From d979ef3b408fb88aac56bb38f1508e3213699dbd Mon Sep 17 00:00:00 2001 From: amitm02 Date: Mon, 23 Jul 2018 10:31:48 +0300 Subject: [PATCH] commit --- .gitignore | 2 +- build/index.js | 81885 ++++++++++++++++ build/src/export/formatter.d.ts | 4 + build/src/export/index.d.ts | 5 + build/src/export/packer/buffer-stream.d.ts | 9 + build/src/export/packer/buffer.d.ts | 7 + build/src/export/packer/compiler.d.ts | 12 + build/src/export/packer/express.d.ts | 9 + build/src/export/packer/local.d.ts | 10 + build/src/export/packer/packer.d.ts | 4 + .../export/packer/pdf-convert-wrapper.d.ts | 7 + build/src/export/packer/stream.d.ts | 9 + .../app-properties-attributes.d.ts | 11 + .../file/app-properties/app-properties.d.ts | 4 + .../content-types-attributes.d.ts | 9 + .../src/file/content-types/content-types.d.ts | 6 + .../default/default-attributes.d.ts | 11 + .../file/content-types/default/default.d.ts | 4 + .../override/override-attributes.d.ts | 11 + .../file/content-types/override/override.d.ts | 4 + .../src/file/core-properties/components.d.ts | 31 + build/src/file/core-properties/index.d.ts | 1 + .../src/file/core-properties/properties.d.ts | 14 + build/src/file/document/body/body.d.ts | 12 + build/src/file/document/body/index.d.ts | 2 + .../columns/columns-attributes.d.ts | 9 + .../section-properties/columns/columns.d.ts | 4 + .../doc-grid/doc-grid-attributes.d.ts | 9 + .../section-properties/doc-grid/doc-grid.d.ts | 4 + .../footer-reference-attributes.d.ts | 16 + .../footer-reference/footer-reference.d.ts | 9 + .../footer-reference/index.d.ts | 2 + .../header-reference-attributes.d.ts | 16 + .../header-reference/header-reference.d.ts | 9 + .../header-reference/index.d.ts | 2 + .../body/section-properties/index.d.ts | 5 + .../page-margin/page-margin-attributes.d.ts | 21 + .../page-margin/page-margin.d.ts | 4 + .../section-properties/page-number/index.d.ts | 1 + .../page-number/page-number.d.ts | 28 + .../section-properties/page-size/index.d.ts | 2 + .../page-size/page-size-attributes.d.ts | 17 + .../page-size/page-size.d.ts | 5 + .../section-properties.d.ts | 14 + .../file/document/document-attributes.d.ts | 53 + build/src/file/document/document.d.ts | 17 + build/src/file/document/index.d.ts | 2 + .../drawing/anchor/anchor-attributes.d.ts | 24 + build/src/file/drawing/anchor/anchor.d.ts | 6 + build/src/file/drawing/anchor/index.d.ts | 2 + .../doc-properties-attributes.d.ts | 13 + .../doc-properties/doc-properties.d.ts | 4 + build/src/file/drawing/drawing.d.ts | 24 + .../effect-extent-attributes.d.ts | 15 + .../drawing/effect-extent/effect-extent.d.ts | 4 + .../drawing/extent/extent-attributes.d.ts | 11 + build/src/file/drawing/extent/extent.d.ts | 6 + build/src/file/drawing/floating/align.d.ts | 5 + .../drawing/floating/floating-position.d.ts | 52 + .../drawing/floating/horizontal-position.d.ts | 5 + build/src/file/drawing/floating/index.d.ts | 4 + .../drawing/floating/position-offset.d.ts | 4 + .../src/file/drawing/floating/simple-pos.d.ts | 4 + .../drawing/floating/vertical-position.d.ts | 5 + .../graphic-frame-lock-attributes.d.ts | 11 + .../graphic-frame-locks.d.ts | 4 + .../graphic-frame-properties.d.ts | 4 + build/src/file/drawing/index.d.ts | 3 + .../graphic-data/graphic-data-attribute.d.ts | 9 + .../graphic/graphic-data/graphic-data.d.ts | 6 + .../inline/graphic/graphic-data/index.d.ts | 1 + .../graphic-data/pic/blip/blip-fill.d.ts | 4 + .../graphic/graphic-data/pic/blip/blip.d.ts | 4 + .../pic/blip/source-rectangle.d.ts | 4 + .../graphic-data/pic/blip/stretch.d.ts | 4 + .../graphic/graphic-data/pic/index.d.ts | 1 + .../child-non-visual-pic-properties.d.ts | 4 + .../pic-locks/pic-locks-attributes.d.ts | 11 + .../pic-locks/pic-locks.d.ts | 4 + .../non-visual-pic-properties.d.ts | 4 + .../non-visual-properties-attributes.d.ts | 13 + .../non-visual-properties.d.ts | 4 + .../graphic-data/pic/pic-attributes.d.ts | 9 + .../inline/graphic/graphic-data/pic/pic.d.ts | 6 + .../form/extents/extents-attributes.d.ts | 11 + .../form/extents/extents.d.ts | 6 + .../pic/shape-properties/form/form.d.ts | 6 + .../pic/shape-properties/form/index.d.ts | 1 + .../form/offset/off-attributes.d.ts | 11 + .../pic/shape-properties/form/offset/off.d.ts | 4 + .../adjustment-values/adjustment-values.d.ts | 4 + .../preset-geometry-attributes.d.ts | 9 + .../preset-geometry/preset-geometry.d.ts | 4 + .../shape-properties-attributes.d.ts | 9 + .../shape-properties/shape-properties.d.ts | 6 + .../file/drawing/inline/graphic/graphic.d.ts | 6 + .../file/drawing/inline/graphic/index.d.ts | 1 + build/src/file/drawing/inline/index.d.ts | 1 + .../drawing/inline/inline-attributes.d.ts | 12 + build/src/file/drawing/inline/inline.d.ts | 9 + build/src/file/drawing/text-wrap/index.d.ts | 5 + .../file/drawing/text-wrap/text-wrapping.d.ts | 18 + .../src/file/drawing/text-wrap/wrap-none.d.ts | 4 + .../file/drawing/text-wrap/wrap-square.d.ts | 5 + .../file/drawing/text-wrap/wrap-tight.d.ts | 5 + .../text-wrap/wrap-top-and-bottom.d.ts | 5 + build/src/file/file.d.ts | 60 + build/src/file/footer-wrapper.d.ts | 21 + build/src/file/footer/footer-attributes.d.ts | 51 + build/src/file/footer/footer.d.ts | 14 + .../footnote/footnote-attributes.d.ts | 11 + .../src/file/footnotes/footnote/footnote.d.ts | 10 + .../run/continuation-seperator-run.d.ts | 4 + .../footnote/run/continuation-seperator.d.ts | 4 + .../footnote/run/footnote-ref-run.d.ts | 4 + .../footnotes/footnote/run/footnote-ref.d.ts | 4 + .../footnotes/footnote/run/reference-run.d.ts | 16 + .../footnotes/footnote/run/seperator-run.d.ts | 4 + .../footnotes/footnote/run/seperator.d.ts | 4 + .../file/footnotes/footnotes-attributes.d.ts | 41 + build/src/file/footnotes/footnotes.d.ts | 7 + build/src/file/footnotes/index.d.ts | 1 + build/src/file/header-wrapper.d.ts | 21 + build/src/file/header/header-attributes.d.ts | 51 + build/src/file/header/header.d.ts | 14 + build/src/file/index.d.ts | 9 + build/src/file/media/data.d.ts | 20 + build/src/file/media/index.d.ts | 2 + build/src/file/media/media.d.ts | 11 + .../file/numbering/abstract-numbering.d.ts | 8 + build/src/file/numbering/index.d.ts | 2 + build/src/file/numbering/level.d.ts | 37 + .../src/file/numbering/multi-level-type.d.ts | 4 + build/src/file/numbering/num.d.ts | 13 + build/src/file/numbering/numbering.d.ts | 12 + .../file/paragraph/formatting/alignment.d.ts | 12 + build/src/file/paragraph/formatting/bidi.d.ts | 4 + .../src/file/paragraph/formatting/border.d.ts | 4 + .../src/file/paragraph/formatting/indent.d.ts | 4 + .../src/file/paragraph/formatting/index.d.ts | 9 + build/src/file/paragraph/formatting/keep.d.ts | 7 + .../file/paragraph/formatting/page-break.d.ts | 8 + .../file/paragraph/formatting/spacing.d.ts | 10 + .../src/file/paragraph/formatting/style.d.ts | 4 + .../file/paragraph/formatting/tab-stop.d.ts | 29 + .../paragraph/formatting/unordered-list.d.ts | 4 + build/src/file/paragraph/index.d.ts | 5 + .../paragraph/links/hyperlink-attributes.d.ts | 11 + build/src/file/paragraph/links/hyperlink.d.ts | 5 + build/src/file/paragraph/links/index.d.ts | 1 + build/src/file/paragraph/paragraph.d.ts | 43 + build/src/file/paragraph/properties.d.ts | 5 + build/src/file/paragraph/run/break.d.ts | 4 + build/src/file/paragraph/run/caps.d.ts | 7 + build/src/file/paragraph/run/formatting.d.ts | 37 + build/src/file/paragraph/run/index.d.ts | 3 + build/src/file/paragraph/run/page-number.d.ts | 13 + build/src/file/paragraph/run/picture-run.d.ts | 8 + build/src/file/paragraph/run/properties.d.ts | 5 + .../paragraph/run/run-components/text.d.ts | 4 + build/src/file/paragraph/run/run-fonts.d.ts | 4 + build/src/file/paragraph/run/run.d.ts | 22 + build/src/file/paragraph/run/script.d.ts | 10 + build/src/file/paragraph/run/style.d.ts | 4 + build/src/file/paragraph/run/tab.d.ts | 4 + build/src/file/paragraph/run/text-run.d.ts | 4 + build/src/file/paragraph/run/underline.d.ts | 55 + build/src/file/relationships/attributes.d.ts | 9 + build/src/file/relationships/index.d.ts | 1 + .../relationship/relationship-attributes.d.ts | 15 + .../relationship/relationship.d.ts | 6 + .../src/file/relationships/relationships.d.ts | 8 + build/src/file/styles/defaults/index.d.ts | 6 + .../styles/defaults/paragraph-properties.d.ts | 4 + .../file/styles/defaults/run-properties.d.ts | 7 + .../file/styles/external-styles-factory.d.ts | 4 + build/src/file/styles/factory.d.ts | 4 + build/src/file/styles/index.d.ts | 9 + build/src/file/styles/style/components.d.ts | 29 + build/src/file/styles/style/index.d.ts | 94 + build/src/file/table/grid.d.ts | 7 + build/src/file/table/index.d.ts | 2 + build/src/file/table/properties.d.ts | 8 + build/src/file/table/table-cell.d.ts | 65 + build/src/file/table/table.d.ts | 40 + build/src/file/xml-components/attributes.d.ts | 45 + build/src/file/xml-components/base.d.ts | 8 + .../xml-components/default-attributes.d.ts | 12 + .../imported-xml-component.d.ts | 19 + build/src/file/xml-components/index.d.ts | 5 + .../file/xml-components/xml-component.d.ts | 10 + .../file/xml-components/xmlable-object.d.ts | 6 + build/src/index.d.ts | 3 + package.json | 3 +- 194 files changed, 84007 insertions(+), 3 deletions(-) create mode 100644 build/index.js create mode 100644 build/src/export/formatter.d.ts create mode 100644 build/src/export/index.d.ts create mode 100644 build/src/export/packer/buffer-stream.d.ts create mode 100644 build/src/export/packer/buffer.d.ts create mode 100644 build/src/export/packer/compiler.d.ts create mode 100644 build/src/export/packer/express.d.ts create mode 100644 build/src/export/packer/local.d.ts create mode 100644 build/src/export/packer/packer.d.ts create mode 100644 build/src/export/packer/pdf-convert-wrapper.d.ts create mode 100644 build/src/export/packer/stream.d.ts create mode 100644 build/src/file/app-properties/app-properties-attributes.d.ts create mode 100644 build/src/file/app-properties/app-properties.d.ts create mode 100644 build/src/file/content-types/content-types-attributes.d.ts create mode 100644 build/src/file/content-types/content-types.d.ts create mode 100644 build/src/file/content-types/default/default-attributes.d.ts create mode 100644 build/src/file/content-types/default/default.d.ts create mode 100644 build/src/file/content-types/override/override-attributes.d.ts create mode 100644 build/src/file/content-types/override/override.d.ts create mode 100644 build/src/file/core-properties/components.d.ts create mode 100644 build/src/file/core-properties/index.d.ts create mode 100644 build/src/file/core-properties/properties.d.ts create mode 100644 build/src/file/document/body/body.d.ts create mode 100644 build/src/file/document/body/index.d.ts create mode 100644 build/src/file/document/body/section-properties/columns/columns-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/columns/columns.d.ts create mode 100644 build/src/file/document/body/section-properties/doc-grid/doc-grid-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/doc-grid/doc-grid.d.ts create mode 100644 build/src/file/document/body/section-properties/footer-reference/footer-reference-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/footer-reference/footer-reference.d.ts create mode 100644 build/src/file/document/body/section-properties/footer-reference/index.d.ts create mode 100644 build/src/file/document/body/section-properties/header-reference/header-reference-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/header-reference/header-reference.d.ts create mode 100644 build/src/file/document/body/section-properties/header-reference/index.d.ts create mode 100644 build/src/file/document/body/section-properties/index.d.ts create mode 100644 build/src/file/document/body/section-properties/page-margin/page-margin-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/page-margin/page-margin.d.ts create mode 100644 build/src/file/document/body/section-properties/page-number/index.d.ts create mode 100644 build/src/file/document/body/section-properties/page-number/page-number.d.ts create mode 100644 build/src/file/document/body/section-properties/page-size/index.d.ts create mode 100644 build/src/file/document/body/section-properties/page-size/page-size-attributes.d.ts create mode 100644 build/src/file/document/body/section-properties/page-size/page-size.d.ts create mode 100644 build/src/file/document/body/section-properties/section-properties.d.ts create mode 100644 build/src/file/document/document-attributes.d.ts create mode 100644 build/src/file/document/document.d.ts create mode 100644 build/src/file/document/index.d.ts create mode 100644 build/src/file/drawing/anchor/anchor-attributes.d.ts create mode 100644 build/src/file/drawing/anchor/anchor.d.ts create mode 100644 build/src/file/drawing/anchor/index.d.ts create mode 100644 build/src/file/drawing/doc-properties/doc-properties-attributes.d.ts create mode 100644 build/src/file/drawing/doc-properties/doc-properties.d.ts create mode 100644 build/src/file/drawing/drawing.d.ts create mode 100644 build/src/file/drawing/effect-extent/effect-extent-attributes.d.ts create mode 100644 build/src/file/drawing/effect-extent/effect-extent.d.ts create mode 100644 build/src/file/drawing/extent/extent-attributes.d.ts create mode 100644 build/src/file/drawing/extent/extent.d.ts create mode 100644 build/src/file/drawing/floating/align.d.ts create mode 100644 build/src/file/drawing/floating/floating-position.d.ts create mode 100644 build/src/file/drawing/floating/horizontal-position.d.ts create mode 100644 build/src/file/drawing/floating/index.d.ts create mode 100644 build/src/file/drawing/floating/position-offset.d.ts create mode 100644 build/src/file/drawing/floating/simple-pos.d.ts create mode 100644 build/src/file/drawing/floating/vertical-position.d.ts create mode 100644 build/src/file/drawing/graphic-frame/graphic-frame-locks/graphic-frame-lock-attributes.d.ts create mode 100644 build/src/file/drawing/graphic-frame/graphic-frame-locks/graphic-frame-locks.d.ts create mode 100644 build/src/file/drawing/graphic-frame/graphic-frame-properties.d.ts create mode 100644 build/src/file/drawing/index.