { /*JSSTYLED*/ return (s.replace(/=*$/, '')); } function sshBase64Format(alg, h) { return (alg.toUpperCase() + ':' + base64Strip(h)); } Fingerprint.isFingerprint = function (obj, ver) { return (utils.isCompatible(obj, Fingerprint, ver)); }; /* * API versions for Fingerprint: * [1,0] -- initial ver * [1,1] -- first tagged ver */ Fingerprint.prototype._sshpkApiVersion = [1, 1]; Fingerprint._oldVersionDetect = function (obj) { assert.func(obj.toString); assert.func(obj.matches); return ([1, 0]); }; /***/ }), /* 40 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2016 Joyent, Inc. module.exports = Certificate; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var Fingerprint = __webpack_require__(39); var Signature = __webpack_require__(19); var errs = __webpack_require__(18); var util = __webpack_require__(1); var utils = __webpack_require__(5); var Key = __webpack_require__(6); var PrivateKey = __webpack_require__(8); var Identity = __webpack_require__(44); var formats = {}; formats['openssh'] = __webpack_require__(416); formats['x509'] = __webpack_require__(151); formats['pem'] = __webpack_require__(417); var CertificateParseError = errs.CertificateParseError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Certificate(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.subjects, 'options.subjects'); utils.assertCompatible(opts.subjects[0], Identity, [1, 0], 'options.subjects'); utils.assertCompatible(opts.subjectKey, Key, [1, 0], 'options.subjectKey'); utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); if (opts.issuerKey !== undefined) { utils.assertCompatible(opts.issuerKey, Key, [1, 0], 'options.issuerKey'); } assert.object(opts.signatures, 'options.signatures'); assert.buffer(opts.serial, 'options.serial'); assert.date(opts.validFrom, 'options.validFrom'); assert.date(opts.validUntil, 'optons.validUntil'); assert.optionalArrayOfString(opts.purposes, 'options.purposes'); this._hashCache = {}; this.subjects = opts.subjects; this.issuer = opts.issuer; this.subjectKey = opts.subjectKey; this.issuerKey = opts.issuerKey; this.signatures = opts.signatures; this.serial = opts.serial; this.validFrom = opts.validFrom; this.validUntil = opts.validUntil; this.purposes = opts.purposes; } Certificate.formats = formats; Certificate.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'x509'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; Certificate.prototype.toString = function (format, options) { if (format === undefined) format = 'pem'; return (this.toBuffer(format, options).toString()); }; Certificate.prototype.fingerprint = function (algo) { if (algo === undefined) algo = 'sha256'; assert.string(algo, 'algorithm'); var opts = { type: 'certificate', hash: this.hash(algo), algorithm: algo }; return (new Fingerprint(opts)); }; Certificate.prototype.hash = function (algo) { assert.string(algo, 'algorithm'); algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); if (this._hashCache[algo]) return (this._hashCache[algo]); var hash = crypto.createHash(algo). update(this.toBuffer('x509')).digest(); this._hashCache[algo] = hash; return (hash); }; Certificate.prototype.isExpired = function (when) { if (when === undefined) when = new Date(); return (!((when.getTime() >= this.validFrom.getTime()) && (when.getTime() < this.validUntil.getTime()))); }; Certificate.prototype.isSignedBy = function (issuerCert) { utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); if (!this.issuer.equals(issuerCert.subjects[0])) return (false); if (this.issuer.purposes && this.issuer.purposes.length > 0 && this.issuer.purposes.indexOf('ca') === -1) { return (false); } return (this.isSignedByKey(issuerCert.subjectKey)); }; Certificate.prototype.isSignedByKey = function (issuerKey) { utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); if (this.issuerKey !== undefined) { return (this.issuerKey. fingerprint('sha512').matches(issuerKey)); } var fmt = Object.keys(this.signatures)[0]; var valid = formats[fmt].verify(this, issuerKey); if (valid) this.issuerKey = issuerKey; return (valid); }; Certificate.prototype.signWith = function (key) { utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); var fmts = Object.keys(formats); var didOne = false; for (var i = 0; i < fmts.length; ++i) { if (fmts[i] !== 'pem') { var ret = formats[fmts[i]].sign(this, key); if (ret === true) didOne = true; } } if (!didOne) { throw (new Error('Failed to sign the certificate for any ' + 'available certificate formats')); } }; Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = new Buffer('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); /* Self-signed certs are always CAs. */ if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); /* * If we weren't explicitly given any other purposes, do the sensible * thing and add some basic ones depending on the subject type. */ if (purposes.length <= 3) { var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } } var cert = new Certificate({ subjects: subjects, issuer: subjects[0], subjectKey: key.toPublic(), issuerKey: key.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(key); return (cert); }; Certificate.create = function (subjectOrSubjects, key, issuer, issuerKey, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, Key, [1, 0], 'key'); if (PrivateKey.isPrivateKey(key)) key = key.toPublic(); utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = new Buffer('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); if (options.ca === true) { if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); } var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } var cert = new Certificate({ subjects: subjects, issuer: issuer, subjectKey: key, issuerKey: issuerKey.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(issuerKey); return (cert); }; Certificate.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); return (k); } catch (e) { throw (new CertificateParseError(options.filename, format, e)); } }; Certificate.isCertificate = function (obj, ver) { return (utils.isCompatible(obj, Certificate, ver)); }; /* * API versions for Certificate: * [1,0] -- initial ver */ Certificate.prototype._sshpkApiVersion = [1, 0]; Certificate._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), /* 41 */ /***/ (function(module, exports, __webpack_require__) { // Basic Javascript Elliptic Curve implementation // Ported loosely from BouncyCastle's Java EC code // Only Fp curves implemented for now // Requires jsbn.js and jsbn2.js var BigInteger = __webpack_require__(25).BigInteger var Barrett = BigInteger.prototype.Barrett // ---------------- // ECFieldElementFp // constructor function ECFieldElementFp(q,x) { this.x = x; // TODO if(x.compareTo(q) >= 0) error this.q = q; } function feFpEquals(other) { if(other == this) return true; return (this.q.equals(other.q) && this.x.equals(other.x)); } function feFpToBigInteger() { return this.x; } function feFpNegate() { return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); } function feFpAdd(b) { return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); } function feFpSubtract(b) { return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); } function feFpMultiply(b) { return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); } function feFpSquare() { return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); } function feFpDivide(b) { return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); } ECFieldElementFp.prototype.equals = feFpEquals; ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; ECFieldElementFp.prototype.negate = feFpNegate; ECFieldElementFp.prototype.add = feFpAdd; ECFieldElementFp.prototype.subtract = feFpSubtract; ECFieldElementFp.prototype.multiply = feFpMultiply; ECFieldElementFp.prototype.square = feFpSquare; ECFieldElementFp.prototype.divide = feFpDivide; // ---------------- // ECPointFp // constructor function ECPointFp(curve,x,y,z) { this.curve = curve; this.x = x; this.y = y; // Projective coordinates: either zinv == null or z * zinv == 1 // z and zinv are just BigIntegers, not fieldElements if(z == null) { this.z = BigInteger.ONE; } else { this.z = z; } this.zinv = null; //TODO: compression flag } function pointFpGetX() { if(this.zinv == null) { this.zinv = this.z.modInverse(this.curve.q); } var r = this.x.toBigInteger().multiply(this.zinv); this.curve.reduce(r); return this.curve.fromBigInteger(r); } function pointFpGetY() { if(this.zinv == null) { this.zinv = this.z.modInverse(this.curve.q); } var r = this.y.toBigInteger().multiply(this.zinv); this.curve.reduce(r); return this.curve.fromBigInteger(r); } function pointFpEquals(other) { if(other == this) return true; if(this.isInfinity()) return other.isInfinity(); if(other.isInfinity()) return this.isInfinity(); var u, v; // u = Y2 * Z1 - Y1 * Z2 u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); if(!u.equals(BigInteger.ZERO)) return false; // v = X2 * Z1 - X1 * Z2 v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); return v.equals(BigInteger.ZERO); } function pointFpIsInfinity() { if((this.x == null) && (this.y == null)) return true; return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); } function pointFpNegate() { return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); } function pointFpAdd(b) { if(this.isInfinity()) return b; if(b.isInfinity()) return this; // u = Y2 * Z1 - Y1 * Z2 var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); // v = X2 * Z1 - X1 * Z2 var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); if(BigInteger.ZERO.equals(v)) { if(BigInteger.ZERO.equals(u)) { return this.twice(); // this == b, so double } return this.curve.getInfinity(); // this = -b, so infinity } var THREE = new BigInteger("3"); var x1 = this.x.toBigInteger(); var y1 = this.y.toBigInteger(); var x2 = b.x.toBigInteger(); var y2 = b.y.toBigInteger(); var v2 = v.square(); var v3 = v2.multiply(v); var x1v2 = x1.multiply(v2); var zu2 = u.square().multiply(this.z); // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); // z3 = v^3 * z1 * z2 var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); } function pointFpTwice() { if(this.isInfinity()) return this; if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); // TODO: optimized handling of constants var THREE = new BigInteger("3"); var x1 = this.x.toBigInteger(); var y1 = this.y.toBigInteger(); var y1z1 = y1.multiply(this.z); var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); var a = this.curve.a.toBigInteger(); // w = 3 * x1^2 + a * z1^2 var w = x1.square().multiply(THREE); if(!BigInteger.ZERO.equals(a)) { w = w.add(this.z.square().multiply(a)); } w = w.mod(this.curve.q); //this.curve.reduce(w); // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); // z3 = 8 * (y1 * z1)^3 var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); } // Simple NAF (Non-Adjacent Form) multiplication algorithm // TODO: modularize the multiplication algorithm function pointFpMultiply(k) { if(this.isInfinity()) return this; if(k.signum() == 0) return this.curve.getInfinity(); var e = k; var h = e.multiply(new BigInteger("3")); var neg = this.negate(); var R = this; var i; for(i = h.bitLength() - 2; i > 0; --i) { R = R.twice(); var hBit = h.testBit(i); var eBit = e.testBit(i); if (hBit != eBit) { R = R.add(hBit ? this : neg); } } return R; } // Compute this*j + x*k (simultaneous multiplication) function pointFpMultiplyTwo(j,x,k) { var i; if(j.bitLength() > k.bitLength()) i = j.bitLength() - 1; else i = k.bitLength() - 1; var R = this.curve.getInfinity(); var both = this.add(x); while(i >= 0) { R = R.twice(); if(j.testBit(i)) { if(k.testBit(i)) { R = R.add(both); } else { R = R.add(this); } } else { if(k.testBit(i)) { R = R.add(x); } } --i; } return R; } ECPointFp.prototype.getX = pointFpGetX; ECPointFp.prototype.getY = pointFpGetY; ECPointFp.prototype.equals = pointFpEquals; ECPointFp.prototype.isInfinity = pointFpIsInfinity; ECPointFp.prototype.negate = pointFpNegate; ECPointFp.prototype.add = pointFpAdd; ECPointFp.prototype.twice = pointFpTwice; ECPointFp.prototype.multiply = pointFpMultiply; ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; // ---------------- // ECCurveFp // constructor function ECCurveFp(q,a,b) { this.q = q; this.a = this.fromBigInteger(a); this.b = this.fromBigInteger(b); this.infinity = new ECPointFp(this, null, null); this.reducer = new Barrett(this.q); } function curveFpGetQ() { return this.q; } function curveFpGetA() { return this.a; } function curveFpGetB() { return this.b; } function curveFpEquals(other) { if(other == this) return true; return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); } function curveFpGetInfinity() { return this.infinity; } function curveFpFromBigInteger(x) { return new ECFieldElementFp(this.q, x); } function curveReduce(x) { this.reducer.reduce(x); } // for now, work with hex strings because they're easier in JS function curveFpDecodePointHex(s) { switch(parseInt(s.substr(0,2), 16)) { // first byte case 0: return this.infinity; case 2: case 3: // point compression not supported yet return null; case 4: case 6: case 7: var len = (s.length - 2) / 2; var xHex = s.substr(2, len); var yHex = s.substr(len+2, len); return new ECPointFp(this, this.fromBigInteger(new BigInteger(xHex, 16)), this.fromBigInteger(new BigInteger(yHex, 16))); default: // unsupported return null; } } function curveFpEncodePointHex(p) { if (p.isInfinity()) return "00"; var xHex = p.getX().toBigInteger().toString(16); var yHex = p.getY().toBigInteger().toString(16); var oLen = this.getQ().toString(16).length; if ((oLen % 2) != 0) oLen++; while (xHex.length < oLen) { xHex = "0" + xHex; } while (yHex.length < oLen) { yHex = "0" + yHex; } return "04" + xHex + yHex; } ECCurveFp.prototype.getQ = curveFpGetQ; ECCurveFp.prototype.getA = curveFpGetA; ECCurveFp.prototype.getB = curveFpGetB; ECCurveFp.prototype.equals = curveFpEquals; ECCurveFp.prototype.getInfinity = curveFpGetInfinity; ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; ECCurveFp.prototype.reduce = curveReduce; //ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; // from: https://github.com/kaielvin/jsbn-ec-point-compression ECCurveFp.prototype.decodePointHex = function(s) { var yIsEven; switch(parseInt(s.substr(0,2), 16)) { // first byte case 0: return this.infinity; case 2: yIsEven = false; case 3: if(yIsEven == undefined) yIsEven = true; var len = s.length - 2; var xHex = s.substr(2, len); var x = this.fromBigInteger(new BigInteger(xHex,16)); var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); var beta = alpha.sqrt(); if (beta == null) throw "Invalid point compression"; var betaValue = beta.toBigInteger(); if (betaValue.testBit(0) != yIsEven) { // Use the other root beta = this.fromBigInteger(this.getQ().subtract(betaValue)); } return new ECPointFp(this,x,beta); case 4: case 6: case 7: var len = (s.length - 2) / 2; var xHex = s.substr(2, len); var yHex = s.substr(len+2, len); return new ECPointFp(this, this.fromBigInteger(new BigInteger(xHex, 16)), this.fromBigInteger(new BigInteger(yHex, 16))); default: // unsupported return null; } } ECCurveFp.prototype.encodeCompressedPointHex = function(p) { if (p.isInfinity()) return "00"; var xHex = p.getX().toBigInteger().toString(16); var oLen = this.getQ().toString(16).length; if ((oLen % 2) != 0) oLen++; while (xHex.length < oLen) xHex = "0" + xHex; var yPrefix; if(p.getY().toBigInteger().isEven()) yPrefix = "02"; else yPrefix = "03"; return yPrefix + xHex; } ECFieldElementFp.prototype.getR = function() { if(this.r != undefined) return this.r; this.r = null; var bitLength = this.q.bitLength(); if (bitLength > 128) { var firstWord = this.q.shiftRight(bitLength - 64); if (firstWord.intValue() == -1) { this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); } } return this.r; } ECFieldElementFp.prototype.modMult = function(x1,x2) { return this.modReduce(x1.multiply(x2)); } ECFieldElementFp.prototype.modReduce = function(x) { if (this.getR() != null) { var qLen = q.bitLength(); while (x.bitLength() > (qLen + 1)) { var u = x.shiftRight(qLen); var v = x.subtract(u.shiftLeft(qLen)); if (!this.getR().equals(BigInteger.ONE)) { u = u.multiply(this.getR()); } x = u.add(v); } while (x.compareTo(q) >= 0) { x = x.subtract(q); } } else { x = x.mod(q); } return x; } ECFieldElementFp.prototype.sqrt = function() { if (!this.q.testBit(0)) throw "unsupported"; // p mod 4 == 3 if (this.q.testBit(1)) { var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); return z.square().equals(this) ? z : null; } // p mod 4 == 1 var qMinusOne = this.q.subtract(BigInteger.ONE); var legendreExponent = qMinusOne.shiftRight(1); if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) { return null; } var u = qMinusOne.shiftRight(2); var k = u.shiftLeft(1).add(BigInteger.ONE); var Q = this.x; var fourQ = modDouble(modDouble(Q)); var U, V; do { var P; do { P = new BigInteger(this.q.bitLength(), new SecureRandom()); } while (P.compareTo(this.q) >= 0 || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); var result = this.lucasSequence(P, Q, k); U = result[0]; V = result[1]; if (this.modMult(V, V).equals(fourQ)) { // Integer division by 2, mod q if (V.testBit(0)) { V = V.add(q); } V = V.shiftRight(1); return new ECFieldElementFp(q,V); } } while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); return null; } ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) { var n = k.bitLength(); var s = k.getLowestSetBit(); var Uh = BigInteger.ONE; var Vl = BigInteger.TWO; var Vh = P; var Ql = BigInteger.ONE; var Qh = BigInteger.ONE; for (var j = n - 1; j >= s + 1; --j) { Ql = this.modMult(Ql, Qh); if (k.testBit(j)) { Qh = this.modMult(Ql, Q); Uh = this.modMult(Uh, Vh); Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); } else { Qh = Ql; Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); } } Ql = this.modMult(Ql, Qh); Qh = this.modMult(Ql, Q); Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Ql = this.modMult(Ql, Qh); for (var j = 1; j <= s; ++j) { Uh = this.modMult(Uh, Vl); Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); Ql = this.modMult(Ql, Ql); } return [ Uh, Vl ]; } var exports = { ECCurveFp: ECCurveFp, ECPointFp: ECPointFp, ECFieldElementFp: ECFieldElementFp } module.exports = exports /***/ }), /* 42 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readPkcs8: readPkcs8, write: write, writePkcs8: writePkcs8, readECDSACurve: readECDSACurve, writeECDSACurve: writeECDSACurve }; var assert = __webpack_require__(2); var asn1 = __webpack_require__(21); var algs = __webpack_require__(7); var utils = __webpack_require__(5); var Key = __webpack_require__(6); var PrivateKey = __webpack_require__(8); var pem = __webpack_require__(26); function read(buf, options) { return (pem.read(buf, options, 'pkcs8')); } function write(key, options) { return (pem.write(key, options, 'pkcs8')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs8(alg, type, der) { /* Private keys in pkcs#8 format have a weird extra int */ if (der.peek() === asn1.Ber.Integer) { assert.strictEqual(type, 'private', 'unexpected Integer at start of public key'); der.readString(asn1.Ber.Integer, true); } der.readSequence(); var next = der.offset + der.length; var oid = der.readOID(); switch (oid) { case '1.2.840.113549.1.1.1': der._offset = next; if (type === 'public') return (readPkcs8RSAPublic(der)); else return (readPkcs8RSAPrivate(der)); case '1.2.840.10040.4.1': if (type === 'public') return (readPkcs8DSAPublic(der)); else return (readPkcs8DSAPrivate(der)); case '1.2.840.10045.2.1': if (type === 'public') return (readPkcs8ECDSAPublic(der)); else return (readPkcs8ECDSAPrivate(der)); case '1.3.101.112': if (type === 'public') { return (readPkcs8EdDSAPublic(der)); } else { return (readPkcs8EdDSAPrivate(der)); } case '1.3.101.110': if (type === 'public') { return (readPkcs8X25519Public(der)); } else { return (readPkcs8X25519Private(der)); } default: throw (new Error('Unknown key type OID ' + oid)); } } function readPkcs8RSAPublic(der) { // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); der.readSequence(); // modulus var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', source: der.originalInput, parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs8RSAPrivate(der) { der.readSequence(asn1.Ber.OctetString); der.readSequence(); var ver = readMPInt(der, 'version'); assert.equal(ver[0], 0x0, 'unknown RSA private key version'); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs8DSAPublic(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); var y = readMPInt(der, 'y'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y } ] }; return (new Key(key)); } function readPkcs8DSAPrivate(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); der.readSequence(asn1.Ber.OctetString); var x = readMPInt(der, 'x'); /* The pkcs#8 format does not include the public key */ var y = utils.calculateDSAPublic(g, p, x); var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readECDSACurve(der) { var curveName, curveNames; var j, c, cd; if (der.peek() === asn1.Ber.OID) { var oid = der.readOID(); curveNames = Object.keys(algs.curves); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; if (cd.pkcs8oid === oid) { curveName = c; break; } } } else { // ECParameters sequence der.readSequence(); var version = der.readString(asn1.Ber.Integer, true); assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); var curve = {}; // FieldID sequence der.readSequence(); var fieldTypeOid = der.readOID(); assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', 'ECDSA key is not from a prime-field'); var p = curve.p = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); /* * p always starts with a 1 bit, so count the zeros to get its * real size. */ curve.size = p.length * 8 - utils.countZeros(p); // Curve sequence der.readSequence(); curve.a = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); curve.b = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); if (der.peek() === asn1.Ber.BitString) curve.s = der.readString(asn1.Ber.BitString, true); // Combined Gx and Gy curve.G = der.readString(asn1.Ber.OctetString, true); assert.strictEqual(curve.G[0], 0x4, 'uncompressed G is required'); curve.n = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); curve.h = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + 'required'); curveNames = Object.keys(algs.curves); var ks = Object.keys(curve); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; var equal = true; for (var i = 0; i < ks.length; ++i) { var k = ks[i]; if (cd[k] === undefined) continue; if (typeof (cd[k]) === 'object' && cd[k].equals !== undefined) { if (!cd[k].equals(curve[k])) { equal = false; break; } } else if (Buffer.isBuffer(cd[k])) { if (cd[k].toString('binary') !== curve[k].toString('binary')) { equal = false; break; } } else { if (cd[k] !== curve[k]) { equal = false; break; } } } if (equal) { curveName = c; break; } } } return (curveName); } function readPkcs8ECDSAPrivate(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); der.readSequence(asn1.Ber.OctetString); der.readSequence(); var version = readMPInt(der, 'version'); assert.equal(version[0], 1, 'unknown version of ECDSA key'); var d = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa1); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: new Buffer(curveName) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function readPkcs8ECDSAPublic(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: new Buffer(curveName) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs8EdDSAPublic(der) { if (der.peek() === 0x00) der.readByte(); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8X25519Public(der) { var A = utils.readBitString(der); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8EdDSAPrivate(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A; if (der.peek() === asn1.Ber.BitString) { A = utils.readBitString(der); A = utils.zeroPadToLength(A, 32); } else { A = utils.calculateED25519Public(k); } var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function readPkcs8X25519Private(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A = utils.calculateX25519Public(k); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function writePkcs8(der, key) { der.startSequence(); if (PrivateKey.isPrivateKey(key)) { var sillyInt = new Buffer(1); sillyInt[0] = 0x0; der.writeBuffer(sillyInt, asn1.Ber.Integer); } der.startSequence(); switch (key.type) { case 'rsa': der.writeOID('1.2.840.113549.1.1.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8RSAPrivate(key, der); else writePkcs8RSAPublic(key, der); break; case 'dsa': der.writeOID('1.2.840.10040.4.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8DSAPrivate(key, der); else writePkcs8DSAPublic(key, der); break; case 'ecdsa': der.writeOID('1.2.840.10045.2.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8ECDSAPrivate(key, der); else writePkcs8ECDSAPublic(key, der); break; case 'ed25519': der.writeOID('1.3.101.112'); if (PrivateKey.isPrivateKey(key)) throw (new Error('Ed25519 private keys in pkcs8 ' + 'format are not supported')); writePkcs8EdDSAPublic(key, der); break; default: throw (new Error('Unsupported key type: ' + key.type)); } der.endSequence(); } function writePkcs8RSAPrivate(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = new Buffer(1); version[0] = 0; der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8RSAPublic(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.startSequence(); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8DSAPrivate(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); der.endSequence(); } function writePkcs8DSAPublic(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.endSequence(); } function writeECDSACurve(key, der) { var curve = algs.curves[key.curve]; if (curve.pkcs8oid) { /* This one has a name in pkcs#8, so just write the oid */ der.writeOID(curve.pkcs8oid); } else { // ECParameters sequence der.startSequence(); var version = new Buffer(1); version.writeUInt8(1, 0); der.writeBuffer(version, asn1.Ber.Integer); // FieldID sequence der.startSequence(); der.writeOID('1.2.840.10045.1.1'); // prime-field der.writeBuffer(curve.p, asn1.Ber.Integer); der.endSequence(); // Curve sequence der.startSequence(); var a = curve.p; if (a[0] === 0x0) a = a.slice(1); der.writeBuffer(a, asn1.Ber.OctetString); der.writeBuffer(curve.b, asn1.Ber.OctetString); der.writeBuffer(curve.s, asn1.Ber.BitString); der.endSequence(); der.writeBuffer(curve.G, asn1.Ber.OctetString); der.writeBuffer(curve.n, asn1.Ber.Integer); var h = curve.h; if (!h) { h = new Buffer(1); h[0] = 1; } der.writeBuffer(h, asn1.Ber.Integer); // ECParameters der.endSequence(); } } function writePkcs8ECDSAPublic(key, der) { writeECDSACurve(key, der); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs8ECDSAPrivate(key, der) { writeECDSACurve(key, der); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = new Buffer(1); version[0] = 1; der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); der.endSequence(); der.endSequence(); } function writePkcs8EdDSAPublic(key, der) { der.endSequence(); utils.writeBitString(der, key.part.A.data); } function writePkcs8EdDSAPrivate(key, der) { der.endSequence(); var k = utils.mpNormalize(key.part.k.data, true); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(k, asn1.Ber.OctetString); der.endSequence(); } /***/ }), /* 43 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = SSHBuffer; var assert = __webpack_require__(2); function SSHBuffer(opts) { assert.object(opts, 'options'); if (opts.buffer !== undefined) assert.buffer(opts.buffer, 'options.buffer'); this._size = opts.buffer ? opts.buffer.length : 1024; this._buffer = opts.buffer || (new Buffer(this._size)); this._offset = 0; } SSHBuffer.prototype.toBuffer = function () { return (this._buffer.slice(0, this._offset)); }; SSHBuffer.prototype.atEnd = function () { return (this._offset >= this._buffer.length); }; SSHBuffer.prototype.remainder = function () { return (this._buffer.slice(this._offset)); }; SSHBuffer.prototype.skip = function (n) { this._offset += n; }; SSHBuffer.prototype.expand = function () { this._size *= 2; var buf = new Buffer(this._size); this._buffer.copy(buf, 0); this._buffer = buf; }; SSHBuffer.prototype.readPart = function () { return ({data: this.readBuffer()}); }; SSHBuffer.prototype.readBuffer = function () { var len = this._buffer.readUInt32BE(this._offset); this._offset += 4; assert.ok(this._offset + len <= this._buffer.length, 'length out of bounds at +0x' + this._offset.toString(16) + ' (data truncated?)'); var buf = this._buffer.slice(this._offset, this._offset + len); this._offset += len; return (buf); }; SSHBuffer.prototype.readString = function () { return (this.readBuffer().toString()); }; SSHBuffer.prototype.readCString = function () { var offset = this._offset; while (offset < this._buffer.length && this._buffer[offset] !== 0x00) offset++; assert.ok(offset < this._buffer.length, 'c string does not terminate'); var str = this._buffer.slice(this._offset, offset).toString(); this._offset = offset + 1; return (str); }; SSHBuffer.prototype.readInt = function () { var v = this._buffer.readUInt32BE(this._offset); this._offset += 4; return (v); }; SSHBuffer.prototype.readInt64 = function () { assert.ok(this._offset + 8 < this._buffer.length, 'buffer not long enough to read Int64'); var v = this._buffer.slice(this._offset, this._offset + 8); this._offset += 8; return (v); }; SSHBuffer.prototype.readChar = function () { var v = this._buffer[this._offset++]; return (v); }; SSHBuffer.prototype.writeBuffer = function (buf) { while (this._offset + 4 + buf.length > this._size) this.expand(); this._buffer.writeUInt32BE(buf.length, this._offset); this._offset += 4; buf.copy(this._buffer, this._offset); this._offset += buf.length; }; SSHBuffer.prototype.writeString = function (str) { this.writeBuffer(new Buffer(str, 'utf8')); }; SSHBuffer.prototype.writeCString = function (str) { while (this._offset + 1 + str.length > this._size) this.expand(); this._buffer.write(str, this._offset); this._offset += str.length; this._buffer[this._offset++] = 0; }; SSHBuffer.prototype.writeInt = function (v) { while (this._offset + 4 > this._size) this.expand(); this._buffer.writeUInt32BE(v, this._offset); this._offset += 4; }; SSHBuffer.prototype.writeInt64 = function (v) { assert.buffer(v, 'value'); if (v.length > 8) { var lead = v.slice(0, v.length - 8); for (var i = 0; i < lead.length; ++i) { assert.strictEqual(lead[i], 0, 'must fit in 64 bits of precision'); } v = v.slice(v.length - 8, v.length); } while (this._offset + 8 > this._size) this.expand(); v.copy(this._buffer, this._offset); this._offset += 8; }; SSHBuffer.prototype.writeChar = function (v) { while (this._offset + 1 > this._size) this.expand(); this._buffer[this._offset++] = v; }; SSHBuffer.prototype.writePart = function (p) { this.writeBuffer(p.data); }; SSHBuffer.prototype.write = function (buf) { while (this._offset + buf.length > this._size) this.expand(); buf.copy(this._buffer, this._offset); this._offset += buf.length; }; /***/ }), /* 44 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Identity; var assert = __webpack_require__(2); var algs = __webpack_require__(7); var crypto = __webpack_require__(4); var Fingerprint = __webpack_require__(39); var Signature = __webpack_require__(19); var errs = __webpack_require__(18); var util = __webpack_require__(1); var utils = __webpack_require__(5); var asn1 = __webpack_require__(21); /*JSSTYLED*/ var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; var oids = {}; oids.cn = '2.5.4.3'; oids.o = '2.5.4.10'; oids.ou = '2.5.4.11'; oids.l = '2.5.4.7'; oids.s = '2.5.4.8'; oids.c = '2.5.4.6'; oids.sn = '2.5.4.4'; oids.dc = '0.9.2342.19200300.100.1.25'; oids.uid = '0.9.2342.19200300.100.1.1'; oids.mail = '0.9.2342.19200300.100.1.3'; var unoids = {}; Object.keys(oids).forEach(function (k) { unoids[oids[k]] = k; }); function Identity(opts) { var self = this; assert.object(opts, 'options'); assert.arrayOfObject(opts.components, 'options.components'); this.components = opts.components; this.componentLookup = {}; this.components.forEach(function (c) { if (c.name && !c.oid) c.oid = oids[c.name]; if (c.oid && !c.name) c.name = unoids[c.oid]; if (self.componentLookup[c.name] === undefined) self.componentLookup[c.name] = []; self.componentLookup[c.name].push(c); }); if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { this.cn = this.componentLookup.cn[0].value; } assert.optionalString(opts.type, 'options.type'); if (opts.type === undefined) { if (this.components.length === 1 && this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.dc && this.components.length === this.componentLookup.dc.length) { this.type = 'host'; this.hostname = this.componentLookup.dc.map( function (c) { return (c.value); }).join('.'); } else if (this.componentLookup.uid && this.components.length === this.componentLookup.uid.length) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.uid && this.componentLookup.uid.length === 1) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.mail && this.componentLookup.mail.length === 1) { this.type = 'email'; this.email = this.componentLookup.mail[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1) { this.type = 'user'; this.uid = this.componentLookup.cn[0].value; } else { this.type = 'unknown'; } } else { this.type = opts.type; if (this.type === 'host') this.hostname = opts.hostname; else if (this.type === 'user') this.uid = opts.uid; else if (this.type === 'email') this.email = opts.email; else throw (new Error('Unknown type ' + this.type)); } } Identity.prototype.toString = function () { return (this.components.map(function (c) { return (c.name.toUpperCase() + '=' + c.value); }).join(', ')); }; /* * These are from X.680 -- PrintableString allowed chars are in section 37.4 * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 * (the basic ASCII character set). */ /* JSSTYLED */ var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; /* JSSTYLED */ var NOT_IA5 = /[^\x00-\x7f]/; Identity.prototype.toAsn1 = function (der, tag) { der.startSequence(tag); this.components.forEach(function (c) { der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); der.startSequence(); der.writeOID(c.oid); /* * If we fit in a PrintableString, use that. Otherwise use an * IA5String or UTF8String. * * If this identity was parsed from a DN, use the ASN.1 types * from the original representation (otherwise this might not * be a full match for the original in some validators). */ if (c.asn1type === asn1.Ber.Utf8String || c.value.match(NOT_IA5)) { var v = new Buffer(c.value, 'utf8'); der.writeBuffer(v, asn1.Ber.Utf8String); } else if (c.asn1type === asn1.Ber.IA5String || c.value.match(NOT_PRINTABLE)) { der.writeString(c.value, asn1.Ber.IA5String); } else { var type = asn1.Ber.PrintableString; if (c.asn1type !== undefined) type = c.asn1type; der.writeString(c.value, type); } der.endSequence(); der.endSequence(); }); der.endSequence(); }; function globMatch(a, b) { if (a === '**' || b === '**') return (true); var aParts = a.split('.'); var bParts = b.split('.'); if (aParts.length !== bParts.length) return (false); for (var i = 0; i < aParts.length; ++i) { if (aParts[i] === '*' || bParts[i] === '*') continue; if (aParts[i] !== bParts[i]) return (false); } return (true); } Identity.prototype.equals = function (other) { if (!Identity.isIdentity(other, [1, 0])) return (false); if (other.components.length !== this.components.length) return (false); for (var i = 0; i < this.components.length; ++i) { if (this.components[i].oid !== other.components[i].oid) return (false); if (!globMatch(this.components[i].value, other.components[i].value)) { return (false); } } return (true); }; Identity.forHost = function (hostname) { assert.string(hostname, 'hostname'); return (new Identity({ type: 'host', hostname: hostname, components: [ { name: 'cn', value: hostname } ] })); }; Identity.forUser = function (uid) { assert.string(uid, 'uid'); return (new Identity({ type: 'user', uid: uid, components: [ { name: 'uid', value: uid } ] })); }; Identity.forEmail = function (email) { assert.string(email, 'email'); return (new Identity({ type: 'email', email: email, components: [ { name: 'mail', value: email } ] })); }; Identity.parseDN = function (dn) { assert.string(dn, 'dn'); var parts = dn.split(','); var cmps = parts.map(function (c) { c = c.trim(); var eqPos = c.indexOf('='); var name = c.slice(0, eqPos).toLowerCase(); var value = c.slice(eqPos + 1); return ({ name: name, value: value }); }); return (new Identity({ components: cmps })); }; Identity.parseAsn1 = function (der, top) { var components = []; der.readSequence(top); var end = der.offset + der.length; while (der.offset < end) { der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); var after = der.offset + der.length; der.readSequence(); var oid = der.readOID(); var type = der.peek(); var value; switch (type) { case asn1.Ber.PrintableString: case asn1.Ber.IA5String: case asn1.Ber.OctetString: case asn1.Ber.T61String: value = der.readString(type); break; case asn1.Ber.Utf8String: value = der.readString(type, true); value = value.toString('utf8'); break; case asn1.Ber.CharacterString: case asn1.Ber.BMPString: value = der.readString(type, true); value = value.toString('utf16le'); break; default: throw (new Error('Unknown asn1 type ' + type)); } components.push({ oid: oid, asn1type: type, value: value }); der._offset = after; } der._offset = end; return (new Identity({ components: components })); }; Identity.isIdentity = function (obj, ver) { return (utils.isCompatible(obj, Identity, ver)); }; /* * API versions for Identity: * [1,0] -- initial ver */ Identity.prototype._sshpkApiVersion = [1, 0]; Identity._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), /* 45 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const xml_components_1 = __webpack_require__(0); class RunFontAttributes extends xml_components_1.XmlAttributeComponent { constructor() { super(...arguments); this.xmlKeys = { ascii: "w:ascii", hAnsi: "w:hAnsi", hint: "w:hint", }; } } class RunFonts extends xml_components_1.XmlComponent { constructor(ascii, hint) { super("w:rFonts"); this.root.push(new RunFontAttributes({ ascii: ascii, hAnsi: ascii, hint: hint, })); } } exports.RunFonts = RunFonts; /***/ }), /* 46 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const xml_components_1 = __webpack_require__(0); class RunProperties extends xml_components_1.XmlComponent { constructor() { super("w:rPr"); } push(item) { this.root.push(item); } } exports.RunProperties = RunProperties; /***/ }), /* 47 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const xml_components_1 = __webpack_require__(0); class ParagraphProperties extends xml_components_1.XmlComponent { constructor() { super("w:pPr"); } push(item) { this.root.push(item); } } exports.ParagraphProperties = ParagraphProperties; /***/ }), /* 48 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function __export(m) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } Object.defineProperty(exports, "__esModule", { value: true }); __export(__webpack_require__(231)); /***/ }), /* 49 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; if (!process.version || process.version.indexOf('v0.') === 0 || process.version.indexOf('v1.') === 0 && process.version.indexOf('v1.8.') !== 0) { module.exports = { nextTick: nextTick }; } else { module.exports = process } function nextTick(fn, arg1, arg2, arg3) { if (typeof fn !== 'function') { throw new TypeError('"callback" argument must be a function'); } var len = arguments.length; var args, i; switch (len) { case 0: case 1: return process.nextTick(fn); case 2: return process.nextTick(function afterTickOne() { fn.call(null, arg1); }); case 3: return process.nextTick(function afterTickTwo() { fn.call(null, arg1, arg2); }); case 4: return process.nextTick(function afterTickThree() { fn.call(null, arg1, arg2, arg3); }); default: args = new Array(len - 1); i = 0; while (i < args.length) { args[i++] = arguments[i]; } return process.nextTick(function afterTick() { fn.apply(null, args); }); } } /***/ }), /* 50 */ /***/ (function(module, exports) { module.exports = require("https"); /***/ }), /* 51 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; // Load modules const Sntp = __webpack_require__(144); const Boom = __webpack_require__(72); // Declare internals const internals = {}; exports.version = function () { return __webpack_require__(405).version; }; exports.limits = { maxMatchLength: 4096 // Limit the length of uris and headers to avoid a DoS attack on string matching }; // Extract host and port from request // $1 $2 internals.hostHeaderRegex = /^(?:(?:\r\n)?\s)*((?:[^:]+)|(?:\[[^\]]+\]))(?::(\d+))?(?:(?:\r\n)?\s)*$/; // (IPv4, hostname)|(IPv6) exports.parseHost = function (req, hostHeaderName) { hostHeaderName = (hostHeaderName ? hostHeaderName.toLowerCase() : 'host'); const hostHeader = req.headers[hostHeaderName]; if (!hostHeader) { return null; } if (hostHeader.length > exports.limits.maxMatchLength) { return null; } const hostParts = hostHeader.match(internals.hostHeaderRegex); if (!hostParts) { return null; } return { name: hostParts[1], port: (hostParts[2] ? hostParts[2] : (req.connection && req.connection.encrypted ? 443 : 80)) }; }; // Parse Content-Type header content exports.parseContentType = function (header) { if (!header) { return ''; } return header.split(';')[0].trim().toLowerCase(); }; // Convert node's to request configuration object exports.parseRequest = function (req, options) { if (!req.headers) { return req; } // Obtain host and port information let host; if (!options.host || !options.port) { host = exports.parseHost(req, options.hostHeaderName); if (!host) { return new Error('Invalid Host header'); } } const request = { method: req.method, url: req.url, host: options.host || host.name, port: options.port || host.port, authorization: req.headers.authorization, contentType: req.headers['content-type'] || '' }; return request; }; exports.now = function (localtimeOffsetMsec) { return Sntp.now() + (localtimeOffsetMsec || 0); }; exports.nowSecs = function (localtimeOffsetMsec) { return Math.floor(exports.now(localtimeOffsetMsec) / 1000); }; internals.authHeaderRegex = /^(\w+)(?:\s+(.*))?$/; // Header: scheme[ something] internals.attributeRegex = /^[ \w\!#\$%&'\(\)\*\+,\-\.\/\:;<\=>\?@\[\]\^`\{\|\}~]+$/; // !#$%&'()*+,-./:;<=>?@[]^_`{|}~ and space, a-z, A-Z, 0-9 // Parse Hawk HTTP Authorization header exports.parseAuthorizationHeader = function (header, keys) { keys = keys || ['id', 'ts', 'nonce', 'hash', 'ext', 'mac', 'app', 'dlg']; if (!header) { return Boom.unauthorized(null, 'Hawk'); } if (header.length > exports.limits.maxMatchLength) { return Boom.badRequest('Header length too long'); } const headerParts = header.match(internals.authHeaderRegex); if (!headerParts) { return Boom.badRequest('Invalid header syntax'); } const scheme = headerParts[1]; if (scheme.toLowerCase() !== 'hawk') { return Boom.unauthorized(null, 'Hawk'); } const attributesString = headerParts[2]; if (!attributesString) { return Boom.badRequest('Invalid header syntax'); } const attributes = {}; let errorMessage = ''; const verify = attributesString.replace(/(\w+)="([^"\\]*)"\s*(?:,\s*|$)/g, ($0, $1, $2) => { // Check valid attribute names if (keys.indexOf($1) === -1) { errorMessage = 'Unknown attribute: ' + $1; return; } // Allowed attribute value characters if ($2.match(internals.attributeRegex) === null) { errorMessage = 'Bad attribute value: ' + $1; return; } // Check for duplicates if (attributes.hasOwnProperty($1)) { errorMessage = 'Duplicate attribute: ' + $1; return; } attributes[$1] = $2; return ''; }); if (verify !== '') { return Boom.badRequest(errorMessage || 'Bad header format'); } return attributes; }; exports.unauthorized = function (message, attributes) { return Boom.unauthorized(message || null, 'Hawk', attributes); }; /***/ }), /* 52 */ /***/ (function(module, exports) { module.exports = require("querystring"); /***/ }), /* 53 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(2); var sshpk = __webpack_require__(74); var util = __webpack_require__(1); var HASH_ALGOS = { 'sha1': true, 'sha256': true, 'sha512': true }; var PK_ALGOS = { 'rsa': true, 'dsa': true, 'ecdsa': true }; function HttpSignatureError(message, caller) { if (Error.captureStackTrace) Error.captureStackTrace(this, caller || HttpSignatureError); this.message = message; this.name = caller.name; } util.inherits(HttpSignatureError, Error); function InvalidAlgorithmError(message) { HttpSignatureError.call(this, message, InvalidAlgorithmError); } util.inherits(InvalidAlgorithmError, HttpSignatureError); function validateAlgorithm(algorithm) { var alg = algorithm.toLowerCase().split('-'); if (alg.length !== 2) { throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + 'valid algorithm')); } if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + 'are not supported')); } if (!HASH_ALGOS[alg[1]]) { throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + 'supported hash algorithm')); } return (alg); } ///--- API module.exports = { HASH_ALGOS: HASH_ALGOS, PK_ALGOS: PK_ALGOS, HttpSignatureError: HttpSignatureError, InvalidAlgorithmError: InvalidAlgorithmError, validateAlgorithm: validateAlgorithm, /** * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. * * The intent of this module is to interoperate with OpenSSL only, * specifically the node crypto module's `verify` method. * * @param {String} key an OpenSSH public key. * @return {String} PEM encoded form of the RSA public key. * @throws {TypeError} on bad input. * @throws {Error} on invalid ssh key formatted data. */ sshKeyToPEM: function sshKeyToPEM(key) { assert.string(key, 'ssh_key'); var k = sshpk.parseKey(key, 'ssh'); return (k.toString('pem')); }, /** * Generates an OpenSSH fingerprint from an ssh public key. * * @param {String} key an OpenSSH public key. * @return {String} key fingerprint. * @throws {TypeError} on bad input. * @throws {Error} if what you passed doesn't look like an ssh public key. */ fingerprint: function fingerprint(key) { assert.string(key, 'ssh_key'); var k = sshpk.parseKey(key, 'ssh'); return (k.fingerprint('md5').toString('hex')); }, /** * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) * * The reverse of the above function. */ pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { assert.equal('string', typeof (pem), 'typeof pem'); var k = sshpk.parseKey(pem, 'pem'); k.comment = comment; return (k.toString('ssh')); } }; /***/ }), /* 54 */ /***/ (function(module, exports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readSSHPrivate: readSSHPrivate, write: write }; var assert = __webpack_require__(2); var asn1 = __webpack_require__(21); var algs = __webpack_require__(7); var utils = __webpack_require__(5); var crypto = __webpack_require__(4); var Key = __webpack_require__(6); var PrivateKey = __webpack_require__(8); var pem = __webpack_require__(26); var rfc4253 = __webpack_require__(27); var SSHBuffer = __webpack_require__(43); var errors = __webpack_require__(18); var bcrypt; function read(buf, options) { return (pem.read(buf, options)); } var MAGIC = 'openssh-key-v1'; function readSSHPrivate(type, buf, options) { buf = new SSHBuffer({buffer: buf}); var magic = buf.readCString(); assert.strictEqual(magic, MAGIC, 'bad magic string'); var cipher = buf.readString(); var kdf = buf.readString(); var kdfOpts = buf.readBuffer(); var nkeys = buf.readInt(); if (nkeys !== 1) { throw (new Error('OpenSSH-format key file contains ' + 'multiple keys: this is unsupported.')); } var pubKey = buf.readBuffer(); if (type === 'public') { assert.ok(buf.atEnd(), 'excess bytes left after key'); return (rfc4253.read(pubKey)); } var privKeyBlob = buf.readBuffer(); assert.ok(buf.atEnd(), 'excess bytes left after key'); var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); switch (kdf) { case 'none': if (cipher !== 'none') { throw (new Error('OpenSSH-format key uses KDF "none" ' + 'but specifies a cipher other than "none"')); } break; case 'bcrypt': var salt = kdfOptsBuf.readBuffer(); var rounds = kdfOptsBuf.readInt(); var cinf = utils.opensshCipherInfo(cipher); if (bcrypt === undefined) { bcrypt = __webpack_require__(149); } if (typeof (options.passphrase) === 'string') { options.passphrase = new Buffer(options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'OpenSSH')); } var pass = new Uint8Array(options.passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = new Buffer(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createDecipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(privKeyBlob); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privKeyBlob = Buffer.concat(chunks); break; default: throw (new Error( 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } buf = new SSHBuffer({buffer: privKeyBlob}); var checkInt1 = buf.readInt(); var checkInt2 = buf.readInt(); if (checkInt1 !== checkInt2) { throw (new Error('Incorrect passphrase supplied, could not ' + 'decrypt key')); } var ret = {}; var key = rfc4253.readInternal(ret, 'private', buf.remainder()); buf.skip(ret.consumed); var comment = buf.readString(); key.comment = comment; return (key); } function write(key, options) { var pubKey; if (PrivateKey.isPrivateKey(key)) pubKey = key.toPublic(); else pubKey = key; var cipher = 'none'; var kdf = 'none'; var kdfopts = new Buffer(0); var cinf = { blockSize: 8 }; var passphrase; if (options !== undefined) { passphrase = options.passphrase; if (typeof (passphrase) === 'string') passphrase = new Buffer(passphrase, 'utf-8'); if (passphrase !== undefined) { assert.buffer(passphrase, 'options.passphrase'); assert.optionalString(options.cipher, 'options.cipher'); cipher = options.cipher; if (cipher === undefined) cipher = 'aes128-ctr'; cinf = utils.opensshCipherInfo(cipher); kdf = 'bcrypt'; } } var privBuf; if (PrivateKey.isPrivateKey(key)) { privBuf = new SSHBuffer({}); var checkInt = crypto.randomBytes(4).readUInt32BE(0); privBuf.writeInt(checkInt); privBuf.writeInt(checkInt); privBuf.write(key.toBuffer('rfc4253')); privBuf.writeString(key.comment || ''); var n = 1; while (privBuf._offset % cinf.blockSize !