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/graphic-data-attribute.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/graphic-data.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/index.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/blip/blip-fill.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/blip/blip.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/blip/source-rectangle.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/blip/stretch.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/index.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/child-non-visual-pic-properties/child-non-visual-pic-properties.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/child-non-visual-pic-properties/pic-locks/pic-locks-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/child-non-visual-pic-properties/pic-locks/pic-locks.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/non-visual-pic-properties.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/non-visual-properties/non-visual-properties-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/non-visual-pic-properties/non-visual-properties/non-visual-properties.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/pic-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/pic.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/extents/extents-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/extents/extents.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/form.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/index.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/offset/off-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/form/offset/off.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/preset-geometry/adjustment-values/adjustment-values.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/preset-geometry/preset-geometry-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/preset-geometry/preset-geometry.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/shape-properties-attributes.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic-data/pic/shape-properties/shape-properties.d.ts create mode 100644 build/src/file/drawing/inline/graphic/graphic.d.ts create mode 100644 build/src/file/drawing/inline/graphic/index.d.ts create mode 100644 build/src/file/drawing/inline/index.d.ts create mode 100644 build/src/file/drawing/inline/inline-attributes.d.ts create mode 100644 build/src/file/drawing/inline/inline.d.ts create mode 100644 build/src/file/drawing/text-wrap/index.d.ts create mode 100644 build/src/file/drawing/text-wrap/text-wrapping.d.ts create mode 100644 build/src/file/drawing/text-wrap/wrap-none.d.ts create mode 100644 build/src/file/drawing/text-wrap/wrap-square.d.ts create mode 100644 build/src/file/drawing/text-wrap/wrap-tight.d.ts create mode 100644 build/src/file/drawing/text-wrap/wrap-top-and-bottom.d.ts create mode 100644 build/src/file/file.d.ts create mode 100644 build/src/file/footer-wrapper.d.ts create mode 100644 build/src/file/footer/footer-attributes.d.ts create mode 100644 build/src/file/footer/footer.d.ts create mode 100644 build/src/file/footnotes/footnote/footnote-attributes.d.ts create mode 100644 build/src/file/footnotes/footnote/footnote.d.ts create mode 100644 build/src/file/footnotes/footnote/run/continuation-seperator-run.d.ts create mode 100644 build/src/file/footnotes/footnote/run/continuation-seperator.d.ts create mode 100644 build/src/file/footnotes/footnote/run/footnote-ref-run.d.ts create mode 100644 build/src/file/footnotes/footnote/run/footnote-ref.d.ts create mode 100644 build/src/file/footnotes/footnote/run/reference-run.d.ts create mode 100644 build/src/file/footnotes/footnote/run/seperator-run.d.ts create mode 100644 build/src/file/footnotes/footnote/run/seperator.d.ts create mode 100644 build/src/file/footnotes/footnotes-attributes.d.ts create mode 100644 build/src/file/footnotes/footnotes.d.ts create mode 100644 build/src/file/footnotes/index.d.ts create mode 100644 build/src/file/header-wrapper.d.ts create mode 100644 build/src/file/header/header-attributes.d.ts create mode 100644 build/src/file/header/header.d.ts create mode 100644 build/src/file/index.d.ts create mode 100644 build/src/file/media/data.d.ts create mode 100644 build/src/file/media/index.d.ts create mode 100644 build/src/file/media/media.d.ts create mode 100644 build/src/file/numbering/abstract-numbering.d.ts create mode 100644 build/src/file/numbering/index.d.ts create mode 100644 build/src/file/numbering/level.d.ts create mode 100644 build/src/file/numbering/multi-level-type.d.ts create mode 100644 build/src/file/numbering/num.d.ts create mode 100644 build/src/file/numbering/numbering.d.ts create mode 100644 build/src/file/paragraph/formatting/alignment.d.ts create mode 100644 build/src/file/paragraph/formatting/bidi.d.ts create mode 100644 build/src/file/paragraph/formatting/border.d.ts create mode 100644 build/src/file/paragraph/formatting/indent.d.ts create mode 100644 build/src/file/paragraph/formatting/index.d.ts create mode 100644 build/src/file/paragraph/formatting/keep.d.ts create mode 100644 build/src/file/paragraph/formatting/page-break.d.ts create mode 100644 build/src/file/paragraph/formatting/spacing.d.ts create mode 100644 build/src/file/paragraph/formatting/style.d.ts create mode 100644 build/src/file/paragraph/formatting/tab-stop.d.ts create mode 100644 build/src/file/paragraph/formatting/unordered-list.d.ts create mode 100644 build/src/file/paragraph/index.d.ts create mode 100644 build/src/file/paragraph/links/hyperlink-attributes.d.ts create mode 100644 build/src/file/paragraph/links/hyperlink.d.ts create mode 100644 build/src/file/paragraph/links/index.d.ts create mode 100644 build/src/file/paragraph/paragraph.d.ts create mode 100644 build/src/file/paragraph/properties.d.ts create mode 100644 build/src/file/paragraph/run/break.d.ts create mode 100644 build/src/file/paragraph/run/caps.d.ts create mode 100644 build/src/file/paragraph/run/formatting.d.ts create mode 100644 build/src/file/paragraph/run/index.d.ts create mode 100644 build/src/file/paragraph/run/page-number.d.ts create mode 100644 build/src/file/paragraph/run/picture-run.d.ts create mode 100644 build/src/file/paragraph/run/properties.d.ts create mode 100644 build/src/file/paragraph/run/run-components/text.d.ts create mode 100644 build/src/file/paragraph/run/run-fonts.d.ts create mode 100644 build/src/file/paragraph/run/run.d.ts create mode 100644 build/src/file/paragraph/run/script.d.ts create mode 100644 build/src/file/paragraph/run/style.d.ts create mode 100644 build/src/file/paragraph/run/tab.d.ts create mode 100644 build/src/file/paragraph/run/text-run.d.ts create mode 100644 build/src/file/paragraph/run/underline.d.ts create mode 100644 build/src/file/relationships/attributes.d.ts create mode 100644 build/src/file/relationships/index.d.ts create mode 100644 build/src/file/relationships/relationship/relationship-attributes.d.ts create mode 100644 build/src/file/relationships/relationship/relationship.d.ts create mode 100644 build/src/file/relationships/relationships.d.ts create mode 100644 build/src/file/styles/defaults/index.d.ts create mode 100644 build/src/file/styles/defaults/paragraph-properties.d.ts create mode 100644 build/src/file/styles/defaults/run-properties.d.ts create mode 100644 build/src/file/styles/external-styles-factory.d.ts create mode 100644 build/src/file/styles/factory.d.ts create mode 100644 build/src/file/styles/index.d.ts create mode 100644 build/src/file/styles/style/components.d.ts create mode 100644 build/src/file/styles/style/index.d.ts create mode 100644 build/src/file/table/grid.d.ts create mode 100644 build/src/file/table/index.d.ts create mode 100644 build/src/file/table/properties.d.ts create mode 100644 build/src/file/table/table-cell.d.ts create mode 100644 build/src/file/table/table.d.ts create mode 100644 build/src/file/xml-components/attributes.d.ts create mode 100644 build/src/file/xml-components/base.d.ts create mode 100644 build/src/file/xml-components/default-attributes.d.ts create mode 100644 build/src/file/xml-components/imported-xml-component.d.ts create mode 100644 build/src/file/xml-components/index.d.ts create mode 100644 build/src/file/xml-components/xml-component.d.ts create mode 100644 build/src/file/xml-components/xmlable-object.d.ts create mode 100644 build/src/index.d.ts diff --git a/.gitignore b/.gitignore index 53f1416525..3288b97e06 100644 --- a/.gitignore +++ b/.gitignore @@ -33,7 +33,7 @@ node_modules .node_repl_history # build -build +# build build-tests # VSCode diff --git a/build/index.js b/build/index.js new file mode 100644 index 0000000000..77fd3d9fd6 --- /dev/null +++ b/build/index.js @@ -0,0 +1,81885 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else { + var a = factory(); + for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i]; + } +})(typeof self !== 'undefined' ? self : this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) { +/******/ return installedModules[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.l = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { +/******/ configurable: false, +/******/ enumerable: true, +/******/ get: getter +/******/ }); +/******/ } +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = 197); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +function __export(m) { + for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; +} +Object.defineProperty(exports, "__esModule", { value: true }); +__export(__webpack_require__(198)); +__export(__webpack_require__(199)); +__export(__webpack_require__(92)); +__export(__webpack_require__(200)); +__export(__webpack_require__(207)); + + +/***/ }), +/* 1 */ +/***/ (function(module, exports) { + +module.exports = require("util"); + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(25); +var Stream = __webpack_require__(13).Stream; +var util = __webpack_require__(1); + + +///--- Globals + +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + +///--- Internal + +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); +} + +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} + +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} + +function noop() { + // Why even bother with asserts? +} + + +///--- Exports + +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } +}; + +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; +} + +module.exports = _setExports(process.env.NODE_NDEBUG); + + +/***/ }), +/* 3 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +var es5 = __webpack_require__(34); +var canEvaluate = typeof navigator == "undefined"; + +var errorObj = {e: {}}; +var tryCatchTarget; +var globalObject = typeof self !== "undefined" ? self : + typeof window !== "undefined" ? window : + typeof global !== "undefined" ? global : + this !== undefined ? this : null; + +function tryCatcher() { + try { + var target = tryCatchTarget; + tryCatchTarget = null; + return target.apply(this, arguments); + } catch (e) { + errorObj.e = e; + return errorObj; + } +} +function tryCatch(fn) { + tryCatchTarget = fn; + return tryCatcher; +} + +var inherits = function(Child, Parent) { + var hasProp = {}.hasOwnProperty; + + function T() { + this.constructor = Child; + this.constructor$ = Parent; + for (var propertyName in Parent.prototype) { + if (hasProp.call(Parent.prototype, propertyName) && + propertyName.charAt(propertyName.length-1) !== "$" + ) { + this[propertyName + "$"] = Parent.prototype[propertyName]; + } + } + } + T.prototype = Parent.prototype; + Child.prototype = new T(); + return Child.prototype; +}; + + +function isPrimitive(val) { + return val == null || val === true || val === false || + typeof val === "string" || typeof val === "number"; + +} + +function isObject(value) { + return typeof value === "function" || + typeof value === "object" && value !== null; +} + +function maybeWrapAsError(maybeError) { + if (!isPrimitive(maybeError)) return maybeError; + + return new Error(safeToString(maybeError)); +} + +function withAppended(target, appendee) { + var len = target.length; + var ret = new Array(len + 1); + var i; + for (i = 0; i < len; ++i) { + ret[i] = target[i]; + } + ret[i] = appendee; + return ret; +} + +function getDataPropertyOrDefault(obj, key, defaultValue) { + if (es5.isES5) { + var desc = Object.getOwnPropertyDescriptor(obj, key); + + if (desc != null) { + return desc.get == null && desc.set == null + ? desc.value + : defaultValue; + } + } else { + return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined; + } +} + +function notEnumerableProp(obj, name, value) { + if (isPrimitive(obj)) return obj; + var descriptor = { + value: value, + configurable: true, + enumerable: false, + writable: true + }; + es5.defineProperty(obj, name, descriptor); + return obj; +} + +function thrower(r) { + throw r; +} + +var inheritedDataKeys = (function() { + var excludedPrototypes = [ + Array.prototype, + Object.prototype, + Function.prototype + ]; + + var isExcludedProto = function(val) { + for (var i = 0; i < excludedPrototypes.length; ++i) { + if (excludedPrototypes[i] === val) { + return true; + } + } + return false; + }; + + if (es5.isES5) { + var getKeys = Object.getOwnPropertyNames; + return function(obj) { + var ret = []; + var visitedKeys = Object.create(null); + while (obj != null && !isExcludedProto(obj)) { + var keys; + try { + keys = getKeys(obj); + } catch (e) { + return ret; + } + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + if (visitedKeys[key]) continue; + visitedKeys[key] = true; + var desc = Object.getOwnPropertyDescriptor(obj, key); + if (desc != null && desc.get == null && desc.set == null) { + ret.push(key); + } + } + obj = es5.getPrototypeOf(obj); + } + return ret; + }; + } else { + var hasProp = {}.hasOwnProperty; + return function(obj) { + if (isExcludedProto(obj)) return []; + var ret = []; + + /*jshint forin:false */ + enumeration: for (var key in obj) { + if (hasProp.call(obj, key)) { + ret.push(key); + } else { + for (var i = 0; i < excludedPrototypes.length; ++i) { + if (hasProp.call(excludedPrototypes[i], key)) { + continue enumeration; + } + } + ret.push(key); + } + } + return ret; + }; + } + +})(); + +var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/; +function isClass(fn) { + try { + if (typeof fn === "function") { + var keys = es5.names(fn.prototype); + + var hasMethods = es5.isES5 && keys.length > 1; + var hasMethodsOtherThanConstructor = keys.length > 0 && + !(keys.length === 1 && keys[0] === "constructor"); + var hasThisAssignmentAndStaticMethods = + thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0; + + if (hasMethods || hasMethodsOtherThanConstructor || + hasThisAssignmentAndStaticMethods) { + return true; + } + } + return false; + } catch (e) { + return false; + } +} + +function toFastProperties(obj) { + /*jshint -W027,-W055,-W031*/ + function FakeConstructor() {} + FakeConstructor.prototype = obj; + var l = 8; + while (l--) new FakeConstructor(); + return obj; + eval(obj); +} + +var rident = /^[a-z$_][a-z$_0-9]*$/i; +function isIdentifier(str) { + return rident.test(str); +} + +function filledRange(count, prefix, suffix) { + var ret = new Array(count); + for(var i = 0; i < count; ++i) { + ret[i] = prefix + i + suffix; + } + return ret; +} + +function safeToString(obj) { + try { + return obj + ""; + } catch (e) { + return "[no string representation]"; + } +} + +function isError(obj) { + return obj instanceof Error || + (obj !== null && + typeof obj === "object" && + typeof obj.message === "string" && + typeof obj.name === "string"); +} + +function markAsOriginatingFromRejection(e) { + try { + notEnumerableProp(e, "isOperational", true); + } + catch(ignore) {} +} + +function originatesFromRejection(e) { + if (e == null) return false; + return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) || + e["isOperational"] === true); +} + +function canAttachTrace(obj) { + return isError(obj) && es5.propertyIsWritable(obj, "stack"); +} + +var ensureErrorObject = (function() { + if (!("stack" in new Error())) { + return function(value) { + if (canAttachTrace(value)) return value; + try {throw new Error(safeToString(value));} + catch(err) {return err;} + }; + } else { + return function(value) { + if (canAttachTrace(value)) return value; + return new Error(safeToString(value)); + }; + } +})(); + +function classString(obj) { + return {}.toString.call(obj); +} + +function copyDescriptors(from, to, filter) { + var keys = es5.names(from); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + if (filter(key)) { + try { + es5.defineProperty(to, key, es5.getDescriptor(from, key)); + } catch (ignore) {} + } + } +} + +var asArray = function(v) { + if (es5.isArray(v)) { + return v; + } + return null; +}; + +if (typeof Symbol !== "undefined" && Symbol.iterator) { + var ArrayFrom = typeof Array.from === "function" ? function(v) { + return Array.from(v); + } : function(v) { + var ret = []; + var it = v[Symbol.iterator](); + var itResult; + while (!((itResult = it.next()).done)) { + ret.push(itResult.value); + } + return ret; + }; + + asArray = function(v) { + if (es5.isArray(v)) { + return v; + } else if (v != null && typeof v[Symbol.iterator] === "function") { + return ArrayFrom(v); + } + return null; + }; +} + +var isNode = typeof process !== "undefined" && + classString(process).toLowerCase() === "[object process]"; + +var hasEnvVariables = typeof process !== "undefined" && + typeof process.env !== "undefined"; + +function env(key) { + return hasEnvVariables ? process.env[key] : undefined; +} + +function getNativePromise() { + if (typeof Promise === "function") { + try { + var promise = new Promise(function(){}); + if ({}.toString.call(promise) === "[object Promise]") { + return Promise; + } + } catch (e) {} + } +} + +function domainBind(self, cb) { + return self.bind(cb); +} + +var ret = { + isClass: isClass, + isIdentifier: isIdentifier, + inheritedDataKeys: inheritedDataKeys, + getDataPropertyOrDefault: getDataPropertyOrDefault, + thrower: thrower, + isArray: es5.isArray, + asArray: asArray, + notEnumerableProp: notEnumerableProp, + isPrimitive: isPrimitive, + isObject: isObject, + isError: isError, + canEvaluate: canEvaluate, + errorObj: errorObj, + tryCatch: tryCatch, + inherits: inherits, + withAppended: withAppended, + maybeWrapAsError: maybeWrapAsError, + toFastProperties: toFastProperties, + filledRange: filledRange, + toString: safeToString, + canAttachTrace: canAttachTrace, + ensureErrorObject: ensureErrorObject, + originatesFromRejection: originatesFromRejection, + markAsOriginatingFromRejection: markAsOriginatingFromRejection, + classString: classString, + copyDescriptors: copyDescriptors, + hasDevTools: typeof chrome !== "undefined" && chrome && + typeof chrome.loadTimes === "function", + isNode: isNode, + hasEnvVariables: hasEnvVariables, + env: env, + global: globalObject, + getNativePromise: getNativePromise, + domainBind: domainBind +}; +ret.isRecentNode = ret.isNode && (function() { + var version = process.versions.node.split(".").map(Number); + return (version[0] === 0 && version[1] > 10) || (version[0] > 0); +})(); + +if (ret.isNode) ret.toFastProperties(process); + +try {throw new Error(); } catch (e) {ret.lastLineError = e;} +module.exports = ret; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + +module.exports = require("crypto"); + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/* eslint-disable node/no-deprecated-api */ + + + +var buffer = __webpack_require__(11) +var Buffer = buffer.Buffer + +var safer = {} + +var key + +for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue + if (key === 'SlowBuffer' || key === 'Buffer') continue + safer[key] = buffer[key] +} + +var Safer = safer.Buffer = {} +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue + Safer[key] = Buffer[key] +} + +safer.Buffer.prototype = Buffer.prototype + +if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) + } + if (value && typeof value.length === 'undefined') { + throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) + } + return Buffer(value, encodingOrOffset, length) + } +} + +if (!Safer.alloc) { + Safer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + var buf = Buffer(size) + if (!fill || fill.length === 0) { + buf.fill(0) + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + return buf + } +} + +if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } +} + +if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength + } + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + } +} + +module.exports = safer + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + calculateED25519Public: calculateED25519Public, + calculateX25519Public: calculateX25519Public, + mpNormalize: mpNormalize, + mpDenormalize: mpDenormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo, + publicFromPrivateECDSA: publicFromPrivateECDSA, + zeroPadToLength: zeroPadToLength, + writeBitString: writeBitString, + readBitString: readBitString +}; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; +var PrivateKey = __webpack_require__(9); +var Key = __webpack_require__(7); +var crypto = __webpack_require__(4); +var algs = __webpack_require__(8); +var asn1 = __webpack_require__(24); + +var ec, jsbn; +var nacl; + +var MAX_CLASS_DEPTH = 3; + +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} + +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} + +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; + +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); + + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); + + salt = salt.slice(0, PKCS5_SALT_LEN); + + var D, D_prev, bufs; + var material = Buffer.alloc(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } + + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} + +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} + +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; + + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); + + return (parts); +} + +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} + +function readBitString(der, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var buf = der.readString(tag, true); + assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + + 'not supported (0x' + buf[0].toString(16) + ')'); + return (buf.slice(1)); +} + +function writeBitString(der, buf, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + der.writeBuffer(b, tag); +} + +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function mpDenormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00) + buf = buf.slice(1); + return (buf); +} + +function zeroPadToLength(buf, len) { + assert.buffer(buf); + assert.number(len); + while (buf.length > len) { + assert.equal(buf[0], 0x00); + buf = buf.slice(1); + } + while (buf.length < len) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function bigintToMpBuf(bigint) { + var buf = Buffer.from(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} + +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(27).BigInteger; + } catch (e) { + throw (new Error('To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.')); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} + +function calculateED25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) + nacl = __webpack_require__(23); + + var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function calculateX25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) + nacl = __webpack_require__(23); + + var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(27).BigInteger; + } catch (e) { + throw (new Error('To write a PEM private key from ' + + 'this source, the node jsbn lib is required.')); + } + + var d = new bigInt(key.part.d.data); + var buf; + + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); + + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); + + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} + +function publicFromPrivateECDSA(curveName, priv) { + assert.string(curveName, 'curveName'); + assert.buffer(priv); + if (ec === undefined) + ec = __webpack_require__(42); + if (jsbn === undefined) + jsbn = __webpack_require__(27).BigInteger; + var