== 0) privBuf.writeChar(n++); privBuf = privBuf.toBuffer(); } switch (kdf) { case 'none': break; case 'bcrypt': var salt = crypto.randomBytes(16); var rounds = 16; var kdfssh = new SSHBuffer({}); kdfssh.writeBuffer(salt); kdfssh.writeInt(rounds); kdfopts = kdfssh.toBuffer(); if (bcrypt === undefined) { bcrypt = __webpack_require__(149); } var pass = new Uint8Array(passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = new Buffer(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createCipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { throw (e); }); cipherStream.write(privBuf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privBuf = Buffer.concat(chunks); break; default: throw (new Error('Unsupported kdf ' + kdf)); } var buf = new SSHBuffer({}); buf.writeCString(MAGIC); buf.writeString(cipher); /* cipher */ buf.writeString(kdf); /* kdf */ buf.writeBuffer(kdfopts); /* kdfoptions */ buf.writeInt(1); /* nkeys */ buf.writeBuffer(pubKey.toBuffer('rfc4253')); if (privBuf) buf.writeBuffer(privBuf); buf = buf.toBuffer(); var header; if (PrivateKey.isPrivateKey(key)) header = 'OPENSSH PRIVATE KEY'; else header = 'OPENSSH PUBLIC KEY'; var tmp = buf.toString('base64'); var len = tmp.length + (tmp.length / 70) + 18 + 16 + header.length*2 + 10; buf = new Buffer(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 70; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /* 55 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function __export(m) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } Object.defineProperty(exports, "__esModule", { value: true }); __export(__webpack_require__(86)); __export(__webpack_require__(89)); __export(__webpack_require__(90)); __export(__webpack_require__(91)); __export(__webpack_require__(92)); __export(__webpack_require__(96)); __export(__webpack_require__(97)); __export(__webpack_require__(98)); __export(__webpack_require__(99)); /***/ }), /* 56 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function __export(m) { for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; } Object.defineProperty(exports, "__esModule", { value: true }); __export(__webpack_require__(266)); /***/ }), /* 57 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; Object.defineProperty(exports, "__esModule", { value: true }); const archiver = __webpack_require__(299); const xml = __webpack_require__(347); const formatter_1 = __webpack_require__(349); class Compiler { constructor(file) { this.file = file; this.formatter = new formatter_1.Formatter(); this.archive = archiver.create("zip", {}); this.archive.on("error", (err) => { throw err; }); } compile(output) { return __awaiter(this, void 0, void 0, function* () { this.archive.pipe(output); const xmlDocument = xml(this.formatter.format(this.file.Document), true); const xmlStyles = xml(this.formatter.format(this.file.Styles)); const xmlProperties = xml(this.formatter.format(this.file.CoreProperties), { declaration: { standalone: "yes", encoding: "UTF-8", }, }); const xmlNumbering = xml(this.formatter.format(this.file.Numbering)); const xmlRelationships = xml(this.formatter.format(this.file.DocumentRelationships)); const xmlFileRelationships = xml(this.formatter.format(this.file.FileRelationships)); const xmlHeader = xml(this.formatter.format(this.file.Header.Header)); const xmlFooter = xml(this.formatter.format(this.file.Footer.Footer)); const xmlHeaderRelationships = xml(this.formatter.format(this.file.Header.Relationships)); const xmlFooterRelationships = xml(this.formatter.format(this.file.Footer.Relationships)); const xmlContentTypes = xml(this.formatter.format(this.file.ContentTypes)); const xmlAppProperties = xml(this.formatter.format(this.file.AppProperties)); this.archive.append(xmlDocument, { name: "word/document.xml", }); this.archive.append(xmlStyles, { name: "word/styles.xml", }); this.archive.append(xmlProperties, { name: "docProps/core.xml", }); this.archive.append(xmlAppProperties, { name: "docProps/app.xml", }); this.archive.append(xmlNumbering, { name: "word/numbering.xml", }); this.archive.append(xmlHeader, { name: "word/header1.xml", }); this.archive.append(xmlFooter, { name: "word/footer1.xml", }); this.archive.append(xmlRelationships, { name: "word/_rels/document.xml.rels", }); this.archive.append(xmlHeaderRelationships, { name: "word/_rels/header1.xml.rels", }); this.archive.append(xmlFooterRelationships, { name: "word/_rels/footer1.xml.rels", }); this.archive.append(xmlContentTypes, { name: "[Content_Types].xml", }); this.archive.append(xmlFileRelationships, { name: "_rels/.rels", }); for (const data of this.file.Media.array) { this.archive.append(data.stream, { name: `word/media/${data.fileName}`, }); } this.archive.finalize(); return new Promise((resolve) => { output.on("close", () => { resolve(); }); }); }); } } exports.Compiler = Compiler; /***/ }), /* 58 */ /***/ (function(module, exports, __webpack_require__) { // Approach: // // 1. Get the minimatch set // 2. For each pattern in the set, PROCESS(pattern, false) // 3. Store matches per-set, then uniq them // // PROCESS(pattern, inGlobStar) // Get the first [n] items from pattern that are all strings // Join these together. This is PREFIX. // If there is no more remaining, then stat(PREFIX) and // add to matches if it succeeds. END. // // If inGlobStar and PREFIX is symlink and points to dir // set ENTRIES = [] // else readdir(PREFIX) as ENTRIES // If fail, END // // with ENTRIES // If pattern[n] is GLOBSTAR // // handle the case where the globstar match is empty // // by pruning it out, and testing the resulting pattern // PROCESS(pattern[0..n] + pattern[n+1 .. $], false) // // handle other cases. // for ENTRY in ENTRIES (not dotfiles) // // attach globstar + tail onto the entry // // Mark that this entry is a globstar match // PROCESS(pattern[0..n] + ENTRY + pattern[n .. $], true) // // else // not globstar // for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot) // Test ENTRY against pattern[n] // If fails, continue // If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $]) // // Caveat: // Cache all stats and readdirs results to minimize syscall. Since all // we ever care about is existence and directory-ness, we can just keep // `true` for files, and [children,...] for directories, or `false` for // things that don't exist. module.exports = glob var fs = __webpack_require__(9) var rp = __webpack_require__(108) var minimatch = __webpack_require__(59) var Minimatch = minimatch.Minimatch var inherits = __webpack_require__(28) var EE = __webpack_require__(60).EventEmitter var path = __webpack_require__(10) var assert = __webpack_require__(23) var isAbsolute = __webpack_require__(61) var globSync = __webpack_require__(306) var common = __webpack_require__(109) var alphasort = common.alphasort var alphasorti = common.alphasorti var setopts = common.setopts var ownProp = common.ownProp var inflight = __webpack_require__(307) var util = __webpack_require__(1) var childrenIgnored = common.childrenIgnored var isIgnored = common.isIgnored var once = __webpack_require__(62) function glob (pattern, options, cb) { if (typeof options === 'function') cb = options, options = {} if (!options) options = {} if (options.sync) { if (cb) throw new TypeError('callback provided to sync glob') return globSync(pattern, options) } return new Glob(pattern, options, cb) } glob.sync = globSync var GlobSync = glob.GlobSync = globSync.GlobSync // old api surface glob.glob = glob function extend (origin, add) { if (add === null || typeof add !== 'object') { return origin } var keys = Object.keys(add) var i = keys.length while (i--) { origin[keys[i]] = add[keys[i]] } return origin } glob.hasMagic = function (pattern, options_) { var options = extend({}, options_) options.noprocess = true var g = new Glob(pattern, options) var set = g.minimatch.set if (!pattern) return false if (set.length > 1) return true for (var j = 0; j < set[0].length; j++) { if (typeof set[0][j] !== 'string') return true } return false } glob.Glob = Glob inherits(Glob, EE) function Glob (pattern, options, cb) { if (typeof options === 'function') { cb = options options = null } if (options && options.sync) { if (cb) throw new TypeError('callback provided to sync glob') return new GlobSync(pattern, options) } if (!(this instanceof Glob)) return new Glob(pattern, options, cb) setopts(this, pattern, options) this._didRealPath = false // process each pattern in the minimatch set var n = this.minimatch.set.length // The matches are stored as {: true,...} so that // duplicates are automagically pruned. // Later, we do an Object.keys() on these. // Keep them as a list so we can fill in when nonull is set. this.matches = new Array(n) if (typeof cb === 'function') { cb = once(cb) this.on('error', cb) this.on('end', function (matches) { cb(null, matches) }) } var self = this this._processing = 0 this._emitQueue = [] this._processQueue = [] this.paused = false if (this.noprocess) return this if (n === 0) return done() var sync = true for (var i = 0; i < n; i ++) { this._process(this.minimatch.set[i], i, false, done) } sync = false function done () { --self._processing if (self._processing <= 0) { if (sync) { process.nextTick(function () { self._finish() }) } else { self._finish() } } } } Glob.prototype._finish = function () { assert(this instanceof Glob) if (this.aborted) return if (this.realpath && !this._didRealpath) return this._realpath() common.finish(this) this.emit('end', this.found) } Glob.prototype._realpath = function () { if (this._didRealpath) return this._didRealpath = true var n = this.matches.length if (n === 0) return this._finish() var self = this for (var i = 0; i < this.matches.length; i++) this._realpathSet(i, next) function next () { if (--n === 0) self._finish() } } Glob.prototype._realpathSet = function (index, cb) { var matchset = this.matches[index] if (!matchset) return cb() var found = Object.keys(matchset) var self = this var n = found.length if (n === 0) return cb() var set = this.matches[index] = Object.create(null) found.forEach(function (p, i) { // If there's a problem with the stat, then it means that // one or more of the links in the realpath couldn't be // resolved. just return the abs value in that case. p = self._makeAbs(p) rp.realpath(p, self.realpathCache, function (er, real) { if (!er) set[real] = true else if (er.syscall === 'stat') set[p] = true else self.emit('error', er) // srsly wtf right here if (--n === 0) { self.matches[index] = set cb() } }) }) } Glob.prototype._mark = function (p) { return common.mark(this, p) } Glob.prototype._makeAbs = function (f) { return common.makeAbs(this, f) } Glob.prototype.abort = function () { this.aborted = true this.emit('abort') } Glob.prototype.pause = function () { if (!this.paused) { this.paused = true this.emit('pause') } } Glob.prototype.resume = function () { if (this.paused) { this.emit('resume') this.paused = false if (this._emitQueue.length) { var eq = this._emitQueue.slice(0) this._emitQueue.length = 0 for (var i = 0; i < eq.length; i ++) { var e = eq[i] this._emitMatch(e[0], e[1]) } } if (this._processQueue.length) { var pq = this._processQueue.slice(0) this._processQueue.length = 0 for (var i = 0; i < pq.length; i ++) { var p = pq[i] this._processing-- this._process(p[0], p[1], p[2], p[3]) } } } } Glob.prototype._process = function (pattern, index, inGlobStar, cb) { assert(this instanceof Glob) assert(typeof cb === 'function') if (this.aborted) return this._processing++ if (this.paused) { this._processQueue.push([pattern, index, inGlobStar, cb]) return } //console.error('PROCESS %d', this._processing, pattern) // Get the first [n] parts of pattern that are all strings. var n = 0 while (typeof pattern[n] === 'string') { n ++ } // now n is the index of the first one that is *not* a string. // see if there's anything else var prefix switch (n) { // if not, then this is rather simple case pattern.length: this._processSimple(pattern.join('/'), index, cb) return case 0: // pattern *starts* with some non-trivial item. // going to readdir(cwd), but not include the prefix in matches. prefix = null break default: // pattern has some string bits in the front. // whatever it starts with, whether that's 'absolute' like /foo/bar, // or 'relative' like '../baz' prefix = pattern.slice(0, n).join('/') break } var remain = pattern.slice(n) // get the list of entries. var read if (prefix === null) read = '.' else if (isAbsolute(prefix) || isAbsolute(pattern.join('/'))) { if (!prefix || !isAbsolute(prefix)) prefix = '/' + prefix read = prefix } else read = prefix var abs = this._makeAbs(read) //if ignored, skip _processing if (childrenIgnored(this, read)) return cb() var isGlobStar = remain[0] === minimatch.GLOBSTAR if (isGlobStar) this._processGlobStar(prefix, read, abs, remain, index, inGlobStar, cb) else this._processReaddir(prefix, read, abs, remain, index, inGlobStar, cb) } Glob.prototype._processReaddir = function (prefix, read, abs, remain, index, inGlobStar, cb) { var self = this this._readdir(abs, inGlobStar, function (er, entries) { return self._processReaddir2(prefix, read, abs, remain, index, inGlobStar, entries, cb) }) } Glob.prototype._processReaddir2 = function (prefix, read, abs, remain, index, inGlobStar, entries, cb) { // if the abs isn't a dir, then nothing can match! if (!entries) return cb() // It will only match dot entries if it starts with a dot, or if // dot is set. Stuff like @(.foo|.bar) isn't allowed. var pn = remain[0] var negate = !!this.minimatch.negate var rawGlob = pn._glob var dotOk = this.dot || rawGlob.charAt(0) === '.' var matchedEntries = [] for (var i = 0; i < entries.length; i++) { var e = entries[i] if (e.charAt(0) !== '.' || dotOk) { var m if (negate && !prefix) { m = !e.match(pn) } else { m = e.match(pn) } if (m) matchedEntries.push(e) } } //console.error('prd2', prefix, entries, remain[0]._glob, matchedEntries) var len = matchedEntries.length // If there are no matched entries, then nothing matches. if (len === 0) return cb() // if this is the last remaining pattern bit, then no need for // an additional stat *unless* the user has specified mark or // stat explicitly. We know they exist, since readdir returned // them. if (remain.length === 1 && !this.mark && !this.stat) { if (!this.matches[index]) this.matches[index] = Object.create(null) for (var i = 0; i < len; i ++) { var e = matchedEntries[i] if (prefix) { if (prefix !== '/') e = prefix + '/' + e else e = prefix + e } if (e.charAt(0) === '/' && !this.nomount) { e = path.join(this.root, e) } this._emitMatch(index, e) } // This was the last one, and no stats were needed return cb() } // now test all matched entries as stand-ins for that part // of the pattern. remain.shift() for (var i = 0; i < len; i ++) { var e = matchedEntries[i] var newPattern if (prefix) { if (prefix !== '/') e = prefix + '/' + e else e = prefix + e } this._process([e].concat(remain), index, inGlobStar, cb) } cb() } Glob.prototype._emitMatch = function (index, e) { if (this.aborted) return if (isIgnored(this, e)) return if (this.paused) { this._emitQueue.push([index, e]) return } var abs = isAbsolute(e) ? e : this._makeAbs(e) if (this.mark) e = this._mark(e) if (this.absolute) e = abs if (this.matches[index][e]) return if (this.nodir) { var c = this.cache[abs] if (c === 'DIR' || Array.isArray(c)) return } this.matches[index][e] = true var st = this.statCache[abs] if (st) this.emit('stat', e, st) this.emit('match', e) } Glob.prototype._readdirInGlobStar = function (abs, cb) { if (this.aborted) return // follow all symlinked directories forever // just proceed as if this is a non-globstar situation if (this.follow) return this._readdir(abs, false, cb) var lstatkey = 'lstat\0' + abs var self = this var lstatcb = inflight(lstatkey, lstatcb_) if (lstatcb) fs.lstat(abs, lstatcb) function lstatcb_ (er, lstat) { if (er && er.code === 'ENOENT') return cb() var isSym = lstat && lstat.isSymbolicLink() self.symlinks[abs] = isSym // If it's not a symlink or a dir, then it's definitely a regular file. // don't bother doing a readdir in that case. if (!isSym && lstat && !lstat.isDirectory()) { self.cache[abs] = 'FILE' cb() } else self._readdir(abs, false, cb) } } Glob.prototype._readdir = function (abs, inGlobStar, cb) { if (this.aborted) return cb = inflight('readdir\0'+abs+'\0'+inGlobStar, cb) if (!cb) return //console.error('RD %j %j', +inGlobStar, abs) if (inGlobStar && !ownProp(this.symlinks, abs)) return this._readdirInGlobStar(abs, cb) if (ownProp(this.cache, abs)) { var c = this.cache[abs] if (!c || c === 'FILE') return cb() if (Array.isArray(c)) return cb(null, c) } var self = this fs.readdir(abs, readdirCb(this, abs, cb)) } function readdirCb (self, abs, cb) { return function (er, entries) { if (er) self._readdirError(abs, er, cb) else self._readdirEntries(abs, entries, cb) } } Glob.prototype._readdirEntries = function (abs, entries, cb) { if (this.aborted) return // if we haven't asked to stat everything, then just // assume that everything in there exists, so we can avoid // having to stat it a second time. if (!this.mark && !this.stat) { for (var i = 0; i < entries.length; i ++) { var e = entries[i] if (abs === '/') e = abs + e else e = abs + '/' + e this.cache[e] = true } } this.cache[abs] = entries return cb(null, entries) } Glob.prototype._readdirError = function (f, er, cb) { if (this.aborted) return // handle errors, and cache the information switch (er.code) { case 'ENOTSUP': // https://github.com/isaacs/node-glob/issues/205 case 'ENOTDIR': // totally normal. means it *does* exist. var abs = this._makeAbs(f) this.cache[abs] = 'FILE' if (abs === this.cwdAbs) { var error = new Error(er.code + ' invalid cwd ' + this.cwd) error.path = this.cwd error.code = er.code this.emit('error', error) this.abort() } break case 'ENOENT': // not terribly unusual case 'ELOOP': case 'ENAMETOOLONG': case 'UNKNOWN': this.cache[this._makeAbs(f)] = false break default: // some unusual error. Treat as failure. this.cache[this._makeAbs(f)] = false if (this.strict) { this.emit('error', er) // If the error is handled, then we abort // if not, we threw out of here this.abort() } if (!this.silent) console.error('glob error', er) break } return cb() } Glob.prototype._processGlobStar = function (prefix, read, abs, remain, index, inGlobStar, cb) { var self = this this._readdir(abs, inGlobStar, function (er, entries) { self._processGlobStar2(prefix, read, abs, remain, index, inGlobStar, entries, cb) }) } Glob.prototype._processGlobStar2 = function (prefix, read, abs, remain, index, inGlobStar, entries, cb) { //console.error('pgs2', prefix, remain[0], entries) // no entries means not a dir, so it can never have matches // foo.txt/** doesn't match foo.txt if (!entries) return cb() // test without the globstar, and with every child both below // and replacing the globstar. var remainWithoutGlobStar = remain.slice(1) var gspref = prefix ? [ prefix ] : [] var noGlobStar = gspref.concat(remainWithoutGlobStar) // the noGlobStar pattern exits the inGlobStar state this._process(noGlobStar, index, false, cb) var isSym = this.symlinks[abs] var len = entries.length // If it's a symlink, and we're in a globstar, then stop if (isSym && inGlobStar) return cb() for (var i = 0; i < len; i++) { var e = entries[i] if (e.charAt(0) === '.' && !this.dot) continue // these two cases enter the inGlobStar state var instead = gspref.concat(entries[i], remainWithoutGlobStar) this._process(instead, index, true, cb) var below = gspref.concat(entries[i], remain) this._process(below, index, true, cb) } cb() } Glob.prototype._processSimple = function (prefix, index, cb) { // XXX review this. Shouldn't it be doing the mounting etc // before doing stat? kinda weird? var self = this this._stat(prefix, function (er, exists) { self._processSimple2(prefix, index, er, exists, cb) }) } Glob.prototype._processSimple2 = function (prefix, index, er, exists, cb) { //console.error('ps2', prefix, exists) if (!this.matches[index]) this.matches[index] = Object.create(null) // If it doesn't exist, then just mark the lack of results if (!exists) return cb() if (prefix && isAbsolute(prefix) && !this.nomount) { var trail = /[\/\\]$/.test(prefix) if (prefix.charAt(0) === '/') { prefix = path.join(this.root, prefix) } else { prefix = path.resolve(this.root, prefix) if (trail) prefix += '/' } } if (process.platform === 'win32') prefix = prefix.replace(/\\/g, '/') // Mark this as a match this._emitMatch(index, prefix) cb() } // Returns either 'DIR', 'FILE', or false Glob.prototype._stat = function (f, cb) { var abs = this._makeAbs(f) var needDir = f.slice(-1) === '/' if (f.length > this.maxLength) return cb() if (!this.stat && ownProp(this.cache, abs)) { var c = this.cache[abs] if (Array.isArray(c)) c = 'DIR' // It exists, but maybe not how we need it if (!needDir || c === 'DIR') return cb(null, c) if (needDir && c === 'FILE') return cb() // otherwise we have to stat, because maybe c=true // if we know it exists, but not what it is. } var exists var stat = this.statCache[abs] if (stat !== undefined) { if (stat === false) return cb(null, stat) else { var type = stat.isDirectory() ? 'DIR' : 'FILE' if (needDir && type === 'FILE') return cb() else return cb(null, type, stat) } } var self = this var statcb = inflight('stat\0' + abs, lstatcb_) if (statcb) fs.lstat(abs, statcb) function lstatcb_ (er, lstat) { if (lstat && lstat.isSymbolicLink()) { // If it's a symlink, then treat it as the target, unless // the target does not exist, then treat it as a file. return fs.stat(abs, function (er, stat) { if (er) self._stat2(f, abs, null, lstat, cb) else self._stat2(f, abs, er, stat, cb) }) } else { self._stat2(f, abs, er, lstat, cb) } } } Glob.prototype._stat2 = function (f, abs, er, stat, cb) { if (er && (er.code === 'ENOENT' || er.code === 'ENOTDIR')) { this.statCache[abs] = false return cb() } var needDir = f.slice(-1) === '/' this.statCache[abs] = stat if (abs.slice(-1) === '/' && stat && !stat.isDirectory()) return cb(null, false, stat) var c = true if (stat) c = stat.isDirectory() ? 'DIR' : 'FILE' this.cache[abs] = this.cache[abs] || c if (needDir && c === 'FILE') return cb() return cb(null, c, stat) } /***/ }), /* 59 */ /***/ (function(module, exports, __webpack_require__) { module.exports = minimatch minimatch.Minimatch = Minimatch var path = { sep: '/' } try { path = __webpack_require__(10) } catch (er) {} var GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {} var expand = __webpack_require__(302) var plTypes = { '!': { open: '(?:(?!(?:', close: '))[^/]*?)'}, '?': { open: '(?:', close: ')?' }, '+': { open: '(?:', close: ')+' }, '*': { open: '(?:', close: ')*' }, '@': { open: '(?:', close: ')' } } // any single thing other than / // don't need to escape / when using new RegExp() var qmark = '[^/]' // * => any number of characters var star = qmark + '*?' // ** when dots are allowed. Anything goes, except .. and . // not (^ or / followed by one or two dots followed by $ or /), // followed by anything, any number of times. var twoStarDot = '(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?' // not a ^ or / followed by a dot, // followed by anything, any number of times. var twoStarNoDot = '(?:(?!(?:\\\/|^)\\.).)*?' // characters that need to be escaped in RegExp. var reSpecials = charSet('().*{}+?[]^$\\!') // "abc" -> { a:true, b:true, c:true } function charSet (s) { return s.split('').reduce(function (set, c) { set[c] = true return set }, {}) } // normalizes slashes. var slashSplit = /\/+/ minimatch.filter = filter function filter (pattern, options) { options = options || {} return function (p, i, list) { return minimatch(p, pattern, options) } } function ext (a, b) { a = a || {} b = b || {} var t = {} Object.keys(b).forEach(function (k) { t[k] = b[k] }) Object.keys(a).forEach(function (k) { t[k] = a[k] }) return t } minimatch.defaults = function (def) { if (!def || !Object.keys(def).length) return minimatch var orig = minimatch var m = function minimatch (p, pattern, options) { return orig.minimatch(p, pattern, ext(def, options)) } m.Minimatch = function Minimatch (pattern, options) { return new orig.Minimatch(pattern, ext(def, options)) } return m } Minimatch.defaults = function (def) { if (!def || !Object.keys(def).length) return Minimatch return minimatch.defaults(def).Minimatch } function minimatch (p, pattern, options) { if (typeof pattern !== 'string') { throw new TypeError('glob pattern string required') } if (!options) options = {} // shortcut: comments match nothing. if (!options.nocomment && pattern.charAt(0) === '#') { return false } // "" only matches "" if (pattern.trim() === '') return p === '' return new Minimatch(pattern, options).match(p) } function Minimatch (pattern, options) { if (!(this instanceof Minimatch)) { return new Minimatch(pattern, options) } if (typeof pattern !== 'string') { throw new TypeError('glob pattern string required') } if (!options) options = {} pattern = pattern.trim() // windows support: need to use /, not \ if (path.sep !== '/') { pattern = pattern.split(path.sep).join('/') } this.options = options this.set = [] this.pattern = pattern this.regexp = null this.negate = false this.comment = false this.empty = false // make the set of regexps etc. this.make() } Minimatch.prototype.debug = function () {} Minimatch.prototype.make = make function make () { // don't do it more than once. if (this._made) return var pattern = this.pattern var options = this.options // empty patterns and comments match nothing. if (!options.nocomment && pattern.charAt(0) === '#') { this.comment = true return } if (!pattern) { this.empty = true return } // step 1: figure out negation, etc. this.parseNegate() // step 2: expand braces var set = this.globSet = this.braceExpand() if (options.debug) this.debug = console.error this.debug(this.pattern, set) // step 3: now we have a set, so turn each one into a series of path-portion // matching patterns. // These will be regexps, except in the case of "**", which is // set to the GLOBSTAR object for globstar behavior, // and will not contain any / characters set = this.globParts = set.map(function (s) { return s.split(slashSplit) }) this.debug(this.pattern, set) // glob --> regexps set = set.map(function (s, si, set) { return s.map(this.parse, this) }, this) this.debug(this.pattern, set) // filter out everything that didn't compile properly. set = set.filter(function (s) { return s.indexOf(false) === -1 }) this.debug(this.pattern, set) this.set = set } Minimatch.prototype.parseNegate = parseNegate function parseNegate () { var pattern = this.pattern var negate = false var options = this.options var negateOffset = 0 if (options.nonegate) return for (var i = 0, l = pattern.length ; i < l && pattern.charAt(i) === '!' ; i++) { negate = !negate negateOffset++ } if (negateOffset) this.pattern = pattern.substr(negateOffset) this.negate = negate } // Brace expansion: // a{b,c}d -> abd acd // a{b,}c -> abc ac // a{0..3}d -> a0d a1d a2d a3d // a{b,c{d,e}f}g -> abg acdfg acefg // a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg // // Invalid sets are not expanded. // a{2..}b -> a{2..}b // a{b}c -> a{b}c minimatch.braceExpand = function (pattern, options) { return braceExpand(pattern, options) } Minimatch.prototype.braceExpand = braceExpand function braceExpand (pattern, options) { if (!options) { if (this instanceof Minimatch) { options = this.options } else { options = {} } } pattern = typeof pattern === 'undefined' ? this.pattern : pattern if (typeof pattern === 'undefined') { throw new TypeError('undefined pattern') } if (options.nobrace || !pattern.match(/\{.*\}/)) { // shortcut. no need to expand. return [pattern] } return expand(pattern) } // parse a component of the expanded set. // At this point, no pattern may contain "/" in it // so we're going to return a 2d array, where each entry is the full // pattern, split on '/', and then turned into a regular expression. // A regexp is made at the end which joins each array with an // escaped /, and another full one which joins each regexp with |. // // Following the lead of Bash 4.1, note that "**" only has special meaning // when it is the *only* thing in a path portion. Otherwise, any series // of * is equivalent to a single *. Globstar behavior is enabled by // default, and can be disabled by setting options.noglobstar. Minimatch.prototype.parse = parse var SUBPARSE = {} function parse (pattern, isSub) { if (pattern.length > 1024 * 64) { throw new TypeError('pattern is too long') } var options = this.options // shortcuts if (!options.noglobstar && pattern === '**') return GLOBSTAR if (pattern === '') return '' var re = '' var hasMagic = !!options.nocase var escaping = false // ? => one single character var patternListStack = [] var negativeLists = [] var stateChar var inClass = false var reClassStart = -1 var classStart = -1 // . and .. never match anything that doesn't start with ., // even when options.dot is set. var patternStart = pattern.charAt(0) === '.' ? '' // anything // not (start or / followed by . or .. followed by / or end) : options.dot ? '(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))' : '(?!\\.)' var self = this function clearStateChar () { if (stateChar) { // we had some state-tracking character // that wasn't consumed by this pass. switch (stateChar) { case '*': re += star hasMagic = true break case '?': re += qmark hasMagic = true break default: re += '\\' + stateChar break } self.debug('clearStateChar %j %j', stateChar, re) stateChar = false } } for (var i = 0, len = pattern.length, c ; (i < len) && (c = pattern.charAt(i)) ; i++) { this.debug('%s\t%s %s %j', pattern, i, re, c) // skip over any that are escaped. if (escaping && reSpecials[c]) { re += '\\' + c escaping = false continue } switch (c) { case '/': // completely not allowed, even escaped. // Should already be path-split by now. return false case '\\': clearStateChar() escaping = true continue // the various stateChar values // for the "extglob" stuff. case '?': case '*': case '+': case '@': case '!': this.debug('%s\t%s %s %j <-- stateChar', pattern, i, re, c) // all of those are literals inside a class, except that // the glob [!a] means [^a] in regexp if (inClass) { this.debug(' in class') if (c === '!' && i === classStart + 1) c = '^' re += c continue } // if we already have a stateChar, then it means // that there was something like ** or +? in there. // Handle the stateChar, then proceed with this one. self.debug('call clearStateChar %j', stateChar) clearStateChar() stateChar = c // if extglob is disabled, then +(asdf|foo) isn't a thing. // just clear the statechar *now*, rather than even diving into // the patternList stuff. if (options.noext) clearStateChar() continue case '(': if (inClass) { re += '(' continue } if (!stateChar) { re += '\\(' continue } patternListStack.push({ type: stateChar, start: i - 1, reStart: re.length, open: plTypes[stateChar].open, close: plTypes[stateChar].close }) // negation is (?:(?!js)[^/]*) re += stateChar === '!' ? '(?:(?!(?:' : '(?:' this.debug('plType %j %j', stateChar, re) stateChar = false continue case ')': if (inClass || !patternListStack.length) { re += '\\)' continue } clearStateChar() hasMagic = true var pl = patternListStack.pop() // negation is (?:(?!js)[^/]*) // The others are (?:) re += pl.close if (pl.type === '!') { negativeLists.push(pl) } pl.reEnd = re.length continue case '|': if (inClass || !patternListStack.length || escaping) { re += '\\|' escaping = false continue } clearStateChar() re += '|' continue // these are mostly the same in regexp and glob case '[': // swallow any state-tracking char before the [ clearStateChar() if (inClass) { re += '\\' + c continue } inClass = true classStart = i reClassStart = re.length re += c continue case ']': // a right bracket shall lose its special // meaning and represent itself in // a bracket expression if it occurs // first in the list. -- POSIX.2 2.8.3.2 if (i === classStart + 1 || !inClass) { re += '\\' + c escaping = false continue } // handle the case where we left a class open. // "[z-a]" is valid, equivalent to "\[z-a\]" if (inClass) { // split where the last [ was, make sure we don't have // an invalid re. if so, re-walk the contents of the // would-be class to re-translate any characters that // were passed through as-is // TODO: It would probably be faster to determine this // without a try/catch and a new RegExp, but it's tricky // to do safely. For now, this is safe and works. var cs = pattern.substring(classStart + 1, i) try { RegExp('[' + cs + ']') } catch (er) { // not a valid class! var sp = this.parse(cs, SUBPARSE) re = re.substr(0, reClassStart) + '\\[' + sp[0] + '\\]' hasMagic = hasMagic || sp[1] inClass = false continue } } // finish up the class. hasMagic = true inClass = false re += c continue default: // swallow any state char that wasn't consumed clearStateChar() if (escaping) { // no need escaping = false } else if (reSpecials[c] && !(c === '^' && inClass)) { re += '\\' } re += c } // switch } // for // handle the case where we left a class open. // "[abc" is valid, equivalent to "\[abc" if (inClass) { // split where the last [ was, and escape it // this is a huge pita. We now have to re-walk // the contents of the would-be class to re-translate // any characters that were passed through as-is cs = pattern.substr(classStart + 1) sp = this.parse(cs, SUBPARSE) re = re.substr(0, reClassStart) + '\\[' + sp[0] hasMagic = hasMagic || sp[1] } // handle the case where we had a +( thing at the *end* // of the pattern. // each pattern list stack adds 3 chars, and we need to go through // and escape any | chars that were passed through as-is for the regexp. // Go through and escape them, taking care not to double-escape any // | chars that were already escaped. for (pl = patternListStack.pop(); pl; pl = patternListStack.pop()) { var tail = re.slice(pl.reStart + pl.open.length) this.debug('setting tail', re, pl) // maybe some even number of \, then maybe 1 \, followed by a | tail = tail.replace(/((?:\\{2}){0,64})(\\?)\|/g, function (_, $1, $2) { if (!$2) { // the | isn't already escaped, so escape it. $2 = '\\' } // need to escape all those slashes *again*, without escaping the // one that we need for escaping the | character. As it works out, // escaping an even number of slashes can be done by simply repeating // it exactly after itself. That's why this trick works. // // I am sorry that you have to see this. return $1 + $1 + $2 + '|' }) this.debug('tail=%j\n %s', tail, tail, pl, re) var t = pl.type === '*' ? star : pl.type === '?' ? qmark : '\\' + pl.type hasMagic = true re = re.slice(0, pl.reStart) + t + '\\(' + tail } // handle trailing things that only matter at the very end. clearStateChar() if (escaping) { // trailing \\ re += '\\\\' } // only need to apply the nodot start if the re starts with // something that could conceivably capture a dot var addPatternStart = false switch (re.charAt(0)) { case '.': case '[': case '(': addPatternStart = true } // Hack to work around lack of negative lookbehind in JS // A pattern like: *.!(x).!(y|z) needs to ensure that a name // like 'a.xyz.yz' doesn't match. So, the first negative // lookahead, has to look ALL the way ahead, to the end of // the pattern. for (var n = negativeLists.length - 1; n > -1; n--) { var nl = negativeLists[n] var nlBefore = re.slice(0, nl.reStart) var nlFirst = re.slice(nl.reStart, nl.reEnd - 8) var nlLast = re.slice(nl.reEnd - 8, nl.reEnd) var nlAfter = re.slice(nl.reEnd) nlLast += nlAfter // Handle nested stuff like *(*.js|!(*.json)), where open parens // mean that we should *not* include the ) in the bit that is considered // "after" the negated section. var openParensBefore = nlBefore.split('(').length - 1 var cleanAfter = nlAfter for (i = 0; i < openParensBefore; i++) { cleanAfter = cleanAfter.replace(/\)[+*?]?/, '') } nlAfter = cleanAfter var dollar = '' if (nlAfter === '' && isSub !== SUBPARSE) { dollar = '$' } var newRe = nlBefore + nlFirst + nlAfter + dollar + nlLast re = newRe } // if the re is not "" at this point, then we need to make sure // it doesn't match against an empty path part. // Otherwise a/* will match a/, which it should not. if (re !== '' && hasMagic) { re = '(?=.)' + re } if (addPatternStart) { re = patternStart + re } // parsing just a piece of a larger pattern. if (isSub === SUBPARSE) { return [re, hasMagic] } // skip the regexp for non-magical patterns // unescape anything in it, though, so that it'll be // an exact match against a file etc. if (!hasMagic) { return globUnescape(pattern) } var flags = options.nocase ? 'i' : '' try { var regExp = new RegExp('^' + re + '$', flags) } catch (er) { // If it was an invalid regular expression, then it can't match // anything. This trick looks for a character after the end of // the string, which is of course impossible, except in multi-line // mode, but it's not a /m regex. return new RegExp('$.') } regExp._glob = pattern regExp._src = re return regExp } minimatch.makeRe = function (pattern, options) { return new Minimatch(pattern, options || {}).makeRe() } Minimatch.prototype.makeRe = makeRe function makeRe () { if (this.regexp || this.regexp === false) return this.regexp // at this point, this.set is a 2d array of partial // pattern strings, or "**". // // It's better to use .match(). This function shouldn't // be used, really, but it's pretty convenient sometimes, // when you just want to work with a regex. var set = this.set if (!set.length) { this.regexp = false return this.regexp } var options = this.options var twoStar = options.noglobstar ? star : options.dot ? twoStarDot : twoStarNoDot var flags = options.nocase ? 'i' : '' var re = set.map(function (pattern) { return pattern.map(function (p) { return (p === GLOBSTAR) ? twoStar : (typeof p === 'string') ? regExpEscape(p) : p._src }).join('\\\/') }).join('|') // must match entire pattern // ending in a * or ** will make it less strict. re = '^(?:' + re + ')$' // can match anything, as long as it's not this. if (this.negate) re = '^(?!' + re + ').*$' try { this.regexp = new RegExp(re, flags) } catch (ex) { this.regexp = false } return this.regexp } minimatch.match = function (list, pattern, options) { options = options || {} var mm = new Minimatch(pattern, options) list = list.filter(function (f) { return mm.match(f) }) if (mm.options.nonull && !list.length) { list.push(pattern) } return list } Minimatch.prototype.match = match function match (f, partial) { this.debug('match', f, this.pattern) // short-circuit in the case of busted things. // comments, etc. if (this.comment) return false if (this.empty) return f === '' if (f === '/' && partial) return true var options = this.options // windows: need to use /, not \ if (path.sep !== '/') { f = f.split(path.sep).join('/') } // treat the test path as a set of pathparts. f = f.split(slashSplit) this.debug(this.pattern, 'split', f) // just ONE of the pattern sets in this.set needs to match // in order for it to be valid. If negating, then just one // match means that we have failed. // Either way, return on the first hit. var set = this.set this.debug(this.pattern, 'set', set) // Find the basename of the path by looking for the last non-empty segment var filename var i for (i = f.length - 1; i >= 0; i--) { filename = f[i] if (filename) break } for (i = 0; i < set.length; i++) { var pattern = set[i] var file = f if (options.matchBase && pattern.length === 1) { file = [filename] } var hit = this.matchOne(file, pattern, partial) if (hit) { if (options.flipNegate) return true return !this.negate } } // didn't get any hits. this is success if it's a negative // pattern, failure otherwise. if (options.flipNegate) return false return this.negate } // set partial to true to test if, for example, // "/a/b" matches the start of "/*/b/*/d" // Partial means, if you run out of file before you run // out of pattern, then that's fine, as long as all // the parts match. Minimatch.prototype.matchOne = function (file, pattern, partial) { var options = this.options this.debug('matchOne', { 'this': this, file: file, pattern: pattern }) this.debug('matchOne', file.length, pattern.length) for (var fi = 0, pi = 0, fl = file.length, pl = pattern.length ; (fi < fl) && (pi < pl) ; fi++, pi++) { this.debug('matchOne loop') var p = pattern[pi] var f = file[fi] this.debug(pattern, p, f) // should be impossible. // some invalid regexp stuff in the set. if (p === false) return false if (p === GLOBSTAR) { this.debug('GLOBSTAR', [pattern, p, f]) // "**" // a/**/b/**/c would match the following: // a/b/x/y/z/c // a/x/y/z/b/c // a/b/x/b/x/c // a/b/c // To do this, take the rest of the pattern after // the **, and see if it would match the file remainder. // If so, return success. // If not, the ** "swallows" a segment, and try again. // This is recursively awful. // // a/**/b/**/c matching a/b/x/y/z/c // - a matches a // - doublestar // - matchOne(b/x/y/z/c, b/**/c) // - b matches b // - doublestar // - matchOne(x/y/z/c, c) -> no // - matchOne(y/z/c, c) -> no // - matchOne(z/c, c) -> no // - matchOne(c, c) yes, hit var fr = fi var pr = pi + 1 if (pr === pl) { this.debug('** at the end') // a ** at the end will just swallow the rest. // We have found a match. // however, it will not swallow /.x, unless // options.dot is set. // . and .. are *never* matched by **, for explosively // exponential reasons. for (; fi < fl; fi++) { if (file[fi] === '.' || file[fi] === '..' || (!options.dot && file[fi].charAt(0) === '.')) return false } return true } // ok, let's see if we can swallow whatever we can. while (fr < fl) { var swallowee = file[fr] this.debug('\nglobstar while', file, fr, pattern, pr, swallowee) // XXX remove this slice. Just pass the start index. if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) { this.debug('globstar found match!', fr, fl, swallowee) // found a match. return true } else { // can't swallow "." or ".." ever. // can only swallow ".foo" when explicitly asked. if (swallowee === '.' || swallowee === '..' || (!options.dot && swallowee.charAt(0) === '.')) { this.debug('dot detected!', file, fr, pattern, pr) break } // ** swallows a segment, and continue. this.debug('globstar swallow a segment, and continue') fr++ } } // no match was found. // However, in partial mode, we can't say this is necessarily over. // If there's more *pattern* left, then if (partial) { // ran out of file this.debug('\n>>> no match, partial?', file, fr, pattern, pr) if (fr === fl) return true } return false } // something other than ** // non-magic patterns just have to match exactly // patterns with magic have been turned into regexps. var hit if (typeof p === 'string') { if (options.nocase) { hit = f.toLowerCase() === p.toLowerCase() } else { hit = f === p } this.debug('string match', p, f, hit) } else { hit = f.match(p) this.debug('pattern match', p, f, hit) } if (!hit) return false } // Note: ending in / means that we'll get a final "" // at the end of the pattern. This can only match a // corresponding "" at the end of the file. // If the file ends in /, then it can only match a // a pattern that ends in /, unless the pattern just // doesn't have any more for it. But, a/b/ should *not* // match "a/b/*", even though "" matches against the // [^/]*? pattern, except in partial mode, where it might // simply not be reached yet. // However, a/b/ should still satisfy a/* // now either we fell off the end of the pattern, or we're done. if (fi === fl && pi === pl) { // ran out of pattern and filename at the same time. // an exact hit! return true } else if (fi === fl) { // ran out of file, but still had pattern left. // this is ok if we're doing the match as part of // a glob fs traversal. return partial } else if (pi === pl) { // ran out of pattern, still have file left. // this is only acceptable if we're on the very last // empty segment of a file with a trailing slash. // a/* should match a/b/ var emptyFileEnd = (fi === fl - 1) && (file[fi] === '') return emptyFileEnd } // should be unreachable. throw new Error('wtf?') } // replace stuff like \* with * function globUnescape (s) { return s.replace(/\\(.)/g, '$1') } function regExpEscape (s) { return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&') } /***/ }), /* 60 */ /***/ (function(module, exports) { module.exports = require("events"); /***/ }), /* 61 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; function posix(path) { return path.charAt(0) === '/'; } function win32(path) { // https://github.com/nodejs/node/blob/b3fcc245fb25539909ef1d5eaa01dbf92e168633/lib/path.js#L56 var splitDeviceRe = /^([a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/]+[^\\\/]+)?([\\\/])?([\s\S]*?)$/; var result = splitDeviceRe.exec(path); var device = result[1] || ''; var isUnc = Boolean(device && device.charAt(1) !== ':'); // UNC paths are always absolute return Boolean(result[2] || isUnc); } module.exports = process.platform === 'win32' ? win32 : posix; module.exports.posix = posix; module.exports.win32 = win32; /***/ }), /* 62 */ /***/ (function(module, exports, __webpack_require__) { var wrappy = __webpack_require__(110) module.exports = wrappy(once) module.exports.strict = wrappy(onceStrict) once.proto = once(function () { Object.defineProperty(Function.prototype, 'once', { value: function () { return once(this) }, configurable: true }) Object.defineProperty(Function.prototype, 'onceStrict', { value: function () { return onceStrict(this) }, configurable: true }) }) function once (fn) { var f = function () { if (f.called) return f.value f.called = true return f.value = fn.apply(this, arguments) } f.called = false return f } function onceStrict (fn) { var f = function () { if (f.called) throw new Error(f.onceError) f.called = true return f.value = fn.apply(this, arguments) } var name = fn.name || 'Function wrapped with `once`' f.onceError = name + " shouldn't be called more than once" f.called = false return f } /***/ }), /* 63 */ /***/ (function(module, exports) { module.exports = function(module) { if(!module.webpackPolyfill) { module.deprecate = function() {}; module.paths = []; // module.parent = undefined by default if(!module.children) module.children = []; Object.defineProperty(module, "loaded", { enumerable: true, get: function() { return module.l; } }); Object.defineProperty(module, "id", { enumerable: true, get: function() { return module.i; } }); module.webpackPolyfill = 1; } return module; }; /***/ }), /* 64 */ /***/ (function(module, exports, __webpack_require__) { /* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** * @license * Lodash * Copyright JS Foundation and other contributors * Released under MIT license * Based on Underscore.js 1.8.3 * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors */ ;(function() { /** Used as a safe reference for `undefined` in pre-ES5 environments. */ var undefined; /** Used as the semantic version number. */ var VERSION = '4.17.5'; /** Used as the size to enable large array optimizations. */ var LARGE_ARRAY_SIZE = 200; /** Error message constants. */ var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', FUNC_ERROR_TEXT = 'Expected a function'; /** Used to stand-in for `undefined` hash values. */ var HASH_UNDEFINED = '__lodash_hash_undefined__'; /** Used as the maximum memoize cache size. */ var MAX_MEMOIZE_SIZE = 500; /** Used as the internal argument placeholder. */ var PLACEHOLDER = '__lodash_placeholder__'; /** Used to compose bitmasks for cloning. */ var CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG = 4; /** Used to compose bitmasks for value comparisons. */ var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2; /** Used to compose bitmasks for function metadata. */ var WRAP_BIND_FLAG = 1, WRAP_BIND_KEY_FLAG = 2, WRAP_CURRY_BOUND_FLAG = 4, WRAP_CURRY_FLAG = 8, WRAP_CURRY_RIGHT_FLAG = 16, WRAP_PARTIAL_FLAG = 32, WRAP_PARTIAL_RIGHT_FLAG = 64, WRAP_ARY_FLAG = 128, WRAP_REARG_FLAG = 256, WRAP_FLIP_FLAG = 512; /** Used as default options for `_.truncate`. */ var DEFAULT_TRUNC_LENGTH = 30, DEFAULT_TRUNC_OMISSION = '...'; /** Used to detect hot functions by number of calls within a span of milliseconds. */ var HOT_COUNT = 800, HOT_SPAN = 16; /** Used to indicate the type of lazy iteratees. */ var LAZY_FILTER_FLAG = 1, LAZY_MAP_FLAG = 2, LAZY_WHILE_FLAG = 3; /** Used as references for various `Number` constants. */ var INFINITY = 1 / 0, MAX_SAFE_INTEGER = 9007199254740991, MAX_INTEGER = 1.7976931348623157e+308, NAN = 0 / 0; /** Used as references for the maximum length and index of an array. */ var MAX_ARRAY_LENGTH = 4294967295, MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; /** Used to associate wrap methods with their bit flags. */ var wrapFlags = [ ['ary', WRAP_ARY_FLAG], ['bind', WRAP_BIND_FLAG], ['bindKey', WRAP_BIND_KEY_FLAG], ['curry', WRAP_CURRY_FLAG], ['curryRight', WRAP_CURRY_RIGHT_FLAG], ['flip', WRAP_FLIP_FLAG], ['partial', WRAP_PARTIAL_FLAG], ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], ['rearg', WRAP_REARG_FLAG] ]; /** `Object#toString` result references. */ var argsTag = '[object Arguments]', arrayTag = '[object Array]', asyncTag = '[object AsyncFunction]', boolTag = '[object Boolean]', dateTag = '[object Date]', domExcTag = '[object DOMException]', errorTag = '[object Error]', funcTag = '[object Function]', genTag = '[object GeneratorFunction]', mapTag = '[object Map]', numberTag = '[object Number]', nullTag = '[object Null]', objectTag = '[object Object]', promiseTag = '[object Promise]', proxyTag = '[object Proxy]', regexpTag = '[object RegExp]', setTag = '[object Set]', stringTag = '[object String]', symbolTag = '[object Symbol]', undefinedTag = '[object Undefined]', weakMapTag = '[object WeakMap]', weakSetTag = '[object WeakSet]'; var arrayBufferTag = '[object ArrayBuffer]', dataViewTag = '[object DataView]', float32Tag = '[object Float32Array]', float64Tag = '[object Float64Array]', int8Tag = '[object Int8Array]', int16Tag = '[object Int16Array]', int32Tag = '[object Int32Array]', uint8Tag = '[object Uint8Array]', uint8ClampedTag = '[object Uint8ClampedArray]', uint16Tag = '[object Uint16Array]', uint32Tag = '[object Uint32Array]'; /** Used to match empty string literals in compiled template source. */ var reEmptyStringLeading = /\b__p \+= '';/g, reEmptyStringMiddle = /\b(__p \+=) '' \+/g, reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; /** Used to match HTML entities and HTML characters. */ var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, reUnescapedHtml = /[&<>"']/g, reHasEscapedHtml = RegExp(reEscapedHtml.source), reHasUnescapedHtml = RegExp(reUnescapedHtml.source); /** Used to match template delimiters. */ var reEscape = /<%-([\s\S]+?)%>/g, reEvaluate = /<%([\s\S]+?)%>/g, reInterpolate = /<%=([\s\S]+?)%>/g; /** Used to match property names within property paths. */ var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/, rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; /** * Used to match `RegExp` * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). */ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, reHasRegExpChar = RegExp(reRegExpChar.source); /** Used to match leading and trailing whitespace. */ var reTrim = /^\s+|\s+$/g, reTrimStart = /^\s+/, reTrimEnd = /\s+$/; /** Used to match wrap detail comments. */ var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, reSplitDetails = /,? & /; /** Used to match words composed of alphanumeric characters. */ var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; /** Used to match backslashes in property paths. */ var reEscapeChar = /\\(\\)?