params = algs.curves[curveName]; + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); + + var d = new jsbn(mpNormalize(priv)); + var pub = G.multiply(d); + pub = Buffer.from(curve.encodePointHex(pub), 'hex'); + + var parts = []; + parts.push({name: 'curve', data: Buffer.from(curveName)}); + parts.push({name: 'Q', data: pub}); + + var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); + return (key); +} + +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = Key; + +var assert = __webpack_require__(2); +var algs = __webpack_require__(8); +var crypto = __webpack_require__(4); +var Fingerprint = __webpack_require__(40); +var Signature = __webpack_require__(22); +var DiffieHellman = __webpack_require__(79).DiffieHellman; +var errs = __webpack_require__(21); +var utils = __webpack_require__(6); +var PrivateKey = __webpack_require__(9); +var edCompat; + +try { + edCompat = __webpack_require__(168); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; + +var formats = {}; +formats['auto'] = __webpack_require__(169); +formats['pem'] = __webpack_require__(28); +formats['pkcs1'] = __webpack_require__(82); +formats['pkcs8'] = __webpack_require__(43); +formats['rfc4253'] = __webpack_require__(30); +formats['ssh'] = __webpack_require__(171); +formats['ssh-private'] = __webpack_require__(57); +formats['openssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(83); + +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); + + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; + + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; + + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519' || this.type === 'curve25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} + +Key.formats = formats; + +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } + + return (formats[format].write(this, options)); +}; + +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; + +Key.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); + + if (this._hashCache[algo]) + return (this._hashCache[algo]); + var hash = crypto.createHash(algo). + update(this.toBuffer('rfc4253')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; + +Key.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; + +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; + +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); + + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); + + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; + +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); + + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; + +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; + +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + * [1,6] -- changed ed25519 part names + */ +Key.prototype._sshpkApiVersion = [1, 6]; + +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var Buffer = __webpack_require__(5).Buffer; + +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['A'], + sizePart: 'A' + } +}; +algInfo['curve25519'] = algInfo['ed25519']; + +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['A', 'k'] + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; + +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; + +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: Buffer.from(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: Buffer.from(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: Buffer.from(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: Buffer.from(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } +}; + +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = PrivateKey; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var crypto = __webpack_require__(4); +var Fingerprint = __webpack_require__(40); +var Signature = __webpack_require__(22); +var errs = __webpack_require__(21); +var util = __webpack_require__(1); +var utils = __webpack_require__(6); +var dhe = __webpack_require__(79); +var generateECDSA = dhe.generateECDSA; +var generateED25519 = dhe.generateED25519; +var edCompat; +var nacl; + +try { + edCompat = __webpack_require__(168); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var Key = __webpack_require__(7); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; + +var formats = {}; +formats['auto'] = __webpack_require__(169); +formats['pem'] = __webpack_require__(28); +formats['pkcs1'] = __webpack_require__(82); +formats['pkcs8'] = __webpack_require__(43); +formats['rfc4253'] = __webpack_require__(30); +formats['ssh-private'] = __webpack_require__(57); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(83); + +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); + + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); + +PrivateKey.formats = formats; + +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +PrivateKey.prototype.hash = function (algo) { + return (this.toPublic().hash(algo)); +}; + +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); + + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } + + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; + +PrivateKey.prototype.derive = function (newType) { + assert.string(newType, 'type'); + var priv, pub, pair; + + if (this.type === 'ed25519' && newType === 'curve25519') { + if (nacl === undefined) + nacl = __webpack_require__(23); + + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (nacl === undefined) + nacl = __webpack_require__(23); + + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; + +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; + +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = Buffer.from(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); +}; + +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; + +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); + + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); + } +}; + +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + * [1,5] -- changed ed25519 part names and format + */ +PrivateKey.prototype._sshpkApiVersion = [1, 5]; + +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports) { + +module.exports = require("fs"); + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + +module.exports = require("buffer"); + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +function __export(m) { + for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; +} +Object.defineProperty(exports, "__esModule", { value: true }); +__export(__webpack_require__(89)); +__export(__webpack_require__(264)); +__export(__webpack_require__(49)); +__export(__webpack_require__(29)); +__export(__webpack_require__(267)); + + +/***/ }), +/* 13 */ +/***/ (function(module, exports) { + +module.exports = require("stream"); + +/***/ }), +/* 14 */ +/***/ (function(module, exports) { + +module.exports = require("path"); + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + +var Stream = __webpack_require__(13); +if (process.env.READABLE_STREAM === 'disable' && Stream) { + module.exports = Stream; + exports = module.exports = Stream.Readable; + exports.Readable = Stream.Readable; + exports.Writable = Stream.Writable; + exports.Duplex = Stream.Duplex; + exports.Transform = Stream.Transform; + exports.PassThrough = Stream.PassThrough; + exports.Stream = Stream; +} else { + exports = module.exports = __webpack_require__(136); + exports.Stream = Stream || exports; + exports.Readable = exports; + exports.Writable = __webpack_require__(139); + exports.Duplex = __webpack_require__(33); + exports.Transform = __webpack_require__(141); + exports.PassThrough = __webpack_require__(364); +} + + +/***/ }), +/* 16 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_buffer__ = __webpack_require__(11); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_buffer___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_buffer__); + + +const createBuffer = + __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].from && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].alloc && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].allocUnsafe && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].allocUnsafeSlow + ? __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].from + : // support for Node < 5.10 + val => new __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"](val); + +/* harmony default export */ __webpack_exports__["a"] = (createBuffer); + + +/***/ }), +/* 17 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony default export */ __webpack_exports__["a"] = (function(model, calc) { + const fn = (buf, previous) => calc(buf, previous) >>> 0; + fn.signed = calc; + fn.unsigned = fn; + fn.model = model; + + return fn; +}); + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + +/* eslint-disable node/no-deprecated-api */ +var buffer = __webpack_require__(11) +var Buffer = buffer.Buffer + +// alternative to using Object.keys for old browsers +function copyProps (src, dst) { + for (var key in src) { + dst[key] = src[key] + } +} +if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { + module.exports = buffer +} else { + // Copy properties from require('buffer') + copyProps(buffer, exports) + exports.Buffer = SafeBuffer +} + +function SafeBuffer (arg, encodingOrOffset, length) { + return Buffer(arg, encodingOrOffset, length) +} + +// Copy static methods from Buffer +copyProps(Buffer, SafeBuffer) + +SafeBuffer.from = function (arg, encodingOrOffset, length) { + if (typeof arg === 'number') { + throw new TypeError('Argument must not be a number') + } + return Buffer(arg, encodingOrOffset, length) +} + +SafeBuffer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + var buf = Buffer(size) + if (fill !== undefined) { + if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + } else { + buf.fill(0) + } + return buf +} + +SafeBuffer.allocUnsafe = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return Buffer(size) +} + +SafeBuffer.allocUnsafeSlow = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return buffer.SlowBuffer(size) +} + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +const getAllMatches = function(string, regex) { + const matches = []; + let match = regex.exec(string); + while (match) { + const allmatches = []; + const len = match.length; + for (let index = 0; index < len; index++) { + allmatches.push(match[index]); + } + matches.push(allmatches); + match = regex.exec(string); + } + return matches; +}; + +const doesMatch = function(string, regex) { + const match = regex.exec(string); + return !(match === null || typeof match === "undefined"); +}; + +const doesNotMatch = function(string, regex) { + return !doesMatch(string, regex); +}; + +exports.isExist = function(v) { + return typeof v !== "undefined"; +}; + +exports.isEmptyObject = function(obj) { + return Object.keys(obj).length === 0; +}; + +/** + * Copy all the properties of a into b. + * @param {*} target + * @param {*} a + */ +exports.merge = function(target, a) { + if (a) { + const keys = Object.keys(a); // will return an array of own properties + const len = keys.length; //don't make it inline + for (let i = 0; i < len; i++) { + target[keys[i]] = a[keys[i]]; + } + } +}; +/* exports.merge =function (b,a){ + return Object.assign(b,a); +} */ + +exports.getValue = function(v) { + if (exports.isExist(v)) { + return v; + } else { + return ""; + } +}; + +// const fakeCall = function(a) {return a;}; +// const fakeCallNoReturn = function() {}; + +exports.buildOptions = function(options,defaultOptions,props) { + var newOptions = {}; + if (!options) { + return defaultOptions; //if there are not options + } + + for (let i = 0; i < props.length; i++) { + if ( options[props[i]] !== undefined) { + newOptions[props[i]] = options[props[i]]; + }else{ + newOptions[props[i]] = defaultOptions[props[i]]; + } + } + return newOptions; +}; + +exports.doesMatch = doesMatch; +exports.doesNotMatch = doesNotMatch; +exports.getAllMatches = getAllMatches; + + +/***/ }), +/* 20 */ +/***/ (function(module, exports) { + +module.exports = require("url"); + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(2); +var util = __webpack_require__(1); + +function FingerprintFormatError(fp, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, FingerprintFormatError); + this.name = 'FingerprintFormatError'; + this.fingerprint = fp; + this.format = format; + this.message = 'Fingerprint format is not supported, or is invalid: '; + if (fp !== undefined) + this.message += ' fingerprint = ' + fp; + if (format !