/g; /** * Used to match * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). */ var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; /** Used to match `RegExp` flags from their coerced string values. */ var reFlags = /\w*$/; /** Used to detect bad signed hexadecimal string values. */ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; /** Used to detect binary string values. */ var reIsBinary = /^0b[01]+$/i; /** Used to detect host constructors (Safari). */ var reIsHostCtor = /^\[object .+?Constructor\]$/; /** Used to detect octal string values. */ var reIsOctal = /^0o[0-7]+$/i; /** Used to detect unsigned integer values. */ var reIsUint = /^(?:0|[1-9]\d*)$/; /** Used to match Latin Unicode letters (excluding mathematical operators). */ var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; /** Used to ensure capturing order of template delimiters. */ var reNoMatch = /($^)/; /** Used to match unescaped characters in compiled string literals. */ var reUnescapedString = /['\n\r\u2028\u2029\\]/g; /** Used to compose unicode character classes. */ var rsAstralRange = '\\ud800-\\udfff', rsComboMarksRange = '\\u0300-\\u036f', reComboHalfMarksRange = '\\ufe20-\\ufe2f', rsComboSymbolsRange = '\\u20d0-\\u20ff', rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, rsDingbatRange = '\\u2700-\\u27bf', rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', rsPunctuationRange = '\\u2000-\\u206f', rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', rsVarRange = '\\ufe0e\\ufe0f', rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; /** Used to compose unicode capture groups. */ var rsApos = "['\u2019]", rsAstral = '[' + rsAstralRange + ']', rsBreak = '[' + rsBreakRange + ']', rsCombo = '[' + rsComboRange + ']', rsDigits = '\\d+', rsDingbat = '[' + rsDingbatRange + ']', rsLower = '[' + rsLowerRange + ']', rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', rsFitz = '\\ud83c[\\udffb-\\udfff]', rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', rsNonAstral = '[^' + rsAstralRange + ']', rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', rsUpper = '[' + rsUpperRange + ']', rsZWJ = '\\u200d'; /** Used to compose unicode regexes. */ var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', reOptMod = rsModifier + '?', rsOptVar = '[' + rsVarRange + ']?', rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', rsSeq = rsOptVar + reOptMod + rsOptJoin, rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; /** Used to match apostrophes. */ var reApos = RegExp(rsApos, 'g'); /** * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). */ var reComboMark = RegExp(rsCombo, 'g'); /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); /** Used to match complex or compound words. */ var reUnicodeWord = RegExp([ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, rsUpper + '+' + rsOptContrUpper, rsOrdUpper, rsOrdLower, rsDigits, rsEmoji ].join('|'), 'g'); /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); /** Used to detect strings that need a more robust regexp to match words. */ var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; /** Used to assign default `context` object properties. */ var contextProps = [ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' ]; /** Used to make template sourceURLs easier to identify. */ var templateCounter = -1; /** Used to identify `toStringTag` values of typed arrays. */ var typedArrayTags = {}; typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true; typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false; /** Used to identify `toStringTag` values supported by `_.clone`. */ var cloneableTags = {}; cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false; /** Used to map Latin Unicode letters to basic Latin letters. */ var deburredLetters = { // Latin-1 Supplement block. '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', '\xc7': 'C', '\xe7': 'c', '\xd0': 'D', '\xf0': 'd', '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', '\xd1': 'N', '\xf1': 'n', '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', '\xc6': 'Ae', '\xe6': 'ae', '\xde': 'Th', '\xfe': 'th', '\xdf': 'ss', // Latin Extended-A block. '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', '\u0134': 'J', '\u0135': 'j', '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', '\u0163': 't', '\u0165': 't', '\u0167': 't', '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', '\u0174': 'W', '\u0175': 'w', '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', '\u0132': 'IJ', '\u0133': 'ij', '\u0152': 'Oe', '\u0153': 'oe', '\u0149': "'n", '\u017f': 's' }; /** Used to map characters to HTML entities. */ var htmlEscapes = { '&': '&', '<': '<', '>': '>', '"': '"', "'": ''' }; /** Used to map HTML entities to characters. */ var htmlUnescapes = { '&': '&', '<': '<', '>': '>', '"': '"', ''': "'" }; /** Used to escape characters for inclusion in compiled string literals. */ var stringEscapes = { '\\': '\\', "'": "'", '\n': 'n', '\r': 'r', '\u2028': 'u2028', '\u2029': 'u2029' }; /** Built-in method references without a dependency on `root`. */ var freeParseFloat = parseFloat, freeParseInt = parseInt; /** Detect free variable `global` from Node.js. */ var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; /** Detect free variable `self`. */ var freeSelf = typeof self == 'object' && self && self.Object === Object && self; /** Used as a reference to the global object. */ var root = freeGlobal || freeSelf || Function('return this')(); /** Detect free variable `exports`. */ var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; /** Detect free variable `module`. */ var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; /** Detect the popular CommonJS extension `module.exports`. */ var moduleExports = freeModule && freeModule.exports === freeExports; /** Detect free variable `process` from Node.js. */ var freeProcess = moduleExports && freeGlobal.process; /** Used to access faster Node.js helpers. */ var nodeUtil = (function() { try { return freeProcess && freeProcess.binding && freeProcess.binding('util'); } catch (e) {} }()); /* Node.js helper references. */ var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, nodeIsDate = nodeUtil && nodeUtil.isDate, nodeIsMap = nodeUtil && nodeUtil.isMap, nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, nodeIsSet = nodeUtil && nodeUtil.isSet, nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; /*--------------------------------------------------------------------------*/ /** * A faster alternative to `Function#apply`, this function invokes `func` * with the `this` binding of `thisArg` and the arguments of `args`. * * @private * @param {Function} func The function to invoke. * @param {*} thisArg The `this` binding of `func`. * @param {Array} args The arguments to invoke `func` with. * @returns {*} Returns the result of `func`. */ function apply(func, thisArg, args) { switch (args.length) { case 0: return func.call(thisArg); case 1: return func.call(thisArg, args[0]); case 2: return func.call(thisArg, args[0], args[1]); case 3: return func.call(thisArg, args[0], args[1], args[2]); } return func.apply(thisArg, args); } /** * A specialized version of `baseAggregator` for arrays. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function arrayAggregator(array, setter, iteratee, accumulator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { var value = array[index]; setter(accumulator, value, iteratee(value), array); } return accumulator; } /** * A specialized version of `_.forEach` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEach(array, iteratee) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (iteratee(array[index], index, array) === false) { break; } } return array; } /** * A specialized version of `_.forEachRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns `array`. */ function arrayEachRight(array, iteratee) { var length = array == null ? 0 : array.length; while (length--) { if (iteratee(array[length], length, array) === false) { break; } } return array; } /** * A specialized version of `_.every` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. */ function arrayEvery(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (!predicate(array[index], index, array)) { return false; } } return true; } /** * A specialized version of `_.filter` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function arrayFilter(array, predicate) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result[resIndex++] = value; } } return result; } /** * A specialized version of `_.includes` for arrays without support for * specifying an index to search from. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludes(array, value) { var length = array == null ? 0 : array.length; return !!length && baseIndexOf(array, value, 0) > -1; } /** * This function is like `arrayIncludes` except that it accepts a comparator. * * @private * @param {Array} [array] The array to inspect. * @param {*} target The value to search for. * @param {Function} comparator The comparator invoked per element. * @returns {boolean} Returns `true` if `target` is found, else `false`. */ function arrayIncludesWith(array, value, comparator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (comparator(value, array[index])) { return true; } } return false; } /** * A specialized version of `_.map` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function arrayMap(array, iteratee) { var index = -1, length = array == null ? 0 : array.length, result = Array(length); while (++index < length) { result[index] = iteratee(array[index], index, array); } return result; } /** * Appends the elements of `values` to `array`. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to append. * @returns {Array} Returns `array`. */ function arrayPush(array, values) { var index = -1, length = values.length, offset = array.length; while (++index < length) { array[offset + index] = values[index]; } return array; } /** * A specialized version of `_.reduce` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the first element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduce(array, iteratee, accumulator, initAccum) { var index = -1, length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[++index]; } while (++index < length) { accumulator = iteratee(accumulator, array[index], index, array); } return accumulator; } /** * A specialized version of `_.reduceRight` for arrays without support for * iteratee shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} [accumulator] The initial value. * @param {boolean} [initAccum] Specify using the last element of `array` as * the initial value. * @returns {*} Returns the accumulated value. */ function arrayReduceRight(array, iteratee, accumulator, initAccum) { var length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[--length]; } while (length--) { accumulator = iteratee(accumulator, array[length], length, array); } return accumulator; } /** * A specialized version of `_.some` for arrays without support for iteratee * shorthands. * * @private * @param {Array} [array] The array to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function arraySome(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (predicate(array[index], index, array)) { return true; } } return false; } /** * Gets the size of an ASCII `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ var asciiSize = baseProperty('length'); /** * Converts an ASCII `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function asciiToArray(string) { return string.split(''); } /** * Splits an ASCII `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function asciiWords(string) { return string.match(reAsciiWord) || []; } /** * The base implementation of methods like `_.findKey` and `_.findLastKey`, * without support for iteratee shorthands, which iterates over `collection` * using `eachFunc`. * * @private * @param {Array|Object} collection The collection to inspect. * @param {Function} predicate The function invoked per iteration. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the found element or its key, else `undefined`. */ function baseFindKey(collection, predicate, eachFunc) { var result; eachFunc(collection, function(value, key, collection) { if (predicate(value, key, collection)) { result = key; return false; } }); return result; } /** * The base implementation of `_.findIndex` and `_.findLastIndex` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} predicate The function invoked per iteration. * @param {number} fromIndex The index to search from. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseFindIndex(array, predicate, fromIndex, fromRight) { var length = array.length, index = fromIndex + (fromRight ? 1 : -1); while ((fromRight ? index-- : ++index < length)) { if (predicate(array[index], index, array)) { return index; } } return -1; } /** * The base implementation of `_.indexOf` without `fromIndex` bounds checks. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOf(array, value, fromIndex) { return value === value ? strictIndexOf(array, value, fromIndex) : baseFindIndex(array, baseIsNaN, fromIndex); } /** * This function is like `baseIndexOf` except that it accepts a comparator. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @param {Function} comparator The comparator invoked per element. * @returns {number} Returns the index of the matched value, else `-1`. */ function baseIndexOfWith(array, value, fromIndex, comparator) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (comparator(array[index], value)) { return index; } } return -1; } /** * The base implementation of `_.isNaN` without support for number objects. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. */ function baseIsNaN(value) { return value !== value; } /** * The base implementation of `_.mean` and `_.meanBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the mean. */ function baseMean(array, iteratee) { var length = array == null ? 0 : array.length; return length ? (baseSum(array, iteratee) / length) : NAN; } /** * The base implementation of `_.property` without support for deep paths. * * @private * @param {string} key The key of the property to get. * @returns {Function} Returns the new accessor function. */ function baseProperty(key) { return function(object) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.propertyOf` without support for deep paths. * * @private * @param {Object} object The object to query. * @returns {Function} Returns the new accessor function. */ function basePropertyOf(object) { return function(key) { return object == null ? undefined : object[key]; }; } /** * The base implementation of `_.reduce` and `_.reduceRight`, without support * for iteratee shorthands, which iterates over `collection` using `eachFunc`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {*} accumulator The initial value. * @param {boolean} initAccum Specify using the first or last element of * `collection` as the initial value. * @param {Function} eachFunc The function to iterate over `collection`. * @returns {*} Returns the accumulated value. */ function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { eachFunc(collection, function(value, index, collection) { accumulator = initAccum ? (initAccum = false, value) : iteratee(accumulator, value, index, collection); }); return accumulator; } /** * The base implementation of `_.sortBy` which uses `comparer` to define the * sort order of `array` and replaces criteria objects with their corresponding * values. * * @private * @param {Array} array The array to sort. * @param {Function} comparer The function to define sort order. * @returns {Array} Returns `array`. */ function baseSortBy(array, comparer) { var length = array.length; array.sort(comparer); while (length--) { array[length] = array[length].value; } return array; } /** * The base implementation of `_.sum` and `_.sumBy` without support for * iteratee shorthands. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {number} Returns the sum. */ function baseSum(array, iteratee) { var result, index = -1, length = array.length; while (++index < length) { var current = iteratee(array[index]); if (current !== undefined) { result = result === undefined ? current : (result + current); } } return result; } /** * The base implementation of `_.times` without support for iteratee shorthands * or max array length checks. * * @private * @param {number} n The number of times to invoke `iteratee`. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the array of results. */ function baseTimes(n, iteratee) { var index = -1, result = Array(n); while (++index < n) { result[index] = iteratee(index); } return result; } /** * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array * of key-value pairs for `object` corresponding to the property names of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the key-value pairs. */ function baseToPairs(object, props) { return arrayMap(props, function(key) { return [key, object[key]]; }); } /** * The base implementation of `_.unary` without support for storing metadata. * * @private * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. */ function baseUnary(func) { return function(value) { return func(value); }; } /** * The base implementation of `_.values` and `_.valuesIn` which creates an * array of `object` property values corresponding to the property names * of `props`. * * @private * @param {Object} object The object to query. * @param {Array} props The property names to get values for. * @returns {Object} Returns the array of property values. */ function baseValues(object, props) { return arrayMap(props, function(key) { return object[key]; }); } /** * Checks if a `cache` value for `key` exists. * * @private * @param {Object} cache The cache to query. * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function cacheHas(cache, key) { return cache.has(key); } /** * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the first unmatched string symbol. */ function charsStartIndex(strSymbols, chrSymbols) { var index = -1, length = strSymbols.length; while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol * that is not found in the character symbols. * * @private * @param {Array} strSymbols The string symbols to inspect. * @param {Array} chrSymbols The character symbols to find. * @returns {number} Returns the index of the last unmatched string symbol. */ function charsEndIndex(strSymbols, chrSymbols) { var index = strSymbols.length; while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} return index; } /** * Gets the number of `placeholder` occurrences in `array`. * * @private * @param {Array} array The array to inspect. * @param {*} placeholder The placeholder to search for. * @returns {number} Returns the placeholder count. */ function countHolders(array, placeholder) { var length = array.length, result = 0; while (length--) { if (array[length] === placeholder) { ++result; } } return result; } /** * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A * letters to basic Latin letters. * * @private * @param {string} letter The matched letter to deburr. * @returns {string} Returns the deburred letter. */ var deburrLetter = basePropertyOf(deburredLetters); /** * Used by `_.escape` to convert characters to HTML entities. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ var escapeHtmlChar = basePropertyOf(htmlEscapes); /** * Used by `_.template` to escape characters for inclusion in compiled string literals. * * @private * @param {string} chr The matched character to escape. * @returns {string} Returns the escaped character. */ function escapeStringChar(chr) { return '\\' + stringEscapes[chr]; } /** * Gets the value at `key` of `object`. * * @private * @param {Object} [object] The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function getValue(object, key) { return object == null ? undefined : object[key]; } /** * Checks if `string` contains Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a symbol is found, else `false`. */ function hasUnicode(string) { return reHasUnicode.test(string); } /** * Checks if `string` contains a word composed of Unicode symbols. * * @private * @param {string} string The string to inspect. * @returns {boolean} Returns `true` if a word is found, else `false`. */ function hasUnicodeWord(string) { return reHasUnicodeWord.test(string); } /** * Converts `iterator` to an array. * * @private * @param {Object} iterator The iterator to convert. * @returns {Array} Returns the converted array. */ function iteratorToArray(iterator) { var data, result = []; while (!(data = iterator.next()).done) { result.push(data.value); } return result; } /** * Converts `map` to its key-value pairs. * * @private * @param {Object} map The map to convert. * @returns {Array} Returns the key-value pairs. */ function mapToArray(map) { var index = -1, result = Array(map.size); map.forEach(function(value, key) { result[++index] = [key, value]; }); return result; } /** * Creates a unary function that invokes `func` with its argument transformed. * * @private * @param {Function} func The function to wrap. * @param {Function} transform The argument transform. * @returns {Function} Returns the new function. */ function overArg(func, transform) { return function(arg) { return func(transform(arg)); }; } /** * Replaces all `placeholder` elements in `array` with an internal placeholder * and returns an array of their indexes. * * @private * @param {Array} array The array to modify. * @param {*} placeholder The placeholder to replace. * @returns {Array} Returns the new array of placeholder indexes. */ function replaceHolders(array, placeholder) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value === placeholder || value === PLACEHOLDER) { array[index] = PLACEHOLDER; result[resIndex++] = index; } } return result; } /** * Gets the value at `key`, unless `key` is "__proto__". * * @private * @param {Object} object The object to query. * @param {string} key The key of the property to get. * @returns {*} Returns the property value. */ function safeGet(object, key) { return key == '__proto__' ? undefined : object[key]; } /** * Converts `set` to an array of its values. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the values. */ function setToArray(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = value; }); return result; } /** * Converts `set` to its value-value pairs. * * @private * @param {Object} set The set to convert. * @returns {Array} Returns the value-value pairs. */ function setToPairs(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = [value, value]; }); return result; } /** * A specialized version of `_.indexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictIndexOf(array, value, fromIndex) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (array[index] === value) { return index; } } return -1; } /** * A specialized version of `_.lastIndexOf` which performs strict equality * comparisons of values, i.e. `===`. * * @private * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} fromIndex The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. */ function strictLastIndexOf(array, value, fromIndex) { var index = fromIndex + 1; while (index--) { if (array[index] === value) { return index; } } return index; } /** * Gets the number of symbols in `string`. * * @private * @param {string} string The string to inspect. * @returns {number} Returns the string size. */ function stringSize(string) { return hasUnicode(string) ? unicodeSize(string) : asciiSize(string); } /** * Converts `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function stringToArray(string) { return hasUnicode(string) ? unicodeToArray(string) : asciiToArray(string); } /** * Used by `_.unescape` to convert HTML entities to characters. * * @private * @param {string} chr The matched character to unescape. * @returns {string} Returns the unescaped character. */ var unescapeHtmlChar = basePropertyOf(htmlUnescapes); /** * Gets the size of a Unicode `string`. * * @private * @param {string} string The string inspect. * @returns {number} Returns the string size. */ function unicodeSize(string) { var result = reUnicode.lastIndex = 0; while (reUnicode.test(string)) { ++result; } return result; } /** * Converts a Unicode `string` to an array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the converted array. */ function unicodeToArray(string) { return string.match(reUnicode) || []; } /** * Splits a Unicode `string` into an array of its words. * * @private * @param {string} The string to inspect. * @returns {Array} Returns the words of `string`. */ function unicodeWords(string) { return string.match(reUnicodeWord) || []; } /*--------------------------------------------------------------------------*/ /** * Create a new pristine `lodash` function using the `context` object. * * @static * @memberOf _ * @since 1.1.0 * @category Util * @param {Object} [context=root] The context object. * @returns {Function} Returns a new `lodash` function. * @example * * _.mixin({ 'foo': _.constant('foo') }); * * var lodash = _.runInContext(); * lodash.mixin({ 'bar': lodash.constant('bar') }); * * _.isFunction(_.foo); * // => true * _.isFunction(_.bar); * // => false * * lodash.isFunction(lodash.foo); * // => false * lodash.isFunction(lodash.bar); * // => true * * // Create a suped-up `defer` in Node.js. * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; */ var runInContext = (function runInContext(context) { context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); /** Built-in constructor references. */ var Array = context.Array, Date = context.Date, Error = context.Error, Function = context.Function, Math = context.Math, Object = context.Object, RegExp = context.RegExp, String = context.String, TypeError = context.TypeError; /** Used for built-in method references. */ var arrayProto = Array.prototype, funcProto = Function.prototype, objectProto = Object.prototype; /** Used to detect overreaching core-js shims. */ var coreJsData = context['__core-js_shared__']; /** Used to resolve the decompiled source of functions. */ var funcToString = funcProto.toString; /** Used to check objects for own properties. */ var hasOwnProperty = objectProto.hasOwnProperty; /** Used to generate unique IDs. */ var idCounter = 0; /** Used to detect methods masquerading as native. */ var maskSrcKey = (function() { var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); return uid ? ('Symbol(src)_1.' + uid) : ''; }()); /** * Used to resolve the * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) * of values. */ var nativeObjectToString = objectProto.toString; /** Used to infer the `Object` constructor. */ var objectCtorString = funcToString.call(Object); /** Used to restore the original `_` reference in `_.noConflict`. */ var oldDash = root._; /** Used to detect if a method is native. */ var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' ); /** Built-in value references. */ var Buffer = moduleExports ? context.Buffer : undefined, Symbol = context.Symbol, Uint8Array = context.Uint8Array, allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, getPrototype = overArg(Object.getPrototypeOf, Object), objectCreate = Object.create, propertyIsEnumerable = objectProto.propertyIsEnumerable, splice = arrayProto.splice, spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, symIterator = Symbol ? Symbol.iterator : undefined, symToStringTag = Symbol ? Symbol.toStringTag : undefined; var defineProperty = (function() { try { var func = getNative(Object, 'defineProperty'); func({}, '', {}); return func; } catch (e) {} }()); /** Mocked built-ins. */ var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, ctxNow = Date && Date.now !== root.Date.now && Date.now, ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; /* Built-in method references for those with the same name as other `lodash` methods. */ var nativeCeil = Math.ceil, nativeFloor = Math.floor, nativeGetSymbols = Object.getOwnPropertySymbols, nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, nativeIsFinite = context.isFinite, nativeJoin = arrayProto.join, nativeKeys = overArg(Object.keys, Object), nativeMax = Math.max, nativeMin = Math.min, nativeNow = Date.now, nativeParseInt = context.parseInt, nativeRandom = Math.random, nativeReverse = arrayProto.reverse; /* Built-in method references that are verified to be native. */ var DataView = getNative(context, 'DataView'), Map = getNative(context, 'Map'), Promise = getNative(context, 'Promise'), Set = getNative(context, 'Set'), WeakMap = getNative(context, 'WeakMap'), nativeCreate = getNative(Object, 'create'); /** Used to store function metadata. */ var metaMap = WeakMap && new WeakMap; /** Used to lookup unminified function names. */ var realNames = {}; /** Used to detect maps, sets, and weakmaps. */ var dataViewCtorString = toSource(DataView), mapCtorString = toSource(Map), promiseCtorString = toSource(Promise), setCtorString = toSource(Set), weakMapCtorString = toSource(WeakMap); /** Used to convert symbols to primitives and strings. */ var symbolProto = Symbol ? Symbol.prototype : undefined, symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, symbolToString = symbolProto ? symbolProto.toString : undefined; /*------------------------------------------------------------------------*/ /** * Creates a `lodash` object which wraps `value` to enable implicit method * chain sequences. Methods that operate on and return arrays, collections, * and functions can be chained together. Methods that retrieve a single value * or may return a primitive value will automatically end the chain sequence * and return the unwrapped value. Otherwise, the value must be unwrapped * with `_#value`. * * Explicit chain sequences, which must be unwrapped with `_#value`, may be * enabled using `_.chain`. * * The execution of chained methods is lazy, that is, it's deferred until * `_#value` is implicitly or explicitly called. * * Lazy evaluation allows several methods to support shortcut fusion. * Shortcut fusion is an optimization to merge iteratee calls; this avoids * the creation of intermediate arrays and can greatly reduce the number of * iteratee executions. Sections of a chain sequence qualify for shortcut * fusion if the section is applied to an array and iteratees accept only * one argument. The heuristic for whether a section qualifies for shortcut * fusion is subject to change. * * Chaining is supported in custom builds as long as the `_#value` method is * directly or indirectly included in the build. * * In addition to lodash methods, wrappers have `Array` and `String` methods. * * The wrapper `Array` methods are: * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` * * The wrapper `String` methods are: * `replace` and `split` * * The wrapper methods that support shortcut fusion are: * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` * * The chainable wrapper methods are: * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, * `zipObject`, `zipObjectDeep`, and `zipWith` * * The wrapper methods that are **not** chainable by default are: * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, * `upperFirst`, `value`, and `words` * * @name _ * @constructor * @category Seq * @param {*} value The value to wrap in a `lodash` instance. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2, 3]); * * // Returns an unwrapped value. * wrapped.reduce(_.add); * // => 6 * * // Returns a wrapped value. * var squares = wrapped.map(square); * * _.isArray(squares); * // => false * * _.isArray(squares.value()); * // => true */ function lodash(value) { if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { if (value instanceof LodashWrapper) { return value; } if (hasOwnProperty.call(value, '__wrapped__')) { return wrapperClone(value); } } return new LodashWrapper(value); } /** * The base implementation of `_.create` without support for assigning * properties to the created object. * * @private * @param {Object} proto The object to inherit from. * @returns {Object} Returns the new object. */ var baseCreate = (function() { function object() {} return function(proto) { if (!isObject(proto)) { return {}; } if (objectCreate) { return objectCreate(proto); } object.prototype = proto; var result = new object; object.prototype = undefined; return result; }; }()); /** * The function whose prototype chain sequence wrappers inherit from. * * @private */ function baseLodash() { // No operation performed. } /** * The base constructor for creating `lodash` wrapper objects. * * @private * @param {*} value The value to wrap. * @param {boolean} [chainAll] Enable explicit method chain sequences. */ function LodashWrapper(value, chainAll) { this.__wrapped__ = value; this.__actions__ = []; this.__chain__ = !!chainAll; this.__index__ = 0; this.__values__ = undefined; } /** * By default, the template delimiters used by lodash are like those in * embedded Ruby (ERB) as well as ES2015 template strings. Change the * following template settings to use alternative delimiters. * * @static * @memberOf _ * @type {Object} */ lodash.templateSettings = { /** * Used to detect `data` property values to be HTML-escaped. * * @memberOf _.templateSettings * @type {RegExp} */ 'escape': reEscape, /** * Used to detect code to be evaluated. * * @memberOf _.templateSettings * @type {RegExp} */ 'evaluate': reEvaluate, /** * Used to detect `data` property values to inject. * * @memberOf _.templateSettings * @type {RegExp} */ 'interpolate': reInterpolate, /** * Used to reference the data object in the template text. * * @memberOf _.templateSettings * @type {string} */ 'variable': '', /** * Used to import variables into the compiled template. * * @memberOf _.templateSettings * @type {Object} */ 'imports': { /** * A reference to the `lodash` function. * * @memberOf _.templateSettings.imports * @type {Function} */ '_': lodash } }; // Ensure wrappers are instances of `baseLodash`. lodash.prototype = baseLodash.prototype; lodash.prototype.constructor = lodash; LodashWrapper.prototype = baseCreate(baseLodash.prototype); LodashWrapper.prototype.constructor = LodashWrapper; /*------------------------------------------------------------------------*/ /** * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. * * @private * @constructor * @param {*} value The value to wrap. */ function LazyWrapper(value) { this.__wrapped__ = value; this.__actions__ = []; this.__dir__ = 1; this.__filtered__ = false; this.__iteratees__ = []; this.__takeCount__ = MAX_ARRAY_LENGTH; this.__views__ = []; } /** * Creates a clone of the lazy wrapper object. * * @private * @name clone * @memberOf LazyWrapper * @returns {Object} Returns the cloned `LazyWrapper` object. */ function lazyClone() { var result = new LazyWrapper(this.__wrapped__); result.__actions__ = copyArray(this.__actions__); result.__dir__ = this.__dir__; result.__filtered__ = this.__filtered__; result.__iteratees__ = copyArray(this.__iteratees__); result.__takeCount__ = this.__takeCount__; result.__views__ = copyArray(this.__views__); return result; } /** * Reverses the direction of lazy iteration. * * @private * @name reverse * @memberOf LazyWrapper * @returns {Object} Returns the new reversed `LazyWrapper` object. */ function lazyReverse() { if (this.__filtered__) { var result = new LazyWrapper(this); result.__dir__ = -1; result.__filtered__ = true; } else { result = this.clone(); result.__dir__ *= -1; } return result; } /** * Extracts the unwrapped value from its lazy wrapper. * * @private * @name value * @memberOf LazyWrapper * @returns {*} Returns the unwrapped value. */ function lazyValue() { var array = this.__wrapped__.value(), dir = this.__dir__, isArr = isArray(array), isRight = dir < 0, arrLength = isArr ? array.length : 0, view = getView(0, arrLength, this.__views__), start = view.start, end = view.end, length = end - start, index = isRight ? end : (start - 1), iteratees = this.__iteratees__, iterLength = iteratees.length, resIndex = 0, takeCount = nativeMin(length, this.__takeCount__); if (!isArr || (!isRight && arrLength == length && takeCount == length)) { return baseWrapperValue(array, this.__actions__); } var result = []; outer: while (length-- && resIndex < takeCount) { index += dir; var iterIndex = -1, value = array[index]; while (++iterIndex < iterLength) { var data = iteratees[iterIndex], iteratee = data.iteratee, type = data.type, computed = iteratee(value); if (type == LAZY_MAP_FLAG) { value = computed; } else if (!computed) { if (type == LAZY_FILTER_FLAG) { continue outer; } else { break outer; } } } result[resIndex++] = value; } return result; } // Ensure `LazyWrapper` is an instance of `baseLodash`. LazyWrapper.prototype = baseCreate(baseLodash.prototype); LazyWrapper.prototype.constructor = LazyWrapper; /*------------------------------------------------------------------------*/ /** * Creates a hash object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Hash(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the hash. * * @private * @name clear * @memberOf Hash */ function hashClear() { this.__data__ = nativeCreate ? nativeCreate(null) : {}; this.size = 0; } /** * Removes `key` and its value from the hash. * * @private * @name delete * @memberOf Hash * @param {Object} hash The hash to modify. * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function hashDelete(key) { var result = this.has(key) && delete this.__data__[key]; this.size -= result ? 1 : 0; return result; } /** * Gets the hash value for `key`. * * @private * @name get * @memberOf Hash * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function hashGet(key) { var data = this.__data__; if (nativeCreate) { var result = data[key]; return result === HASH_UNDEFINED ? undefined : result; } return hasOwnProperty.call(data, key) ? data[key] : undefined; } /** * Checks if a hash value for `key` exists. * * @private * @name has * @memberOf Hash * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function hashHas(key) { var data = this.__data__; return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } /** * Sets the hash `key` to `value`. * * @private * @name set * @memberOf Hash * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the hash instance. */ function hashSet(key, value) { var data = this.__data__; this.size += this.has(key) ? 0 : 1; data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; return this; } // Add methods to `Hash`. Hash.prototype.clear = hashClear; Hash.prototype['delete'] = hashDelete; Hash.prototype.get = hashGet; Hash.prototype.has = hashHas; Hash.prototype.set = hashSet; /*------------------------------------------------------------------------*/ /** * Creates an list cache object. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function ListCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the list cache. * * @private * @name clear * @memberOf ListCache */ function listCacheClear() { this.__data__ = []; this.size = 0; } /** * Removes `key` and its value from the list cache. * * @private * @name delete * @memberOf ListCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function listCacheDelete(key) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { return false; } var lastIndex = data.length - 1; if (index == lastIndex) { data.pop(); } else { splice.call(data, index, 1); } --this.size; return true; } /** * Gets the list cache value for `key`. * * @private * @name get * @memberOf ListCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function listCacheGet(key) { var data = this.__data__, index = assocIndexOf(data, key); return index < 0 ? undefined : data[index][1]; } /** * Checks if a list cache value for `key` exists. * * @private * @name has * @memberOf ListCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function listCacheHas(key) { return assocIndexOf(this.__data__, key) > -1; } /** * Sets the list cache `key` to `value`. * * @private * @name set * @memberOf ListCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the list cache instance. */ function listCacheSet(key, value) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { ++this.size; data.push([key, value]); } else { data[index][1] = value; } return this; } // Add methods to `ListCache`. ListCache.prototype.clear = listCacheClear; ListCache.prototype['delete'] = listCacheDelete; ListCache.prototype.get = listCacheGet; ListCache.prototype.has = listCacheHas; ListCache.prototype.set = listCacheSet; /*------------------------------------------------------------------------*/ /** * Creates a map cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function MapCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } /** * Removes all key-value entries from the map. * * @private * @name clear * @memberOf MapCache */ function mapCacheClear() { this.size = 0; this.__data__ = { 'hash': new Hash, 'map': new (Map || ListCache), 'string': new Hash }; } /** * Removes `key` and its value from the map. * * @private * @name delete * @memberOf MapCache * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function mapCacheDelete(key) { var result = getMapData(this, key)['delete'](key); this.size -= result ? 1 : 0; return result; } /** * Gets the map value for `key`. * * @private * @name get * @memberOf MapCache * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function mapCacheGet(key) { return getMapData(this, key).get(key); } /** * Checks if a map value for `key` exists. * * @private * @name has * @memberOf MapCache * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function mapCacheHas(key) { return getMapData(this, key).has(key); } /** * Sets the map `key` to `value`. * * @private * @name set * @memberOf MapCache * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the map cache instance. */ function mapCacheSet(key, value) { var data = getMapData(this, key), size = data.size; data.set(key, value); this.size += data.size == size ? 0 : 1; return this; } // Add methods to `MapCache`. MapCache.prototype.clear = mapCacheClear; MapCache.prototype['delete'] = mapCacheDelete; MapCache.prototype.get = mapCacheGet; MapCache.prototype.has = mapCacheHas; MapCache.prototype.set = mapCacheSet; /*------------------------------------------------------------------------*/ /** * * Creates an array cache object to store unique values. * * @private * @constructor * @param {Array} [values] The values to cache. */ function SetCache(values) { var index = -1, length = values == null ? 0 : values.length; this.__data__ = new MapCache; while (++index < length) { this.add(values[index]); } } /** * Adds `value` to the array cache. * * @private * @name add * @memberOf SetCache * @alias push * @param {*} value The value to cache. * @returns {Object} Returns the cache instance. */ function setCacheAdd(value) { this.__data__.set(value, HASH_UNDEFINED); return this; } /** * Checks if `value` is in the array cache. * * @private * @name has * @memberOf SetCache * @param {*} value The value to search for. * @returns {number} Returns `true` if `value` is found, else `false`. */ function setCacheHas(value) { return this.__data__.has(value); } // Add methods to `SetCache`. SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; SetCache.prototype.has = setCacheHas; /*------------------------------------------------------------------------*/ /** * Creates a stack cache object to store key-value pairs. * * @private * @constructor * @param {Array} [entries] The key-value pairs to cache. */ function Stack(entries) { var data = this.__data__ = new ListCache(entries); this.size = data.size; } /** * Removes all key-value entries from the stack. * * @private * @name clear * @memberOf Stack */ function stackClear() { this.__data__ = new ListCache; this.size = 0; } /** * Removes `key` and its value from the stack. * * @private * @name delete * @memberOf Stack * @param {string} key The key of the value to remove. * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ function stackDelete(key) { var data = this.__data__, result = data['delete'](key); this.size = data.size; return result; } /** * Gets the stack value for `key`. * * @private * @name get * @memberOf Stack * @param {string} key The key of the value to get. * @returns {*} Returns the entry value. */ function stackGet(key) { return this.__data__.get(key); } /** * Checks if a stack value for `key` exists. * * @private * @name has * @memberOf Stack * @param {string} key The key of the entry to check. * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ function stackHas(key) { return this.__data__.has(key); } /** * Sets the stack `key` to `value`. * * @private * @name set * @memberOf Stack * @param {string} key The key of the value to set. * @param {*} value The value to set. * @returns {Object} Returns the stack cache instance. */ function stackSet(key, value) { var data = this.__data__; if (data instanceof ListCache) { var pairs = data.__data__; if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { pairs.push([key, value]); this.size = ++data.size; return this; } data = this.__data__ = new MapCache(pairs); } data.set(key, value); this.size = data.size; return this; } // Add methods to `Stack`. Stack.prototype.clear = stackClear; Stack.prototype['delete'] = stackDelete; Stack.prototype.get = stackGet; Stack.prototype.has = stackHas; Stack.prototype.set = stackSet; /*------------------------------------------------------------------------*/ /** * Creates an array of the enumerable property names of the array-like `value`. * * @private * @param {*} value The value to query. * @param {boolean} inherited Specify returning inherited property names. * @returns {Array} Returns the array of property names. */ function arrayLikeKeys(value, inherited) { var isArr = isArray(value), isArg = !isArr && isArguments(value), isBuff = !isArr && !isArg && isBuffer(value), isType = !isArr && !isArg && !isBuff && isTypedArray(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length; for (var key in value) { if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && ( // Safari 9 has enumerable `arguments.length` in strict mode. key == 'length' || // Node.js 0.10 has enumerable non-index properties on buffers. (isBuff && (key == 'offset' || key == 'parent')) || // PhantomJS 2 has enumerable non-index properties on typed arrays. (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || // Skip index properties. isIndex(key, length) ))) { result.push(key); } } return result; } /** * A specialized version of `_.sample` for arrays. * * @private * @param {Array} array The array to sample. * @returns {*} Returns the random element. */ function arraySample(array) { var length = array.length; return length ? array[baseRandom(0, length - 1)] : undefined; } /** * A specialized version of `_.sampleSize` for arrays. * * @private * @param {Array} array The array to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function arraySampleSize(array, n) { return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); } /** * A specialized version of `_.shuffle` for arrays. * * @private * @param {Array} array The array to shuffle. * @returns {Array} Returns the new shuffled array. */ function arrayShuffle(array) { return shuffleSelf(copyArray(array)); } /** * This function is like `assignValue` except that it doesn't assign * `undefined` values. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignMergeValue(object, key, value) { if ((value !== undefined && !eq(object[key], value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Assigns `value` to `key` of `object` if the existing value is not equivalent * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function assignValue(object, key, value) { var objValue = object[key]; if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } /** * Gets the index at which the `key` is found in `array` of key-value pairs. * * @private * @param {Array} array The array to inspect. * @param {*} key The key to search for. * @returns {number} Returns the index of the matched value, else `-1`. */ function assocIndexOf(array, key) { var length = array.length; while (length--) { if (eq(array[length][0], key)) { return length; } } return -1; } /** * Aggregates elements of `collection` on `accumulator` with keys transformed * by `iteratee` and values set by `setter`. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform keys. * @param {Object} accumulator The initial aggregated object. * @returns {Function} Returns `accumulator`. */ function baseAggregator(collection, setter, iteratee, accumulator) { baseEach(collection, function(value, key, collection) { setter(accumulator, value, iteratee(value), collection); }); return accumulator; } /** * The base implementation of `_.assign` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssign(object, source) { return object && copyObject(source, keys(source), object); } /** * The base implementation of `_.assignIn` without support for multiple sources * or `customizer` functions. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @returns {Object} Returns `object`. */ function baseAssignIn(object, source) { return object && copyObject(source, keysIn(source), object); } /** * The base implementation of `assignValue` and `assignMergeValue` without * value checks. * * @private * @param {Object} object The object to modify. * @param {string} key The key of the property to assign. * @param {*} value The value to assign. */ function baseAssignValue(object, key, value) { if (key == '__proto__' && defineProperty) { defineProperty(object, key, { 'configurable': true, 'enumerable': true, 'value': value, 'writable': true }); } else { object[key] = value; } } /** * The base implementation of `_.at` without support for individual paths. * * @private * @param {Object} object The object to iterate over. * @param {string[]} paths The property paths to pick. * @returns {Array} Returns the picked elements. */ function baseAt(object, paths) { var index = -1, length = paths.length, result = Array(length), skip = object == null; while (++index < length) { result[index] = skip ? undefined : get(object, paths[index]); } return result; } /** * The base implementation of `_.clamp` which doesn't coerce arguments. * * @private * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. */ function baseClamp(number, lower, upper) { if (number === number) { if (upper !== undefined) { number = number <= upper ? number : upper; } if (lower !