== undefined) + this.message += ' format = ' + format; +} +util.inherits(FingerprintFormatError, Error); + +function InvalidAlgorithmError(alg) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, InvalidAlgorithmError); + this.name = 'InvalidAlgorithmError'; + this.algorithm = alg; + this.message = 'Algorithm "' + alg + '" is not supported'; +} +util.inherits(InvalidAlgorithmError, Error); + +function KeyParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyParseError); + this.name = 'KeyParseError'; + this.format = format; + this.keyName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format key: ' + innerErr.message; +} +util.inherits(KeyParseError, Error); + +function SignatureParseError(type, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, SignatureParseError); + this.name = 'SignatureParseError'; + this.type = type; + this.format = format; + this.innerErr = innerErr; + this.message = 'Failed to parse the given data as a ' + type + + ' signature in ' + format + ' format: ' + innerErr.message; +} +util.inherits(SignatureParseError, Error); + +function CertificateParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, CertificateParseError); + this.name = 'CertificateParseError'; + this.format = format; + this.certName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format certificate: ' + innerErr.message; +} +util.inherits(CertificateParseError, Error); + +function KeyEncryptedError(name, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyEncryptedError); + this.name = 'KeyEncryptedError'; + this.format = format; + this.keyName = name; + this.message = 'The ' + format + ' format key ' + name + ' is ' + + 'encrypted (password-protected), and no passphrase was ' + + 'provided in `options`'; +} +util.inherits(KeyEncryptedError, Error); + +module.exports = { + FingerprintFormatError: FingerprintFormatError, + InvalidAlgorithmError: InvalidAlgorithmError, + KeyParseError: KeyParseError, + SignatureParseError: SignatureParseError, + KeyEncryptedError: KeyEncryptedError, + CertificateParseError: CertificateParseError +}; + + +/***/ }), +/* 22 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = Signature; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var crypto = __webpack_require__(4); +var errs = __webpack_require__(21); +var utils = __webpack_require__(6); +var asn1 = __webpack_require__(24); +var SSHBuffer = __webpack_require__(44); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var SignatureParseError = errs.SignatureParseError; + +function Signature(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.hashAlgorithm = opts.hashAlgo; + this.curve = opts.curve; + this.parts = opts.parts; + this.part = partLookup; +} + +Signature.prototype.toBuffer = function (format) { + if (format === undefined) + format = 'asn1'; + assert.string(format, 'format'); + + var buf; + var stype = 'ssh-' + this.type; + + switch (this.type) { + case 'rsa': + switch (this.hashAlgorithm) { + case 'sha256': + stype = 'rsa-sha2-256'; + break; + case 'sha512': + stype = 'rsa-sha2-512'; + break; + case 'sha1': + case undefined: + break; + default: + throw (new Error('SSH signature ' + + 'format does not support hash ' + + 'algorithm ' + this.hashAlgorithm)); + } + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; + + case 'ed25519': + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; + + case 'dsa': + case 'ecdsa': + var r, s; + if (format === 'asn1') { + var der = new asn1.BerWriter(); + der.startSequence(); + r = utils.mpNormalize(this.part.r.data); + s = utils.mpNormalize(this.part.s.data); + der.writeBuffer(r, asn1.Ber.Integer); + der.writeBuffer(s, asn1.Ber.Integer); + der.endSequence(); + return (der.buffer); + } else if (format === 'ssh' && this.type === 'dsa') { + buf = new SSHBuffer({}); + buf.writeString('ssh-dss'); + r = this.part.r.data; + if (r.length > 20 && r[0] === 0x00) + r = r.slice(1); + s = this.part.s.data; + if (s.length > 20 && s[0] === 0x00) + s = s.slice(1); + if ((this.hashAlgorithm && + this.hashAlgorithm !== 'sha1') || + r.length + s.length !== 40) { + throw (new Error('OpenSSH only supports ' + + 'DSA signatures with SHA1 hash')); + } + buf.writeBuffer(Buffer.concat([r, s])); + return (buf.toBuffer()); + } else if (format === 'ssh' && this.type === 'ecdsa') { + var inner = new SSHBuffer({}); + r = this.part.r.data; + inner.writeBuffer(r); + inner.writePart(this.part.s); + + buf = new SSHBuffer({}); + /* XXX: find a more proper way to do this? */ + var curve; + if (r[0] === 0x00) + r = r.slice(1); + var sz = r.length * 8; + if (sz === 256) + curve = 'nistp256'; + else if (sz === 384) + curve = 'nistp384'; + else if (sz === 528) + curve = 'nistp521'; + buf.writeString('ecdsa-sha2-' + curve); + buf.writeBuffer(inner.toBuffer()); + return (buf.toBuffer()); + } + throw (new Error('Invalid signature format')); + default: + throw (new Error('Invalid signature data')); + } +}; + +Signature.prototype.toString = function (format) { + assert.optionalString(format, 'format'); + return (this.toBuffer(format).toString('base64')); +}; + +Signature.parse = function (data, type, format) { + if (typeof (data) === 'string') + data = Buffer.from(data, 'base64'); + assert.buffer(data, 'data'); + assert.string(format, 'format'); + assert.string(type, 'type'); + + var opts = {}; + opts.type = type.toLowerCase(); + opts.parts = []; + + try { + assert.ok(data.length > 0, 'signature must not be empty'); + switch (opts.type) { + case 'rsa': + return (parseOneNum(data, type, format, opts)); + case 'ed25519': + return (parseOneNum(data, type, format, opts)); + + case 'dsa': + case 'ecdsa': + if (format === 'asn1') + return (parseDSAasn1(data, type, format, opts)); + else if (opts.type === 'dsa') + return (parseDSA(data, type, format, opts)); + else + return (parseECDSA(data, type, format, opts)); + + default: + throw (new InvalidAlgorithmError(type)); + } + + } catch (e) { + if (e instanceof InvalidAlgorithmError) + throw (e); + throw (new SignatureParseError(type, format, e)); + } +}; + +function parseOneNum(data, type, format, opts) { + if (format === 'ssh') { + try { + var buf = new SSHBuffer({buffer: data}); + var head = buf.readString(); + } catch (e) { + /* fall through */ + } + if (buf !== undefined) { + var msg = 'SSH signature does not match expected ' + + 'type (expected ' + type + ', got ' + head + ')'; + switch (head) { + case 'ssh-rsa': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha1'; + break; + case 'rsa-sha2-256': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha256'; + break; + case 'rsa-sha2-512': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha512'; + break; + case 'ssh-ed25519': + assert.strictEqual(type, 'ed25519', msg); + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unknown SSH signature ' + + 'type: ' + head)); + } + var sig = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + sig.name = 'sig'; + opts.parts.push(sig); + return (new Signature(opts)); + } + } + opts.parts.push({name: 'sig', data: data}); + return (new Signature(opts)); +} + +function parseDSAasn1(data, type, format, opts) { + var der = new asn1.BerReader(data); + der.readSequence(); + var r = der.readString(asn1.Ber.Integer, true); + var s = der.readString(asn1.Ber.Integer, true); + + opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); + opts.parts.push({name: 's', data: utils.mpNormalize(s)}); + + return (new Signature(opts)); +} + +function parseDSA(data, type, format, opts) { + if (data.length != 40) { + var buf = new SSHBuffer({buffer: data}); + var d = buf.readBuffer(); + if (d.toString('ascii') === 'ssh-dss') + d = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + assert.strictEqual(d.length, 40, 'invalid inner length'); + data = d; + } + opts.parts.push({name: 'r', data: data.slice(0, 20)}); + opts.parts.push({name: 's', data: data.slice(20, 40)}); + return (new Signature(opts)); +} + +function parseECDSA(data, type, format, opts) { + var buf = new SSHBuffer({buffer: data}); + + var r, s; + var inner = buf.readBuffer(); + var stype = inner.toString('ascii'); + if (stype.slice(0, 6) === 'ecdsa-') { + var parts = stype.split('-'); + assert.strictEqual(parts[0], 'ecdsa'); + assert.strictEqual(parts[1], 'sha2'); + opts.curve = parts[2]; + switch (opts.curve) { + case 'nistp256': + opts.hashAlgo = 'sha256'; + break; + case 'nistp384': + opts.hashAlgo = 'sha384'; + break; + case 'nistp521': + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unsupported ECDSA curve: ' + + opts.curve)); + } + inner = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); + buf = new SSHBuffer({buffer: inner}); + r = buf.readPart(); + } else { + r = {data: inner}; + } + + s = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + + r.name = 'r'; + s.name = 's'; + + opts.parts.push(r); + opts.parts.push(s); + return (new Signature(opts)); +} + +Signature.isSignature = function (obj, ver) { + return (utils.isCompatible(obj, Signature, ver)); +}; + +/* + * API versions for Signature: + * [1,0] -- initial ver + * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent + * hashAlgorithm property + * [2,1] -- first tagged version + */ +Signature.prototype._sshpkApiVersion = [2, 1]; + +Signature._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + if (obj.hasOwnProperty('hashAlgorithm')) + return ([2, 0]); + return ([1, 0]); +}; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { + +(function(nacl) { +'use strict'; + +// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. +// Public domain. +// +// Implementation derived from TweetNaCl version 20140427. +// See for details: http://tweetnacl.cr.yp.to/ + +var gf = function(init) { + var i, r = new Float64Array(16); + if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; + return r; +}; + +// Pluggable, initialized in high-level API below. +var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; + +var _0 = new Uint8Array(16); +var _9 = new Uint8Array(32); _9[0] = 9; + +var gf0 = gf(), + gf1 = gf([1]), + _121665 = gf([0xdb41, 1]), + D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), + D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), + X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), + Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), + I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); + +function ts64(x, i, h, l) { + x[i] = (h >> 24) & 0xff; + x[i+1] = (h >> 16) & 0xff; + x[i+2] = (h >> 8) & 0xff; + x[i+3] = h & 0xff; + x[i+4] = (l >> 24) & 0xff; + x[i+5] = (l >> 16) & 0xff; + x[i+6] = (l >> 8) & 0xff; + x[i+7] = l & 0xff; +} + +function vn(x, xi, y, yi, n) { + var i,d = 0; + for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; + return (1 & ((d - 1) >>> 8)) - 1; +} + +function crypto_verify_16(x, xi, y, yi) { + return vn(x,xi,y,yi,16); +} + +function crypto_verify_32(x, xi, y, yi) { + return vn(x,xi,y,yi,32); +} + +function core_salsa20(o, p, k, c) { + var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, + j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, + j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, + j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, + j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, + j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, + j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, + j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, + j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, + j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, + j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, + j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, + j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, + j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, + j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, + j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; + + var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, + x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, + x15 = j15, u; + + for (var i = 0; i < 20; i += 2) { + u = x0 + x12 | 0; + x4 ^= u<<7 | u>>>(32-7); + u = x4 + x0 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x4 | 0; + x12 ^= u<<13 | u>>>(32-13); + u = x12 + x8 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x1 | 0; + x9 ^= u<<7 | u>>>(32-7); + u = x9 + x5 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x9 | 0; + x1 ^= u<<13 | u>>>(32-13); + u = x1 + x13 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x6 | 0; + x14 ^= u<<7 | u>>>(32-7); + u = x14 + x10 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x14 | 0; + x6 ^= u<<13 | u>>>(32-13); + u = x6 + x2 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x11 | 0; + x3 ^= u<<7 | u>>>(32-7); + u = x3 + x15 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x3 | 0; + x11 ^= u<<13 | u>>>(32-13); + u = x11 + x7 | 0; + x15 ^= u<<18 | u>>>(32-18); + + u = x0 + x3 | 0; + x1 ^= u<<7 | u>>>(32-7); + u = x1 + x0 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x1 | 0; + x3 ^= u<<13 | u>>>(32-13); + u = x3 + x2 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x4 | 0; + x6 ^= u<<7 | u>>>(32-7); + u = x6 + x5 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x6 | 0; + x4 ^= u<<13 | u>>>(32-13); + u = x4 + x7 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x9 | 0; + x11 ^= u<<7 | u>>>(32-7); + u = x11 + x10 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x11 | 0; + x9 ^= u<<13 | u>>>(32-13); + u = x9 + x8 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x14 | 0; + x12 ^= u<<7 | u>>>(32-7); + u = x12 + x15 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x12 | 0; + x14 ^= u<<13 | u>>>(32-13); + u = x14 + x13 | 0; + x15 ^= u<<18 | u>>>(32-18); + } + x0 = x0 + j0 | 0; + x1 = x1 + j1 | 0; + x2 = x2 + j2 | 0; + x3 = x3 + j3 | 0; + x4 = x4 + j4 | 0; + x5 = x5 + j5 | 0; + x6 = x6 + j6 | 0; + x7 = x7 + j7 | 0; + x8 = x8 + j8 | 0; + x9 = x9 + j9 | 0; + x10 = x10 + j10 | 0; + x11 = x11 + j11 | 0; + x12 = x12 + j12 | 0; + x13 = x13 + j13 | 0; + x14 = x14 + j14 | 0; + x15 = x15 + j15 | 0; + + o[ 0] = x0 >>> 0 & 0xff; + o[ 1] = x0 >>> 8 & 0xff; + o[ 2] = x0 >>> 16 & 0xff; + o[ 3] = x0 >>> 24 & 0xff; + + o[ 4] = x1 >>> 0 & 0xff; + o[ 5] = x1 >>> 8 & 0xff; + o[ 6] = x1 >>> 16 & 0xff; + o[ 7] = x1 >>> 24 & 0xff; + + o[ 8] = x2 >>> 0 & 0xff; + o[ 9] = x2 >>> 8 & 0xff; + o[10] = x2 >>> 16 & 0xff; + o[11] = x2 >>> 24 & 0xff; + + o[12] = x3 >>> 0 & 0xff; + o[13] = x3 >>> 8 & 0xff; + o[14] = x3 >>> 16 & 0xff; + o[15] = x3 >>> 24 & 0xff; + + o[16] = x4 >>> 0 & 0xff; + o[17] = x4 >>> 8 & 0xff; + o[18] = x4 >>> 16 & 0xff; + o[19] = x4 >>> 24 & 0xff; + + o[20] = x5 >>> 0 & 0xff; + o[21] = x5 >>> 8 & 0xff; + o[22] = x5 >>> 16 & 0xff; + o[23] = x5 >>> 24 & 0xff; + + o[24] = x6 >>> 0 & 0xff; + o[25] = x6 >>> 8 & 0xff; + o[26] = x6 >>> 16 & 0xff; + o[27] = x6 >>> 24 & 0xff; + + o[28] = x7 >>> 0 & 0xff; + o[29] = x7 >>> 8 & 0xff; + o[30] = x7 >>> 16 & 0xff; + o[31] = x7 >>> 24 & 0xff; + + o[32] = x8 >>> 0 & 0xff; + o[33] = x8 >>> 8 & 0xff; + o[34] = x8 >>> 16 & 0xff; + o[35] = x8 >>> 24 & 0xff; + + o[36] = x9 >>> 0 & 0xff; + o[37] = x9 >>> 8 & 0xff; + o[38] = x9 >>> 16 & 0xff; + o[39] = x9 >>> 24 & 0xff; + + o[40] = x10 >>> 0 & 0xff; + o[41] = x10 >>> 8 & 0xff; + o[42] = x10 >>> 16 & 0xff; + o[43] = x10 >>> 24 & 0xff; + + o[44] = x11 >>> 0 & 0xff; + o[45] = x11 >>> 8 & 0xff; + o[46] = x11 >>> 16 & 0xff; + o[47] = x11 >>> 24 & 0xff; + + o[48] = x12 >>> 0 & 0xff; + o[49] = x12 >>> 8 & 0xff; + o[50] = x12 >>> 16 & 0xff; + o[51] = x12 >>> 24 & 0xff; + + o[52] = x13 >>> 0 & 0xff; + o[53] = x13 >>> 8 & 0xff; + o[54] = x13 >>> 16 & 0xff; + o[55] = x13 >>> 24 & 0xff; + + o[56] = x14 >>> 0 & 0xff; + o[57] = x14 >>> 8 & 0xff; + o[58] = x14 >>> 16 & 0xff; + o[59] = x14 >>> 24 & 0xff; + + o[60] = x15 >>> 0 & 0xff; + o[61] = x15 >>> 8 & 0xff; + o[62] = x15 >>> 16 & 0xff; + o[63] = x15 >>> 24 & 0xff; +} + +function core_hsalsa20(o,p,k,c) { + var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, + j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, + j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, + j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, + j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, + j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, + j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, + j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, + j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, + j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, + j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, + j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, + j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, + j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, + j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, + j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; + + var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, + x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, + x15 = j15, u; + + for (var i = 0; i < 20; i += 2) { + u = x0 + x12 | 0; + x4 ^= u<<7 | u>>>(32-7); + u = x4 + x0 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x4 | 0; + x12 ^= u<<13 | u>>>(32-13); + u = x12 + x8 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x1 | 0; + x9 ^= u<<7 | u>>>(32-7); + u = x9 + x5 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x9 | 0; + x1 ^= u<<13 | u>>>(32-13); + u = x1 + x13 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x6 | 0; + x14 ^= u<<7 | u>>>(32-7); + u = x14 + x10 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x14 | 0; + x6 ^= u<<13 | u>>>(32-13); + u = x6 + x2 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x11 | 0; + x3 ^= u<<7 | u>>>(32-7); + u = x3 + x15 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x3 | 0; + x11 ^= u<<13 | u>>>(32-13); + u = x11 + x7 | 0; + x15 ^= u<<18 | u>>>(32-18); + + u = x0 + x3 | 0; + x1 ^= u<<7 | u>>>(32-7); + u = x1 + x0 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x1 | 0; + x3 ^= u<<13 | u>>>(32-13); + u = x3 + x2 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x4 | 0; + x6 ^= u<<7 | u>>>(32-7); + u = x6 + x5 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x6 | 0; + x4 ^= u<<13 | u>>>(32-13); + u = x4 + x7 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x9 | 0; + x11 ^= u<<7 | u>>>(32-7); + u = x11 + x10 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x11 | 0; + x9 ^= u<<13 | u>>>(32-13); + u = x9 + x8 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x14 | 0; + x12 ^= u<<7 | u>>>(32-7); + u = x12 + x15 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x12 | 0; + x14 ^= u<<13 | u>>>(32-13); + u = x14 + x13 | 0; + x15 ^= u<<18 | u>>>(32-18); + } + + o[ 0] = x0 >>> 0 & 0xff; + o[ 1] = x0 >>> 8 & 0xff; + o[ 2] = x0 >>> 16 & 0xff; + o[ 3] = x0 >>> 24 & 0xff; + + o[ 4] = x5 >>> 0 & 0xff; + o[ 5] = x5 >>> 8 & 0xff; + o[ 6] = x5 >>> 16 & 0xff; + o[ 7] = x5 >>> 24 & 0xff; + + o[ 8] = x10 >>> 0 & 0xff; + o[ 9] = x10 >>> 8 & 0xff; + o[10] = x10 >>> 16 & 0xff; + o[11] = x10 >>> 24 & 0xff; + + o[12] = x15 >>> 0 & 0xff; + o[13] = x15 >>> 8 & 0xff; + o[14] = x15 >>> 16 & 0xff; + o[15] = x15 >>> 24 & 0xff; + + o[16] = x6 >>> 0 & 0xff; + o[17] = x6 >>> 8 & 0xff; + o[18] = x6 >>> 16 & 0xff; + o[19] = x6 >>> 24 & 0xff; + + o[20] = x7 >>> 0 & 0xff; + o[21] = x7 >>> 8 & 0xff; + o[22] = x7 >>> 16 & 0xff; + o[23] = x7 >>> 24 & 0xff; + + o[24] = x8 >>> 0 & 0xff; + o[25] = x8 >>> 8 & 0xff; + o[26] = x8 >>> 16 & 0xff; + o[27] = x8 >>> 24 & 0xff; + + o[28] = x9 >>> 0 & 0xff; + o[29] = x9 >>> 8 & 0xff; + o[30] = x9 >>> 16 & 0xff; + o[31] = x9 >>> 24 & 0xff; +} + +function crypto_core_salsa20(out,inp,k,c) { + core_salsa20(out,inp,k,c); +} + +function crypto_core_hsalsa20(out,inp,k,c) { + core_hsalsa20(out,inp,k,c); +} + +var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); + // "expand 32-byte k" + +function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { + var z = new Uint8Array(16), x = new Uint8Array(64); + var u, i; + for (i = 0; i < 16; i++) z[i] = 0; + for (i = 0; i < 8; i++) z[i] = n[i]; + while (b >= 64) { + crypto_core_salsa20(x,z,k,sigma); + for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; + u = 1; + for (i = 8; i < 16; i++) { + u = u + (z[i] & 0xff) | 0; + z[i] = u & 0xff; + u >>>= 8; + } + b -= 64; + cpos += 64; + mpos += 64; + } + if (b > 0) { + crypto_core_salsa20(x,z,k,sigma); + for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; + } + return 0; +} + +function crypto_stream_salsa20(c,cpos,b,n,k) { + var z = new Uint8Array(16), x = new Uint8Array(64); + var u, i; + for (i = 0; i < 16; i++) z[i] = 0; + for (i = 0; i < 8; i++) z[i] = n[i]; + while (b >= 64) { + crypto_core_salsa20(x,z,k,sigma); + for (i = 0; i < 64; i++) c[cpos+i] = x[i]; + u = 1; + for (i = 8; i < 16; i++) { + u = u + (z[i] & 0xff) | 0; + z[i] = u & 0xff; + u >>>= 8; + } + b -= 64; + cpos += 64; + } + if (b > 0) { + crypto_core_salsa20(x,z,k,sigma); + for (i = 0; i < b; i++) c[cpos+i] = x[i]; + } + return 0; +} + +function crypto_stream(c,cpos,d,n,k) { + var s = new Uint8Array(32); + crypto_core_hsalsa20(s,n,k,sigma); + var sn = new Uint8Array(8); + for (var i = 0; i < 8; i++) sn[i] = n[i+16]; + return crypto_stream_salsa20(c,cpos,d,sn,s); +} + +function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { + var s = new Uint8Array(32); + crypto_core_hsalsa20(s,n,k,sigma); + var sn = new Uint8Array(8); + for (var i = 0; i < 8; i++) sn[i] = n[i+16]; + return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); +} + +/* +* Port of Andrew Moon's Poly1305-donna-16. Public domain. +* https://github.com/floodyberry/poly1305-donna +*/ + +var poly1305 = function(key) { + this.buffer = new Uint8Array(16); + this.r = new Uint16Array(10); + this.h = new Uint16Array(10); + this.pad = new Uint16Array(8); + this.leftover = 0; + this.fin = 0; + + var t0, t1, t2, t3, t4, t5, t6, t7; + + t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; + t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; + t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; + t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; + t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; + this.r[5] = ((t4 >>> 1)) & 0x1ffe; + t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; + t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; + t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; + this.r[9] = ((t7 >>> 5)) & 0x007f; + + this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; + this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; + this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; + this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; + this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; + this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; + this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; + this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; +}; + +poly1305.prototype.blocks = function(m, mpos, bytes) { + var hibit = this.fin ? 0 : (1 << 11); + var t0, t1, t2, t3, t4, t5, t6, t7, c; + var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; + + var h0 = this.h[0], + h1 = this.h[1], + h2 = this.h[2], + h3 = this.h[3], + h4 = this.h[4], + h5 = this.h[5], + h6 = this.h[6], + h7 = this.h[7], + h8 = this.h[8], + h9 = this.h[9]; + + var r0 = this.r[0], + r1 = this.r[1], + r2 = this.r[2], + r3 = this.r[3], + r4 = this.r[4], + r5 = this.r[5], + r6 = this.r[6], + r7 = this.r[7], + r8 = this.r[8], + r9 = this.r[9]; + + while (bytes >= 16) { + t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; + t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; + t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; + t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; + t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; + h5 += ((t4 >>> 1)) & 0x1fff; + t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; + t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; + t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; + h9 += ((t7 >>> 5)) | hibit; + + c = 0; + + d0 = c; + d0 += h0 * r0; + d0 += h1 * (5 * r9); + d0 += h2 * (5 * r8); + d0 += h3 * (5 * r7); + d0 += h4 * (5 * r6); + c = (d0 >>> 13); d0 &= 0x1fff; + d0 += h5 * (5 * r5); + d0 += h6 * (5 * r4); + d0 += h7 * (5 * r3); + d0 += h8 * (5 * r2); + d0 += h9 * (5 * r1); + c += (d0 >>> 13); d0 &= 0x1fff; + + d1 = c; + d1 += h0 * r1; + d1 += h1 * r0; + d1 += h2 * (5 * r9); + d1 += h3 * (5 * r8); + d1 += h4 * (5 * r7); + c = (d1 >>> 13); d1 &= 0x1fff; + d1 += h5 * (5 * r6); + d1 += h6 * (5 * r5); + d1 += h7 * (5 * r4); + d1 += h8 * (5 * r3); + d1 += h9 * (5 * r2); + c += (d1 >>> 13); d1 &= 0x1fff; + + d2 = c; + d2 += h0 * r2; + d2 += h1 * r1; + d2 += h2 * r0; + d2 += h3 * (5 * r9); + d2 += h4 * (5 * r8); + c = (d2 >>> 13); d2 &= 0x1fff; + d2 += h5 * (5 * r7); + d2 += h6 * (5 * r6); + d2 += h7 * (5 * r5); + d2 += h8 * (5 * r4); + d2 += h9 * (5 * r3); + c += (d2 >>> 13); d2 &= 0x1fff; + + d3 = c; + d3 += h0 * r3; + d3 += h1 * r2; + d3 += h2 * r1; + d3 += h3 * r0; + d3 += h4 * (5 * r9); + c = (d3 >>> 13); d3 &= 0x1fff; + d3 += h5 * (5 * r8); + d3 += h6 * (5 * r7); + d3 += h7 * (5 * r6); + d3 += h8 * (5 * r5); + d3 += h9 * (5 * r4); + c += (d3 >>> 13); d3 &= 0x1fff; + + d4 = c; + d4 += h0 * r4; + d4 += h1 * r3; + d4 += h2 * r2; + d4 += h3 * r1; + d4 += h4 * r0; + c = (d4 >>> 13); d4 &= 0x1fff; + d4 += h5 * (5 * r9); + d4 += h6 * (5 * r8); + d4 += h7 * (5 * r7); + d4 += h8 * (5 * r6); + d4 += h9 * (5 * r5); + c += (d4 >>> 13); d4 &= 0x1fff; + + d5 = c; + d5 += h0 * r5; + d5 += h1 * r4; + d5 += h2 * r3; + d5 += h3 * r2; + d5 += h4 * r1; + c = (d5 >>> 13); d5 &= 0x1fff; + d5 += h5 * r0; + d5 += h6 * (5 * r9); + d5 += h7 * (5 * r8); + d5 += h8 * (5 * r7); + d5 += h9 * (5 * r6); + c += (d5 >>> 13); d5 &= 0x1fff; + + d6 = c; + d6 += h0 * r6; + d6 += h1 * r5; + d6 += h2 * r4; + d6 += h3 * r3; + d6 += h4 * r2; + c = (d6 >>> 13); d6 &= 0x1fff; + d6 += h5 * r1; + d6 += h6 * r0; + d6 += h7 * (5 * r9); + d6 += h8 * (5 * r8); + d6 += h9 * (5 * r7); + c += (d6 >>> 13); d6 &= 0x1fff; + + d7 = c; + d7 += h0 * r7; + d7 += h1 * r6; + d7 += h2 * r5; + d7 += h3 * r4; + d7 += h4 * r3; + c = (d7 >>> 13); d7 &= 0x1fff; + d7 += h5 * r2; + d7 += h6 * r1; + d7 += h7 * r0; + d7 += h8 * (5 * r9); + d7 += h9 * (5 * r8); + c += (d7 >>> 13); d7 &= 0x1fff; + + d8 = c; + d8 += h0 * r8; + d8 += h1 * r7; + d8 += h2 * r6; + d8 += h3 * r5; + d8 += h4 * r4; + c = (d8 >>> 13); d8 &= 0x1fff; + d8 += h5 * r3; + d8 += h6 * r2; + d8 += h7 * r1; + d8 += h8 * r0; + d8 += h9 * (5 * r9); + c += (d8 >>> 13); d8 &= 0x1fff; + + d9 = c; + d9 += h0 * r9; + d9 += h1 * r8; + d9 += h2 * r7; + d9 += h3 * r6; + d9 += h4 * r5; + c = (d9 >>> 13); d9 &= 0x1fff; + d9 += h5 * r4; + d9 += h6 * r3; + d9 += h7 * r2; + d9 += h8 * r1; + d9 += h9 * r0; + c += (d9 >>> 13); d9 &= 0x1fff; + + c = (((c << 2) + c)) | 0; + c = (c + d0) | 0; + d0 = c & 0x1fff; + c = (c >>> 13); + d1 += c; + + h0 = d0; + h1 = d1; + h2 = d2; + h3 = d3; + h4 = d4; + h5 = d5; + h6 = d6; + h7 = d7; + h8 = d8; + h9 = d9; + + mpos += 16; + bytes -= 16; + } + this.h[0] = h0; + this.h[1] = h1; + this.h[2] = h2; + this.h[3] = h3; + this.h[4] = h4; + this.h[5] = h5; + this.h[6] = h6; + this.h[7] = h7; + this.h[8] = h8; + this.h[9] = h9; +}; + +poly1305.prototype.finish = function(mac, macpos) { + var g = new Uint16Array(10); + var c, mask, f, i; + + if (this.leftover) { + i = this.leftover; + this.buffer[i++] = 1; + for (; i < 16; i++) this.buffer[i] = 0; + this.fin = 1; + this.blocks(this.buffer, 0, 16); + } + + c = this.h[1] >>> 13; + this.h[1] &= 0x1fff; + for (i = 2; i < 10; i++) { + this.h[i] += c; + c = this.h[i] >>> 13; + this.h[i] &= 0x1fff; + } + this.h[0] += (c * 5); + c = this.h[0] >>> 13; + this.h[0] &= 0x1fff; + this.h[1] += c; + c = this.h[1] >>> 13; + this.h[1] &= 0x1fff; + this.h[2] += c; + + g[0] = this.h[0] + 5; + c = g[0] >>> 13; + g[0] &= 0x1fff; + for (i = 1; i < 10; i++) { + g[i] = this.h[i] + c; + c = g[i] >>> 13; + g[i] &= 0x1fff; + } + g[9] -= (1 << 13); + + mask = (c ^ 1) - 1; + for (i = 0; i < 10; i++) g[i] &= mask; + mask = ~mask; + for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; + + this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; + this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; + this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; + this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; + this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; + this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; + this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; + this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; + + f = this.h[0] + this.pad[0]; + this.h[0] = f & 0xffff; + for (i = 1; i < 8; i++) { + f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; + this.h[i] = f & 0xffff; + } + + mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; + mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; + mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; + mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; + mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; + mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; + mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; + mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; + mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; + mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; + mac[macpos+10] = (this.h[5] >>> 0) & 0xff; + mac[macpos+11] = (this.h[5] >>> 8) & 0xff; + mac[macpos+12] = (this.h[6] >>> 0) & 0xff; + mac[macpos+13] = (this.h[6] >>> 8) & 0xff; + mac[macpos+14] = (this.h[7] >>> 0) & 0xff; + mac[macpos+15] = (this.h[7] >>> 8) & 0xff; +}; + +poly1305.prototype.update = function(m, mpos, bytes) { + var i, want; + + if (this.leftover) { + want = (16 - this.leftover); + if (want > bytes) + want = bytes; + for (i = 0; i < want; i++) + this.buffer[this.leftover + i] = m[mpos+i]; + bytes -= want; + mpos += want; + this.leftover += want; + if (this.leftover < 16) + return; + this.blocks(this.buffer, 0, 16); + this.leftover = 0; + } + + if (bytes >= 16) { + want = bytes - (bytes % 16); + this.blocks(m, mpos, want); + mpos += want; + bytes -= want; + } + + if (bytes) { + for (i = 0; i < bytes; i++) + this.buffer[this.leftover + i] = m[mpos+i]; + this.leftover += bytes; + } +}; + +function crypto_onetimeauth(out, outpos, m, mpos, n, k) { + var s = new poly1305(k); + s.update(m, mpos, n); + s.finish(out, outpos); + return 0; +} + +function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { + var x = new Uint8Array(16); + crypto_onetimeauth(x,0,m,mpos,n,k); + return crypto_verify_16(h,hpos,x,0); +} + +function crypto_secretbox(c,m,d,n,k) { + var i; + if (d < 32) return -1; + crypto_stream_xor(c,0,m,0,d,n,k); + crypto_onetimeauth(c, 16, c, 32, d - 32, c); + for (i = 0; i < 16; i++) c[i] = 0; + return 0; +} + +function crypto_secretbox_open(m,c,d,n,k) { + var i; + var x = new Uint8Array(32); + if (d < 32) return -1; + crypto_stream(x,0,32,n,k); + if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; + crypto_stream_xor(m,0,c,0,d,n,k); + for (i = 0; i < 32; i++) m[i] = 0; + return 0; +} + +function set25519(r, a) { + var i; + for (i = 0; i < 16; i++) r[i] = a[i]|0; +} + +function car25519(o) { + var i, v, c = 1; + for (i = 0; i < 16; i++) { + v = o[i] + c + 65535; + c = Math.floor(v / 65536); + o[i] = v - c * 65536; + } + o[0] += c-1 + 37 * (c-1); +} + +function sel25519(p, q, b) { + var t, c = ~(b-1); + for (var i = 0; i < 16; i++) { + t = c & (p[i] ^ q[i]); + p[i] ^= t; + q[i] ^= t; + } +} + +function pack25519(o, n) { + var i, j, b; + var m = gf(), t = gf(); + for (i = 0; i < 16; i++) t[i] = n[i]; + car25519(t); + car25519(t); + car25519(t); + for (j = 0; j < 2; j++) { + m[0] = t[0] - 0xffed; + for (i = 1; i < 15; i++) { + m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); + m[i-1] &= 0xffff; + } + m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); + b = (m[15]>>16) & 1; + m[14] &= 0xffff; + sel25519(t, m, 1-b); + } + for (i = 0; i < 16; i++) { + o[2*i] = t[i] & 0xff; + o[2*i+1] = t[i]>>8; + } +} + +function neq25519(a, b) { + var c = new Uint8Array(32), d = new Uint8Array(32); + pack25519(c, a); + pack25519(d, b); + return crypto_verify_32(c, 0, d, 0); +} + +function par25519(a) { + var d = new Uint8Array(32); + pack25519(d, a); + return d[0] & 1; +} + +function unpack25519(o, n) { + var i; + for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); + o[15] &= 0x7fff; +} + +function A(o, a, b) { + for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; +} + +function Z(o, a, b) { + for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; +} + +function M(o, a, b) { + var v, c, + t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, + t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, + t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, + t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, + b0 = b[0], + b1 = b[1], + b2 = b[2], + b3 = b[3], + b4 = b[4], + b5 = b[5], + b6 = b[6], + b7 = b[7], + b8 = b[8], + b9 = b[9], + b10 = b[10], + b11 = b[11], + b12 = b[12], + b13 = b[13], + b14 = b[14], + b15 = b[15]; + + v = a[0]; + t0 += v * b0; + t1 += v * b1; + t2 += v * b2; + t3 += v * b3; + t4 += v * b4; + t5 += v * b5; + t6 += v * b6; + t7 += v * b7; + t8 += v * b8; + t9 += v * b9; + t10 += v * b10; + t11 += v * b11; + t12 += v * b12; + t13 += v * b13; + t14 += v * b14; + t15 += v * b15; + v = a[1]; + t1 += v * b0; + t2 += v * b1; + t3 += v * b2; + t4 += v * b3; + t5 += v * b4; + t6 += v * b5; + t7 += v * b6; + t8 += v * b7; + t9 += v * b8; + t10 += v * b9; + t11 += v * b10; + t12 += v * b11; + t13 += v * b12; + t14 += v * b13; + t15 += v * b14; + t16 += v * b15; + v = a[2]; + t2 += v * b0; + t3 += v * b1; + t4 += v * b2; + t5 += v * b3; + t6 += v * b4; + t7 += v * b5; + t8 += v * b6; + t9 += v * b7; + t10 += v * b8; + t11 += v * b9; + t12 += v * b10; + t13 += v * b11; + t14 += v * b12; + t15 += v * b13; + t16 += v * b14; + t17 += v * b15; + v = a[3]; + t3 += v * b0; + t4 += v * b1; + t5 += v * b2; + t6 += v * b3; + t7 += v * b4; + t8 += v * b5; + t9 += v * b6; + t10 += v * b7; + t11 += v * b8; + t12 += v * b9; + t13 += v * b10; + t14 += v * b11; + t15 += v * b12; + t16 += v * b13; + t17 += v * b14; + t18 += v * b15; + v = a[4]; + t4 += v * b0; + t5 += v * b1; + t6 += v * b2; + t7 += v * b3; + t8 += v * b4; + t9 += v * b5; + t10 += v * b6; + t11 += v * b7; + t12 += v * b8; + t13 += v * b9; + t14 += v * b10; + t15 += v * b11; + t16 += v * b12; + t17 += v * b13; + t18 += v * b14; + t19 += v * b15; + v = a[5]; + t5 += v * b0; + t6 += v * b1; + t7 += v * b2; + t8 += v * b3; + t9 += v * b4; + t10 += v * b5; + t11 += v * b6; + t12 += v * b7; + t13 += v * b8; + t14 += v * b9; + t15 += v * b10; + t16 += v * b11; + t17 += v * b12; + t18 += v * b13; + t19 += v * b14; + t20 += v * b15; + v = a[6]; + t6 += v * b0; + t7 += v * b1; + t8 += v * b2; + t9 += v * b3; + t10 += v * b4; + t11 += v * b5; + t12 += v * b6; + t13 += v * b7; + t14 += v * b8; + t15 += v * b9; + t16 += v * b10; + t17 += v * b11; + t18 += v * b12; + t19 += v * b13; + t20 += v * b14; + t21 += v * b15; + v = a[7]; + t7 += v * b0; + t8 += v * b1; + t9 += v * b2; + t10 += v * b3; + t11 += v * b4; + t12 += v * b5; + t13 += v * b6; + t14 += v * b7; + t15 += v * b8; + t16 += v * b9; + t17 += v * b10; + t18 += v * b11; + t19 += v * b12; + t20 += v * b13; + t21 += v * b14; + t22 += v * b15; + v = a[8]; + t8 += v * b0; + t9 += v * b1; + t10 += v * b2; + t11 += v * b3; + t12 += v * b4; + t13 += v * b5; + t14 += v * b6; + t15 += v * b7; + t16 += v * b8; + t17 += v * b9; + t18 += v * b10; + t19 += v * b11; + t20 += v * b12; + t21 += v * b13; + t22 += v * b14; + t23 += v * b15; + v = a[9]; + t9 += v * b0; + t10 += v * b1; + t11 += v * b2; + t12 += v * b3; + t13 += v * b4; + t14 += v * b5; + t15 += v * b6; + t16 += v * b7; + t17 += v * b8; + t18 += v * b9; + t19 += v * b10; + t20 += v * b11; + t21 += v * b12; + t22 += v * b13; + t23 += v * b14; + t24 += v * b15; + v = a[10]; + t10 += v * b0; + t11 += v * b1; + t12 += v * b2; + t13 += v * b3; + t14 += v * b4; + t15 += v * b5; + t16 += v * b6; + t17 += v * b7; + t18 += v * b8; + t19 += v * b9; + t20 += v * b10; + t21 += v * b11; + t22 += v * b12; + t23 += v * b13; + t24 += v * b14; + t25 += v * b15; + v = a[11]; + t11 += v * b0; + t12 += v * b1; + t13 += v * b2; + t14 += v * b3; + t15 += v * b4; + t16 += v * b5; + t17 += v * b6; + t18 += v * b7; + t19 += v * b8; + t20 += v * b9; + t21 += v * b10; + t22 += v * b11; + t23 += v * b12; + t24 += v * b13; + t25 += v * b14; + t26 += v * b15; + v = a[12]; + t12 += v * b0; + t13 += v * b1; + t14 += v * b2; + t15 += v * b3; + t16 += v * b4; + t17 += v * b5; + t18 += v * b6; + t19 += v * b7; + t20 += v * b8; + t21 += v * b9; + t22 += v * b10; + t23 += v * b11; + t24 += v * b12; + t25 += v * b13; + t26 += v * b14; + t27 += v * b15; + v = a[13]; + t13 += v * b0; + t14 += v * b1; + t15 += v * b2; + t16 += v * b3; + t17 += v * b4; + t18 += v * b5; + t19 += v * b6; + t20 += v * b7; + t21 += v * b8; + t22 += v * b9; + t23 += v * b10; + t24 += v * b11; + t25 += v * b12; + t26 += v * b13; + t27 += v * b14; + t28 += v * b15; + v = a[14]; + t14 += v * b0; + t15 += v * b1; + t16 += v * b2; + t17 += v * b3; + t18 += v * b4; + t19 += v * b5; + t20 += v * b6; + t21 += v * b7; + t22 += v * b8; + t23 += v * b9; + t24 += v * b10; + t25 += v * b11; + t26 += v * b12; + t27 += v * b13; + t28 += v * b14; + t29 += v * b15; + v = a[15]; + t15 += v * b0; + t16 += v * b1; + t17 += v * b2; + t18 += v * b3; + t19 += v * b4; + t20 += v * b5; + t21 += v * b6; + t22 += v * b7; + t23 += v * b8; + t24 += v * b9; + t25 += v * b10; + t26 += v * b11; + t27 += v * b12; + t28 += v * b13; + t29 += v * b14; + t30 += v * b15; + + t0 += 38 * t16; + t1 += 38 * t17; + t2 += 38 * t18; + t3 += 38 * t19; + t4 += 38 * t20; + t5 += 38 * t21; + t6 += 38 * t22; + t7 += 38 * t23; + t8 += 38 * t24; + t9 += 38 * t25; + t10 += 38 * t26; + t11 += 38 * t27; + t12 += 38 * t28; + t13 += 38 * t29; + t14 += 38 * t30; + // t15 left as is + + // first car + c = 1; + v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; + v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; + v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; + v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; + v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; + v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; + v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; + v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; + v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; + v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; + v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; + v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; + v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; + v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; + v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; + v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; + t0 += c-1 + 37 * (c-1); + + // second car + c = 1; + v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; + v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; + v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; + v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; + v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; + v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; + v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; + v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; + v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; + v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; + v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; + v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; + v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; + v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; + v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; + v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; + t0 += c-1 + 37 * (c-1); + + o[ 0] = t0; + o[ 1] = t1; + o[ 2] = t2; + o[ 3] = t3; + o[ 4] = t4; + o[ 5] = t5; + o[ 6] = t6; + o[ 7] = t7; + o[ 8] = t8; + o[ 9] = t9; + o[10] = t10; + o[11] = t11; + o[12] = t12; + o[13] = t13; + o[14] = t14; + o[15] = t15; +} + +function S(o, a) { + M(o, a, a); +} + +function inv25519(o, i) { + var c = gf(); + var a; + for (a = 0; a < 16; a++) c[a] = i[a]; + for (a = 253; a >= 0; a--) { + S(c, c); + if(a !