== undefined) { number = number >= lower ? number : lower; } } return number; } /** * The base implementation of `_.clone` and `_.cloneDeep` which tracks * traversed objects. * * @private * @param {*} value The value to clone. * @param {boolean} bitmask The bitmask flags. * 1 - Deep clone * 2 - Flatten inherited properties * 4 - Clone symbols * @param {Function} [customizer] The function to customize cloning. * @param {string} [key] The key of `value`. * @param {Object} [object] The parent object of `value`. * @param {Object} [stack] Tracks traversed objects and their clone counterparts. * @returns {*} Returns the cloned value. */ function baseClone(value, bitmask, customizer, key, object, stack) { var result, isDeep = bitmask & CLONE_DEEP_FLAG, isFlat = bitmask & CLONE_FLAT_FLAG, isFull = bitmask & CLONE_SYMBOLS_FLAG; if (customizer) { result = object ? customizer(value, key, object, stack) : customizer(value); } if (result !== undefined) { return result; } if (!isObject(value)) { return value; } var isArr = isArray(value); if (isArr) { result = initCloneArray(value); if (!isDeep) { return copyArray(value, result); } } else { var tag = getTag(value), isFunc = tag == funcTag || tag == genTag; if (isBuffer(value)) { return cloneBuffer(value, isDeep); } if (tag == objectTag || tag == argsTag || (isFunc && !object)) { result = (isFlat || isFunc) ? {} : initCloneObject(value); if (!isDeep) { return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value)); } } else { if (!cloneableTags[tag]) { return object ? value : {}; } result = initCloneByTag(value, tag, isDeep); } } // Check for circular references and return its corresponding clone. stack || (stack = new Stack); var stacked = stack.get(value); if (stacked) { return stacked; } stack.set(value, result); if (isSet(value)) { value.forEach(function(subValue) { result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); }); return result; } if (isMap(value)) { value.forEach(function(subValue, key) { result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } var keysFunc = isFull ? (isFlat ? getAllKeysIn : getAllKeys) : (isFlat ? keysIn : keys); var props = isArr ? undefined : keysFunc(value); arrayEach(props || value, function(subValue, key) { if (props) { key = subValue; subValue = value[key]; } // Recursively populate clone (susceptible to call stack limits). assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } /** * The base implementation of `_.conforms` which doesn't clone `source`. * * @private * @param {Object} source The object of property predicates to conform to. * @returns {Function} Returns the new spec function. */ function baseConforms(source) { var props = keys(source); return function(object) { return baseConformsTo(object, source, props); }; } /** * The base implementation of `_.conformsTo` which accepts `props` to check. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. */ function baseConformsTo(object, source, props) { var length = props.length; if (object == null) { return !length; } object = Object(object); while (length--) { var key = props[length], predicate = source[key], value = object[key]; if ((value === undefined && !(key in object)) || !predicate(value)) { return false; } } return true; } /** * The base implementation of `_.delay` and `_.defer` which accepts `args` * to provide to `func`. * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {Array} args The arguments to provide to `func`. * @returns {number|Object} Returns the timer id or timeout object. */ function baseDelay(func, wait, args) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return setTimeout(function() { func.apply(undefined, args); }, wait); } /** * The base implementation of methods like `_.difference` without support * for excluding multiple arrays or iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Array} values The values to exclude. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. */ function baseDifference(array, values, iteratee, comparator) { var index = -1, includes = arrayIncludes, isCommon = true, length = array.length, result = [], valuesLength = values.length; if (!length) { return result; } if (iteratee) { values = arrayMap(values, baseUnary(iteratee)); } if (comparator) { includes = arrayIncludesWith; isCommon = false; } else if (values.length >= LARGE_ARRAY_SIZE) { includes = cacheHas; isCommon = false; values = new SetCache(values); } outer: while (++index < length) { var value = array[index], computed = iteratee == null ? value : iteratee(value); value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var valuesIndex = valuesLength; while (valuesIndex--) { if (values[valuesIndex] === computed) { continue outer; } } result.push(value); } else if (!includes(values, computed, comparator)) { result.push(value); } } return result; } /** * The base implementation of `_.forEach` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEach = createBaseEach(baseForOwn); /** * The base implementation of `_.forEachRight` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array|Object} Returns `collection`. */ var baseEachRight = createBaseEach(baseForOwnRight, true); /** * The base implementation of `_.every` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false` */ function baseEvery(collection, predicate) { var result = true; baseEach(collection, function(value, index, collection) { result = !!predicate(value, index, collection); return result; }); return result; } /** * The base implementation of methods like `_.max` and `_.min` which accepts a * `comparator` to determine the extremum value. * * @private * @param {Array} array The array to iterate over. * @param {Function} iteratee The iteratee invoked per iteration. * @param {Function} comparator The comparator used to compare values. * @returns {*} Returns the extremum value. */ function baseExtremum(array, iteratee, comparator) { var index = -1, length = array.length; while (++index < length) { var value = array[index], current = iteratee(value); if (current != null && (computed === undefined ? (current === current && !isSymbol(current)) : comparator(current, computed) )) { var computed = current, result = value; } } return result; } /** * The base implementation of `_.fill` without an iteratee call guard. * * @private * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. */ function baseFill(array, value, start, end) { var length = array.length; start = toInteger(start); if (start < 0) { start = -start > length ? 0 : (length + start); } end = (end === undefined || end > length) ? length : toInteger(end); if (end < 0) { end += length; } end = start > end ? 0 : toLength(end); while (start < end) { array[start++] = value; } return array; } /** * The base implementation of `_.filter` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {Array} Returns the new filtered array. */ function baseFilter(collection, predicate) { var result = []; baseEach(collection, function(value, index, collection) { if (predicate(value, index, collection)) { result.push(value); } }); return result; } /** * The base implementation of `_.flatten` with support for restricting flattening. * * @private * @param {Array} array The array to flatten. * @param {number} depth The maximum recursion depth. * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. * @param {Array} [result=[]] The initial result value. * @returns {Array} Returns the new flattened array. */ function baseFlatten(array, depth, predicate, isStrict, result) { var index = -1, length = array.length; predicate || (predicate = isFlattenable); result || (result = []); while (++index < length) { var value = array[index]; if (depth > 0 && predicate(value)) { if (depth > 1) { // Recursively flatten arrays (susceptible to call stack limits). baseFlatten(value, depth - 1, predicate, isStrict, result); } else { arrayPush(result, value); } } else if (!isStrict) { result[result.length] = value; } } return result; } /** * The base implementation of `baseForOwn` which iterates over `object` * properties returned by `keysFunc` and invokes `iteratee` for each property. * Iteratee functions may exit iteration early by explicitly returning `false`. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseFor = createBaseFor(); /** * This function is like `baseFor` except that it iterates over properties * in the opposite order. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @param {Function} keysFunc The function to get the keys of `object`. * @returns {Object} Returns `object`. */ var baseForRight = createBaseFor(true); /** * The base implementation of `_.forOwn` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwn(object, iteratee) { return object && baseFor(object, iteratee, keys); } /** * The base implementation of `_.forOwnRight` without support for iteratee shorthands. * * @private * @param {Object} object The object to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Object} Returns `object`. */ function baseForOwnRight(object, iteratee) { return object && baseForRight(object, iteratee, keys); } /** * The base implementation of `_.functions` which creates an array of * `object` function property names filtered from `props`. * * @private * @param {Object} object The object to inspect. * @param {Array} props The property names to filter. * @returns {Array} Returns the function names. */ function baseFunctions(object, props) { return arrayFilter(props, function(key) { return isFunction(object[key]); }); } /** * The base implementation of `_.get` without support for default values. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @returns {*} Returns the resolved value. */ function baseGet(object, path) { path = castPath(path, object); var index = 0, length = path.length; while (object != null && index < length) { object = object[toKey(path[index++])]; } return (index && index == length) ? object : undefined; } /** * The base implementation of `getAllKeys` and `getAllKeysIn` which uses * `keysFunc` and `symbolsFunc` to get the enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @param {Function} keysFunc The function to get the keys of `object`. * @param {Function} symbolsFunc The function to get the symbols of `object`. * @returns {Array} Returns the array of property names and symbols. */ function baseGetAllKeys(object, keysFunc, symbolsFunc) { var result = keysFunc(object); return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } /** * The base implementation of `getTag` without fallbacks for buggy environments. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ function baseGetTag(value) { if (value == null) { return value === undefined ? undefinedTag : nullTag; } return (symToStringTag && symToStringTag in Object(value)) ? getRawTag(value) : objectToString(value); } /** * The base implementation of `_.gt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. */ function baseGt(value, other) { return value > other; } /** * The base implementation of `_.has` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHas(object, key) { return object != null && hasOwnProperty.call(object, key); } /** * The base implementation of `_.hasIn` without support for deep paths. * * @private * @param {Object} [object] The object to query. * @param {Array|string} key The key to check. * @returns {boolean} Returns `true` if `key` exists, else `false`. */ function baseHasIn(object, key) { return object != null && key in Object(object); } /** * The base implementation of `_.inRange` which doesn't coerce arguments. * * @private * @param {number} number The number to check. * @param {number} start The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. */ function baseInRange(number, start, end) { return number >= nativeMin(start, end) && number < nativeMax(start, end); } /** * The base implementation of methods like `_.intersection`, without support * for iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of shared values. */ function baseIntersection(arrays, iteratee, comparator) { var includes = comparator ? arrayIncludesWith : arrayIncludes, length = arrays[0].length, othLength = arrays.length, othIndex = othLength, caches = Array(othLength), maxLength = Infinity, result = []; while (othIndex--) { var array = arrays[othIndex]; if (othIndex && iteratee) { array = arrayMap(array, baseUnary(iteratee)); } maxLength = nativeMin(array.length, maxLength); caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) ? new SetCache(othIndex && array) : undefined; } array = arrays[0]; var index = -1, seen = caches[0]; outer: while (++index < length && result.length < maxLength) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (!(seen ? cacheHas(seen, computed) : includes(result, computed, comparator) )) { othIndex = othLength; while (--othIndex) { var cache = caches[othIndex]; if (!(cache ? cacheHas(cache, computed) : includes(arrays[othIndex], computed, comparator)) ) { continue outer; } } if (seen) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.invert` and `_.invertBy` which inverts * `object` with values transformed by `iteratee` and set by `setter`. * * @private * @param {Object} object The object to iterate over. * @param {Function} setter The function to set `accumulator` values. * @param {Function} iteratee The iteratee to transform values. * @param {Object} accumulator The initial inverted object. * @returns {Function} Returns `accumulator`. */ function baseInverter(object, setter, iteratee, accumulator) { baseForOwn(object, function(value, key, object) { setter(accumulator, iteratee(value), key, object); }); return accumulator; } /** * The base implementation of `_.invoke` without support for individual * method arguments. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {Array} args The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. */ function baseInvoke(object, path, args) { path = castPath(path, object); object = parent(object, path); var func = object == null ? object : object[toKey(last(path))]; return func == null ? undefined : apply(func, object, args); } /** * The base implementation of `_.isArguments`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, */ function baseIsArguments(value) { return isObjectLike(value) && baseGetTag(value) == argsTag; } /** * The base implementation of `_.isArrayBuffer` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. */ function baseIsArrayBuffer(value) { return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; } /** * The base implementation of `_.isDate` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. */ function baseIsDate(value) { return isObjectLike(value) && baseGetTag(value) == dateTag; } /** * The base implementation of `_.isEqual` which supports partial comparisons * and tracks traversed objects. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {boolean} bitmask The bitmask flags. * 1 - Unordered comparison * 2 - Partial comparison * @param {Function} [customizer] The function to customize comparisons. * @param {Object} [stack] Tracks traversed `value` and `other` objects. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. */ function baseIsEqual(value, other, bitmask, customizer, stack) { if (value === other) { return true; } if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { return value !== value && other !== other; } return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } /** * A specialized version of `baseIsEqual` for arrays and objects which performs * deep comparisons and tracks traversed objects enabling objects with circular * references to be compared. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} [stack] Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { var objIsArr = isArray(object), othIsArr = isArray(other), objTag = objIsArr ? arrayTag : getTag(object), othTag = othIsArr ? arrayTag : getTag(other); objTag = objTag == argsTag ? objectTag : objTag; othTag = othTag == argsTag ? objectTag : othTag; var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag; if (isSameTag && isBuffer(object)) { if (!isBuffer(other)) { return false; } objIsArr = true; objIsObj = false; } if (isSameTag && !objIsObj) { stack || (stack = new Stack); return (objIsArr || isTypedArray(object)) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } if (!(bitmask & COMPARE_PARTIAL_FLAG)) { var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); if (objIsWrapped || othIsWrapped) { var objUnwrapped = objIsWrapped ? object.value() : object, othUnwrapped = othIsWrapped ? other.value() : other; stack || (stack = new Stack); return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); } } if (!isSameTag) { return false; } stack || (stack = new Stack); return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } /** * The base implementation of `_.isMap` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. */ function baseIsMap(value) { return isObjectLike(value) && getTag(value) == mapTag; } /** * The base implementation of `_.isMatch` without support for iteratee shorthands. * * @private * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Array} matchData The property names, values, and compare flags to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. */ function baseIsMatch(object, source, matchData, customizer) { var index = matchData.length, length = index, noCustomizer = !customizer; if (object == null) { return !length; } object = Object(object); while (index--) { var data = matchData[index]; if ((noCustomizer && data[2]) ? data[1] !== object[data[0]] : !(data[0] in object) ) { return false; } } while (++index < length) { data = matchData[index]; var key = data[0], objValue = object[key], srcValue = data[1]; if (noCustomizer && data[2]) { if (objValue === undefined && !(key in object)) { return false; } } else { var stack = new Stack; if (customizer) { var result = customizer(objValue, srcValue, key, object, source, stack); } if (!(result === undefined ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) : result )) { return false; } } } return true; } /** * The base implementation of `_.isNative` without bad shim checks. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. */ function baseIsNative(value) { if (!isObject(value) || isMasked(value)) { return false; } var pattern = isFunction(value) ? reIsNative : reIsHostCtor; return pattern.test(toSource(value)); } /** * The base implementation of `_.isRegExp` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. */ function baseIsRegExp(value) { return isObjectLike(value) && baseGetTag(value) == regexpTag; } /** * The base implementation of `_.isSet` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. */ function baseIsSet(value) { return isObjectLike(value) && getTag(value) == setTag; } /** * The base implementation of `_.isTypedArray` without Node.js optimizations. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. */ function baseIsTypedArray(value) { return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } /** * The base implementation of `_.iteratee`. * * @private * @param {*} [value=_.identity] The value to convert to an iteratee. * @returns {Function} Returns the iteratee. */ function baseIteratee(value) { // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. if (typeof value == 'function') { return value; } if (value == null) { return identity; } if (typeof value == 'object') { return isArray(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value); } return property(value); } /** * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeys(object) { if (!isPrototype(object)) { return nativeKeys(object); } var result = []; for (var key in Object(object)) { if (hasOwnProperty.call(object, key) && key != 'constructor') { result.push(key); } } return result; } /** * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function baseKeysIn(object) { if (!isObject(object)) { return nativeKeysIn(object); } var isProto = isPrototype(object), result = []; for (var key in object) { if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { result.push(key); } } return result; } /** * The base implementation of `_.lt` which doesn't coerce arguments. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. */ function baseLt(value, other) { return value < other; } /** * The base implementation of `_.map` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} iteratee The function invoked per iteration. * @returns {Array} Returns the new mapped array. */ function baseMap(collection, iteratee) { var index = -1, result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value, key, collection) { result[++index] = iteratee(value, key, collection); }); return result; } /** * The base implementation of `_.matches` which doesn't clone `source`. * * @private * @param {Object} source The object of property values to match. * @returns {Function} Returns the new spec function. */ function baseMatches(source) { var matchData = getMatchData(source); if (matchData.length == 1 && matchData[0][2]) { return matchesStrictComparable(matchData[0][0], matchData[0][1]); } return function(object) { return object === source || baseIsMatch(object, source, matchData); }; } /** * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. * * @private * @param {string} path The path of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function baseMatchesProperty(path, srcValue) { if (isKey(path) && isStrictComparable(srcValue)) { return matchesStrictComparable(toKey(path), srcValue); } return function(object) { var objValue = get(object, path); return (objValue === undefined && objValue === srcValue) ? hasIn(object, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); }; } /** * The base implementation of `_.merge` without support for multiple sources. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {number} srcIndex The index of `source`. * @param {Function} [customizer] The function to customize merged values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMerge(object, source, srcIndex, customizer, stack) { if (object === source) { return; } baseFor(source, function(srcValue, key) { if (isObject(srcValue)) { stack || (stack = new Stack); baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); } else { var newValue = customizer ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) : undefined; if (newValue === undefined) { newValue = srcValue; } assignMergeValue(object, key, newValue); } }, keysIn); } /** * A specialized version of `baseMerge` for arrays and objects which performs * deep merges and tracks traversed objects enabling objects with circular * references to be merged. * * @private * @param {Object} object The destination object. * @param {Object} source The source object. * @param {string} key The key of the value to merge. * @param {number} srcIndex The index of `source`. * @param {Function} mergeFunc The function to merge values. * @param {Function} [customizer] The function to customize assigned values. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. */ function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { var objValue = safeGet(object, key), srcValue = safeGet(source, key), stacked = stack.get(srcValue); if (stacked) { assignMergeValue(object, key, stacked); return; } var newValue = customizer ? customizer(objValue, srcValue, (key + ''), object, source, stack) : undefined; var isCommon = newValue === undefined; if (isCommon) { var isArr = isArray(srcValue), isBuff = !isArr && isBuffer(srcValue), isTyped = !isArr && !isBuff && isTypedArray(srcValue); newValue = srcValue; if (isArr || isBuff || isTyped) { if (isArray(objValue)) { newValue = objValue; } else if (isArrayLikeObject(objValue)) { newValue = copyArray(objValue); } else if (isBuff) { isCommon = false; newValue = cloneBuffer(srcValue, true); } else if (isTyped) { isCommon = false; newValue = cloneTypedArray(srcValue, true); } else { newValue = []; } } else if (isPlainObject(srcValue) || isArguments(srcValue)) { newValue = objValue; if (isArguments(objValue)) { newValue = toPlainObject(objValue); } else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { newValue = initCloneObject(srcValue); } } else { isCommon = false; } } if (isCommon) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, newValue); mergeFunc(newValue, srcValue, srcIndex, customizer, stack); stack['delete'](srcValue); } assignMergeValue(object, key, newValue); } /** * The base implementation of `_.nth` which doesn't coerce arguments. * * @private * @param {Array} array The array to query. * @param {number} n The index of the element to return. * @returns {*} Returns the nth element of `array`. */ function baseNth(array, n) { var length = array.length; if (!length) { return; } n += n < 0 ? length : 0; return isIndex(n, length) ? array[n] : undefined; } /** * The base implementation of `_.orderBy` without param guards. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. * @param {string[]} orders The sort orders of `iteratees`. * @returns {Array} Returns the new sorted array. */ function baseOrderBy(collection, iteratees, orders) { var index = -1; iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); var result = baseMap(collection, function(value, key, collection) { var criteria = arrayMap(iteratees, function(iteratee) { return iteratee(value); }); return { 'criteria': criteria, 'index': ++index, 'value': value }; }); return baseSortBy(result, function(object, other) { return compareMultiple(object, other, orders); }); } /** * The base implementation of `_.pick` without support for individual * property identifiers. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @returns {Object} Returns the new object. */ function basePick(object, paths) { return basePickBy(object, paths, function(value, path) { return hasIn(object, path); }); } /** * The base implementation of `_.pickBy` without support for iteratee shorthands. * * @private * @param {Object} object The source object. * @param {string[]} paths The property paths to pick. * @param {Function} predicate The function invoked per property. * @returns {Object} Returns the new object. */ function basePickBy(object, paths, predicate) { var index = -1, length = paths.length, result = {}; while (++index < length) { var path = paths[index], value = baseGet(object, path); if (predicate(value, path)) { baseSet(result, castPath(path, object), value); } } return result; } /** * A specialized version of `baseProperty` which supports deep paths. * * @private * @param {Array|string} path The path of the property to get. * @returns {Function} Returns the new accessor function. */ function basePropertyDeep(path) { return function(object) { return baseGet(object, path); }; } /** * The base implementation of `_.pullAllBy` without support for iteratee * shorthands. * * @private * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. */ function basePullAll(array, values, iteratee, comparator) { var indexOf = comparator ? baseIndexOfWith : baseIndexOf, index = -1, length = values.length, seen = array; if (array === values) { values = copyArray(values); } if (iteratee) { seen = arrayMap(array, baseUnary(iteratee)); } while (++index < length) { var fromIndex = 0, value = values[index], computed = iteratee ? iteratee(value) : value; while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { if (seen !== array) { splice.call(seen, fromIndex, 1); } splice.call(array, fromIndex, 1); } } return array; } /** * The base implementation of `_.pullAt` without support for individual * indexes or capturing the removed elements. * * @private * @param {Array} array The array to modify. * @param {number[]} indexes The indexes of elements to remove. * @returns {Array} Returns `array`. */ function basePullAt(array, indexes) { var length = array ? indexes.length : 0, lastIndex = length - 1; while (length--) { var index = indexes[length]; if (length == lastIndex || index !== previous) { var previous = index; if (isIndex(index)) { splice.call(array, index, 1); } else { baseUnset(array, index); } } } return array; } /** * The base implementation of `_.random` without support for returning * floating-point numbers. * * @private * @param {number} lower The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the random number. */ function baseRandom(lower, upper) { return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); } /** * The base implementation of `_.range` and `_.rangeRight` which doesn't * coerce arguments. * * @private * @param {number} start The start of the range. * @param {number} end The end of the range. * @param {number} step The value to increment or decrement by. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the range of numbers. */ function baseRange(start, end, step, fromRight) { var index = -1, length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), result = Array(length); while (length--) { result[fromRight ? length : ++index] = start; start += step; } return result; } /** * The base implementation of `_.repeat` which doesn't coerce arguments. * * @private * @param {string} string The string to repeat. * @param {number} n The number of times to repeat the string. * @returns {string} Returns the repeated string. */ function baseRepeat(string, n) { var result = ''; if (!string || n < 1 || n > MAX_SAFE_INTEGER) { return result; } // Leverage the exponentiation by squaring algorithm for a faster repeat. // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. do { if (n % 2) { result += string; } n = nativeFloor(n / 2); if (n) { string += string; } } while (n); return result; } /** * The base implementation of `_.rest` which doesn't validate or coerce arguments. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. */ function baseRest(func, start) { return setToString(overRest(func, start, identity), func + ''); } /** * The base implementation of `_.sample`. * * @private * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. */ function baseSample(collection) { return arraySample(values(collection)); } /** * The base implementation of `_.sampleSize` without param guards. * * @private * @param {Array|Object} collection The collection to sample. * @param {number} n The number of elements to sample. * @returns {Array} Returns the random elements. */ function baseSampleSize(collection, n) { var array = values(collection); return shuffleSelf(array, baseClamp(n, 0, array.length)); } /** * The base implementation of `_.set`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseSet(object, path, value, customizer) { if (!isObject(object)) { return object; } path = castPath(path, object); var index = -1, length = path.length, lastIndex = length - 1, nested = object; while (nested != null && ++index < length) { var key = toKey(path[index]), newValue = value; if (index != lastIndex) { var objValue = nested[key]; newValue = customizer ? customizer(objValue, key, nested) : undefined; if (newValue === undefined) { newValue = isObject(objValue) ? objValue : (isIndex(path[index + 1]) ? [] : {}); } } assignValue(nested, key, newValue); nested = nested[key]; } return object; } /** * The base implementation of `setData` without support for hot loop shorting. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var baseSetData = !metaMap ? identity : function(func, data) { metaMap.set(func, data); return func; }; /** * The base implementation of `setToString` without support for hot loop shorting. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var baseSetToString = !defineProperty ? identity : function(func, string) { return defineProperty(func, 'toString', { 'configurable': true, 'enumerable': false, 'value': constant(string), 'writable': true }); }; /** * The base implementation of `_.shuffle`. * * @private * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. */ function baseShuffle(collection) { return shuffleSelf(values(collection)); } /** * The base implementation of `_.slice` without an iteratee call guard. * * @private * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function baseSlice(array, start, end) { var index = -1, length = array.length; if (start < 0) { start = -start > length ? 0 : (length + start); } end = end > length ? length : end; if (end < 0) { end += length; } length = start > end ? 0 : ((end - start) >>> 0); start >>>= 0; var result = Array(length); while (++index < length) { result[index] = array[index + start]; } return result; } /** * The base implementation of `_.some` without support for iteratee shorthands. * * @private * @param {Array|Object} collection The collection to iterate over. * @param {Function} predicate The function invoked per iteration. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. */ function baseSome(collection, predicate) { var result; baseEach(collection, function(value, index, collection) { result = predicate(value, index, collection); return !result; }); return !!result; } /** * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which * performs a binary search of `array` to determine the index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndex(array, value, retHighest) { var low = 0, high = array == null ? low : array.length; if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { while (low < high) { var mid = (low + high) >>> 1, computed = array[mid]; if (computed !== null && !isSymbol(computed) && (retHighest ? (computed <= value) : (computed < value))) { low = mid + 1; } else { high = mid; } } return high; } return baseSortedIndexBy(array, value, identity, retHighest); } /** * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` * which invokes `iteratee` for `value` and each element of `array` to compute * their sort ranking. The iteratee is invoked with one argument; (value). * * @private * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} iteratee The iteratee invoked per element. * @param {boolean} [retHighest] Specify returning the highest qualified index. * @returns {number} Returns the index at which `value` should be inserted * into `array`. */ function baseSortedIndexBy(array, value, iteratee, retHighest) { value = iteratee(value); var low = 0, high = array == null ? 0 : array.length, valIsNaN = value !== value, valIsNull = value === null, valIsSymbol = isSymbol(value), valIsUndefined = value === undefined; while (low < high) { var mid = nativeFloor((low + high) / 2), computed = iteratee(array[mid]), othIsDefined = computed !== undefined, othIsNull = computed === null, othIsReflexive = computed === computed, othIsSymbol = isSymbol(computed); if (valIsNaN) { var setLow = retHighest || othIsReflexive; } else if (valIsUndefined) { setLow = othIsReflexive && (retHighest || othIsDefined); } else if (valIsNull) { setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); } else if (valIsSymbol) { setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); } else if (othIsNull || othIsSymbol) { setLow = false; } else { setLow = retHighest ? (computed <= value) : (computed < value); } if (setLow) { low = mid + 1; } else { high = mid; } } return nativeMin(high, MAX_ARRAY_INDEX); } /** * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without * support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseSortedUniq(array, iteratee) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; if (!index || !eq(computed, seen)) { var seen = computed; result[resIndex++] = value === 0 ? 0 : value; } } return result; } /** * The base implementation of `_.toNumber` which doesn't ensure correct * conversions of binary, hexadecimal, or octal string values. * * @private * @param {*} value The value to process. * @returns {number} Returns the number. */ function baseToNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } return +value; } /** * The base implementation of `_.toString` which doesn't convert nullish * values to empty strings. * * @private * @param {*} value The value to process. * @returns {string} Returns the string. */ function baseToString(value) { // Exit early for strings to avoid a performance hit in some environments. if (typeof value == 'string') { return value; } if (isArray(value)) { // Recursively convert values (susceptible to call stack limits). return arrayMap(value, baseToString) + ''; } if (isSymbol(value)) { return symbolToString ? symbolToString.call(value) : ''; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * The base implementation of `_.uniqBy` without support for iteratee shorthands. * * @private * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. */ function baseUniq(array, iteratee, comparator) { var index = -1, includes = arrayIncludes, length = array.length, isCommon = true, result = [], seen = result; if (comparator) { isCommon = false; includes = arrayIncludesWith; } else if (length >= LARGE_ARRAY_SIZE) { var set = iteratee ? null : createSet(array); if (set) { return setToArray(set); } isCommon = false; includes = cacheHas; seen = new SetCache; } else { seen = iteratee ? [] : result; } outer: while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var seenIndex = seen.length; while (seenIndex--) { if (seen[seenIndex] === computed) { continue outer; } } if (iteratee) { seen.push(computed); } result.push(value); } else if (!includes(seen, computed, comparator)) { if (seen !== result) { seen.push(computed); } result.push(value); } } return result; } /** * The base implementation of `_.unset`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The property path to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ function baseUnset(object, path) { path = castPath(path, object); object = parent(object, path); return object == null || delete object[toKey(last(path))]; } /** * The base implementation of `_.update`. * * @private * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to update. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize path creation. * @returns {Object} Returns `object`. */ function baseUpdate(object, path, updater, customizer) { return baseSet(object, path, updater(baseGet(object, path)), customizer); } /** * The base implementation of methods like `_.dropWhile` and `_.takeWhile` * without support for iteratee shorthands. * * @private * @param {Array} array The array to query. * @param {Function} predicate The function invoked per iteration. * @param {boolean} [isDrop] Specify dropping elements instead of taking them. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the slice of `array`. */ function baseWhile(array, predicate, isDrop, fromRight) { var length = array.length, index = fromRight ? length : -1; while ((fromRight ? index-- : ++index < length) && predicate(array[index], index, array)) {} return isDrop ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } /** * The base implementation of `wrapperValue` which returns the result of * performing a sequence of actions on the unwrapped `value`, where each * successive action is supplied the return value of the previous. * * @private * @param {*} value The unwrapped value. * @param {Array} actions Actions to perform to resolve the unwrapped value. * @returns {*} Returns the resolved value. */ function baseWrapperValue(value, actions) { var result = value; if (result instanceof LazyWrapper) { result = result.value(); } return arrayReduce(actions, function(result, action) { return action.func.apply(action.thisArg, arrayPush([result], action.args)); }, result); } /** * The base implementation of methods like `_.xor`, without support for * iteratee shorthands, that accepts an array of arrays to inspect. * * @private * @param {Array} arrays The arrays to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of values. */ function baseXor(arrays, iteratee, comparator) { var length = arrays.length; if (length < 2) { return length ? baseUniq(arrays[0]) : []; } var index = -1, result = Array(length); while (++index < length) { var array = arrays[index], othIndex = -1; while (++othIndex < length) { if (othIndex != index) { result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); } } } return baseUniq(baseFlatten(result, 1), iteratee, comparator); } /** * This base implementation of `_.zipObject` which assigns values using `assignFunc`. * * @private * @param {Array} props The property identifiers. * @param {Array} values The property values. * @param {Function} assignFunc The function to assign values. * @returns {Object} Returns the new object. */ function baseZipObject(props, values, assignFunc) { var index = -1, length = props.length, valsLength = values.length, result = {}; while (++index < length) { var value = index < valsLength ? values[index] : undefined; assignFunc(result, props[index], value); } return result; } /** * Casts `value` to an empty array if it's not an array like object. * * @private * @param {*} value The value to inspect. * @returns {Array|Object} Returns the cast array-like object. */ function castArrayLikeObject(value) { return isArrayLikeObject(value) ? value : []; } /** * Casts `value` to `identity` if it's not a function. * * @private * @param {*} value The value to inspect. * @returns {Function} Returns cast function. */ function castFunction(value) { return typeof value == 'function' ? value : identity; } /** * Casts `value` to a path array if it's not one. * * @private * @param {*} value The value to inspect. * @param {Object} [object] The object to query keys on. * @returns {Array} Returns the cast property path array. */ function castPath(value, object) { if (isArray(value)) { return value; } return isKey(value, object) ? [value] : stringToPath(toString(value)); } /** * A `baseRest` alias which can be replaced with `identity` by module * replacement plugins. * * @private * @type {Function} * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ var castRest = baseRest; /** * Casts `array` to a slice if it's needed. * * @private * @param {Array} array The array to inspect. * @param {number} start The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the cast slice. */ function castSlice(array, start, end) { var length = array.length; end = end === undefined ? length : end; return (!start && end >= length) ? array : baseSlice(array, start, end); } /** * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). * * @private * @param {number|Object} id The timer id or timeout object of the timer to clear. */ var clearTimeout = ctxClearTimeout || function(id) { return root.clearTimeout(id); }; /** * Creates a clone of `buffer`. * * @private * @param {Buffer} buffer The buffer to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Buffer} Returns the cloned buffer. */ function cloneBuffer(buffer, isDeep) { if (isDeep) { return buffer.slice(); } var length = buffer.length, result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); buffer.copy(result); return result; } /** * Creates a clone of `arrayBuffer`. * * @private * @param {ArrayBuffer} arrayBuffer The array buffer to clone. * @returns {ArrayBuffer} Returns the cloned array buffer. */ function cloneArrayBuffer(arrayBuffer) { var result = new arrayBuffer.constructor(arrayBuffer.byteLength); new Uint8Array(result).set(new Uint8Array(arrayBuffer)); return result; } /** * Creates a clone of `dataView`. * * @private * @param {Object} dataView The data view to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned data view. */ function cloneDataView(dataView, isDeep) { var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } /** * Creates a clone of `regexp`. * * @private * @param {Object} regexp The regexp to clone. * @returns {Object} Returns the cloned regexp. */ function cloneRegExp(regexp) { var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); result.lastIndex = regexp.lastIndex; return result; } /** * Creates a clone of the `symbol` object. * * @private * @param {Object} symbol The symbol object to clone. * @returns {Object} Returns the cloned symbol object. */ function cloneSymbol(symbol) { return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; } /** * Creates a clone of `typedArray`. * * @private * @param {Object} typedArray The typed array to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the cloned typed array. */ function cloneTypedArray(typedArray, isDeep) { var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); } /** * Compares values to sort them in ascending order. * * @private * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {number} Returns the sort order indicator for `value`. */ function compareAscending(value, other) { if (value !== other) { var valIsDefined = value !== undefined, valIsNull = value === null, valIsReflexive = value === value, valIsSymbol = isSymbol(value); var othIsDefined = other !== undefined, othIsNull = other === null, othIsReflexive = other === other, othIsSymbol = isSymbol(other); if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || (valIsNull && othIsDefined && othIsReflexive) || (!valIsDefined && othIsReflexive) || !valIsReflexive) { return 1; } if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || (othIsNull && valIsDefined && valIsReflexive) || (!othIsDefined && valIsReflexive) || !othIsReflexive) { return -1; } } return 0; } /** * Used by `_.orderBy` to compare multiple properties of a value to another * and stable sort them. * * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, * specify an order of "desc" for descending or "asc" for ascending sort order * of corresponding values. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {boolean[]|string[]} orders The order to sort by for each property. * @returns {number} Returns the sort order indicator for `object`. */ function compareMultiple(object, other, orders) { var index = -1, objCriteria = object.criteria, othCriteria = other.criteria, length = objCriteria.length, ordersLength = orders.length; while (++index < length) { var result = compareAscending(objCriteria[index], othCriteria[index]); if (result) { if (index >= ordersLength) { return result; } var order = orders[index]; return result * (order == 'desc' ? -1 : 1); } } // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications // that causes it, under certain circumstances, to provide the same value for // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 // for more details. // // This also ensures a stable sort in V8 and other engines. // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. return object.index - other.index; } /** * Creates an array that is the composition of partially applied arguments, * placeholders, and provided arguments into a single array of arguments. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to prepend to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgs(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersLength = holders.length, leftIndex = -1, leftLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(leftLength + rangeLength), isUncurried = !isCurried; while (++leftIndex < leftLength) { result[leftIndex] = partials[leftIndex]; } while (++argsIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[holders[argsIndex]] = args[argsIndex]; } } while (rangeLength--) { result[leftIndex++] = args[argsIndex++]; } return result; } /** * This function is like `composeArgs` except that the arguments composition * is tailored for `_.partialRight`. * * @private * @param {Array} args The provided arguments. * @param {Array} partials The arguments to append to those provided. * @param {Array} holders The `partials` placeholder indexes. * @params {boolean} [isCurried] Specify composing for a curried function. * @returns {Array} Returns the new array of composed arguments. */ function composeArgsRight(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersIndex = -1, holdersLength = holders.length, rightIndex = -1, rightLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(rangeLength + rightLength), isUncurried = !isCurried; while (++argsIndex < rangeLength) { result[argsIndex] = args[argsIndex]; } var offset = argsIndex; while (++rightIndex < rightLength) { result[offset + rightIndex] = partials[rightIndex]; } while (++holdersIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[offset + holders[holdersIndex]] = args[argsIndex++]; } } return result; } /** * Copies the values of `source` to `array`. * * @private * @param {Array} source The array to copy values from. * @param {Array} [array=[]] The array to copy values to. * @returns {Array} Returns `array`. */ function copyArray(source, array) { var index = -1, length = source.length; array || (array = Array(length)); while (++index < length) { array[index] = source[index]; } return array; } /** * Copies properties of `source` to `object`. * * @private * @param {Object} source The object to copy properties from. * @param {Array} props The property identifiers to copy. * @param {Object} [object={}] The object to copy properties to. * @param {Function} [customizer] The function to customize copied values. * @returns {Object} Returns `object`. */ function copyObject(source, props, object, customizer) { var isNew = !object; object || (object = {}); var index = -1, length = props.length; while (++index < length) { var key = props[index]; var newValue = customizer ? customizer(object[key], source[key], key, object, source) : undefined; if (newValue === undefined) { newValue = source[key]; } if (isNew) { baseAssignValue(object, key, newValue); } else { assignValue(object, key, newValue); } } return object; } /** * Copies own symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbols(source, object) { return copyObject(source, getSymbols(source), object); } /** * Copies own and inherited symbols of `source` to `object`. * * @private * @param {Object} source The object to copy symbols from. * @param {Object} [object={}] The object to copy symbols to. * @returns {Object} Returns `object`. */ function copySymbolsIn(source, object) { return copyObject(source, getSymbolsIn(source), object); } /** * Creates a function like `_.groupBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} [initializer] The accumulator object initializer. * @returns {Function} Returns the new aggregator function. */ function createAggregator(setter, initializer) { return function(collection, iteratee) { var func = isArray(collection) ? arrayAggregator : baseAggregator, accumulator = initializer ? initializer() : {}; return func(collection, setter, getIteratee(iteratee, 2), accumulator); }; } /** * Creates a function like `_.assign`. * * @private * @param {Function} assigner The function to assign values. * @returns {Function} Returns the new assigner function. */ function createAssigner(assigner) { return baseRest(function(object, sources) { var index = -1, length = sources.length, customizer = length > 1 ? sources[length - 1] : undefined, guard = length > 2 ? sources[2] : undefined; customizer = (assigner.length > 3 && typeof customizer == 'function') ? (length--, customizer) : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { customizer = length < 3 ? undefined : customizer; length = 1; } object = Object(object); while (++index < length) { var source = sources[index]; if (source) { assigner(object, source, index, customizer); } } return object; }); } /** * Creates a `baseEach` or `baseEachRight` function. * * @private * @param {Function} eachFunc The function to iterate over a collection. * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseEach(eachFunc, fromRight) { return function(collection, iteratee) { if (collection == null) { return collection; } if (!isArrayLike(collection)) { return eachFunc(collection, iteratee); } var length = collection.length, index = fromRight ? length : -1, iterable = Object(collection); while ((fromRight ? index-- : ++index < length)) { if (iteratee(iterable[index], index, iterable) === false) { break; } } return collection; }; } /** * Creates a base function for methods like `_.forIn` and `_.forOwn`. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new base function. */ function createBaseFor(fromRight) { return function(object, iteratee, keysFunc) { var index = -1, iterable = Object(object), props = keysFunc(object), length = props.length; while (length--) { var key = props[fromRight ? length : ++index]; if (iteratee(iterable[key], key, iterable) === false) { break; } } return object; }; } /** * Creates a function that wraps `func` to invoke it with the optional `this` * binding of `thisArg`. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @returns {Function} Returns the new wrapped function. */ function createBind(func, bitmask, thisArg) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return fn.apply(isBind ? thisArg : this, arguments); } return wrapper; } /** * Creates a function like `_.lowerFirst`. * * @private * @param {string} methodName The name of the `String` case method to use. * @returns {Function} Returns the new case function. */ function createCaseFirst(methodName) { return function(string) { string = toString(string); var strSymbols = hasUnicode(string) ? stringToArray(string) : undefined; var chr = strSymbols ? strSymbols[0] : string.charAt(0); var trailing = strSymbols ? castSlice(strSymbols, 1).join('') : string.slice(1); return chr[methodName]() + trailing; }; } /** * Creates a function like `_.camelCase`. * * @private * @param {Function} callback The function to combine each word. * @returns {Function} Returns the new compounder function. */ function createCompounder(callback) { return function(string) { return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); }; } /** * Creates a function that produces an instance of `Ctor` regardless of * whether it was invoked as part of a `new` expression or by `call` or `apply`. * * @private * @param {Function} Ctor The constructor to wrap. * @returns {Function} Returns the new wrapped function. */ function createCtor(Ctor) { return function() { // Use a `switch` statement to work with class constructors. See // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist // for more details. var args = arguments; switch (args.length) { case 0: return new Ctor; case 1: return new Ctor(args[0]); case 2: return new Ctor(args[0], args[1]); case 3: return new Ctor(args[0], args[1], args[2]); case 4: return new Ctor(args[0], args[1], args[2], args[3]); case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); } var thisBinding = baseCreate(Ctor.prototype), result = Ctor.apply(thisBinding, args); // Mimic the constructor's `return` behavior. // See https://es5.github.io/#x13.2.2 for more details. return isObject(result) ? result : thisBinding; }; } /** * Creates a function that wraps `func` to enable currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {number} arity The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createCurry(func, bitmask, arity) { var Ctor = createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length, placeholder = getHolder(wrapper); while (index--) { args[index] = arguments[index]; } var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) ? [] : replaceHolders(args, placeholder); length -= holders.length; if (length < arity) { return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, undefined, args, holders, undefined, undefined, arity - length); } var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return apply(fn, this, args); } return wrapper; } /** * Creates a `_.find` or `_.findLast` function. * * @private * @param {Function} findIndexFunc The function to find the collection index. * @returns {Function} Returns the new find function. */ function createFind(findIndexFunc) { return function(collection, predicate, fromIndex) { var iterable = Object(collection); if (!isArrayLike(collection)) { var iteratee = getIteratee(predicate, 3); collection = keys(collection); predicate = function(key) { return iteratee(iterable[key], key, iterable); }; } var index = findIndexFunc(collection, predicate, fromIndex); return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; }; } /** * Creates a `_.flow` or `_.flowRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new flow function. */ function createFlow(fromRight) { return flatRest(function(funcs) { var length = funcs.length, index = length, prereq = LodashWrapper.prototype.thru; if (fromRight) { funcs.reverse(); } while (index--) { var func = funcs[index]; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (prereq && !wrapper && getFuncName(func) == 'wrapper') { var wrapper = new LodashWrapper([], true); } } index = wrapper ? index : length; while (++index < length) { func = funcs[index]; var funcName = getFuncName(func), data = funcName == 'wrapper' ? getData(func) : undefined; if (data && isLaziable(data[0]) && data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && !data[4].length && data[9] == 1 ) { wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); } else { wrapper = (func.length == 1 && isLaziable(func)) ? wrapper[funcName]() : wrapper.thru(func); } } return function() { var args = arguments, value = args[0]; if (wrapper && args.length == 1 && isArray(value)) { return wrapper.plant(value).value(); } var index = 0, result = length ? funcs[index].apply(this, args) : value; while (++index < length) { result = funcs[index].call(this, result); } return result; }; }); } /** * Creates a function that wraps `func` to invoke it with optional `this` * binding of `thisArg`, partial application, and currying. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [partialsRight] The arguments to append to those provided * to the new function. * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { var isAry = bitmask & WRAP_ARY_FLAG, isBind = bitmask & WRAP_BIND_FLAG, isBindKey = bitmask & WRAP_BIND_KEY_FLAG, isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), isFlip = bitmask & WRAP_FLIP_FLAG, Ctor = isBindKey ? undefined : createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length; while (index--) { args[index] = arguments[index]; } if (isCurried) { var placeholder = getHolder(wrapper), holdersCount = countHolders(args, placeholder); } if (partials) { args = composeArgs(args, partials, holders, isCurried); } if (partialsRight) { args = composeArgsRight(args, partialsRight, holdersRight, isCurried); } length -= holdersCount; if (isCurried && length < arity) { var newHolders = replaceHolders(args, placeholder); return createRecurry( func, bitmask, createHybrid, wrapper.placeholder, thisArg, args, newHolders, argPos, ary, arity - length ); } var thisBinding = isBind ? thisArg : this, fn = isBindKey ? thisBinding[func] : func; length = args.length; if (argPos) { args = reorder(args, argPos); } else if (isFlip && length > 1) { args.reverse(); } if (isAry && ary < length) { args.length = ary; } if (this && this !== root && this instanceof wrapper) { fn = Ctor || createCtor(fn); } return fn.apply(thisBinding, args); } return wrapper; } /** * Creates a function like `_.invertBy`. * * @private * @param {Function} setter The function to set accumulator values. * @param {Function} toIteratee The function to resolve iteratees. * @returns {Function} Returns the new inverter function. */ function createInverter(setter, toIteratee) { return function(object, iteratee) { return baseInverter(object, setter, toIteratee(iteratee), {}); }; } /** * Creates a function that performs a mathematical operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @param {number} [defaultValue] The value used for `undefined` arguments. * @returns {Function} Returns the new mathematical operation function. */ function createMathOperation(operator, defaultValue) { return function(value, other) { var result; if (value === undefined && other === undefined) { return defaultValue; } if (value !== undefined) { result = value; } if (other !== undefined) { if (result === undefined) { return other; } if (typeof value == 'string' || typeof other == 'string') { value = baseToString(value); other = baseToString(other); } else { value = baseToNumber(value); other = baseToNumber(other); } result = operator(value, other); } return result; }; } /** * Creates a function like `_.over`. * * @private * @param {Function} arrayFunc The function to iterate over iteratees. * @returns {Function} Returns the new over function. */ function createOver(arrayFunc) { return flatRest(function(iteratees) { iteratees = arrayMap(iteratees, baseUnary(getIteratee())); return baseRest(function(args) { var thisArg = this; return arrayFunc(iteratees, function(iteratee) { return apply(iteratee, thisArg, args); }); }); }); } /** * Creates the padding for `string` based on `length`. The `chars` string * is truncated if the number of characters exceeds `length`. * * @private * @param {number} length The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padding for `string`. */ function createPadding(length, chars) { chars = chars === undefined ? ' ' : baseToString(chars); var charsLength = chars.length; if (charsLength < 2) { return charsLength ? baseRepeat(chars, length) : chars; } var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); return hasUnicode(chars) ? castSlice(stringToArray(result), 0, length).join('') : result.slice(0, length); } /** * Creates a function that wraps `func` to invoke it with the `this` binding * of `thisArg` and `partials` prepended to the arguments it receives. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {*} thisArg The `this` binding of `func`. * @param {Array} partials The arguments to prepend to those provided to * the new function. * @returns {Function} Returns the new wrapped function. */ function createPartial(func, bitmask, thisArg, partials) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var argsIndex = -1, argsLength = arguments.length, leftIndex = -1, leftLength = partials.length, args = Array(leftLength + argsLength), fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; while (++leftIndex < leftLength) { args[leftIndex] = partials[leftIndex]; } while (argsLength--) { args[leftIndex++] = arguments[++argsIndex]; } return apply(fn, isBind ? thisArg : this, args); } return wrapper; } /** * Creates a `_.range` or `_.rangeRight` function. * * @private * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Function} Returns the new range function. */ function createRange(fromRight) { return function(start, end, step) { if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { end = step = undefined; } // Ensure the sign of `-0` is preserved. start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); return baseRange(start, end, step, fromRight); }; } /** * Creates a function that performs a relational operation on two values. * * @private * @param {Function} operator The function to perform the operation. * @returns {Function} Returns the new relational operation function. */ function createRelationalOperation(operator) { return function(value, other) { if (!(typeof value == 'string' && typeof other == 'string')) { value = toNumber(value); other = toNumber(other); } return operator(value, other); }; } /** * Creates a function that wraps `func` to continue currying. * * @private * @param {Function} func The function to wrap. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @param {Function} wrapFunc The function to create the `func` wrapper. * @param {*} placeholder The placeholder value. * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to prepend to those provided to * the new function. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { var isCurry = bitmask & WRAP_CURRY_FLAG, newHolders = isCurry ? holders : undefined, newHoldersRight = isCurry ? undefined : holders, newPartials = isCurry ? partials : undefined, newPartialsRight = isCurry ? undefined : partials; bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); } var newData = [ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, newHoldersRight, argPos, ary, arity ]; var result = wrapFunc.apply(undefined, newData); if (isLaziable(func)) { setData(result, newData); } result.placeholder = placeholder; return setWrapToString(result, func, bitmask); } /** * Creates a function like `_.round`. * * @private * @param {string} methodName The name of the `Math` method to use when rounding. * @returns {Function} Returns the new round function. */ function createRound(methodName) { var func = Math[methodName]; return function(number, precision) { number = toNumber(number); precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); if (precision) { // Shift with exponential notation to avoid floating-point issues. // See [MDN](https://mdn.io/round#Examples) for more details. var pair = (toString(number) + 'e').split('e'), value = func(pair[0] + 'e' + (+pair[1] + precision)); pair = (toString(value) + 'e').split('e'); return +(pair[0] + 'e' + (+pair[1] - precision)); } return func(number); }; } /** * Creates a set object of `values`. * * @private * @param {Array} values The values to add to the set. * @returns {Object} Returns the new set. */ var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { return new Set(values); }; /** * Creates a `_.toPairs` or `_.toPairsIn` function. * * @private * @param {Function} keysFunc The function to get the keys of a given object. * @returns {Function} Returns the new pairs function. */ function createToPairs(keysFunc) { return function(object) { var tag = getTag(object); if (tag == mapTag) { return mapToArray(object); } if (tag == setTag) { return setToPairs(object); } return baseToPairs(object, keysFunc(object)); }; } /** * Creates a function that either curries or invokes `func` with optional * `this` binding and partially applied arguments. * * @private * @param {Function|string} func The function or method name to wrap. * @param {number} bitmask The bitmask flags. * 1 - `_.bind` * 2 - `_.bindKey` * 4 - `_.curry` or `_.curryRight` of a bound function * 8 - `_.curry` * 16 - `_.curryRight` * 32 - `_.partial` * 64 - `_.partialRight` * 128 - `_.rearg` * 256 - `_.ary` * 512 - `_.flip` * @param {*} [thisArg] The `this` binding of `func`. * @param {Array} [partials] The arguments to be partially applied. * @param {Array} [holders] The `partials` placeholder indexes. * @param {Array} [argPos] The argument positions of the new function. * @param {number} [ary] The arity cap of `func`. * @param {number} [arity] The arity of `func`. * @returns {Function} Returns the new wrapped function. */ function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; if (!isBindKey && typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } var length = partials ? partials.length : 0; if (!length) { bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); partials = holders = undefined; } ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); arity = arity === undefined ? arity : toInteger(arity); length -= holders ? holders.length : 0; if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { var partialsRight = partials, holdersRight = holders; partials = holders = undefined; } var data = isBindKey ? undefined : getData(func); var newData = [ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity ]; if (data) { mergeData(newData, data); } func = newData[0]; bitmask = newData[1]; thisArg = newData[2]; partials = newData[3]; holders = newData[4]; arity = newData[9] = newData[9] === undefined ? (isBindKey ? 0 : func.length) : nativeMax(newData[9] - length, 0); if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); } if (!bitmask || bitmask == WRAP_BIND_FLAG) { var result = createBind(func, bitmask, thisArg); } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { result = createCurry(func, bitmask, arity); } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { result = createPartial(func, bitmask, thisArg, partials); } else { result = createHybrid.apply(undefined, newData); } var setter = data ? baseSetData : setData; return setWrapToString(setter(result, newData), func, bitmask); } /** * Used by `_.defaults` to customize its `_.assignIn` use to assign properties * of source objects to the destination object for all destination properties * that resolve to `undefined`. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to assign. * @param {Object} object The parent object of `objValue`. * @returns {*} Returns the value to assign. */ function customDefaultsAssignIn(objValue, srcValue, key, object) { if (objValue === undefined || (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { return srcValue; } return objValue; } /** * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source * objects into destination objects that are passed thru. * * @private * @param {*} objValue The destination value. * @param {*} srcValue The source value. * @param {string} key The key of the property to merge. * @param {Object} object The parent object of `objValue`. * @param {Object} source The parent object of `srcValue`. * @param {Object} [stack] Tracks traversed source values and their merged * counterparts. * @returns {*} Returns the value to assign. */ function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { if (isObject(objValue) && isObject(srcValue)) { // Recursively merge objects and arrays (susceptible to call stack limits). stack.set(srcValue, objValue); baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); stack['delete'](srcValue); } return objValue; } /** * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain * objects. * * @private * @param {*} value The value to inspect. * @param {string} key The key of the property to inspect. * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. */ function customOmitClone(value) { return isPlainObject(value) ? undefined : value; } /** * A specialized version of `baseIsEqualDeep` for arrays with support for * partial deep comparisons. * * @private * @param {Array} array The array to compare. * @param {Array} other The other array to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `array` and `other` objects. * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. */ function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, arrLength = array.length, othLength = other.length; if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } // Assume cyclic values are equal. var stacked = stack.get(array); if (stacked && stack.get(other)) { return stacked == other; } var index = -1, result = true, seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; stack.set(array, other); stack.set(other, array); // Ignore non-index properties. while (++index < arrLength) { var arrValue = array[index], othValue = other[index]; if (customizer) { var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack); } if (compared !== undefined) { if (compared) { continue; } result = false; break; } // Recursively compare arrays (susceptible to call stack limits). if (seen) { if (!arraySome(other, function(othValue, othIndex) { if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { return seen.push(othIndex); } })) { result = false; break; } } else if (!( arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack) )) { result = false; break; } } stack['delete'](array); stack['delete'](other); return result; } /** * A specialized version of `baseIsEqualDeep` for comparing objects of * the same `toStringTag`. * * **Note:** This function only supports comparing values with tags of * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {string} tag The `toStringTag` of the objects to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { switch (tag) { case dataViewTag: if ((object.byteLength != other.byteLength) || (object.byteOffset != other.byteOffset)) { return false; } object = object.buffer; other = other.buffer; case arrayBufferTag: if ((object.byteLength != other.byteLength) || !equalFunc(new Uint8Array(object), new Uint8Array(other))) { return false; } return true; case boolTag: case dateTag: case numberTag: // Coerce booleans to `1` or `0` and dates to milliseconds. // Invalid dates are coerced to `NaN`. return eq(+object, +other); case errorTag: return object.name == other.name && object.message == other.message; case regexpTag: case stringTag: // Coerce regexes to strings and treat strings, primitives and objects, // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring // for more details. return object == (other + ''); case mapTag: var convert = mapToArray; case setTag: var isPartial = bitmask & COMPARE_PARTIAL_FLAG; convert || (convert = setToArray); if (object.size != other.size && !isPartial) { return false; } // Assume cyclic values are equal. var stacked = stack.get(object); if (stacked) { return stacked == other; } bitmask |= COMPARE_UNORDERED_FLAG; // Recursively compare objects (susceptible to call stack limits). stack.set(object, other); var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); stack['delete'](object); return result; case symbolTag: if (symbolValueOf) { return symbolValueOf.call(object) == symbolValueOf.call(other); } } return false; } /** * A specialized version of `baseIsEqualDeep` for objects with support for * partial deep comparisons. * * @private * @param {Object} object The object to compare. * @param {Object} other The other object to compare. * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. * @param {Function} customizer The function to customize comparisons. * @param {Function} equalFunc The function to determine equivalents of values. * @param {Object} stack Tracks traversed `object` and `other` objects. * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, objProps = getAllKeys(object), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length; if (objLength != othLength && !isPartial) { return false; } var index = objLength; while (index--) { var key = objProps[index]; if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { return false; } } // Assume cyclic values are equal. var stacked = stack.get(object); if (stacked && stack.get(other)) { return stacked == other; } var result = true; stack.set(object, other); stack.set(other, object); var skipCtor = isPartial; while (++index < objLength) { key = objProps[index]; var objValue = object[key], othValue = other[key]; if (customizer) { var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack); } // Recursively compare objects (susceptible to call stack limits). if (!(compared === undefined ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) : compared )) { result = false; break; } skipCtor || (skipCtor = key == 'constructor'); } if (result && !skipCtor) { var objCtor = object.constructor, othCtor = other.constructor; // Non `Object` object instances with different constructors are not equal. if (objCtor != othCtor && ('constructor' in object && 'constructor' in other) && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) { result = false; } } stack['delete'](object); stack['delete'](other); return result; } /** * A specialized version of `baseRest` which flattens the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @returns {Function} Returns the new function. */ function flatRest(func) { return setToString(overRest(func, undefined, flatten), func + ''); } /** * Creates an array of own enumerable property names and symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeys(object) { return baseGetAllKeys(object, keys, getSymbols); } /** * Creates an array of own and inherited enumerable property names and * symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names and symbols. */ function getAllKeysIn(object) { return baseGetAllKeys(object, keysIn, getSymbolsIn); } /** * Gets metadata for `func`. * * @private * @param {Function} func The function to query. * @returns {*} Returns the metadata for `func`. */ var getData = !metaMap ? noop : function(func) { return metaMap.get(func); }; /** * Gets the name of `func`. * * @private * @param {Function} func The function to query. * @returns {string} Returns the function name. */ function getFuncName(func) { var result = (func.name + ''), array = realNames[result], length = hasOwnProperty.call(realNames, result) ? array.length : 0; while (length--) { var data = array[length], otherFunc = data.func; if (otherFunc == null || otherFunc == func) { return data.name; } } return result; } /** * Gets the argument placeholder value for `func`. * * @private * @param {Function} func The function to inspect. * @returns {*} Returns the placeholder value. */ function getHolder(func) { var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; return object.placeholder; } /** * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, * this function returns the custom method, otherwise it returns `baseIteratee`. * If arguments are provided, the chosen function is invoked with them and * its result is returned. * * @private * @param {*} [value] The value to convert to an iteratee. * @param {number} [arity] The arity of the created iteratee. * @returns {Function} Returns the chosen function or its result. */ function getIteratee() { var result = lodash.iteratee || iteratee; result = result === iteratee ? baseIteratee : result; return arguments.length ? result(arguments[0], arguments[1]) : result; } /** * Gets the data for `map`. * * @private * @param {Object} map The map to query. * @param {string} key The reference key. * @returns {*} Returns the map data. */ function getMapData(map, key) { var data = map.__data__; return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map; } /** * Gets the property names, values, and compare flags of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the match data of `object`. */ function getMatchData(object) { var result = keys(object), length = result.length; while (length--) { var key = result[length], value = object[key]; result[length] = [key, value, isStrictComparable(value)]; } return result; } /** * Gets the native function at `key` of `object`. * * @private * @param {Object} object The object to query. * @param {string} key The key of the method to get. * @returns {*} Returns the function if it's native, else `undefined`. */ function getNative(object, key) { var value = getValue(object, key); return baseIsNative(value) ? value : undefined; } /** * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. * * @private * @param {*} value The value to query. * @returns {string} Returns the raw `toStringTag`. */ function getRawTag(value) { var isOwn = hasOwnProperty.call(value, symToStringTag), tag = value[symToStringTag]; try { value[symToStringTag] = undefined; var unmasked = true; } catch (e) {} var result = nativeObjectToString.call(value); if (unmasked) { if (isOwn) { value[symToStringTag] = tag; } else { delete value[symToStringTag]; } } return result; } /** * Creates an array of the own enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbols = !nativeGetSymbols ? stubArray : function(object) { if (object == null) { return []; } object = Object(object); return arrayFilter(nativeGetSymbols(object), function(symbol) { return propertyIsEnumerable.call(object, symbol); }); }; /** * Creates an array of the own and inherited enumerable symbols of `object`. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of symbols. */ var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { var result = []; while (object) { arrayPush(result, getSymbols(object)); object = getPrototype(object); } return result; }; /** * Gets the `toStringTag` of `value`. * * @private * @param {*} value The value to query. * @returns {string} Returns the `toStringTag`. */ var getTag = baseGetTag; // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || (Map && getTag(new Map) != mapTag) || (Promise && getTag(Promise.resolve()) != promiseTag) || (Set && getTag(new Set) != setTag) || (WeakMap && getTag(new WeakMap) != weakMapTag)) { getTag = function(value) { var result = baseGetTag(value), Ctor = result == objectTag ? value.constructor : undefined, ctorString = Ctor ? toSource(Ctor) : ''; if (ctorString) { switch (ctorString) { case dataViewCtorString: return dataViewTag; case mapCtorString: return mapTag; case promiseCtorString: return promiseTag; case setCtorString: return setTag; case weakMapCtorString: return weakMapTag; } } return result; }; } /** * Gets the view, applying any `transforms` to the `start` and `end` positions. * * @private * @param {number} start The start of the view. * @param {number} end The end of the view. * @param {Array} transforms The transformations to apply to the view. * @returns {Object} Returns an object containing the `start` and `end` * positions of the view. */ function getView(start, end, transforms) { var index = -1, length = transforms.length; while (++index < length) { var data = transforms[index], size = data.size; switch (data.type) { case 'drop': start += size; break; case 'dropRight': end -= size; break; case 'take': end = nativeMin(end, start + size); break; case 'takeRight': start = nativeMax(start, end - size); break; } } return { 'start': start, 'end': end }; } /** * Extracts wrapper details from the `source` body comment. * * @private * @param {string} source The source to inspect. * @returns {Array} Returns the wrapper details. */ function getWrapDetails(source) { var match = source.match(reWrapDetails); return match ? match[1].split(reSplitDetails) : []; } /** * Checks if `path` exists on `object`. * * @private * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @param {Function} hasFunc The function to check properties. * @returns {boolean} Returns `true` if `path` exists, else `false`. */ function hasPath(object, path, hasFunc) { path = castPath(path, object); var index = -1, length = path.length, result = false; while (++index < length) { var key = toKey(path[index]); if (!(result = object != null && hasFunc(object, key))) { break; } object = object[key]; } if (result || ++index != length) { return result; } length = object == null ? 0 : object.length; return !!length && isLength(length) && isIndex(key, length) && (isArray(object) || isArguments(object)); } /** * Initializes an array clone. * * @private * @param {Array} array The array to clone. * @returns {Array} Returns the initialized clone. */ function initCloneArray(array) { var length = array.length, result = new array.constructor(length); // Add properties assigned by `RegExp#exec`. if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { result.index = array.index; result.input = array.input; } return result; } /** * Initializes an object clone. * * @private * @param {Object} object The object to clone. * @returns {Object} Returns the initialized clone. */ function initCloneObject(object) { return (typeof object.constructor == 'function' && !isPrototype(object)) ? baseCreate(getPrototype(object)) : {}; } /** * Initializes an object clone based on its `toStringTag`. * * **Note:** This function only supports cloning values with tags of * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. * * @private * @param {Object} object The object to clone. * @param {string} tag The `toStringTag` of the object to clone. * @param {boolean} [isDeep] Specify a deep clone. * @returns {Object} Returns the initialized clone. */ function initCloneByTag(object, tag, isDeep) { var Ctor = object.constructor; switch (tag) { case arrayBufferTag: return cloneArrayBuffer(object); case boolTag: case dateTag: return new Ctor(+object); case dataViewTag: return cloneDataView(object, isDeep); case float32Tag: case float64Tag: case int8Tag: case int16Tag: case int32Tag: case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: return cloneTypedArray(object, isDeep); case mapTag: return new Ctor; case numberTag: case stringTag: return new Ctor(object); case regexpTag: return cloneRegExp(object); case setTag: return new Ctor; case symbolTag: return cloneSymbol(object); } } /** * Inserts wrapper `details` in a comment at the top of the `source` body. * * @private * @param {string} source The source to modify. * @returns {Array} details The details to insert. * @returns {string} Returns the modified source. */ function insertWrapDetails(source, details) { var length = details.length; if (!length) { return source; } var lastIndex = length - 1; details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; details = details.join(length > 2 ? ', ' : ' '); return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } /** * Checks if `value` is a flattenable `arguments` object or array. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. */ function isFlattenable(value) { return isArray(value) || isArguments(value) || !!(spreadableSymbol && value && value[spreadableSymbol]); } /** * Checks if `value` is a valid array-like index. * * @private * @param {*} value The value to check. * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. */ function isIndex(value, length) { var type = typeof value; length = length == null ? MAX_SAFE_INTEGER : length; return !!length && (type == 'number' || (type != 'symbol' && reIsUint.test(value))) && (value > -1 && value % 1 == 0 && value < length); } /** * Checks if the given arguments are from an iteratee call. * * @private * @param {*} value The potential iteratee value argument. * @param {*} index The potential iteratee index or key argument. * @param {*} object The potential iteratee object argument. * @returns {boolean} Returns `true` if the arguments are from an iteratee call, * else `false`. */ function isIterateeCall(value, index, object) { if (!isObject(object)) { return false; } var type = typeof index; if (type == 'number' ? (isArrayLike(object) && isIndex(index, object.length)) : (type == 'string' && index in object) ) { return eq(object[index], value); } return false; } /** * Checks if `value` is a property name and not a property path. * * @private * @param {*} value The value to check. * @param {Object} [object] The object to query keys on. * @returns {boolean} Returns `true` if `value` is a property name, else `false`. */ function isKey(value, object) { if (isArray(value)) { return false; } var type = typeof value; if (type == 'number' || type == 'symbol' || type == 'boolean' || value == null || isSymbol(value)) { return true; } return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || (object != null && value in Object(object)); } /** * Checks if `value` is suitable for use as unique object key. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is suitable, else `false`. */ function isKeyable(value) { var type = typeof value; return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') ? (value !== '__proto__') : (value === null); } /** * Checks if `func` has a lazy counterpart. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` has a lazy counterpart, * else `false`. */ function isLaziable(func) { var funcName = getFuncName(func), other = lodash[funcName]; if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { return false; } if (func === other) { return true; } var data = getData(other); return !!data && func === data[0]; } /** * Checks if `func` has its source masked. * * @private * @param {Function} func The function to check. * @returns {boolean} Returns `true` if `func` is masked, else `false`. */ function isMasked(func) { return !!maskSrcKey && (maskSrcKey in func); } /** * Checks if `func` is capable of being masked. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `func` is maskable, else `false`. */ var isMaskable = coreJsData ? isFunction : stubFalse; /** * Checks if `value` is likely a prototype object. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. */ function isPrototype(value) { var Ctor = value && value.constructor, proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; return value === proto; } /** * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. * * @private * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` if suitable for strict * equality comparisons, else `false`. */ function isStrictComparable(value) { return value === value && !isObject(value); } /** * A specialized version of `matchesProperty` for source values suitable * for strict equality comparisons, i.e. `===`. * * @private * @param {string} key The key of the property to get. * @param {*} srcValue The value to match. * @returns {Function} Returns the new spec function. */ function matchesStrictComparable(key, srcValue) { return function(object) { if (object == null) { return false; } return object[key] === srcValue && (srcValue !== undefined || (key in Object(object))); }; } /** * A specialized version of `_.memoize` which clears the memoized function's * cache when it exceeds `MAX_MEMOIZE_SIZE`. * * @private * @param {Function} func The function to have its output memoized. * @returns {Function} Returns the new memoized function. */ function memoizeCapped(func) { var result = memoize(func, function(key) { if (cache.size === MAX_MEMOIZE_SIZE) { cache.clear(); } return key; }); var cache = result.cache; return result; } /** * Merges the function metadata of `source` into `data`. * * Merging metadata reduces the number of wrappers used to invoke a function. * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` * may be applied regardless of execution order. Methods like `_.ary` and * `_.rearg` modify function arguments, making the order in which they are * executed important, preventing the merging of metadata. However, we make * an exception for a safe combined case where curried functions have `_.ary` * and or `_.rearg` applied. * * @private * @param {Array} data The destination metadata. * @param {Array} source The source metadata. * @returns {Array} Returns `data`. */ function mergeData(data, source) { var bitmask = data[1], srcBitmask = source[1], newBitmask = bitmask | srcBitmask, isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); var isCombo = ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); // Exit early if metadata can't be merged. if (!(isCommon || isCombo)) { return data; } // Use source `thisArg` if available. if (srcBitmask & WRAP_BIND_FLAG) { data[2] = source[2]; // Set when currying a bound function. newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; } // Compose partial arguments. var value = source[3]; if (value) { var partials = data[3]; data[3] = partials ? composeArgs(partials, value, source[4]) : value; data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; } // Compose partial right arguments. value = source[5]; if (value) { partials = data[5]; data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; } // Use source `argPos` if available. value = source[7]; if (value) { data[7] = value; } // Use source `ary` if it's smaller. if (srcBitmask & WRAP_ARY_FLAG) { data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); } // Use source `arity` if one is not provided. if (data[9] == null) { data[9] = source[9]; } // Use source `func` and merge bitmasks. data[0] = source[0]; data[1] = newBitmask; return data; } /** * This function is like * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * except that it includes inherited enumerable properties. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ function nativeKeysIn(object) { var result = []; if (object != null) { for (var key in Object(object)) { result.push(key); } } return result; } /** * Converts `value` to a string using `Object.prototype.toString`. * * @private * @param {*} value The value to convert. * @returns {string} Returns the converted string. */ function objectToString(value) { return nativeObjectToString.call(value); } /** * A specialized version of `baseRest` which transforms the rest array. * * @private * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @param {Function} transform The rest array transform. * @returns {Function} Returns the new function. */ function overRest(func, start, transform) { start = nativeMax(start === undefined ? (func.length - 1) : start, 0); return function() { var args = arguments, index = -1, length = nativeMax(args.length - start, 0), array = Array(length); while (++index < length) { array[index] = args[start + index]; } index = -1; var otherArgs = Array(start + 1); while (++index < start) { otherArgs[index] = args[index]; } otherArgs[start] = transform(array); return apply(func, this, otherArgs); }; } /** * Gets the parent value at `path` of `object`. * * @private * @param {Object} object The object to query. * @param {Array} path The path to get the parent value of. * @returns {*} Returns the parent value. */ function parent(object, path) { return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); } /** * Reorder `array` according to the specified indexes where the element at * the first index is assigned as the first element, the element at * the second index is assigned as the second element, and so on. * * @private * @param {Array} array The array to reorder. * @param {Array} indexes The arranged array indexes. * @returns {Array} Returns `array`. */ function reorder(array, indexes) { var arrLength = array.length, length = nativeMin(indexes.length, arrLength), oldArray = copyArray(array); while (length--) { var index = indexes[length]; array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; } return array; } /** * Sets metadata for `func`. * * **Note:** If this function becomes hot, i.e. is invoked a lot in a short * period of time, it will trip its breaker and transition to an identity * function to avoid garbage collection pauses in V8. See * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) * for more details. * * @private * @param {Function} func The function to associate metadata with. * @param {*} data The metadata. * @returns {Function} Returns `func`. */ var setData = shortOut(baseSetData); /** * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). * * @private * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @returns {number|Object} Returns the timer id or timeout object. */ var setTimeout = ctxSetTimeout || function(func, wait) { return root.setTimeout(func, wait); }; /** * Sets the `toString` method of `func` to return `string`. * * @private * @param {Function} func The function to modify. * @param {Function} string The `toString` result. * @returns {Function} Returns `func`. */ var setToString = shortOut(baseSetToString); /** * Sets the `toString` method of `wrapper` to mimic the source of `reference` * with wrapper details in a comment at the top of the source body. * * @private * @param {Function} wrapper The function to modify. * @param {Function} reference The reference function. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Function} Returns `wrapper`. */ function setWrapToString(wrapper, reference, bitmask) { var source = (reference + ''); return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } /** * Creates a function that'll short out and invoke `identity` instead * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` * milliseconds. * * @private * @param {Function} func The function to restrict. * @returns {Function} Returns the new shortable function. */ function shortOut(func) { var count = 0, lastCalled = 0; return function() { var stamp = nativeNow(), remaining = HOT_SPAN - (stamp - lastCalled); lastCalled = stamp; if (remaining > 0) { if (++count >= HOT_COUNT) { return arguments[0]; } } else { count = 0; } return func.apply(undefined, arguments); }; } /** * A specialized version of `_.shuffle` which mutates and sets the size of `array`. * * @private * @param {Array} array The array to shuffle. * @param {number} [size=array.length] The size of `array`. * @returns {Array} Returns `array`. */ function shuffleSelf(array, size) { var index = -1, length = array.length, lastIndex = length - 1; size = size === undefined ? length : size; while (++index < size) { var rand = baseRandom(index, lastIndex), value = array[rand]; array[rand] = array[index]; array[index] = value; } array.length = size; return array; } /** * Converts `string` to a property path array. * * @private * @param {string} string The string to convert. * @returns {Array} Returns the property path array. */ var stringToPath = memoizeCapped(function(string) { var result = []; if (string.charCodeAt(0) === 46 /* . */) { result.push(''); } string.replace(rePropName, function(match, number, quote, subString) { result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); }); return result; }); /** * Converts `value` to a string key if it's not a string or symbol. * * @private * @param {*} value The value to inspect. * @returns {string|symbol} Returns the key. */ function toKey(value) { if (typeof value == 'string' || isSymbol(value)) { return value; } var result = (value + ''); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** * Converts `func` to its source code. * * @private * @param {Function} func The function to convert. * @returns {string} Returns the source code. */ function toSource(func) { if (func != null) { try { return funcToString.call(func); } catch (e) {} try { return (func + ''); } catch (e) {} } return ''; } /** * Updates wrapper `details` based on `bitmask` flags. * * @private * @returns {Array} details The details to modify. * @param {number} bitmask The bitmask flags. See `createWrap` for more details. * @returns {Array} Returns `details`. */ function updateWrapDetails(details, bitmask) { arrayEach(wrapFlags, function(pair) { var value = '_.' + pair[0]; if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { details.push(value); } }); return details.sort(); } /** * Creates a clone of `wrapper`. * * @private * @param {Object} wrapper The wrapper to clone. * @returns {Object} Returns the cloned wrapper. */ function wrapperClone(wrapper) { if (wrapper instanceof LazyWrapper) { return wrapper.clone(); } var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); result.__actions__ = copyArray(wrapper.__actions__); result.__index__ = wrapper.__index__; result.__values__ = wrapper.__values__; return result; } /*------------------------------------------------------------------------*/ /** * Creates an array of elements split into groups the length of `size`. * If `array` can't be split evenly, the final chunk will be the remaining * elements. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to process. * @param {number} [size=1] The length of each chunk * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the new array of chunks. * @example * * _.chunk(['a', 'b', 'c', 'd'], 2); * // => [['a', 'b'], ['c', 'd']] * * _.chunk(['a', 'b', 'c', 'd'], 3); * // => [['a', 'b', 'c'], ['d']] */ function chunk(array, size, guard) { if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { size = 1; } else { size = nativeMax(toInteger(size), 0); } var length = array == null ? 0 : array.length; if (!length || size < 1) { return []; } var index = 0, resIndex = 0, result = Array(nativeCeil(length / size)); while (index < length) { result[resIndex++] = baseSlice(array, index, (index += size)); } return result; } /** * Creates an array with all falsey values removed. The values `false`, `null`, * `0`, `""`, `undefined`, and `NaN` are falsey. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to compact. * @returns {Array} Returns the new array of filtered values. * @example * * _.compact([0, 1, false, 2, '', 3]); * // => [1, 2, 3] */ function compact(array) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value) { result[resIndex++] = value; } } return result; } /** * Creates a new array concatenating `array` with any additional arrays * and/or values. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to concatenate. * @param {...*} [values] The values to concatenate. * @returns {Array} Returns the new concatenated array. * @example * * var array = [1]; * var other = _.concat(array, 2, [3], [[4]]); * * console.log(other); * // => [1, 2, 3, [4]] * * console.log(array); * // => [1] */ function concat() { var length = arguments.length; if (!length) { return []; } var args = Array(length - 1), array = arguments[0], index = length; while (index--) { args[index - 1] = arguments[index]; } return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } /** * Creates an array of `array` values not included in the other given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * **Note:** Unlike `_.pullAll`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.without, _.xor * @example * * _.difference([2, 1], [2, 3]); * // => [1] */ var difference = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) : []; }); /** * This method is like `_.difference` except that it accepts `iteratee` which * is invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * **Note:** Unlike `_.pullAllBy`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2] * * // The `_.property` iteratee shorthand. * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var differenceBy = baseRest(function(array, values) { var iteratee = last(values); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.difference` except that it accepts `comparator` * which is invoked to compare elements of `array` to `values`. The order and * references of result values are determined by the first array. The comparator * is invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.pullAllWith`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {...Array} [values] The values to exclude. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); * // => [{ 'x': 2, 'y': 1 }] */ var differenceWith = baseRest(function(array, values) { var comparator = last(values); if (isArrayLikeObject(comparator)) { comparator = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) : []; }); /** * Creates a slice of `array` with `n` elements dropped from the beginning. * * @static * @memberOf _ * @since 0.5.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.drop([1, 2, 3]); * // => [2, 3] * * _.drop([1, 2, 3], 2); * // => [3] * * _.drop([1, 2, 3], 5); * // => [] * * _.drop([1, 2, 3], 0); * // => [1, 2, 3] */ function drop(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with `n` elements dropped from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to drop. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.dropRight([1, 2, 3]); * // => [1, 2] * * _.dropRight([1, 2, 3], 2); * // => [1] * * _.dropRight([1, 2, 3], 5); * // => [] * * _.dropRight([1, 2, 3], 0); * // => [1, 2, 3] */ function dropRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` excluding elements dropped from the end. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.dropRightWhile(users, function(o) { return !o.active; }); * // => objects for ['barney'] * * // The `_.matches` iteratee shorthand. * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['barney', 'fred'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropRightWhile(users, ['active', false]); * // => objects for ['barney'] * * // The `_.property` iteratee shorthand. * _.dropRightWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true, true) : []; } /** * Creates a slice of `array` excluding elements dropped from the beginning. * Elements are dropped until `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.dropWhile(users, function(o) { return !o.active; }); * // => objects for ['pebbles'] * * // The `_.matches` iteratee shorthand. * _.dropWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['fred', 'pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.dropWhile(users, ['active', false]); * // => objects for ['pebbles'] * * // The `_.property` iteratee shorthand. * _.dropWhile(users, 'active'); * // => objects for ['barney', 'fred', 'pebbles'] */ function dropWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true) : []; } /** * Fills elements of `array` with `value` from `start` up to, but not * including, `end`. * * **Note:** This method mutates `array`. * * @static * @memberOf _ * @since 3.2.0 * @category Array * @param {Array} array The array to fill. * @param {*} value The value to fill `array` with. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.fill(array, 'a'); * console.log(array); * // => ['a', 'a', 'a'] * * _.fill(Array(3), 2); * // => [2, 2, 2] * * _.fill([4, 6, 8, 10], '*', 1, 3); * // => [4, '*', '*', 10] */ function fill(array, value, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { start = 0; end = length; } return baseFill(array, value, start, end); } /** * This method is like `_.find` except that it returns the index of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.findIndex(users, function(o) { return o.user == 'barney'; }); * // => 0 * * // The `_.matches` iteratee shorthand. * _.findIndex(users, { 'user': 'fred', 'active': false }); * // => 1 * * // The `_.matchesProperty` iteratee shorthand. * _.findIndex(users, ['active', false]); * // => 0 * * // The `_.property` iteratee shorthand. * _.findIndex(users, 'active'); * // => 2 */ function findIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseFindIndex(array, getIteratee(predicate, 3), index); } /** * This method is like `_.findIndex` except that it iterates over elements * of `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the found element, else `-1`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); * // => 2 * * // The `_.matches` iteratee shorthand. * _.findLastIndex(users, { 'user': 'barney', 'active': true }); * // => 0 * * // The `_.matchesProperty` iteratee shorthand. * _.findLastIndex(users, ['active', false]); * // => 2 * * // The `_.property` iteratee shorthand. * _.findLastIndex(users, 'active'); * // => 0 */ function findLastIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length - 1; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = fromIndex < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return baseFindIndex(array, getIteratee(predicate, 3), index, true); } /** * Flattens `array` a single level deep. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flatten([1, [2, [3, [4]], 5]]); * // => [1, 2, [3, [4]], 5] */ function flatten(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, 1) : []; } /** * Recursively flattens `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to flatten. * @returns {Array} Returns the new flattened array. * @example * * _.flattenDeep([1, [2, [3, [4]], 5]]); * // => [1, 2, 3, 4, 5] */ function flattenDeep(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, INFINITY) : []; } /** * Recursively flatten `array` up to `depth` times. * * @static * @memberOf _ * @since 4.4.0 * @category Array * @param {Array} array The array to flatten. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * var array = [1, [2, [3, [4]], 5]]; * * _.flattenDepth(array, 1); * // => [1, 2, [3, [4]], 5] * * _.flattenDepth(array, 2); * // => [1, 2, 3, [4], 5] */ function flattenDepth(array, depth) { var length = array == null ? 0 : array.length; if (!length) { return []; } depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(array, depth); } /** * The inverse of `_.toPairs`; this method returns an object composed * from key-value `pairs`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} pairs The key-value pairs. * @returns {Object} Returns the new object. * @example * * _.fromPairs([['a', 1], ['b', 2]]); * // => { 'a': 1, 'b': 2 } */ function fromPairs(pairs) { var index = -1, length = pairs == null ? 0 : pairs.length, result = {}; while (++index < length) { var pair = pairs[index]; result[pair[0]] = pair[1]; } return result; } /** * Gets the first element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @alias first * @category Array * @param {Array} array The array to query. * @returns {*} Returns the first element of `array`. * @example * * _.head([1, 2, 3]); * // => 1 * * _.head([]); * // => undefined */ function head(array) { return (array && array.length) ? array[0] : undefined; } /** * Gets the index at which the first occurrence of `value` is found in `array` * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. If `fromIndex` is negative, it's used as the * offset from the end of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.indexOf([1, 2, 1, 2], 2); * // => 1 * * // Search from the `fromIndex`. * _.indexOf([1, 2, 1, 2], 2, 2); * // => 3 */ function indexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseIndexOf(array, value, index); } /** * Gets all but the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.initial([1, 2, 3]); * // => [1, 2] */ function initial(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 0, -1) : []; } /** * Creates an array of unique values that are included in all given arrays * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. The order and references of result values are * determined by the first array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersection([2, 1], [2, 3]); * // => [2] */ var intersection = baseRest(function(arrays) { var mapped = arrayMap(arrays, castArrayLikeObject); return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped) : []; }); /** * This method is like `_.intersection` except that it accepts `iteratee` * which is invoked for each element of each `arrays` to generate the criterion * by which they're compared. The order and references of result values are * determined by the first array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [2.1] * * // The `_.property` iteratee shorthand. * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }] */ var intersectionBy = baseRest(function(arrays) { var iteratee = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); if (iteratee === last(mapped)) { iteratee = undefined; } else { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, getIteratee(iteratee, 2)) : []; }); /** * This method is like `_.intersection` except that it accepts `comparator` * which is invoked to compare elements of `arrays`. The order and references * of result values are determined by the first array. The comparator is * invoked with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of intersecting values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.intersectionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }] */ var intersectionWith = baseRest(function(arrays) { var comparator = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); comparator = typeof comparator == 'function' ? comparator : undefined; if (comparator) { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, undefined, comparator) : []; }); /** * Converts all elements in `array` into a string separated by `separator`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to convert. * @param {string} [separator=','] The element separator. * @returns {string} Returns the joined string. * @example * * _.join(['a', 'b', 'c'], '~'); * // => 'a~b~c' */ function join(array, separator) { return array == null ? '' : nativeJoin.call(array, separator); } /** * Gets the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @returns {*} Returns the last element of `array`. * @example * * _.last([1, 2, 3]); * // => 3 */ function last(array) { var length = array == null ? 0 : array.length; return length ? array[length - 1] : undefined; } /** * This method is like `_.indexOf` except that it iterates over elements of * `array` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=array.length-1] The index to search from. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.lastIndexOf([1, 2, 1, 2], 2); * // => 3 * * // Search from the `fromIndex`. * _.lastIndexOf([1, 2, 1, 2], 2, 2); * // => 1 */ function lastIndexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return value === value ? strictLastIndexOf(array, value, index) : baseFindIndex(array, baseIsNaN, index, true); } /** * Gets the element at index `n` of `array`. If `n` is negative, the nth * element from the end is returned. * * @static * @memberOf _ * @since 4.11.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=0] The index of the element to return. * @returns {*} Returns the nth element of `array`. * @example * * var array = ['a', 'b', 'c', 'd']; * * _.nth(array, 1); * // => 'b' * * _.nth(array, -2); * // => 'c'; */ function nth(array, n) { return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; } /** * Removes all given values from `array` using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` * to remove elements from an array by predicate. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {...*} [values] The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pull(array, 'a', 'c'); * console.log(array); * // => ['b', 'b'] */ var pull = baseRest(pullAll); /** * This method is like `_.pull` except that it accepts an array of values to remove. * * **Note:** Unlike `_.difference`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @returns {Array} Returns `array`. * @example * * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * * _.pullAll(array, ['a', 'c']); * console.log(array); * // => ['b', 'b'] */ function pullAll(array, values) { return (array && array.length && values && values.length) ? basePullAll(array, values) : array; } /** * This method is like `_.pullAll` except that it accepts `iteratee` which is * invoked for each element of `array` and `values` to generate the criterion * by which they're compared. The iteratee is invoked with one argument: (value). * * **Note:** Unlike `_.differenceBy`, this method mutates `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; * * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); * console.log(array); * // => [{ 'x': 2 }] */ function pullAllBy(array, values, iteratee) { return (array && array.length && values && values.length) ? basePullAll(array, values, getIteratee(iteratee, 2)) : array; } /** * This method is like `_.pullAll` except that it accepts `comparator` which * is invoked to compare elements of `array` to `values`. The comparator is * invoked with two arguments: (arrVal, othVal). * * **Note:** Unlike `_.differenceWith`, this method mutates `array`. * * @static * @memberOf _ * @since 4.6.0 * @category Array * @param {Array} array The array to modify. * @param {Array} values The values to remove. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns `array`. * @example * * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; * * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); * console.log(array); * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] */ function pullAllWith(array, values, comparator) { return (array && array.length && values && values.length) ? basePullAll(array, values, undefined, comparator) : array; } /** * Removes elements from `array` corresponding to `indexes` and returns an * array of removed elements. * * **Note:** Unlike `_.at`, this method mutates `array`. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to modify. * @param {...(number|number[])} [indexes] The indexes of elements to remove. * @returns {Array} Returns the new array of removed elements. * @example * * var array = ['a', 'b', 'c', 'd']; * var pulled = _.pullAt(array, [1, 3]); * * console.log(array); * // => ['a', 'c'] * * console.log(pulled); * // => ['b', 'd'] */ var pullAt = flatRest(function(array, indexes) { var length = array == null ? 0 : array.length, result = baseAt(array, indexes); basePullAt(array, arrayMap(indexes, function(index) { return isIndex(index, length) ? +index : index; }).sort(compareAscending)); return result; }); /** * Removes all elements from `array` that `predicate` returns truthy for * and returns an array of the removed elements. The predicate is invoked * with three arguments: (value, index, array). * * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` * to pull elements from an array by value. * * @static * @memberOf _ * @since 2.0.0 * @category Array * @param {Array} array The array to modify. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new array of removed elements. * @example * * var array = [1, 2, 3, 4]; * var evens = _.remove(array, function(n) { * return n % 2 == 0; * }); * * console.log(array); * // => [1, 3] * * console.log(evens); * // => [2, 4] */ function remove(array, predicate) { var result = []; if (!(array && array.length)) { return result; } var index = -1, indexes = [], length = array.length; predicate = getIteratee(predicate, 3); while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result.push(value); indexes.push(index); } } basePullAt(array, indexes); return result; } /** * Reverses `array` so that the first element becomes the last, the second * element becomes the second to last, and so on. * * **Note:** This method mutates `array` and is based on * [`Array#reverse`](https://mdn.io/Array/reverse). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to modify. * @returns {Array} Returns `array`. * @example * * var array = [1, 2, 3]; * * _.reverse(array); * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function reverse(array) { return array == null ? array : nativeReverse.call(array); } /** * Creates a slice of `array` from `start` up to, but not including, `end`. * * **Note:** This method is used instead of * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are * returned. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to slice. * @param {number} [start=0] The start position. * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. */ function slice(array, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { start = 0; end = length; } else { start = start == null ? 0 : toInteger(start); end = end === undefined ? length : toInteger(end); } return baseSlice(array, start, end); } /** * Uses a binary search to determine the lowest index at which `value` * should be inserted into `array` in order to maintain its sort order. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedIndex([30, 50], 40); * // => 1 */ function sortedIndex(array, value) { return baseSortedIndex(array, value); } /** * This method is like `_.sortedIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 0 * * // The `_.property` iteratee shorthand. * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); * // => 0 */ function sortedIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); } /** * This method is like `_.indexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedIndexOf([4, 5, 5, 5, 6], 5); * // => 1 */ function sortedIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value); if (index < length && eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.sortedIndex` except that it returns the highest * index at which `value` should be inserted into `array` in order to * maintain its sort order. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * _.sortedLastIndex([4, 5, 5, 5, 6], 5); * // => 4 */ function sortedLastIndex(array, value) { return baseSortedIndex(array, value, true); } /** * This method is like `_.sortedLastIndex` except that it accepts `iteratee` * which is invoked for `value` and each element of `array` to compute their * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The sorted array to inspect. * @param {*} value The value to evaluate. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {number} Returns the index at which `value` should be inserted * into `array`. * @example * * var objects = [{ 'x': 4 }, { 'x': 5 }]; * * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); * // => 1 * * // The `_.property` iteratee shorthand. * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); * // => 1 */ function sortedLastIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); } /** * This method is like `_.lastIndexOf` except that it performs a binary * search on a sorted `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {*} value The value to search for. * @returns {number} Returns the index of the matched value, else `-1`. * @example * * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); * // => 3 */ function sortedLastIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value, true) - 1; if (eq(array[index], value)) { return index; } } return -1; } /** * This method is like `_.uniq` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniq([1, 1, 2]); * // => [1, 2] */ function sortedUniq(array) { return (array && array.length) ? baseSortedUniq(array) : []; } /** * This method is like `_.uniqBy` except that it's designed and optimized * for sorted arrays. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); * // => [1.1, 2.3] */ function sortedUniqBy(array, iteratee) { return (array && array.length) ? baseSortedUniq(array, getIteratee(iteratee, 2)) : []; } /** * Gets all but the first element of `array`. * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to query. * @returns {Array} Returns the slice of `array`. * @example * * _.tail([1, 2, 3]); * // => [2, 3] */ function tail(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 1, length) : []; } /** * Creates a slice of `array` with `n` elements taken from the beginning. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.take([1, 2, 3]); * // => [1] * * _.take([1, 2, 3], 2); * // => [1, 2] * * _.take([1, 2, 3], 5); * // => [1, 2, 3] * * _.take([1, 2, 3], 0); * // => [] */ function take(array, n, guard) { if (!(array && array.length)) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, 0, n < 0 ? 0 : n); } /** * Creates a slice of `array` with `n` elements taken from the end. * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {number} [n=1] The number of elements to take. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the slice of `array`. * @example * * _.takeRight([1, 2, 3]); * // => [3] * * _.takeRight([1, 2, 3], 2); * // => [2, 3] * * _.takeRight([1, 2, 3], 5); * // => [1, 2, 3] * * _.takeRight([1, 2, 3], 0); * // => [] */ function takeRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, n < 0 ? 0 : n, length); } /** * Creates a slice of `array` with elements taken from the end. Elements are * taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': false } * ]; * * _.takeRightWhile(users, function(o) { return !o.active; }); * // => objects for ['fred', 'pebbles'] * * // The `_.matches` iteratee shorthand. * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); * // => objects for ['pebbles'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeRightWhile(users, ['active', false]); * // => objects for ['fred', 'pebbles'] * * // The `_.property` iteratee shorthand. * _.takeRightWhile(users, 'active'); * // => [] */ function takeRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), false, true) : []; } /** * Creates a slice of `array` with elements taken from the beginning. Elements * are taken until `predicate` returns falsey. The predicate is invoked with * three arguments: (value, index, array). * * @static * @memberOf _ * @since 3.0.0 * @category Array * @param {Array} array The array to query. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the slice of `array`. * @example * * var users = [ * { 'user': 'barney', 'active': false }, * { 'user': 'fred', 'active': false }, * { 'user': 'pebbles', 'active': true } * ]; * * _.takeWhile(users, function(o) { return !o.active; }); * // => objects for ['barney', 'fred'] * * // The `_.matches` iteratee shorthand. * _.takeWhile(users, { 'user': 'barney', 'active': false }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.takeWhile(users, ['active', false]); * // => objects for ['barney', 'fred'] * * // The `_.property` iteratee shorthand. * _.takeWhile(users, 'active'); * // => [] */ function takeWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3)) : []; } /** * Creates an array of unique values, in order, from all given arrays using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of combined values. * @example * * _.union([2], [1, 2]); * // => [2, 1] */ var union = baseRest(function(arrays) { return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); }); /** * This method is like `_.union` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which uniqueness is computed. Result values are chosen from the first * array in which the value occurs. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * _.unionBy([2.1], [1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ var unionBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); }); /** * This method is like `_.union` except that it accepts `comparator` which * is invoked to compare elements of `arrays`. Result values are chosen from * the first array in which the value occurs. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of combined values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.unionWith(objects, others, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var unionWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); }); /** * Creates a duplicate-free version of an array, using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons, in which only the first occurrence of each element * is kept. The order of result values is determined by the order they occur * in the array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniq([2, 1, 2]); * // => [2, 1] */ function uniq(array) { return (array && array.length) ? baseUniq(array) : []; } /** * This method is like `_.uniq` except that it accepts `iteratee` which is * invoked for each element in `array` to generate the criterion by which * uniqueness is computed. The order of result values is determined by the * order they occur in the array. The iteratee is invoked with one argument: * (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * _.uniqBy([2.1, 1.2, 2.3], Math.floor); * // => [2.1, 1.2] * * // The `_.property` iteratee shorthand. * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 1 }, { 'x': 2 }] */ function uniqBy(array, iteratee) { return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } /** * This method is like `_.uniq` except that it accepts `comparator` which * is invoked to compare elements of `array`. The order of result values is * determined by the order they occur in the array.The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {Array} array The array to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new duplicate free array. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.uniqWith(objects, _.isEqual); * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] */ function uniqWith(array, comparator) { comparator = typeof comparator == 'function' ? comparator : undefined; return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } /** * This method is like `_.zip` except that it accepts an array of grouped * elements and creates an array regrouping the elements to their pre-zip * configuration. * * @static * @memberOf _ * @since 1.2.0 * @category Array * @param {Array} array The array of grouped elements to process. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] * * _.unzip(zipped); * // => [['a', 'b'], [1, 2], [true, false]] */ function unzip(array) { if (!(array && array.length)) { return []; } var length = 0; array = arrayFilter(array, function(group) { if (isArrayLikeObject(group)) { length = nativeMax(group.length, length); return true; } }); return baseTimes(length, function(index) { return arrayMap(array, baseProperty(index)); }); } /** * This method is like `_.unzip` except that it accepts `iteratee` to specify * how regrouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {Array} array The array of grouped elements to process. * @param {Function} [iteratee=_.identity] The function to combine * regrouped values. * @returns {Array} Returns the new array of regrouped elements. * @example * * var zipped = _.zip([1, 2], [10, 20], [100, 200]); * // => [[1, 10, 100], [2, 20, 200]] * * _.unzipWith(zipped, _.add); * // => [3, 30, 300] */ function unzipWith(array, iteratee) { if (!(array && array.length)) { return []; } var result = unzip(array); if (iteratee == null) { return result; } return arrayMap(result, function(group) { return apply(iteratee, undefined, group); }); } /** * Creates an array excluding all given values using * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * for equality comparisons. * * **Note:** Unlike `_.pull`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {Array} array The array to inspect. * @param {...*} [values] The values to exclude. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.xor * @example * * _.without([2, 1, 2, 3], 1, 2); * // => [3] */ var without = baseRest(function(array, values) { return isArrayLikeObject(array) ? baseDifference(array, values) : []; }); /** * Creates an array of unique values that is the * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) * of the given arrays. The order of result values is determined by the order * they occur in the arrays. * * @static * @memberOf _ * @since 2.4.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @returns {Array} Returns the new array of filtered values. * @see _.difference, _.without * @example * * _.xor([2, 1], [2, 3]); * // => [1, 3] */ var xor = baseRest(function(arrays) { return baseXor(arrayFilter(arrays, isArrayLikeObject)); }); /** * This method is like `_.xor` except that it accepts `iteratee` which is * invoked for each element of each `arrays` to generate the criterion by * which by which they're compared. The order of result values is determined * by the order they occur in the arrays. The iteratee is invoked with one * argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); * // => [1.2, 3.4] * * // The `_.property` iteratee shorthand. * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); * // => [{ 'x': 2 }] */ var xorBy = baseRest(function(arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); }); /** * This method is like `_.xor` except that it accepts `comparator` which is * invoked to compare elements of `arrays`. The order of result values is * determined by the order they occur in the arrays. The comparator is invoked * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 * @category Array * @param {...Array} [arrays] The arrays to inspect. * @param {Function} [comparator] The comparator invoked per element. * @returns {Array} Returns the new array of filtered values. * @example * * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * * _.xorWith(objects, others, _.isEqual); * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ var xorWith = baseRest(function(arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); }); /** * Creates an array of grouped elements, the first of which contains the * first elements of the given arrays, the second of which contains the * second elements of the given arrays, and so on. * * @static * @memberOf _ * @since 0.1.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zip(['a', 'b'], [1, 2], [true, false]); * // => [['a', 1, true], ['b', 2, false]] */ var zip = baseRest(unzip); /** * This method is like `_.fromPairs` except that it accepts two arrays, * one of property identifiers and one of corresponding values. * * @static * @memberOf _ * @since 0.4.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObject(['a', 'b'], [1, 2]); * // => { 'a': 1, 'b': 2 } */ function zipObject(props, values) { return baseZipObject(props || [], values || [], assignValue); } /** * This method is like `_.zipObject` except that it supports property paths. * * @static * @memberOf _ * @since 4.1.0 * @category Array * @param {Array} [props=[]] The property identifiers. * @param {Array} [values=[]] The property values. * @returns {Object} Returns the new object. * @example * * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } */ function zipObjectDeep(props, values) { return baseZipObject(props || [], values || [], baseSet); } /** * This method is like `_.zip` except that it accepts `iteratee` to specify * how grouped values should be combined. The iteratee is invoked with the * elements of each group: (...group). * * @static * @memberOf _ * @since 3.8.0 * @category Array * @param {...Array} [arrays] The arrays to process. * @param {Function} [iteratee=_.identity] The function to combine * grouped values. * @returns {Array} Returns the new array of grouped elements. * @example * * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { * return a + b + c; * }); * // => [111, 222] */ var zipWith = baseRest(function(arrays) { var length = arrays.length, iteratee = length > 1 ? arrays[length - 1] : undefined; iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; return unzipWith(arrays, iteratee); }); /*------------------------------------------------------------------------*/ /** * Creates a `lodash` wrapper instance that wraps `value` with explicit method * chain sequences enabled. The result of such sequences must be unwrapped * with `_#value`. * * @static * @memberOf _ * @since 1.3.0 * @category Seq * @param {*} value The value to wrap. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'pebbles', 'age': 1 } * ]; * * var youngest = _ * .chain(users) * .sortBy('age') * .map(function(o) { * return o.user + ' is ' + o.age; * }) * .head() * .value(); * // => 'pebbles is 1' */ function chain(value) { var result = lodash(value); result.__chain__ = true; return result; } /** * This method invokes `interceptor` and returns `value`. The interceptor * is invoked with one argument; (value). The purpose of this method is to * "tap into" a method chain sequence in order to modify intermediate results. * * @static * @memberOf _ * @since 0.1.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns `value`. * @example * * _([1, 2, 3]) * .tap(function(array) { * // Mutate input array. * array.pop(); * }) * .reverse() * .value(); * // => [2, 1] */ function tap(value, interceptor) { interceptor(value); return value; } /** * This method is like `_.tap` except that it returns the result of `interceptor`. * The purpose of this method is to "pass thru" values replacing intermediate * results in a method chain sequence. * * @static * @memberOf _ * @since 3.0.0 * @category Seq * @param {*} value The value to provide to `interceptor`. * @param {Function} interceptor The function to invoke. * @returns {*} Returns the result of `interceptor`. * @example * * _(' abc ') * .chain() * .trim() * .thru(function(value) { * return [value]; * }) * .value(); * // => ['abc'] */ function thru(value, interceptor) { return interceptor(value); } /** * This method is the wrapper version of `_.at`. * * @name at * @memberOf _ * @since 1.0.0 * @category Seq * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _(object).at(['a[0].b.c', 'a[1]']).value(); * // => [3, 4] */ var wrapperAt = flatRest(function(paths) { var length = paths.length, start = length ? paths[0] : 0, value = this.__wrapped__, interceptor = function(object) { return baseAt(object, paths); }; if (length > 1 || this.__actions__.length || !(value instanceof LazyWrapper) || !isIndex(start)) { return this.thru(interceptor); } value = value.slice(start, +start + (length ? 1 : 0)); value.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined }); return new LodashWrapper(value, this.__chain__).thru(function(array) { if (length && !array.length) { array.push(undefined); } return array; }); }); /** * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. * * @name chain * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var users = [ * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 } * ]; * * // A sequence without explicit chaining. * _(users).head(); * // => { 'user': 'barney', 'age': 36 } * * // A sequence with explicit chaining. * _(users) * .chain() * .head() * .pick('user') * .value(); * // => { 'user': 'barney' } */ function wrapperChain() { return chain(this); } /** * Executes the chain sequence and returns the wrapped result. * * @name commit * @memberOf _ * @since 3.2.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2]; * var wrapped = _(array).push(3); * * console.log(array); * // => [1, 2] * * wrapped = wrapped.commit(); * console.log(array); * // => [1, 2, 3] * * wrapped.last(); * // => 3 * * console.log(array); * // => [1, 2, 3] */ function wrapperCommit() { return new LodashWrapper(this.value(), this.__chain__); } /** * Gets the next value on a wrapped object following the * [iterator protocol](https://mdn.io/iteration_protocols#iterator). * * @name next * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the next iterator value. * @example * * var wrapped = _([1, 2]); * * wrapped.next(); * // => { 'done': false, 'value': 1 } * * wrapped.next(); * // => { 'done': false, 'value': 2 } * * wrapped.next(); * // => { 'done': true, 'value': undefined } */ function wrapperNext() { if (this.__values__ === undefined) { this.__values__ = toArray(this.value()); } var done = this.__index__ >= this.__values__.length, value = done ? undefined : this.__values__[this.__index__++]; return { 'done': done, 'value': value }; } /** * Enables the wrapper to be iterable. * * @name Symbol.iterator * @memberOf _ * @since 4.0.0 * @category Seq * @returns {Object} Returns the wrapper object. * @example * * var wrapped = _([1, 2]); * * wrapped[Symbol.iterator]() === wrapped; * // => true * * Array.from(wrapped); * // => [1, 2] */ function wrapperToIterator() { return this; } /** * Creates a clone of the chain sequence planting `value` as the wrapped value. * * @name plant * @memberOf _ * @since 3.2.0 * @category Seq * @param {*} value The value to plant. * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * function square(n) { * return n * n; * } * * var wrapped = _([1, 2]).map(square); * var other = wrapped.plant([3, 4]); * * other.value(); * // => [9, 16] * * wrapped.value(); * // => [1, 4] */ function wrapperPlant(value) { var result, parent = this; while (parent instanceof baseLodash) { var clone = wrapperClone(parent); clone.__index__ = 0; clone.__values__ = undefined; if (result) { previous.__wrapped__ = clone; } else { result = clone; } var previous = clone; parent = parent.__wrapped__; } previous.__wrapped__ = value; return result; } /** * This method is the wrapper version of `_.reverse`. * * **Note:** This method mutates the wrapped array. * * @name reverse * @memberOf _ * @since 0.1.0 * @category Seq * @returns {Object} Returns the new `lodash` wrapper instance. * @example * * var array = [1, 2, 3]; * * _(array).reverse().value() * // => [3, 2, 1] * * console.log(array); * // => [3, 2, 1] */ function wrapperReverse() { var value = this.__wrapped__; if (value instanceof LazyWrapper) { var wrapped = value; if (this.__actions__.length) { wrapped = new LazyWrapper(this); } wrapped = wrapped.reverse(); wrapped.__actions__.push({ 'func': thru, 'args': [reverse], 'thisArg': undefined }); return new LodashWrapper(wrapped, this.__chain__); } return this.thru(reverse); } /** * Executes the chain sequence to resolve the unwrapped value. * * @name value * @memberOf _ * @since 0.1.0 * @alias toJSON, valueOf * @category Seq * @returns {*} Returns the resolved unwrapped value. * @example * * _([1, 2, 3]).value(); * // => [1, 2, 3] */ function wrapperValue() { return baseWrapperValue(this.__wrapped__, this.__actions__); } /*------------------------------------------------------------------------*/ /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the number of times the key was returned by `iteratee`. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.5.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.countBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': 1, '6': 2 } * * // The `_.property` iteratee shorthand. * _.countBy(['one', 'two', 'three'], 'length'); * // => { '3': 2, '5': 1 } */ var countBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { ++result[key]; } else { baseAssignValue(result, key, 1); } }); /** * Checks if `predicate` returns truthy for **all** elements of `collection`. * Iteration is stopped once `predicate` returns falsey. The predicate is * invoked with three arguments: (value, index|key, collection). * * **Note:** This method returns `true` for * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of * elements of empty collections. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if all elements pass the predicate check, * else `false`. * @example * * _.every([true, 1, null, 'yes'], Boolean); * // => false * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.every(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.every(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.every(users, 'active'); * // => false */ function every(collection, predicate, guard) { var func = isArray(collection) ? arrayEvery : baseEvery; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning an array of all elements * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * **Note:** Unlike `_.remove`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.reject * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false } * ]; * * _.filter(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.filter(users, { 'age': 36, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.filter(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.filter(users, 'active'); * // => objects for ['barney'] */ function filter(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, getIteratee(predicate, 3)); } /** * Iterates over elements of `collection`, returning the first element * `predicate` returns truthy for. The predicate is invoked with three * arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=0] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': true }, * { 'user': 'fred', 'age': 40, 'active': false }, * { 'user': 'pebbles', 'age': 1, 'active': true } * ]; * * _.find(users, function(o) { return o.age < 40; }); * // => object for 'barney' * * // The `_.matches` iteratee shorthand. * _.find(users, { 'age': 1, 'active': true }); * // => object for 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.find(users, ['active', false]); * // => object for 'fred' * * // The `_.property` iteratee shorthand. * _.find(users, 'active'); * // => object for 'barney' */ var find = createFind(findIndex); /** * This method is like `_.find` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param {number} [fromIndex=collection.length-1] The index to search from. * @returns {*} Returns the matched element, else `undefined`. * @example * * _.findLast([1, 2, 3, 4], function(n) { * return n % 2 == 1; * }); * // => 3 */ var findLast = createFind(findLastIndex); /** * Creates a flattened array of values by running each element in `collection` * thru `iteratee` and flattening the mapped results. The iteratee is invoked * with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [n, n]; * } * * _.flatMap([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMap(collection, iteratee) { return baseFlatten(map(collection, iteratee), 1); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDeep([1, 2], duplicate); * // => [1, 1, 2, 2] */ function flatMapDeep(collection, iteratee) { return baseFlatten(map(collection, iteratee), INFINITY); } /** * This method is like `_.flatMap` except that it recursively flattens the * mapped results up to `depth` times. * * @static * @memberOf _ * @since 4.7.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {number} [depth=1] The maximum recursion depth. * @returns {Array} Returns the new flattened array. * @example * * function duplicate(n) { * return [[[n, n]]]; * } * * _.flatMapDepth([1, 2], duplicate, 2); * // => [[1, 1], [2, 2]] */ function flatMapDepth(collection, iteratee, depth) { depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(map(collection, iteratee), depth); } /** * Iterates over elements of `collection` and invokes `iteratee` for each element. * The iteratee is invoked with three arguments: (value, index|key, collection). * Iteratee functions may exit iteration early by explicitly returning `false`. * * **Note:** As with other "Collections" methods, objects with a "length" * property are iterated like arrays. To avoid this behavior use `_.forIn` * or `_.forOwn` for object iteration. * * @static * @memberOf _ * @since 0.1.0 * @alias each * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEachRight * @example * * _.forEach([1, 2], function(value) { * console.log(value); * }); * // => Logs `1` then `2`. * * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forEach(collection, iteratee) { var func = isArray(collection) ? arrayEach : baseEach; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.forEach` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 2.0.0 * @alias eachRight * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array|Object} Returns `collection`. * @see _.forEach * @example * * _.forEachRight([1, 2], function(value) { * console.log(value); * }); * // => Logs `2` then `1`. */ function forEachRight(collection, iteratee) { var func = isArray(collection) ? arrayEachRight : baseEachRight; return func(collection, getIteratee(iteratee, 3)); } /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The order of grouped values * is determined by the order they occur in `collection`. The corresponding * value of each key is an array of elements responsible for generating the * key. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * _.groupBy([6.1, 4.2, 6.3], Math.floor); * // => { '4': [4.2], '6': [6.1, 6.3] } * * // The `_.property` iteratee shorthand. * _.groupBy(['one', 'two', 'three'], 'length'); * // => { '3': ['one', 'two'], '5': ['three'] } */ var groupBy = createAggregator(function(result, value, key) { if (hasOwnProperty.call(result, key)) { result[key].push(value); } else { baseAssignValue(result, key, [value]); } }); /** * Checks if `value` is in `collection`. If `collection` is a string, it's * checked for a substring of `value`, otherwise * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * is used for equality comparisons. If `fromIndex` is negative, it's used as * the offset from the end of `collection`. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @param {*} value The value to search for. * @param {number} [fromIndex=0] The index to search from. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {boolean} Returns `true` if `value` is found, else `false`. * @example * * _.includes([1, 2, 3], 1); * // => true * * _.includes([1, 2, 3], 1, 2); * // => false * * _.includes({ 'a': 1, 'b': 2 }, 1); * // => true * * _.includes('abcd', 'bc'); * // => true */ function includes(collection, value, fromIndex, guard) { collection = isArrayLike(collection) ? collection : values(collection); fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; var length = collection.length; if (fromIndex < 0) { fromIndex = nativeMax(length + fromIndex, 0); } return isString(collection) ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) : (!!length && baseIndexOf(collection, value, fromIndex) > -1); } /** * Invokes the method at `path` of each element in `collection`, returning * an array of the results of each invoked method. Any additional arguments * are provided to each invoked method. If `path` is a function, it's invoked * for, and `this` bound to, each element in `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array|Function|string} path The path of the method to invoke or * the function invoked per iteration. * @param {...*} [args] The arguments to invoke each method with. * @returns {Array} Returns the array of results. * @example * * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); * // => [[1, 5, 7], [1, 2, 3]] * * _.invokeMap([123, 456], String.prototype.split, ''); * // => [['1', '2', '3'], ['4', '5', '6']] */ var invokeMap = baseRest(function(collection, path, args) { var index = -1, isFunc = typeof path == 'function', result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function(value) { result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); }); return result; }); /** * Creates an object composed of keys generated from the results of running * each element of `collection` thru `iteratee`. The corresponding value of * each key is the last element responsible for generating the key. The * iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The iteratee to transform keys. * @returns {Object} Returns the composed aggregate object. * @example * * var array = [ * { 'dir': 'left', 'code': 97 }, * { 'dir': 'right', 'code': 100 } * ]; * * _.keyBy(array, function(o) { * return String.fromCharCode(o.code); * }); * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } * * _.keyBy(array, 'dir'); * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } */ var keyBy = createAggregator(function(result, value, key) { baseAssignValue(result, key, value); }); /** * Creates an array of values by running each element in `collection` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. * * The guarded methods are: * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, * `template`, `trim`, `trimEnd`, `trimStart`, and `words` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Array} Returns the new mapped array. * @example * * function square(n) { * return n * n; * } * * _.map([4, 8], square); * // => [16, 64] * * _.map({ 'a': 4, 'b': 8 }, square); * // => [16, 64] (iteration order is not guaranteed) * * var users = [ * { 'user': 'barney' }, * { 'user': 'fred' } * ]; * * // The `_.property` iteratee shorthand. * _.map(users, 'user'); * // => ['barney', 'fred'] */ function map(collection, iteratee) { var func = isArray(collection) ? arrayMap : baseMap; return func(collection, getIteratee(iteratee, 3)); } /** * This method is like `_.sortBy` except that it allows specifying the sort * orders of the iteratees to sort by. If `orders` is unspecified, all values * are sorted in ascending order. Otherwise, specify an order of "desc" for * descending or "asc" for ascending sort order of corresponding values. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] * The iteratees to sort by. * @param {string[]} [orders] The sort orders of `iteratees`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 34 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'barney', 'age': 36 } * ]; * * // Sort by `user` in ascending order and by `age` in descending order. * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] */ function orderBy(collection, iteratees, orders, guard) { if (collection == null) { return []; } if (!isArray(iteratees)) { iteratees = iteratees == null ? [] : [iteratees]; } orders = guard ? undefined : orders; if (!isArray(orders)) { orders = orders == null ? [] : [orders]; } return baseOrderBy(collection, iteratees, orders); } /** * Creates an array of elements split into two groups, the first of which * contains elements `predicate` returns truthy for, the second of which * contains elements `predicate` returns falsey for. The predicate is * invoked with one argument: (value). * * @static * @memberOf _ * @since 3.0.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the array of grouped elements. * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true }, * { 'user': 'pebbles', 'age': 1, 'active': false } * ]; * * _.partition(users, function(o) { return o.active; }); * // => objects for [['fred'], ['barney', 'pebbles']] * * // The `_.matches` iteratee shorthand. * _.partition(users, { 'age': 1, 'active': false }); * // => objects for [['pebbles'], ['barney', 'fred']] * * // The `_.matchesProperty` iteratee shorthand. * _.partition(users, ['active', false]); * // => objects for [['barney', 'pebbles'], ['fred']] * * // The `_.property` iteratee shorthand. * _.partition(users, 'active'); * // => objects for [['fred'], ['barney', 'pebbles']] */ var partition = createAggregator(function(result, value, key) { result[key ? 0 : 1].push(value); }, function() { return [[], []]; }); /** * Reduces `collection` to a value which is the accumulated result of running * each element in `collection` thru `iteratee`, where each successive * invocation is supplied the return value of the previous. If `accumulator` * is not given, the first element of `collection` is used as the initial * value. The iteratee is invoked with four arguments: * (accumulator, value, index|key, collection). * * Many lodash methods are guarded to work as iteratees for methods like * `_.reduce`, `_.reduceRight`, and `_.transform`. * * The guarded methods are: * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, * and `sortBy` * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduceRight * @example * * _.reduce([1, 2], function(sum, n) { * return sum + n; * }, 0); * // => 3 * * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * return result; * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) */ function reduce(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduce : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); } /** * This method is like `_.reduce` except that it iterates over elements of * `collection` from right to left. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The initial value. * @returns {*} Returns the accumulated value. * @see _.reduce * @example * * var array = [[0, 1], [2, 3], [4, 5]]; * * _.reduceRight(array, function(flattened, other) { * return flattened.concat(other); * }, []); * // => [4, 5, 2, 3, 0, 1] */ function reduceRight(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduceRight : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); } /** * The opposite of `_.filter`; this method returns the elements of `collection` * that `predicate` does **not** return truthy for. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {Array} Returns the new filtered array. * @see _.filter * @example * * var users = [ * { 'user': 'barney', 'age': 36, 'active': false }, * { 'user': 'fred', 'age': 40, 'active': true } * ]; * * _.reject(users, function(o) { return !o.active; }); * // => objects for ['fred'] * * // The `_.matches` iteratee shorthand. * _.reject(users, { 'age': 40, 'active': true }); * // => objects for ['barney'] * * // The `_.matchesProperty` iteratee shorthand. * _.reject(users, ['active', false]); * // => objects for ['fred'] * * // The `_.property` iteratee shorthand. * _.reject(users, 'active'); * // => objects for ['barney'] */ function reject(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, negate(getIteratee(predicate, 3))); } /** * Gets a random element from `collection`. * * @static * @memberOf _ * @since 2.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @returns {*} Returns the random element. * @example * * _.sample([1, 2, 3, 4]); * // => 2 */ function sample(collection) { var func = isArray(collection) ? arraySample : baseSample; return func(collection); } /** * Gets `n` random elements at unique keys from `collection` up to the * size of `collection`. * * @static * @memberOf _ * @since 4.0.0 * @category Collection * @param {Array|Object} collection The collection to sample. * @param {number} [n=1] The number of elements to sample. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Array} Returns the random elements. * @example * * _.sampleSize([1, 2, 3], 2); * // => [3, 1] * * _.sampleSize([1, 2, 3], 4); * // => [2, 3, 1] */ function sampleSize(collection, n, guard) { if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } var func = isArray(collection) ? arraySampleSize : baseSampleSize; return func(collection, n); } /** * Creates an array of shuffled values, using a version of the * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to shuffle. * @returns {Array} Returns the new shuffled array. * @example * * _.shuffle([1, 2, 3, 4]); * // => [4, 1, 3, 2] */ function shuffle(collection) { var func = isArray(collection) ? arrayShuffle : baseShuffle; return func(collection); } /** * Gets the size of `collection` by returning its length for array-like * values or the number of own enumerable string keyed properties for objects. * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object|string} collection The collection to inspect. * @returns {number} Returns the collection size. * @example * * _.size([1, 2, 3]); * // => 3 * * _.size({ 'a': 1, 'b': 2 }); * // => 2 * * _.size('pebbles'); * // => 7 */ function size(collection) { if (collection == null) { return 0; } if (isArrayLike(collection)) { return isString(collection) ? stringSize(collection) : collection.length; } var tag = getTag(collection); if (tag == mapTag || tag == setTag) { return collection.size; } return baseKeys(collection).length; } /** * Checks if `predicate` returns truthy for **any** element of `collection`. * Iteration is stopped once `predicate` returns truthy. The predicate is * invoked with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {boolean} Returns `true` if any element passes the predicate check, * else `false`. * @example * * _.some([null, 0, 'yes', false], Boolean); * // => true * * var users = [ * { 'user': 'barney', 'active': true }, * { 'user': 'fred', 'active': false } * ]; * * // The `_.matches` iteratee shorthand. * _.some(users, { 'user': 'barney', 'active': false }); * // => false * * // The `_.matchesProperty` iteratee shorthand. * _.some(users, ['active', false]); * // => true * * // The `_.property` iteratee shorthand. * _.some(users, 'active'); * // => true */ function some(collection, predicate, guard) { var func = isArray(collection) ? arraySome : baseSome; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } /** * Creates an array of elements, sorted in ascending order by the results of * running each element in a collection thru each iteratee. This method * performs a stable sort, that is, it preserves the original sort order of * equal elements. The iteratees are invoked with one argument: (value). * * @static * @memberOf _ * @since 0.1.0 * @category Collection * @param {Array|Object} collection The collection to iterate over. * @param {...(Function|Function[])} [iteratees=[_.identity]] * The iteratees to sort by. * @returns {Array} Returns the new sorted array. * @example * * var users = [ * { 'user': 'fred', 'age': 48 }, * { 'user': 'barney', 'age': 36 }, * { 'user': 'fred', 'age': 40 }, * { 'user': 'barney', 'age': 34 } * ]; * * _.sortBy(users, [function(o) { return o.user; }]); * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] * * _.sortBy(users, ['user', 'age']); * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] */ var sortBy = baseRest(function(collection, iteratees) { if (collection == null) { return []; } var length = iteratees.length; if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { iteratees = []; } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { iteratees = [iteratees[0]]; } return baseOrderBy(collection, baseFlatten(iteratees, 1), []); }); /*------------------------------------------------------------------------*/ /** * Gets the timestamp of the number of milliseconds that have elapsed since * the Unix epoch (1 January 1970 00:00:00 UTC). * * @static * @memberOf _ * @since 2.4.0 * @category Date * @returns {number} Returns the timestamp. * @example * * _.defer(function(stamp) { * console.log(_.now() - stamp); * }, _.now()); * // => Logs the number of milliseconds it took for the deferred invocation. */ var now = ctxNow || function() { return root.Date.now(); }; /*------------------------------------------------------------------------*/ /** * The opposite of `_.before`; this method creates a function that invokes * `func` once it's called `n` or more times. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {number} n The number of calls before `func` is invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var saves = ['profile', 'settings']; * * var done = _.after(saves.length, function() { * console.log('done saving!'); * }); * * _.forEach(saves, function(type) { * asyncSave({ 'type': type, 'complete': done }); * }); * // => Logs 'done saving!' after the two async saves have completed. */ function after(n, func) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n < 1) { return func.apply(this, arguments); } }; } /** * Creates a function that invokes `func`, with up to `n` arguments, * ignoring any additional arguments. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @param {number} [n=func.length] The arity cap. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.ary(parseInt, 1)); * // => [6, 8, 10] */ function ary(func, n, guard) { n = guard ? undefined : n; n = (func && n == null) ? func.length : n; return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); } /** * Creates a function that invokes `func`, with the `this` binding and arguments * of the created function, while it's called less than `n` times. Subsequent * calls to the created function return the result of the last `func` invocation. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {number} n The number of calls at which `func` is no longer invoked. * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * jQuery(element).on('click', _.before(5, addContactToList)); * // => Allows adding up to 4 contacts to the list. */ function before(n, func) { var result; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function() { if (--n > 0) { result = func.apply(this, arguments); } if (n <= 1) { func = undefined; } return result; }; } /** * Creates a function that invokes `func` with the `this` binding of `thisArg` * and `partials` prepended to the arguments it receives. * * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for partially applied arguments. * * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" * property of bound functions. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to bind. * @param {*} thisArg The `this` binding of `func`. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * function greet(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * * var object = { 'user': 'fred' }; * * var bound = _.bind(greet, object, 'hi'); * bound('!'); * // => 'hi fred!' * * // Bound with placeholders. * var bound = _.bind(greet, object, _, '!'); * bound('hi'); * // => 'hi fred!' */ var bind = baseRest(function(func, thisArg, partials) { var bitmask = WRAP_BIND_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bind)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(func, bitmask, thisArg, partials, holders); }); /** * Creates a function that invokes the method at `object[key]` with `partials` * prepended to the arguments it receives. * * This method differs from `_.bind` by allowing bound functions to reference * methods that may be redefined or don't yet exist. See * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) * for more details. * * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * @static * @memberOf _ * @since 0.10.0 * @category Function * @param {Object} object The object to invoke the method on. * @param {string} key The key of the method. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new bound function. * @example * * var object = { * 'user': 'fred', * 'greet': function(greeting, punctuation) { * return greeting + ' ' + this.user + punctuation; * } * }; * * var bound = _.bindKey(object, 'greet', 'hi'); * bound('!'); * // => 'hi fred!' * * object.greet = function(greeting, punctuation) { * return greeting + 'ya ' + this.user + punctuation; * }; * * bound('!'); * // => 'hiya fred!' * * // Bound with placeholders. * var bound = _.bindKey(object, 'greet', _, '!'); * bound('hi'); * // => 'hiya fred!' */ var bindKey = baseRest(function(object, key, partials) { var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bindKey)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(key, bitmask, object, partials, holders); }); /** * Creates a function that accepts arguments of `func` and either invokes * `func` returning its result, if at least `arity` number of arguments have * been provided, or returns a function that accepts the remaining `func` * arguments, and so on. The arity of `func` may be specified if `func.length` * is not sufficient. * * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, * may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 2.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curry(abc); * * curried(1)(2)(3); * // => [1, 2, 3] * * curried(1, 2)(3); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(1)(_, 3)(2); * // => [1, 2, 3] */ function curry(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curry.placeholder; return result; } /** * This method is like `_.curry` except that arguments are applied to `func` * in the manner of `_.partialRight` instead of `_.partial`. * * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for provided arguments. * * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to curry. * @param {number} [arity=func.length] The arity of `func`. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the new curried function. * @example * * var abc = function(a, b, c) { * return [a, b, c]; * }; * * var curried = _.curryRight(abc); * * curried(3)(2)(1); * // => [1, 2, 3] * * curried(2, 3)(1); * // => [1, 2, 3] * * curried(1, 2, 3); * // => [1, 2, 3] * * // Curried with placeholders. * curried(3)(1, _)(2); * // => [1, 2, 3] */ function curryRight(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curryRight.placeholder; return result; } /** * Creates a debounced function that delays invoking `func` until after `wait` * milliseconds have elapsed since the last time the debounced function was * invoked. The debounced function comes with a `cancel` method to cancel * delayed `func` invocations and a `flush` method to immediately invoke them. * Provide `options` to indicate whether `func` should be invoked on the * leading and/or trailing edge of the `wait` timeout. The `func` is invoked * with the last arguments provided to the debounced function. Subsequent * calls to the debounced function return the result of the last `func` * invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the debounced function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.debounce` and `_.throttle`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to debounce. * @param {number} [wait=0] The number of milliseconds to delay. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=false] * Specify invoking on the leading edge of the timeout. * @param {number} [options.maxWait] * The maximum time `func` is allowed to be delayed before it's invoked. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new debounced function. * @example * * // Avoid costly calculations while the window size is in flux. * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); * * // Invoke `sendMail` when clicked, debouncing subsequent calls. * jQuery(element).on('click', _.debounce(sendMail, 300, { * 'leading': true, * 'trailing': false * })); * * // Ensure `batchLog` is invoked once after 1 second of debounced calls. * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); * var source = new EventSource('/stream'); * jQuery(source).on('message', debounced); * * // Cancel the trailing debounced invocation. * jQuery(window).on('popstate', debounced.cancel); */ function debounce(func, wait, options) { var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } wait = toNumber(wait) || 0; if (isObject(options)) { leading = !!options.leading; maxing = 'maxWait' in options; maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; trailing = 'trailing' in options ? !!options.trailing : trailing; } function invokeFunc(time) { var args = lastArgs, thisArg = lastThis; lastArgs = lastThis = undefined; lastInvokeTime = time; result = func.apply(thisArg, args); return result; } function leadingEdge(time) { // Reset any `maxWait` timer. lastInvokeTime = time; // Start the timer for the trailing edge. timerId = setTimeout(timerExpired, wait); // Invoke the leading edge. return leading ? invokeFunc(time) : result; } function remainingWait(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall; return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting; } function shouldInvoke(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime; // Either this is the first call, activity has stopped and we're at the // trailing edge, the system time has gone backwards and we're treating // it as the trailing edge, or we've hit the `maxWait` limit. return (lastCallTime === undefined || (timeSinceLastCall >= wait) || (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); } function timerExpired() { var time = now(); if (shouldInvoke(time)) { return trailingEdge(time); } // Restart the timer. timerId = setTimeout(timerExpired, remainingWait(time)); } function trailingEdge(time) { timerId = undefined; // Only invoke if we have `lastArgs` which means `func` has been // debounced at least once. if (trailing && lastArgs) { return invokeFunc(time); } lastArgs = lastThis = undefined; return result; } function cancel() { if (timerId !== undefined) { clearTimeout(timerId); } lastInvokeTime = 0; lastArgs = lastCallTime = lastThis = timerId = undefined; } function flush() { return timerId === undefined ? result : trailingEdge(now()); } function debounced() { var time = now(), isInvoking = shouldInvoke(time); lastArgs = arguments; lastThis = this; lastCallTime = time; if (isInvoking) { if (timerId === undefined) { return leadingEdge(lastCallTime); } if (maxing) { // Handle invocations in a tight loop. timerId = setTimeout(timerExpired, wait); return invokeFunc(lastCallTime); } } if (timerId === undefined) { timerId = setTimeout(timerExpired, wait); } return result; } debounced.cancel = cancel; debounced.flush = flush; return debounced; } /** * Defers invoking the `func` until the current call stack has cleared. Any * additional arguments are provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to defer. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.defer(function(text) { * console.log(text); * }, 'deferred'); * // => Logs 'deferred' after one millisecond. */ var defer = baseRest(function(func, args) { return baseDelay(func, 1, args); }); /** * Invokes `func` after `wait` milliseconds. Any additional arguments are * provided to `func` when it's invoked. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to delay. * @param {number} wait The number of milliseconds to delay invocation. * @param {...*} [args] The arguments to invoke `func` with. * @returns {number} Returns the timer id. * @example * * _.delay(function(text) { * console.log(text); * }, 1000, 'later'); * // => Logs 'later' after one second. */ var delay = baseRest(function(func, wait, args) { return baseDelay(func, toNumber(wait) || 0, args); }); /** * Creates a function that invokes `func` with arguments reversed. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to flip arguments for. * @returns {Function} Returns the new flipped function. * @example * * var flipped = _.flip(function() { * return _.toArray(arguments); * }); * * flipped('a', 'b', 'c', 'd'); * // => ['d', 'c', 'b', 'a'] */ function flip(func) { return createWrap(func, WRAP_FLIP_FLAG); } /** * Creates a function that memoizes the result of `func`. If `resolver` is * provided, it determines the cache key for storing the result based on the * arguments provided to the memoized function. By default, the first argument * provided to the memoized function is used as the map cache key. The `func` * is invoked with the `this` binding of the memoized function. * * **Note:** The cache is exposed as the `cache` property on the memoized * function. Its creation may be customized by replacing the `_.memoize.Cache` * constructor with one whose instances implement the * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) * method interface of `clear`, `delete`, `get`, `has`, and `set`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to have its output memoized. * @param {Function} [resolver] The function to resolve the cache key. * @returns {Function} Returns the new memoized function. * @example * * var object = { 'a': 1, 'b': 2 }; * var other = { 'c': 3, 'd': 4 }; * * var values = _.memoize(_.values); * values(object); * // => [1, 2] * * values(other); * // => [3, 4] * * object.a = 2; * values(object); * // => [1, 2] * * // Modify the result cache. * values.cache.set(object, ['a', 'b']); * values(object); * // => ['a', 'b'] * * // Replace `_.memoize.Cache`. * _.memoize.Cache = WeakMap; */ function memoize(func, resolver) { if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { throw new TypeError(FUNC_ERROR_TEXT); } var memoized = function() { var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache; if (cache.has(key)) { return cache.get(key); } var result = func.apply(this, args); memoized.cache = cache.set(key, result) || cache; return result; }; memoized.cache = new (memoize.Cache || MapCache); return memoized; } // Expose `MapCache`. memoize.Cache = MapCache; /** * Creates a function that negates the result of the predicate `func`. The * `func` predicate is invoked with the `this` binding and arguments of the * created function. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} predicate The predicate to negate. * @returns {Function} Returns the new negated function. * @example * * function isEven(n) { * return n % 2 == 0; * } * * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); * // => [1, 3, 5] */ function negate(predicate) { if (typeof predicate != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return function() { var args = arguments; switch (args.length) { case 0: return !predicate.call(this); case 1: return !predicate.call(this, args[0]); case 2: return !predicate.call(this, args[0], args[1]); case 3: return !predicate.call(this, args[0], args[1], args[2]); } return !predicate.apply(this, args); }; } /** * Creates a function that is restricted to invoking `func` once. Repeat calls * to the function return the value of the first invocation. The `func` is * invoked with the `this` binding and arguments of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to restrict. * @returns {Function} Returns the new restricted function. * @example * * var initialize = _.once(createApplication); * initialize(); * initialize(); * // => `createApplication` is invoked once */ function once(func) { return before(2, func); } /** * Creates a function that invokes `func` with its arguments transformed. * * @static * @since 4.0.0 * @memberOf _ * @category Function * @param {Function} func The function to wrap. * @param {...(Function|Function[])} [transforms=[_.identity]] * The argument transforms. * @returns {Function} Returns the new function. * @example * * function doubled(n) { * return n * 2; * } * * function square(n) { * return n * n; * } * * var func = _.overArgs(function(x, y) { * return [x, y]; * }, [square, doubled]); * * func(9, 3); * // => [81, 6] * * func(10, 5); * // => [100, 10] */ var overArgs = castRest(function(func, transforms) { transforms = (transforms.length == 1 && isArray(transforms[0])) ? arrayMap(transforms[0], baseUnary(getIteratee())) : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); var funcsLength = transforms.length; return baseRest(function(args) { var index = -1, length = nativeMin(args.length, funcsLength); while (++index < length) { args[index] = transforms[index].call(this, args[index]); } return apply(func, this, args); }); }); /** * Creates a function that invokes `func` with `partials` prepended to the * arguments it receives. This method is like `_.bind` except it does **not** * alter the `this` binding. * * The `_.partial.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 0.2.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var sayHelloTo = _.partial(greet, 'hello'); * sayHelloTo('fred'); * // => 'hello fred' * * // Partially applied with placeholders. * var greetFred = _.partial(greet, _, 'fred'); * greetFred('hi'); * // => 'hi fred' */ var partial = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partial)); return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); }); /** * This method is like `_.partial` except that partially applied arguments * are appended to the arguments it receives. * * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic * builds, may be used as a placeholder for partially applied arguments. * * **Note:** This method doesn't set the "length" property of partially * applied functions. * * @static * @memberOf _ * @since 1.0.0 * @category Function * @param {Function} func The function to partially apply arguments to. * @param {...*} [partials] The arguments to be partially applied. * @returns {Function} Returns the new partially applied function. * @example * * function greet(greeting, name) { * return greeting + ' ' + name; * } * * var greetFred = _.partialRight(greet, 'fred'); * greetFred('hi'); * // => 'hi fred' * * // Partially applied with placeholders. * var sayHelloTo = _.partialRight(greet, 'hello', _); * sayHelloTo('fred'); * // => 'hello fred' */ var partialRight = baseRest(function(func, partials) { var holders = replaceHolders(partials, getHolder(partialRight)); return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); }); /** * Creates a function that invokes `func` with arguments arranged according * to the specified `indexes` where the argument value at the first index is * provided as the first argument, the argument value at the second index is * provided as the second argument, and so on. * * @static * @memberOf _ * @since 3.0.0 * @category Function * @param {Function} func The function to rearrange arguments for. * @param {...(number|number[])} indexes The arranged argument indexes. * @returns {Function} Returns the new function. * @example * * var rearged = _.rearg(function(a, b, c) { * return [a, b, c]; * }, [2, 0, 1]); * * rearged('b', 'c', 'a') * // => ['a', 'b', 'c'] */ var rearg = flatRest(function(func, indexes) { return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); }); /** * Creates a function that invokes `func` with the `this` binding of the * created function and arguments from `start` and beyond provided as * an array. * * **Note:** This method is based on the * [rest parameter](https://mdn.io/rest_parameters). * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to apply a rest parameter to. * @param {number} [start=func.length-1] The start position of the rest parameter. * @returns {Function} Returns the new function. * @example * * var say = _.rest(function(what, names) { * return what + ' ' + _.initial(names).join(', ') + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); * }); * * say('hello', 'fred', 'barney', 'pebbles'); * // => 'hello fred, barney, & pebbles' */ function rest(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start === undefined ? start : toInteger(start); return baseRest(func, start); } /** * Creates a function that invokes `func` with the `this` binding of the * create function and an array of arguments much like * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). * * **Note:** This method is based on the * [spread operator](https://mdn.io/spread_operator). * * @static * @memberOf _ * @since 3.2.0 * @category Function * @param {Function} func The function to spread arguments over. * @param {number} [start=0] The start position of the spread. * @returns {Function} Returns the new function. * @example * * var say = _.spread(function(who, what) { * return who + ' says ' + what; * }); * * say(['fred', 'hello']); * // => 'fred says hello' * * var numbers = Promise.all([ * Promise.resolve(40), * Promise.resolve(36) * ]); * * numbers.then(_.spread(function(x, y) { * return x + y; * })); * // => a Promise of 76 */ function spread(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start == null ? 0 : nativeMax(toInteger(start), 0); return baseRest(function(args) { var array = args[start], otherArgs = castSlice(args, 0, start); if (array) { arrayPush(otherArgs, array); } return apply(func, this, otherArgs); }); } /** * Creates a throttled function that only invokes `func` at most once per * every `wait` milliseconds. The throttled function comes with a `cancel` * method to cancel delayed `func` invocations and a `flush` method to * immediately invoke them. Provide `options` to indicate whether `func` * should be invoked on the leading and/or trailing edge of the `wait` * timeout. The `func` is invoked with the last arguments provided to the * throttled function. Subsequent calls to the throttled function return the * result of the last `func` invocation. * * **Note:** If `leading` and `trailing` options are `true`, `func` is * invoked on the trailing edge of the timeout only if the throttled function * is invoked more than once during the `wait` timeout. * * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred * until to the next tick, similar to `setTimeout` with a timeout of `0`. * * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) * for details over the differences between `_.throttle` and `_.debounce`. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {Function} func The function to throttle. * @param {number} [wait=0] The number of milliseconds to throttle invocations to. * @param {Object} [options={}] The options object. * @param {boolean} [options.leading=true] * Specify invoking on the leading edge of the timeout. * @param {boolean} [options.trailing=true] * Specify invoking on the trailing edge of the timeout. * @returns {Function} Returns the new throttled function. * @example * * // Avoid excessively updating the position while scrolling. * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); * * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); * jQuery(element).on('click', throttled); * * // Cancel the trailing throttled invocation. * jQuery(window).on('popstate', throttled.cancel); */ function throttle(func, wait, options) { var leading = true, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (isObject(options)) { leading = 'leading' in options ? !!options.leading : leading; trailing = 'trailing' in options ? !!options.trailing : trailing; } return debounce(func, wait, { 'leading': leading, 'maxWait': wait, 'trailing': trailing }); } /** * Creates a function that accepts up to one argument, ignoring any * additional arguments. * * @static * @memberOf _ * @since 4.0.0 * @category Function * @param {Function} func The function to cap arguments for. * @returns {Function} Returns the new capped function. * @example * * _.map(['6', '8', '10'], _.unary(parseInt)); * // => [6, 8, 10] */ function unary(func) { return ary(func, 1); } /** * Creates a function that provides `value` to `wrapper` as its first * argument. Any additional arguments provided to the function are appended * to those provided to the `wrapper`. The wrapper is invoked with the `this` * binding of the created function. * * @static * @memberOf _ * @since 0.1.0 * @category Function * @param {*} value The value to wrap. * @param {Function} [wrapper=identity] The wrapper function. * @returns {Function} Returns the new function. * @example * * var p = _.wrap(_.escape, function(func, text) { * return '

' + func(text) + '

'; * }); * * p('fred, barney, & pebbles'); * // => '

fred, barney, & pebbles

' */ function wrap(value, wrapper) { return partial(castFunction(wrapper), value); } /*------------------------------------------------------------------------*/ /** * Casts `value` as an array if it's not one. * * @static * @memberOf _ * @since 4.4.0 * @category Lang * @param {*} value The value to inspect. * @returns {Array} Returns the cast array. * @example * * _.castArray(1); * // => [1] * * _.castArray({ 'a': 1 }); * // => [{ 'a': 1 }] * * _.castArray('abc'); * // => ['abc'] * * _.castArray(null); * // => [null] * * _.castArray(undefined); * // => [undefined] * * _.castArray(); * // => [] * * var array = [1, 2, 3]; * console.log(_.castArray(array) === array); * // => true */ function castArray() { if (!arguments.length) { return []; } var value = arguments[0]; return isArray(value) ? value : [value]; } /** * Creates a shallow clone of `value`. * * **Note:** This method is loosely based on the * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) * and supports cloning arrays, array buffers, booleans, date objects, maps, * numbers, `Object` objects, regexes, sets, strings, symbols, and typed * arrays. The own enumerable properties of `arguments` objects are cloned * as plain objects. An empty object is returned for uncloneable values such * as error objects, functions, DOM nodes, and WeakMaps. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to clone. * @returns {*} Returns the cloned value. * @see _.cloneDeep * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var shallow = _.clone(objects); * console.log(shallow[0] === objects[0]); * // => true */ function clone(value) { return baseClone(value, CLONE_SYMBOLS_FLAG); } /** * This method is like `_.clone` except that it accepts `customizer` which * is invoked to produce the cloned value. If `customizer` returns `undefined`, * cloning is handled by the method instead. The `customizer` is invoked with * up to four arguments; (value [, index|key, object, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the cloned value. * @see _.cloneDeepWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(false); * } * } * * var el = _.cloneWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 0 */ function cloneWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); } /** * This method is like `_.clone` except that it recursively clones `value`. * * @static * @memberOf _ * @since 1.0.0 * @category Lang * @param {*} value The value to recursively clone. * @returns {*} Returns the deep cloned value. * @see _.clone * @example * * var objects = [{ 'a': 1 }, { 'b': 2 }]; * * var deep = _.cloneDeep(objects); * console.log(deep[0] === objects[0]); * // => false */ function cloneDeep(value) { return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); } /** * This method is like `_.cloneWith` except that it recursively clones `value`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to recursively clone. * @param {Function} [customizer] The function to customize cloning. * @returns {*} Returns the deep cloned value. * @see _.cloneWith * @example * * function customizer(value) { * if (_.isElement(value)) { * return value.cloneNode(true); * } * } * * var el = _.cloneDeepWith(document.body, customizer); * * console.log(el === document.body); * // => false * console.log(el.nodeName); * // => 'BODY' * console.log(el.childNodes.length); * // => 20 */ function cloneDeepWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); } /** * Checks if `object` conforms to `source` by invoking the predicate * properties of `source` with the corresponding property values of `object`. * * **Note:** This method is equivalent to `_.conforms` when `source` is * partially applied. * * @static * @memberOf _ * @since 4.14.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property predicates to conform to. * @returns {boolean} Returns `true` if `object` conforms, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); * // => true * * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); * // => false */ function conformsTo(object, source) { return source == null || baseConformsTo(object, source, keys(source)); } /** * Performs a * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) * comparison between two values to determine if they are equivalent. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.eq(object, object); * // => true * * _.eq(object, other); * // => false * * _.eq('a', 'a'); * // => true * * _.eq('a', Object('a')); * // => false * * _.eq(NaN, NaN); * // => true */ function eq(value, other) { return value === other || (value !== value && other !== other); } /** * Checks if `value` is greater than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than `other`, * else `false`. * @see _.lt * @example * * _.gt(3, 1); * // => true * * _.gt(3, 3); * // => false * * _.gt(1, 3); * // => false */ var gt = createRelationalOperation(baseGt); /** * Checks if `value` is greater than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is greater than or equal to * `other`, else `false`. * @see _.lte * @example * * _.gte(3, 1); * // => true * * _.gte(3, 3); * // => true * * _.gte(1, 3); * // => false */ var gte = createRelationalOperation(function(value, other) { return value >= other; }); /** * Checks if `value` is likely an `arguments` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an `arguments` object, * else `false`. * @example * * _.isArguments(function() { return arguments; }()); * // => true * * _.isArguments([1, 2, 3]); * // => false */ var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee'); }; /** * Checks if `value` is classified as an `Array` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array, else `false`. * @example * * _.isArray([1, 2, 3]); * // => true * * _.isArray(document.body.children); * // => false * * _.isArray('abc'); * // => false * * _.isArray(_.noop); * // => false */ var isArray = Array.isArray; /** * Checks if `value` is classified as an `ArrayBuffer` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. * @example * * _.isArrayBuffer(new ArrayBuffer(2)); * // => true * * _.isArrayBuffer(new Array(2)); * // => false */ var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; /** * Checks if `value` is array-like. A value is considered array-like if it's * not a function and has a `value.length` that's an integer greater than or * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is array-like, else `false`. * @example * * _.isArrayLike([1, 2, 3]); * // => true * * _.isArrayLike(document.body.children); * // => true * * _.isArrayLike('abc'); * // => true * * _.isArrayLike(_.noop); * // => false */ function isArrayLike(value) { return value != null && isLength(value.length) && !isFunction(value); } /** * This method is like `_.isArrayLike` except that it also checks if `value` * is an object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an array-like object, * else `false`. * @example * * _.isArrayLikeObject([1, 2, 3]); * // => true * * _.isArrayLikeObject(document.body.children); * // => true * * _.isArrayLikeObject('abc'); * // => false * * _.isArrayLikeObject(_.noop); * // => false */ function isArrayLikeObject(value) { return isObjectLike(value) && isArrayLike(value); } /** * Checks if `value` is classified as a boolean primitive or object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. * @example * * _.isBoolean(false); * // => true * * _.isBoolean(null); * // => false */ function isBoolean(value) { return value === true || value === false || (isObjectLike(value) && baseGetTag(value) == boolTag); } /** * Checks if `value` is a buffer. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. * @example * * _.isBuffer(new Buffer(2)); * // => true * * _.isBuffer(new Uint8Array(2)); * // => false */ var isBuffer = nativeIsBuffer || stubFalse; /** * Checks if `value` is classified as a `Date` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a date object, else `false`. * @example * * _.isDate(new Date); * // => true * * _.isDate('Mon April 23 2012'); * // => false */ var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; /** * Checks if `value` is likely a DOM element. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. * @example * * _.isElement(document.body); * // => true * * _.isElement(''); * // => false */ function isElement(value) { return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); } /** * Checks if `value` is an empty object, collection, map, or set. * * Objects are considered empty if they have no own enumerable string keyed * properties. * * Array-like values such as `arguments` objects, arrays, buffers, strings, or * jQuery-like collections are considered empty if they have a `length` of `0`. * Similarly, maps and sets are considered empty if they have a `size` of `0`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is empty, else `false`. * @example * * _.isEmpty(null); * // => true * * _.isEmpty(true); * // => true * * _.isEmpty(1); * // => true * * _.isEmpty([1, 2, 3]); * // => false * * _.isEmpty({ 'a': 1 }); * // => false */ function isEmpty(value) { if (value == null) { return true; } if (isArrayLike(value) && (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || isBuffer(value) || isTypedArray(value) || isArguments(value))) { return !value.length; } var tag = getTag(value); if (tag == mapTag || tag == setTag) { return !value.size; } if (isPrototype(value)) { return !baseKeys(value).length; } for (var key in value) { if (hasOwnProperty.call(value, key)) { return false; } } return true; } /** * Performs a deep comparison between two values to determine if they are * equivalent. * * **Note:** This method supports comparing arrays, array buffers, booleans, * date objects, error objects, maps, numbers, `Object` objects, regexes, * sets, strings, symbols, and typed arrays. `Object` objects are compared * by their own, not inherited, enumerable properties. Functions and DOM * nodes are compared by strict equality, i.e. `===`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * var object = { 'a': 1 }; * var other = { 'a': 1 }; * * _.isEqual(object, other); * // => true * * object === other; * // => false */ function isEqual(value, other) { return baseIsEqual(value, other); } /** * This method is like `_.isEqual` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with up to * six arguments: (objValue, othValue [, index|key, object, other, stack]). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, othValue) { * if (isGreeting(objValue) && isGreeting(othValue)) { * return true; * } * } * * var array = ['hello', 'goodbye']; * var other = ['hi', 'goodbye']; * * _.isEqualWith(array, other, customizer); * // => true */ function isEqualWith(value, other, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; var result = customizer ? customizer(value, other) : undefined; return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; } /** * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, * `SyntaxError`, `TypeError`, or `URIError` object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an error object, else `false`. * @example * * _.isError(new Error); * // => true * * _.isError(Error); * // => false */ function isError(value) { if (!isObjectLike(value)) { return false; } var tag = baseGetTag(value); return tag == errorTag || tag == domExcTag || (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); } /** * Checks if `value` is a finite primitive number. * * **Note:** This method is based on * [`Number.isFinite`](https://mdn.io/Number/isFinite). * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. * @example * * _.isFinite(3); * // => true * * _.isFinite(Number.MIN_VALUE); * // => true * * _.isFinite(Infinity); * // => false * * _.isFinite('3'); * // => false */ function isFinite(value) { return typeof value == 'number' && nativeIsFinite(value); } /** * Checks if `value` is classified as a `Function` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a function, else `false`. * @example * * _.isFunction(_); * // => true * * _.isFunction(/abc/); * // => false */ function isFunction(value) { if (!isObject(value)) { return false; } // The use of `Object#toString` avoids issues with the `typeof` operator // in Safari 9 which returns 'object' for typed arrays and other constructors. var tag = baseGetTag(value); return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; } /** * Checks if `value` is an integer. * * **Note:** This method is based on * [`Number.isInteger`](https://mdn.io/Number/isInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an integer, else `false`. * @example * * _.isInteger(3); * // => true * * _.isInteger(Number.MIN_VALUE); * // => false * * _.isInteger(Infinity); * // => false * * _.isInteger('3'); * // => false */ function isInteger(value) { return typeof value == 'number' && value == toInteger(value); } /** * Checks if `value` is a valid array-like length. * * **Note:** This method is loosely based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. * @example * * _.isLength(3); * // => true * * _.isLength(Number.MIN_VALUE); * // => false * * _.isLength(Infinity); * // => false * * _.isLength('3'); * // => false */ function isLength(value) { return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is the * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is an object, else `false`. * @example * * _.isObject({}); * // => true * * _.isObject([1, 2, 3]); * // => true * * _.isObject(_.noop); * // => true * * _.isObject(null); * // => false */ function isObject(value) { var type = typeof value; return value != null && (type == 'object' || type == 'function'); } /** * Checks if `value` is object-like. A value is object-like if it's not `null` * and has a `typeof` result of "object". * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is object-like, else `false`. * @example * * _.isObjectLike({}); * // => true * * _.isObjectLike([1, 2, 3]); * // => true * * _.isObjectLike(_.noop); * // => false * * _.isObjectLike(null); * // => false */ function isObjectLike(value) { return value != null && typeof value == 'object'; } /** * Checks if `value` is classified as a `Map` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a map, else `false`. * @example * * _.isMap(new Map); * // => true * * _.isMap(new WeakMap); * // => false */ var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; /** * Performs a partial deep comparison between `object` and `source` to * determine if `object` contains equivalent property values. * * **Note:** This method is equivalent to `_.matches` when `source` is * partially applied. * * Partial comparisons will match empty array and empty object `source` * values against any array or object value, respectively. See `_.isEqual` * for a list of supported value comparisons. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * var object = { 'a': 1, 'b': 2 }; * * _.isMatch(object, { 'b': 2 }); * // => true * * _.isMatch(object, { 'b': 1 }); * // => false */ function isMatch(object, source) { return object === source || baseIsMatch(object, source, getMatchData(source)); } /** * This method is like `_.isMatch` except that it accepts `customizer` which * is invoked to compare values. If `customizer` returns `undefined`, comparisons * are handled by the method instead. The `customizer` is invoked with five * arguments: (objValue, srcValue, index|key, object, source). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {Object} object The object to inspect. * @param {Object} source The object of property values to match. * @param {Function} [customizer] The function to customize comparisons. * @returns {boolean} Returns `true` if `object` is a match, else `false`. * @example * * function isGreeting(value) { * return /^h(?:i|ello)$/.test(value); * } * * function customizer(objValue, srcValue) { * if (isGreeting(objValue) && isGreeting(srcValue)) { * return true; * } * } * * var object = { 'greeting': 'hello' }; * var source = { 'greeting': 'hi' }; * * _.isMatchWith(object, source, customizer); * // => true */ function isMatchWith(object, source, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseIsMatch(object, source, getMatchData(source), customizer); } /** * Checks if `value` is `NaN`. * * **Note:** This method is based on * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for * `undefined` and other non-number values. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. * @example * * _.isNaN(NaN); * // => true * * _.isNaN(new Number(NaN)); * // => true * * isNaN(undefined); * // => true * * _.isNaN(undefined); * // => false */ function isNaN(value) { // An `NaN` primitive is the only value that is not equal to itself. // Perform the `toStringTag` check first to avoid errors with some // ActiveX objects in IE. return isNumber(value) && value != +value; } /** * Checks if `value` is a pristine native function. * * **Note:** This method can't reliably detect native functions in the presence * of the core-js package because core-js circumvents this kind of detection. * Despite multiple requests, the core-js maintainer has made it clear: any * attempt to fix the detection will be obstructed. As a result, we're left * with little choice but to throw an error. Unfortunately, this also affects * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), * which rely on core-js. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a native function, * else `false`. * @example * * _.isNative(Array.prototype.push); * // => true * * _.isNative(_); * // => false */ function isNative(value) { if (isMaskable(value)) { throw new Error(CORE_ERROR_TEXT); } return baseIsNative(value); } /** * Checks if `value` is `null`. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `null`, else `false`. * @example * * _.isNull(null); * // => true * * _.isNull(void 0); * // => false */ function isNull(value) { return value === null; } /** * Checks if `value` is `null` or `undefined`. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is nullish, else `false`. * @example * * _.isNil(null); * // => true * * _.isNil(void 0); * // => true * * _.isNil(NaN); * // => false */ function isNil(value) { return value == null; } /** * Checks if `value` is classified as a `Number` primitive or object. * * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are * classified as numbers, use the `_.isFinite` method. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a number, else `false`. * @example * * _.isNumber(3); * // => true * * _.isNumber(Number.MIN_VALUE); * // => true * * _.isNumber(Infinity); * // => true * * _.isNumber('3'); * // => false */ function isNumber(value) { return typeof value == 'number' || (isObjectLike(value) && baseGetTag(value) == numberTag); } /** * Checks if `value` is a plain object, that is, an object created by the * `Object` constructor or one with a `[[Prototype]]` of `null`. * * @static * @memberOf _ * @since 0.8.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. * @example * * function Foo() { * this.a = 1; * } * * _.isPlainObject(new Foo); * // => false * * _.isPlainObject([1, 2, 3]); * // => false * * _.isPlainObject({ 'x': 0, 'y': 0 }); * // => true * * _.isPlainObject(Object.create(null)); * // => true */ function isPlainObject(value) { if (!isObjectLike(value) || baseGetTag(value) != objectTag) { return false; } var proto = getPrototype(value); if (proto === null) { return true; } var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; return typeof Ctor == 'function' && Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString; } /** * Checks if `value` is classified as a `RegExp` object. * * @static * @memberOf _ * @since 0.1.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. * @example * * _.isRegExp(/abc/); * // => true * * _.isRegExp('/abc/'); * // => false */ var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; /** * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 * double precision number which isn't the result of a rounded unsafe integer. * * **Note:** This method is based on * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. * @example * * _.isSafeInteger(3); * // => true * * _.isSafeInteger(Number.MIN_VALUE); * // => false * * _.isSafeInteger(Infinity); * // => false * * _.isSafeInteger('3'); * // => false */ function isSafeInteger(value) { return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; } /** * Checks if `value` is classified as a `Set` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a set, else `false`. * @example * * _.isSet(new Set); * // => true * * _.isSet(new WeakSet); * // => false */ var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; /** * Checks if `value` is classified as a `String` primitive or object. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a string, else `false`. * @example * * _.isString('abc'); * // => true * * _.isString(1); * // => false */ function isString(value) { return typeof value == 'string' || (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); } /** * Checks if `value` is classified as a `Symbol` primitive or object. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. * @example * * _.isSymbol(Symbol.iterator); * // => true * * _.isSymbol('abc'); * // => false */ function isSymbol(value) { return typeof value == 'symbol' || (isObjectLike(value) && baseGetTag(value) == symbolTag); } /** * Checks if `value` is classified as a typed array. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. * @example * * _.isTypedArray(new Uint8Array); * // => true * * _.isTypedArray([]); * // => false */ var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; /** * Checks if `value` is `undefined`. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. * @example * * _.isUndefined(void 0); * // => true * * _.isUndefined(null); * // => false */ function isUndefined(value) { return value === undefined; } /** * Checks if `value` is classified as a `WeakMap` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. * @example * * _.isWeakMap(new WeakMap); * // => true * * _.isWeakMap(new Map); * // => false */ function isWeakMap(value) { return isObjectLike(value) && getTag(value) == weakMapTag; } /** * Checks if `value` is classified as a `WeakSet` object. * * @static * @memberOf _ * @since 4.3.0 * @category Lang * @param {*} value The value to check. * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. * @example * * _.isWeakSet(new WeakSet); * // => true * * _.isWeakSet(new Set); * // => false */ function isWeakSet(value) { return isObjectLike(value) && baseGetTag(value) == weakSetTag; } /** * Checks if `value` is less than `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than `other`, * else `false`. * @see _.gt * @example * * _.lt(1, 3); * // => true * * _.lt(3, 3); * // => false * * _.lt(3, 1); * // => false */ var lt = createRelationalOperation(baseLt); /** * Checks if `value` is less than or equal to `other`. * * @static * @memberOf _ * @since 3.9.0 * @category Lang * @param {*} value The value to compare. * @param {*} other The other value to compare. * @returns {boolean} Returns `true` if `value` is less than or equal to * `other`, else `false`. * @see _.gte * @example * * _.lte(1, 3); * // => true * * _.lte(3, 3); * // => true * * _.lte(3, 1); * // => false */ var lte = createRelationalOperation(function(value, other) { return value <= other; }); /** * Converts `value` to an array. * * @static * @since 0.1.0 * @memberOf _ * @category Lang * @param {*} value The value to convert. * @returns {Array} Returns the converted array. * @example * * _.toArray({ 'a': 1, 'b': 2 }); * // => [1, 2] * * _.toArray('abc'); * // => ['a', 'b', 'c'] * * _.toArray(1); * // => [] * * _.toArray(null); * // => [] */ function toArray(value) { if (!value) { return []; } if (isArrayLike(value)) { return isString(value) ? stringToArray(value) : copyArray(value); } if (symIterator && value[symIterator]) { return iteratorToArray(value[symIterator]()); } var tag = getTag(value), func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); return func(value); } /** * Converts `value` to a finite number. * * @static * @memberOf _ * @since 4.12.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted number. * @example * * _.toFinite(3.2); * // => 3.2 * * _.toFinite(Number.MIN_VALUE); * // => 5e-324 * * _.toFinite(Infinity); * // => 1.7976931348623157e+308 * * _.toFinite('3.2'); * // => 3.2 */ function toFinite(value) { if (!value) { return value === 0 ? value : 0; } value = toNumber(value); if (value === INFINITY || value === -INFINITY) { var sign = (value < 0 ? -1 : 1); return sign * MAX_INTEGER; } return value === value ? value : 0; } /** * Converts `value` to an integer. * * **Note:** This method is loosely based on * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toInteger(3.2); * // => 3 * * _.toInteger(Number.MIN_VALUE); * // => 0 * * _.toInteger(Infinity); * // => 1.7976931348623157e+308 * * _.toInteger('3.2'); * // => 3 */ function toInteger(value) { var result = toFinite(value), remainder = result % 1; return result === result ? (remainder ? result - remainder : result) : 0; } /** * Converts `value` to an integer suitable for use as the length of an * array-like object. * * **Note:** This method is based on * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toLength(3.2); * // => 3 * * _.toLength(Number.MIN_VALUE); * // => 0 * * _.toLength(Infinity); * // => 4294967295 * * _.toLength('3.2'); * // => 3 */ function toLength(value) { return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; } /** * Converts `value` to a number. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to process. * @returns {number} Returns the number. * @example * * _.toNumber(3.2); * // => 3.2 * * _.toNumber(Number.MIN_VALUE); * // => 5e-324 * * _.toNumber(Infinity); * // => Infinity * * _.toNumber('3.2'); * // => 3.2 */ function toNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } if (isObject(value)) { var other = typeof value.valueOf == 'function' ? value.valueOf() : value; value = isObject(other) ? (other + '') : other; } if (typeof value != 'string') { return value === 0 ? value : +value; } value = value.replace(reTrim, ''); var isBinary = reIsBinary.test(value); return (isBinary || reIsOctal.test(value)) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : (reIsBadHex.test(value) ? NAN : +value); } /** * Converts `value` to a plain object flattening inherited enumerable string * keyed properties of `value` to own properties of the plain object. * * @static * @memberOf _ * @since 3.0.0 * @category Lang * @param {*} value The value to convert. * @returns {Object} Returns the converted plain object. * @example * * function Foo() { * this.b = 2; * } * * Foo.prototype.c = 3; * * _.assign({ 'a': 1 }, new Foo); * // => { 'a': 1, 'b': 2 } * * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); * // => { 'a': 1, 'b': 2, 'c': 3 } */ function toPlainObject(value) { return copyObject(value, keysIn(value)); } /** * Converts `value` to a safe integer. A safe integer can be compared and * represented correctly. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {number} Returns the converted integer. * @example * * _.toSafeInteger(3.2); * // => 3 * * _.toSafeInteger(Number.MIN_VALUE); * // => 0 * * _.toSafeInteger(Infinity); * // => 9007199254740991 * * _.toSafeInteger('3.2'); * // => 3 */ function toSafeInteger(value) { return value ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) : (value === 0 ? value : 0); } /** * Converts `value` to a string. An empty string is returned for `null` * and `undefined` values. The sign of `-0` is preserved. * * @static * @memberOf _ * @since 4.0.0 * @category Lang * @param {*} value The value to convert. * @returns {string} Returns the converted string. * @example * * _.toString(null); * // => '' * * _.toString(-0); * // => '-0' * * _.toString([1, 2, 3]); * // => '1,2,3' */ function toString(value) { return value == null ? '' : baseToString(value); } /*------------------------------------------------------------------------*/ /** * Assigns own enumerable string keyed properties of source objects to the * destination object. Source objects are applied from left to right. * Subsequent sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object` and is loosely based on * [`Object.assign`](https://mdn.io/Object/assign). * * @static * @memberOf _ * @since 0.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assignIn * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assign({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'c': 3 } */ var assign = createAssigner(function(object, source) { if (isPrototype(source) || isArrayLike(source)) { copyObject(source, keys(source), object); return; } for (var key in source) { if (hasOwnProperty.call(source, key)) { assignValue(object, key, source[key]); } } }); /** * This method is like `_.assign` except that it iterates over own and * inherited source properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extend * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.assign * @example * * function Foo() { * this.a = 1; * } * * function Bar() { * this.c = 3; * } * * Foo.prototype.b = 2; * Bar.prototype.d = 4; * * _.assignIn({ 'a': 0 }, new Foo, new Bar); * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } */ var assignIn = createAssigner(function(object, source) { copyObject(source, keysIn(source), object); }); /** * This method is like `_.assignIn` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @alias extendWith * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignInWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keysIn(source), object, customizer); }); /** * This method is like `_.assign` except that it accepts `customizer` * which is invoked to produce the assigned values. If `customizer` returns * `undefined`, assignment is handled by the method instead. The `customizer` * is invoked with five arguments: (objValue, srcValue, key, object, source). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @see _.assignInWith * @example * * function customizer(objValue, srcValue) { * return _.isUndefined(objValue) ? srcValue : objValue; * } * * var defaults = _.partialRight(_.assignWith, customizer); * * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var assignWith = createAssigner(function(object, source, srcIndex, customizer) { copyObject(source, keys(source), object, customizer); }); /** * Creates an array of values corresponding to `paths` of `object`. * * @static * @memberOf _ * @since 1.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Array} Returns the picked values. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * * _.at(object, ['a[0].b.c', 'a[1]']); * // => [3, 4] */ var at = flatRest(baseAt); /** * Creates an object that inherits from the `prototype` object. If a * `properties` object is given, its own enumerable string keyed properties * are assigned to the created object. * * @static * @memberOf _ * @since 2.3.0 * @category Object * @param {Object} prototype The object to inherit from. * @param {Object} [properties] The properties to assign to the object. * @returns {Object} Returns the new object. * @example * * function Shape() { * this.x = 0; * this.y = 0; * } * * function Circle() { * Shape.call(this); * } * * Circle.prototype = _.create(Shape.prototype, { * 'constructor': Circle * }); * * var circle = new Circle; * circle instanceof Circle; * // => true * * circle instanceof Shape; * // => true */ function create(prototype, properties) { var result = baseCreate(prototype); return properties == null ? result : baseAssign(result, properties); } /** * Assigns own and inherited enumerable string keyed properties of source * objects to the destination object for all destination properties that * resolve to `undefined`. Source objects are applied from left to right. * Once a property is set, additional values of the same property are ignored. * * **Note:** This method mutates `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaultsDeep * @example * * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); * // => { 'a': 1, 'b': 2 } */ var defaults = baseRest(function(object, sources) { object = Object(object); var index = -1; var length = sources.length; var guard = length > 2 ? sources[2] : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { length = 1; } while (++index < length) { var source = sources[index]; var props = keysIn(source); var propsIndex = -1; var propsLength = props.length; while (++propsIndex < propsLength) { var key = props[propsIndex]; var value = object[key]; if (value === undefined || (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { object[key] = source[key]; } } } return object; }); /** * This method is like `_.defaults` except that it recursively assigns * default properties. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.10.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @see _.defaults * @example * * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); * // => { 'a': { 'b': 2, 'c': 3 } } */ var defaultsDeep = baseRest(function(args) { args.push(undefined, customDefaultsMerge); return apply(mergeWith, undefined, args); }); /** * This method is like `_.find` except that it returns the key of the first * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ * @since 1.1.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findKey(users, function(o) { return o.age < 40; }); * // => 'barney' (iteration order is not guaranteed) * * // The `_.matches` iteratee shorthand. * _.findKey(users, { 'age': 1, 'active': true }); * // => 'pebbles' * * // The `_.matchesProperty` iteratee shorthand. * _.findKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findKey(users, 'active'); * // => 'barney' */ function findKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); } /** * This method is like `_.findKey` except that it iterates over elements of * a collection in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to inspect. * @param {Function} [predicate=_.identity] The function invoked per iteration. * @returns {string|undefined} Returns the key of the matched element, * else `undefined`. * @example * * var users = { * 'barney': { 'age': 36, 'active': true }, * 'fred': { 'age': 40, 'active': false }, * 'pebbles': { 'age': 1, 'active': true } * }; * * _.findLastKey(users, function(o) { return o.age < 40; }); * // => returns 'pebbles' assuming `_.findKey` returns 'barney' * * // The `_.matches` iteratee shorthand. * _.findLastKey(users, { 'age': 36, 'active': true }); * // => 'barney' * * // The `_.matchesProperty` iteratee shorthand. * _.findLastKey(users, ['active', false]); * // => 'fred' * * // The `_.property` iteratee shorthand. * _.findLastKey(users, 'active'); * // => 'pebbles' */ function findLastKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); } /** * Iterates over own and inherited enumerable string keyed properties of an * object and invokes `iteratee` for each property. The iteratee is invoked * with three arguments: (value, key, object). Iteratee functions may exit * iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forInRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forIn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). */ function forIn(object, iteratee) { return object == null ? object : baseFor(object, getIteratee(iteratee, 3), keysIn); } /** * This method is like `_.forIn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forIn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forInRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. */ function forInRight(object, iteratee) { return object == null ? object : baseForRight(object, getIteratee(iteratee, 3), keysIn); } /** * Iterates over own enumerable string keyed properties of an object and * invokes `iteratee` for each property. The iteratee is invoked with three * arguments: (value, key, object). Iteratee functions may exit iteration * early by explicitly returning `false`. * * @static * @memberOf _ * @since 0.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwnRight * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwn(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ function forOwn(object, iteratee) { return object && baseForOwn(object, getIteratee(iteratee, 3)); } /** * This method is like `_.forOwn` except that it iterates over properties of * `object` in the opposite order. * * @static * @memberOf _ * @since 2.0.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns `object`. * @see _.forOwn * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.forOwnRight(new Foo, function(value, key) { * console.log(key); * }); * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. */ function forOwnRight(object, iteratee) { return object && baseForOwnRight(object, getIteratee(iteratee, 3)); } /** * Creates an array of function property names from own enumerable properties * of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functionsIn * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functions(new Foo); * // => ['a', 'b'] */ function functions(object) { return object == null ? [] : baseFunctions(object, keys(object)); } /** * Creates an array of function property names from own and inherited * enumerable properties of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to inspect. * @returns {Array} Returns the function names. * @see _.functions * @example * * function Foo() { * this.a = _.constant('a'); * this.b = _.constant('b'); * } * * Foo.prototype.c = _.constant('c'); * * _.functionsIn(new Foo); * // => ['a', 'b', 'c'] */ function functionsIn(object) { return object == null ? [] : baseFunctions(object, keysIn(object)); } /** * Gets the value at `path` of `object`. If the resolved value is * `undefined`, the `defaultValue` is returned in its place. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to get. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.get(object, 'a[0].b.c'); * // => 3 * * _.get(object, ['a', '0', 'b', 'c']); * // => 3 * * _.get(object, 'a.b.c', 'default'); * // => 'default' */ function get(object, path, defaultValue) { var result = object == null ? undefined : baseGet(object, path); return result === undefined ? defaultValue : result; } /** * Checks if `path` is a direct property of `object`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = { 'a': { 'b': 2 } }; * var other = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.has(object, 'a'); * // => true * * _.has(object, 'a.b'); * // => true * * _.has(object, ['a', 'b']); * // => true * * _.has(other, 'a'); * // => false */ function has(object, path) { return object != null && hasPath(object, path, baseHas); } /** * Checks if `path` is a direct or inherited property of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path to check. * @returns {boolean} Returns `true` if `path` exists, else `false`. * @example * * var object = _.create({ 'a': _.create({ 'b': 2 }) }); * * _.hasIn(object, 'a'); * // => true * * _.hasIn(object, 'a.b'); * // => true * * _.hasIn(object, ['a', 'b']); * // => true * * _.hasIn(object, 'b'); * // => false */ function hasIn(object, path) { return object != null && hasPath(object, path, baseHasIn); } /** * Creates an object composed of the inverted keys and values of `object`. * If `object` contains duplicate values, subsequent values overwrite * property assignments of previous values. * * @static * @memberOf _ * @since 0.7.0 * @category Object * @param {Object} object The object to invert. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invert(object); * // => { '1': 'c', '2': 'b' } */ var invert = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } result[value] = key; }, constant(identity)); /** * This method is like `_.invert` except that the inverted object is generated * from the results of running each element of `object` thru `iteratee`. The * corresponding inverted value of each inverted key is an array of keys * responsible for generating the inverted value. The iteratee is invoked * with one argument: (value). * * @static * @memberOf _ * @since 4.1.0 * @category Object * @param {Object} object The object to invert. * @param {Function} [iteratee=_.identity] The iteratee invoked per element. * @returns {Object} Returns the new inverted object. * @example * * var object = { 'a': 1, 'b': 2, 'c': 1 }; * * _.invertBy(object); * // => { '1': ['a', 'c'], '2': ['b'] } * * _.invertBy(object, function(value) { * return 'group' + value; * }); * // => { 'group1': ['a', 'c'], 'group2': ['b'] } */ var invertBy = createInverter(function(result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } if (hasOwnProperty.call(result, value)) { result[value].push(key); } else { result[value] = [key]; } }, getIteratee); /** * Invokes the method at `path` of `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the method to invoke. * @param {...*} [args] The arguments to invoke the method with. * @returns {*} Returns the result of the invoked method. * @example * * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; * * _.invoke(object, 'a[0].b.c.slice', 1, 3); * // => [2, 3] */ var invoke = baseRest(baseInvoke); /** * Creates an array of the own enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. See the * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) * for more details. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keys(new Foo); * // => ['a', 'b'] (iteration order is not guaranteed) * * _.keys('hi'); * // => ['0', '1'] */ function keys(object) { return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); } /** * Creates an array of the own and inherited enumerable property names of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.keysIn(new Foo); * // => ['a', 'b', 'c'] (iteration order is not guaranteed) */ function keysIn(object) { return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); } /** * The opposite of `_.mapValues`; this method creates an object with the * same values as `object` and keys generated by running each own enumerable * string keyed property of `object` thru `iteratee`. The iteratee is invoked * with three arguments: (value, key, object). * * @static * @memberOf _ * @since 3.8.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapValues * @example * * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { * return key + value; * }); * // => { 'a1': 1, 'b2': 2 } */ function mapKeys(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, iteratee(value, key, object), value); }); return result; } /** * Creates an object with the same keys as `object` and values generated * by running each own enumerable string keyed property of `object` thru * `iteratee`. The iteratee is invoked with three arguments: * (value, key, object). * * @static * @memberOf _ * @since 2.4.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @returns {Object} Returns the new mapped object. * @see _.mapKeys * @example * * var users = { * 'fred': { 'user': 'fred', 'age': 40 }, * 'pebbles': { 'user': 'pebbles', 'age': 1 } * }; * * _.mapValues(users, function(o) { return o.age; }); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) * * // The `_.property` iteratee shorthand. * _.mapValues(users, 'age'); * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) */ function mapValues(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function(value, key, object) { baseAssignValue(result, key, iteratee(value, key, object)); }); return result; } /** * This method is like `_.assign` except that it recursively merges own and * inherited enumerable string keyed properties of source objects into the * destination object. Source properties that resolve to `undefined` are * skipped if a destination value exists. Array and plain object properties * are merged recursively. Other objects and value types are overridden by * assignment. Source objects are applied from left to right. Subsequent * sources overwrite property assignments of previous sources. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 0.5.0 * @category Object * @param {Object} object The destination object. * @param {...Object} [sources] The source objects. * @returns {Object} Returns `object`. * @example * * var object = { * 'a': [{ 'b': 2 }, { 'd': 4 }] * }; * * var other = { * 'a': [{ 'c': 3 }, { 'e': 5 }] * }; * * _.merge(object, other); * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } */ var merge = createAssigner(function(object, source, srcIndex) { baseMerge(object, source, srcIndex); }); /** * This method is like `_.merge` except that it accepts `customizer` which * is invoked to produce the merged values of the destination and source * properties. If `customizer` returns `undefined`, merging is handled by the * method instead. The `customizer` is invoked with six arguments: * (objValue, srcValue, key, object, source, stack). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The destination object. * @param {...Object} sources The source objects. * @param {Function} customizer The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * function customizer(objValue, srcValue) { * if (_.isArray(objValue)) { * return objValue.concat(srcValue); * } * } * * var object = { 'a': [1], 'b': [2] }; * var other = { 'a': [3], 'b': [4] }; * * _.mergeWith(object, other, customizer); * // => { 'a': [1, 3], 'b': [2, 4] } */ var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { baseMerge(object, source, srcIndex, customizer); }); /** * The opposite of `_.pick`; this method creates an object composed of the * own and inherited enumerable property paths of `object` that are not omitted. * * **Note:** This method is considerably slower than `_.pick`. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to omit. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omit(object, ['a', 'c']); * // => { 'b': '2' } */ var omit = flatRest(function(object, paths) { var result = {}; if (object == null) { return result; } var isDeep = false; paths = arrayMap(paths, function(path) { path = castPath(path, object); isDeep || (isDeep = path.length > 1); return path; }); copyObject(object, getAllKeysIn(object), result); if (isDeep) { result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); } var length = paths.length; while (length--) { baseUnset(result, paths[length]); } return result; }); /** * The opposite of `_.pickBy`; this method creates an object composed of * the own and inherited enumerable string keyed properties of `object` that * `predicate` doesn't return truthy for. The predicate is invoked with two * arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.omitBy(object, _.isNumber); * // => { 'b': '2' } */ function omitBy(object, predicate) { return pickBy(object, negate(getIteratee(predicate))); } /** * Creates an object composed of the picked `object` properties. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The source object. * @param {...(string|string[])} [paths] The property paths to pick. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pick(object, ['a', 'c']); * // => { 'a': 1, 'c': 3 } */ var pick = flatRest(function(object, paths) { return object == null ? {} : basePick(object, paths); }); /** * Creates an object composed of the `object` properties `predicate` returns * truthy for. The predicate is invoked with two arguments: (value, key). * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The source object. * @param {Function} [predicate=_.identity] The function invoked per property. * @returns {Object} Returns the new object. * @example * * var object = { 'a': 1, 'b': '2', 'c': 3 }; * * _.pickBy(object, _.isNumber); * // => { 'a': 1, 'c': 3 } */ function pickBy(object, predicate) { if (object == null) { return {}; } var props = arrayMap(getAllKeysIn(object), function(prop) { return [prop]; }); predicate = getIteratee(predicate); return basePickBy(object, props, function(value, path) { return predicate(value, path[0]); }); } /** * This method is like `_.get` except that if the resolved value is a * function it's invoked with the `this` binding of its parent object and * its result is returned. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @param {Array|string} path The path of the property to resolve. * @param {*} [defaultValue] The value returned for `undefined` resolved values. * @returns {*} Returns the resolved value. * @example * * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; * * _.result(object, 'a[0].b.c1'); * // => 3 * * _.result(object, 'a[0].b.c2'); * // => 4 * * _.result(object, 'a[0].b.c3', 'default'); * // => 'default' * * _.result(object, 'a[0].b.c3', _.constant('default')); * // => 'default' */ function result(object, path, defaultValue) { path = castPath(path, object); var index = -1, length = path.length; // Ensure the loop is entered when path is empty. if (!length) { length = 1; object = undefined; } while (++index < length) { var value = object == null ? undefined : object[toKey(path[index])]; if (value === undefined) { index = length; value = defaultValue; } object = isFunction(value) ? value.call(object) : value; } return object; } /** * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, * it's created. Arrays are created for missing index properties while objects * are created for all other missing properties. Use `_.setWith` to customize * `path` creation. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 3.7.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.set(object, 'a[0].b.c', 4); * console.log(object.a[0].b.c); * // => 4 * * _.set(object, ['x', '0', 'y', 'z'], 5); * console.log(object.x[0].y.z); * // => 5 */ function set(object, path, value) { return object == null ? object : baseSet(object, path, value); } /** * This method is like `_.set` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {*} value The value to set. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.setWith(object, '[0][1]', 'a', Object); * // => { '0': { '1': 'a' } } */ function setWith(object, path, value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseSet(object, path, value, customizer); } /** * Creates an array of own enumerable string keyed-value pairs for `object` * which can be consumed by `_.fromPairs`. If `object` is a map or set, its * entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entries * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairs(new Foo); * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) */ var toPairs = createToPairs(keys); /** * Creates an array of own and inherited enumerable string keyed-value pairs * for `object` which can be consumed by `_.fromPairs`. If `object` is a map * or set, its entries are returned. * * @static * @memberOf _ * @since 4.0.0 * @alias entriesIn * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the key-value pairs. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.toPairsIn(new Foo); * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) */ var toPairsIn = createToPairs(keysIn); /** * An alternative to `_.reduce`; this method transforms `object` to a new * `accumulator` object which is the result of running each of its own * enumerable string keyed properties thru `iteratee`, with each invocation * potentially mutating the `accumulator` object. If `accumulator` is not * provided, a new object with the same `[[Prototype]]` will be used. The * iteratee is invoked with four arguments: (accumulator, value, key, object). * Iteratee functions may exit iteration early by explicitly returning `false`. * * @static * @memberOf _ * @since 1.3.0 * @category Object * @param {Object} object The object to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. * @param {*} [accumulator] The custom accumulator value. * @returns {*} Returns the accumulated value. * @example * * _.transform([2, 3, 4], function(result, n) { * result.push(n *= n); * return n % 2 == 0; * }, []); * // => [4, 9] * * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { * (result[value] || (result[value] = [])).push(key); * }, {}); * // => { '1': ['a', 'c'], '2': ['b'] } */ function transform(object, iteratee, accumulator) { var isArr = isArray(object), isArrLike = isArr || isBuffer(object) || isTypedArray(object); iteratee = getIteratee(iteratee, 4); if (accumulator == null) { var Ctor = object && object.constructor; if (isArrLike) { accumulator = isArr ? new Ctor : []; } else if (isObject(object)) { accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; } else { accumulator = {}; } } (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { return iteratee(accumulator, value, index, object); }); return accumulator; } /** * Removes the property at `path` of `object`. * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.0.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to unset. * @returns {boolean} Returns `true` if the property is deleted, else `false`. * @example * * var object = { 'a': [{ 'b': { 'c': 7 } }] }; * _.unset(object, 'a[0].b.c'); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; * * _.unset(object, ['a', '0', 'b', 'c']); * // => true * * console.log(object); * // => { 'a': [{ 'b': {} }] }; */ function unset(object, path) { return object == null ? true : baseUnset(object, path); } /** * This method is like `_.set` except that accepts `updater` to produce the * value to set. Use `_.updateWith` to customize `path` creation. The `updater` * is invoked with one argument: (value). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @returns {Object} Returns `object`. * @example * * var object = { 'a': [{ 'b': { 'c': 3 } }] }; * * _.update(object, 'a[0].b.c', function(n) { return n * n; }); * console.log(object.a[0].b.c); * // => 9 * * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); * console.log(object.x[0].y.z); * // => 0 */ function update(object, path, updater) { return object == null ? object : baseUpdate(object, path, castFunction(updater)); } /** * This method is like `_.update` except that it accepts `customizer` which is * invoked to produce the objects of `path`. If `customizer` returns `undefined` * path creation is handled by the method instead. The `customizer` is invoked * with three arguments: (nsValue, key, nsObject). * * **Note:** This method mutates `object`. * * @static * @memberOf _ * @since 4.6.0 * @category Object * @param {Object} object The object to modify. * @param {Array|string} path The path of the property to set. * @param {Function} updater The function to produce the updated value. * @param {Function} [customizer] The function to customize assigned values. * @returns {Object} Returns `object`. * @example * * var object = {}; * * _.updateWith(object, '[0][1]', _.constant('a'), Object); * // => { '0': { '1': 'a' } } */ function updateWith(object, path, updater, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); } /** * Creates an array of the own enumerable string keyed property values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @since 0.1.0 * @memberOf _ * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.values(new Foo); * // => [1, 2] (iteration order is not guaranteed) * * _.values('hi'); * // => ['h', 'i'] */ function values(object) { return object == null ? [] : baseValues(object, keys(object)); } /** * Creates an array of the own and inherited enumerable string keyed property * values of `object`. * * **Note:** Non-object values are coerced to objects. * * @static * @memberOf _ * @since 3.0.0 * @category Object * @param {Object} object The object to query. * @returns {Array} Returns the array of property values. * @example * * function Foo() { * this.a = 1; * this.b = 2; * } * * Foo.prototype.c = 3; * * _.valuesIn(new Foo); * // => [1, 2, 3] (iteration order is not guaranteed) */ function valuesIn(object) { return object == null ? [] : baseValues(object, keysIn(object)); } /*------------------------------------------------------------------------*/ /** * Clamps `number` within the inclusive `lower` and `upper` bounds. * * @static * @memberOf _ * @since 4.0.0 * @category Number * @param {number} number The number to clamp. * @param {number} [lower] The lower bound. * @param {number} upper The upper bound. * @returns {number} Returns the clamped number. * @example * * _.clamp(-10, -5, 5); * // => -5 * * _.clamp(10, -5, 5); * // => 5 */ function clamp(number, lower, upper) { if (upper === undefined) { upper = lower; lower = undefined; } if (upper !== undefined) { upper = toNumber(upper); upper = upper === upper ? upper : 0; } if (lower !== undefined) { lower = toNumber(lower); lower = lower === lower ? lower : 0; } return baseClamp(toNumber(number), lower, upper); } /** * Checks if `n` is between `start` and up to, but not including, `end`. If * `end` is not specified, it's set to `start` with `start` then set to `0`. * If `start` is greater than `end` the params are swapped to support * negative ranges. * * @static * @memberOf _ * @since 3.3.0 * @category Number * @param {number} number The number to check. * @param {number} [start=0] The start of the range. * @param {number} end The end of the range. * @returns {boolean} Returns `true` if `number` is in the range, else `false`. * @see _.range, _.rangeRight * @example * * _.inRange(3, 2, 4); * // => true * * _.inRange(4, 8); * // => true * * _.inRange(4, 2); * // => false * * _.inRange(2, 2); * // => false * * _.inRange(1.2, 2); * // => true * * _.inRange(5.2, 4); * // => false * * _.inRange(-3, -2, -6); * // => true */ function inRange(number, start, end) { start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } number = toNumber(number); return baseInRange(number, start, end); } /** * Produces a random number between the inclusive `lower` and `upper` bounds. * If only one argument is provided a number between `0` and the given number * is returned. If `floating` is `true`, or either `lower` or `upper` are * floats, a floating-point number is returned instead of an integer. * * **Note:** JavaScript follows the IEEE-754 standard for resolving * floating-point values which can produce unexpected results. * * @static * @memberOf _ * @since 0.7.0 * @category Number * @param {number} [lower=0] The lower bound. * @param {number} [upper=1] The upper bound. * @param {boolean} [floating] Specify returning a floating-point number. * @returns {number} Returns the random number. * @example * * _.random(0, 5); * // => an integer between 0 and 5 * * _.random(5); * // => also an integer between 0 and 5 * * _.random(5, true); * // => a floating-point number between 0 and 5 * * _.random(1.2, 5.2); * // => a floating-point number between 1.2 and 5.2 */ function random(lower, upper, floating) { if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { upper = floating = undefined; } if (floating === undefined) { if (typeof upper == 'boolean') { floating = upper; upper = undefined; } else if (typeof lower == 'boolean') { floating = lower; lower = undefined; } } if (lower === undefined && upper === undefined) { lower = 0; upper = 1; } else { lower = toFinite(lower); if (upper === undefined) { upper = lower; lower = 0; } else { upper = toFinite(upper); } } if (lower > upper) { var temp = lower; lower = upper; upper = temp; } if (floating || lower % 1 || upper % 1) { var rand = nativeRandom(); return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); } return baseRandom(lower, upper); } /*------------------------------------------------------------------------*/ /** * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the camel cased string. * @example * * _.camelCase('Foo Bar'); * // => 'fooBar' * * _.camelCase('--foo-bar--'); * // => 'fooBar' * * _.camelCase('__FOO_BAR__'); * // => 'fooBar' */ var camelCase = createCompounder(function(result, word, index) { word = word.toLowerCase(); return result + (index ? capitalize(word) : word); }); /** * Converts the first character of `string` to upper case and the remaining * to lower case. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to capitalize. * @returns {string} Returns the capitalized string. * @example * * _.capitalize('FRED'); * // => 'Fred' */ function capitalize(string) { return upperFirst(toString(string).toLowerCase()); } /** * Deburrs `string` by converting * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) * letters to basic Latin letters and removing * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to deburr. * @returns {string} Returns the deburred string. * @example * * _.deburr('déjà vu'); * // => 'deja vu' */ function deburr(string) { string = toString(string); return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); } /** * Checks if `string` ends with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=string.length] The position to search up to. * @returns {boolean} Returns `true` if `string` ends with `target`, * else `false`. * @example * * _.endsWith('abc', 'c'); * // => true * * _.endsWith('abc', 'b'); * // => false * * _.endsWith('abc', 'b', 2); * // => true */ function endsWith(string, target, position) { string = toString(string); target = baseToString(target); var length = string.length; position = position === undefined ? length : baseClamp(toInteger(position), 0, length); var end = position; position -= target.length; return position >= 0 && string.slice(position, end) == target; } /** * Converts the characters "&", "<", ">", '"', and "'" in `string` to their * corresponding HTML entities. * * **Note:** No other characters are escaped. To escape additional * characters use a third-party library like [_he_](https://mths.be/he). * * Though the ">" character is escaped for symmetry, characters like * ">" and "/" don't need escaping in HTML and have no special meaning * unless they're part of a tag or unquoted attribute value. See * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) * (under "semi-related fun fact") for more details. * * When working with HTML you should always * [quote attribute values](http://wonko.com/post/html-escaping) to reduce * XSS vectors. * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escape('fred, barney, & pebbles'); * // => 'fred, barney, & pebbles' */ function escape(string) { string = toString(string); return (string && reHasUnescapedHtml.test(string)) ? string.replace(reUnescapedHtml, escapeHtmlChar) : string; } /** * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to escape. * @returns {string} Returns the escaped string. * @example * * _.escapeRegExp('[lodash](https://lodash.com/)'); * // => '\[lodash\]\(https://lodash\.com/\)' */ function escapeRegExp(string) { string = toString(string); return (string && reHasRegExpChar.test(string)) ? string.replace(reRegExpChar, '\\$&') : string; } /** * Converts `string` to * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the kebab cased string. * @example * * _.kebabCase('Foo Bar'); * // => 'foo-bar' * * _.kebabCase('fooBar'); * // => 'foo-bar' * * _.kebabCase('__FOO_BAR__'); * // => 'foo-bar' */ var kebabCase = createCompounder(function(result, word, index) { return result + (index ? '-' : '') + word.toLowerCase(); }); /** * Converts `string`, as space separated words, to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the lower cased string. * @example * * _.lowerCase('--Foo-Bar--'); * // => 'foo bar' * * _.lowerCase('fooBar'); * // => 'foo bar' * * _.lowerCase('__FOO_BAR__'); * // => 'foo bar' */ var lowerCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + word.toLowerCase(); }); /** * Converts the first character of `string` to lower case. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the converted string. * @example * * _.lowerFirst('Fred'); * // => 'fred' * * _.lowerFirst('FRED'); * // => 'fRED' */ var lowerFirst = createCaseFirst('toLowerCase'); /** * Pads `string` on the left and right sides if it's shorter than `length`. * Padding characters are truncated if they can't be evenly divided by `length`. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.pad('abc', 8); * // => ' abc ' * * _.pad('abc', 8, '_-'); * // => '_-abc_-_' * * _.pad('abc', 3); * // => 'abc' */ function pad(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; if (!length || strLength >= length) { return string; } var mid = (length - strLength) / 2; return ( createPadding(nativeFloor(mid), chars) + string + createPadding(nativeCeil(mid), chars) ); } /** * Pads `string` on the right side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padEnd('abc', 6); * // => 'abc ' * * _.padEnd('abc', 6, '_-'); * // => 'abc_-_' * * _.padEnd('abc', 3); * // => 'abc' */ function padEnd(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (string + createPadding(length - strLength, chars)) : string; } /** * Pads `string` on the left side if it's shorter than `length`. Padding * characters are truncated if they exceed `length`. * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to pad. * @param {number} [length=0] The padding length. * @param {string} [chars=' '] The string used as padding. * @returns {string} Returns the padded string. * @example * * _.padStart('abc', 6); * // => ' abc' * * _.padStart('abc', 6, '_-'); * // => '_-_abc' * * _.padStart('abc', 3); * // => 'abc' */ function padStart(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (createPadding(length - strLength, chars) + string) : string; } /** * Converts `string` to an integer of the specified radix. If `radix` is * `undefined` or `0`, a `radix` of `10` is used unless `value` is a * hexadecimal, in which case a `radix` of `16` is used. * * **Note:** This method aligns with the * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. * * @static * @memberOf _ * @since 1.1.0 * @category String * @param {string} string The string to convert. * @param {number} [radix=10] The radix to interpret `value` by. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {number} Returns the converted integer. * @example * * _.parseInt('08'); * // => 8 * * _.map(['6', '08', '10'], _.parseInt); * // => [6, 8, 10] */ function parseInt(string, radix, guard) { if (guard || radix == null) { radix = 0; } else if (radix) { radix = +radix; } return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); } /** * Repeats the given string `n` times. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to repeat. * @param {number} [n=1] The number of times to repeat the string. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {string} Returns the repeated string. * @example * * _.repeat('*', 3); * // => '***' * * _.repeat('abc', 2); * // => 'abcabc' * * _.repeat('abc', 0); * // => '' */ function repeat(string, n, guard) { if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } return baseRepeat(toString(string), n); } /** * Replaces matches for `pattern` in `string` with `replacement`. * * **Note:** This method is based on * [`String#replace`](https://mdn.io/String/replace). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to modify. * @param {RegExp|string} pattern The pattern to replace. * @param {Function|string} replacement The match replacement. * @returns {string} Returns the modified string. * @example * * _.replace('Hi Fred', 'Fred', 'Barney'); * // => 'Hi Barney' */ function replace() { var args = arguments, string = toString(args[0]); return args.length < 3 ? string : string.replace(args[1], args[2]); } /** * Converts `string` to * [snake case](https://en.wikipedia.org/wiki/Snake_case). * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the snake cased string. * @example * * _.snakeCase('Foo Bar'); * // => 'foo_bar' * * _.snakeCase('fooBar'); * // => 'foo_bar' * * _.snakeCase('--FOO-BAR--'); * // => 'foo_bar' */ var snakeCase = createCompounder(function(result, word, index) { return result + (index ? '_' : '') + word.toLowerCase(); }); /** * Splits `string` by `separator`. * * **Note:** This method is based on * [`String#split`](https://mdn.io/String/split). * * @static * @memberOf _ * @since 4.0.0 * @category String * @param {string} [string=''] The string to split. * @param {RegExp|string} separator The separator pattern to split by. * @param {number} [limit] The length to truncate results to. * @returns {Array} Returns the string segments. * @example * * _.split('a-b-c', '-', 2); * // => ['a', 'b'] */ function split(string, separator, limit) { if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { separator = limit = undefined; } limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; if (!limit) { return []; } string = toString(string); if (string && ( typeof separator == 'string' || (separator != null && !isRegExp(separator)) )) { separator = baseToString(separator); if (!separator && hasUnicode(string)) { return castSlice(stringToArray(string), 0, limit); } } return string.split(separator, limit); } /** * Converts `string` to * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). * * @static * @memberOf _ * @since 3.1.0 * @category String * @param {string} [string=''] The string to convert. * @returns {string} Returns the start cased string. * @example * * _.startCase('--foo-bar--'); * // => 'Foo Bar' * * _.startCase('fooBar'); * // => 'Foo Bar' * * _.startCase('__FOO_BAR__'); * // => 'FOO BAR' */ var startCase = createCompounder(function(result, word, index) { return result + (index ? ' ' : '') + upperFirst(word); }); /** * Checks if `string` starts with the given target string. * * @static * @memberOf _ * @since 3.0.0 * @category String * @param {string} [string=''] The string to inspect. * @param {string} [target] The string to search for. * @param {number} [position=0] The position to search from. * @returns {boolean} Returns `true` if `string` starts with `target`, * else `false`. * @example * * _.startsWith('abc', 'a'); * // => true * * _.startsWith('abc', 'b'); * // => false * * _.startsWith('abc', 'b', 1); * // => true */ function startsWith(string, target, position) { string = toString(string); position = position == null ? 0 : baseClamp(toInteger(position), 0, string.length); target = baseToString(target); return string.slice(position, position + target.length) == target; } /** * Creates a compiled template function that can interpolate data properties * in "interpolate" delimiters, HTML-escape interpolated data properties in * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data * properties may be accessed as free variables in the template. If a setting * object is given, it takes precedence over `_.templateSettings` values. * * **Note:** In the development build `_.template` utilizes * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) * for easier debugging. * * For more information on precompiling templates see * [lodash's custom builds documentation](https://lodash.com/custom-builds). * * For more information on Chrome extension sandboxes see * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). * * @static * @since 0.1.0 * @memberOf _ * @category String * @param {string} [string=''] The template string. * @param {Object} [options={}] The options object. * @param {RegExp} [options.escape=_.templateSettings.escape] * The HTML "escape" delimiter. * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] * The "evaluate" delimiter. * @param {Object} [options.imports=_.templateSettings.imports] * An object to import into the template as free variables. * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] * The "interpolate" delimiter. * @param {string} [options.sourceURL='lodash.templateSources[n]'] * The sourceURL of the compiled template. * @param {string} [options.variable='obj'] * The data object variable name. * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. * @returns {Function} Returns the compiled template function. * @example * * // Use the "interpolate" delimiter to create a compiled template. * var compiled = _.template('hello <%= user %>!'); * compiled({ 'user': 'fred' }); * // => 'hello fred!' * * // Use the HTML "escape" delimiter to escape data property values. * var compiled = _.template('<%- value %>'); * compiled({ 'value': '