== 2 && a !== 4) M(c, c, i); + } + for (a = 0; a < 16; a++) o[a] = c[a]; +} + +function pow2523(o, i) { + var c = gf(); + var a; + for (a = 0; a < 16; a++) c[a] = i[a]; + for (a = 250; a >= 0; a--) { + S(c, c); + if(a !== 1) M(c, c, i); + } + for (a = 0; a < 16; a++) o[a] = c[a]; +} + +function crypto_scalarmult(q, n, p) { + var z = new Uint8Array(32); + var x = new Float64Array(80), r, i; + var a = gf(), b = gf(), c = gf(), + d = gf(), e = gf(), f = gf(); + for (i = 0; i < 31; i++) z[i] = n[i]; + z[31]=(n[31]&127)|64; + z[0]&=248; + unpack25519(x,p); + for (i = 0; i < 16; i++) { + b[i]=x[i]; + d[i]=a[i]=c[i]=0; + } + a[0]=d[0]=1; + for (i=254; i>=0; --i) { + r=(z[i>>>3]>>>(i&7))&1; + sel25519(a,b,r); + sel25519(c,d,r); + A(e,a,c); + Z(a,a,c); + A(c,b,d); + Z(b,b,d); + S(d,e); + S(f,a); + M(a,c,a); + M(c,b,e); + A(e,a,c); + Z(a,a,c); + S(b,a); + Z(c,d,f); + M(a,c,_121665); + A(a,a,d); + M(c,c,a); + M(a,d,f); + M(d,b,x); + S(b,e); + sel25519(a,b,r); + sel25519(c,d,r); + } + for (i = 0; i < 16; i++) { + x[i+16]=a[i]; + x[i+32]=c[i]; + x[i+48]=b[i]; + x[i+64]=d[i]; + } + var x32 = x.subarray(32); + var x16 = x.subarray(16); + inv25519(x32,x32); + M(x16,x16,x32); + pack25519(q,x16); + return 0; +} + +function crypto_scalarmult_base(q, n) { + return crypto_scalarmult(q, n, _9); +} + +function crypto_box_keypair(y, x) { + randombytes(x, 32); + return crypto_scalarmult_base(y, x); +} + +function crypto_box_beforenm(k, y, x) { + var s = new Uint8Array(32); + crypto_scalarmult(s, x, y); + return crypto_core_hsalsa20(k, _0, s, sigma); +} + +var crypto_box_afternm = crypto_secretbox; +var crypto_box_open_afternm = crypto_secretbox_open; + +function crypto_box(c, m, d, n, y, x) { + var k = new Uint8Array(32); + crypto_box_beforenm(k, y, x); + return crypto_box_afternm(c, m, d, n, k); +} + +function crypto_box_open(m, c, d, n, y, x) { + var k = new Uint8Array(32); + crypto_box_beforenm(k, y, x); + return crypto_box_open_afternm(m, c, d, n, k); +} + +var K = [ + 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, + 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, + 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, + 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, + 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, + 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, + 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, + 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, + 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, + 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, + 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, + 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, + 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, + 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, + 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, + 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, + 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, + 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, + 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, + 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, + 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, + 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, + 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, + 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, + 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, + 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, + 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, + 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, + 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, + 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, + 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, + 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, + 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, + 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, + 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, + 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, + 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, + 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, + 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, + 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 +]; + +function crypto_hashblocks_hl(hh, hl, m, n) { + var wh = new Int32Array(16), wl = new Int32Array(16), + bh0, bh1, bh2, bh3, bh4, bh5, bh6, bh7, + bl0, bl1, bl2, bl3, bl4, bl5, bl6, bl7, + th, tl, i, j, h, l, a, b, c, d; + + var ah0 = hh[0], + ah1 = hh[1], + ah2 = hh[2], + ah3 = hh[3], + ah4 = hh[4], + ah5 = hh[5], + ah6 = hh[6], + ah7 = hh[7], + + al0 = hl[0], + al1 = hl[1], + al2 = hl[2], + al3 = hl[3], + al4 = hl[4], + al5 = hl[5], + al6 = hl[6], + al7 = hl[7]; + + var pos = 0; + while (n >= 128) { + for (i = 0; i < 16; i++) { + j = 8 * i + pos; + wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; + wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; + } + for (i = 0; i < 80; i++) { + bh0 = ah0; + bh1 = ah1; + bh2 = ah2; + bh3 = ah3; + bh4 = ah4; + bh5 = ah5; + bh6 = ah6; + bh7 = ah7; + + bl0 = al0; + bl1 = al1; + bl2 = al2; + bl3 = al3; + bl4 = al4; + bl5 = al5; + bl6 = al6; + bl7 = al7; + + // add + h = ah7; + l = al7; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + // Sigma1 + h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); + l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // Ch + h = (ah4 & ah5) ^ (~ah4 & ah6); + l = (al4 & al5) ^ (~al4 & al6); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // K + h = K[i*2]; + l = K[i*2+1]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // w + h = wh[i%16]; + l = wl[i%16]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + th = c & 0xffff | d << 16; + tl = a & 0xffff | b << 16; + + // add + h = th; + l = tl; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + // Sigma0 + h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); + l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // Maj + h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); + l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + bh7 = (c & 0xffff) | (d << 16); + bl7 = (a & 0xffff) | (b << 16); + + // add + h = bh3; + l = bl3; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = th; + l = tl; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + bh3 = (c & 0xffff) | (d << 16); + bl3 = (a & 0xffff) | (b << 16); + + ah1 = bh0; + ah2 = bh1; + ah3 = bh2; + ah4 = bh3; + ah5 = bh4; + ah6 = bh5; + ah7 = bh6; + ah0 = bh7; + + al1 = bl0; + al2 = bl1; + al3 = bl2; + al4 = bl3; + al5 = bl4; + al6 = bl5; + al7 = bl6; + al0 = bl7; + + if (i%16 === 15) { + for (j = 0; j < 16; j++) { + // add + h = wh[j]; + l = wl[j]; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = wh[(j+9)%16]; + l = wl[(j+9)%16]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // sigma0 + th = wh[(j+1)%16]; + tl = wl[(j+1)%16]; + h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); + l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + // sigma1 + th = wh[(j+14)%16]; + tl = wl[(j+14)%16]; + h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); + l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + wh[j] = (c & 0xffff) | (d << 16); + wl[j] = (a & 0xffff) | (b << 16); + } + } + } + + // add + h = ah0; + l = al0; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[0]; + l = hl[0]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[0] = ah0 = (c & 0xffff) | (d << 16); + hl[0] = al0 = (a & 0xffff) | (b << 16); + + h = ah1; + l = al1; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[1]; + l = hl[1]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[1] = ah1 = (c & 0xffff) | (d << 16); + hl[1] = al1 = (a & 0xffff) | (b << 16); + + h = ah2; + l = al2; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[2]; + l = hl[2]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[2] = ah2 = (c & 0xffff) | (d << 16); + hl[2] = al2 = (a & 0xffff) | (b << 16); + + h = ah3; + l = al3; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[3]; + l = hl[3]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[3] = ah3 = (c & 0xffff) | (d << 16); + hl[3] = al3 = (a & 0xffff) | (b << 16); + + h = ah4; + l = al4; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[4]; + l = hl[4]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[4] = ah4 = (c & 0xffff) | (d << 16); + hl[4] = al4 = (a & 0xffff) | (b << 16); + + h = ah5; + l = al5; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[5]; + l = hl[5]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[5] = ah5 = (c & 0xffff) | (d << 16); + hl[5] = al5 = (a & 0xffff) | (b << 16); + + h = ah6; + l = al6; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[6]; + l = hl[6]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[6] = ah6 = (c & 0xffff) | (d << 16); + hl[6] = al6 = (a & 0xffff) | (b << 16); + + h = ah7; + l = al7; + + a = l & 0xffff; b = l >>> 16; + c = h & 0xffff; d = h >>> 16; + + h = hh[7]; + l = hl[7]; + + a += l & 0xffff; b += l >>> 16; + c += h & 0xffff; d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[7] = ah7 = (c & 0xffff) | (d << 16); + hl[7] = al7 = (a & 0xffff) | (b << 16); + + pos += 128; + n -= 128; + } + + return n; +} + +function crypto_hash(out, m, n) { + var hh = new Int32Array(8), + hl = new Int32Array(8), + x = new Uint8Array(256), + i, b = n; + + hh[0] = 0x6a09e667; + hh[1] = 0xbb67ae85; + hh[2] = 0x3c6ef372; + hh[3] = 0xa54ff53a; + hh[4] = 0x510e527f; + hh[5] = 0x9b05688c; + hh[6] = 0x1f83d9ab; + hh[7] = 0x5be0cd19; + + hl[0] = 0xf3bcc908; + hl[1] = 0x84caa73b; + hl[2] = 0xfe94f82b; + hl[3] = 0x5f1d36f1; + hl[4] = 0xade682d1; + hl[5] = 0x2b3e6c1f; + hl[6] = 0xfb41bd6b; + hl[7] = 0x137e2179; + + crypto_hashblocks_hl(hh, hl, m, n); + n %= 128; + + for (i = 0; i < n; i++) x[i] = m[b-n+i]; + x[n] = 128; + + n = 256-128*(n<112?1:0); + x[n-9] = 0; + ts64(x, n-8, (b / 0x20000000) | 0, b << 3); + crypto_hashblocks_hl(hh, hl, x, n); + + for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); + + return 0; +} + +function add(p, q) { + var a = gf(), b = gf(), c = gf(), + d = gf(), e = gf(), f = gf(), + g = gf(), h = gf(), t = gf(); + + Z(a, p[1], p[0]); + Z(t, q[1], q[0]); + M(a, a, t); + A(b, p[0], p[1]); + A(t, q[0], q[1]); + M(b, b, t); + M(c, p[3], q[3]); + M(c, c, D2); + M(d, p[2], q[2]); + A(d, d, d); + Z(e, b, a); + Z(f, d, c); + A(g, d, c); + A(h, b, a); + + M(p[0], e, f); + M(p[1], h, g); + M(p[2], g, f); + M(p[3], e, h); +} + +function cswap(p, q, b) { + var i; + for (i = 0; i < 4; i++) { + sel25519(p[i], q[i], b); + } +} + +function pack(r, p) { + var tx = gf(), ty = gf(), zi = gf(); + inv25519(zi, p[2]); + M(tx, p[0], zi); + M(ty, p[1], zi); + pack25519(r, ty); + r[31] ^= par25519(tx) << 7; +} + +function scalarmult(p, q, s) { + var b, i; + set25519(p[0], gf0); + set25519(p[1], gf1); + set25519(p[2], gf1); + set25519(p[3], gf0); + for (i = 255; i >= 0; --i) { + b = (s[(i/8)|0] >> (i&7)) & 1; + cswap(p, q, b); + add(q, p); + add(p, p); + cswap(p, q, b); + } +} + +function scalarbase(p, s) { + var q = [gf(), gf(), gf(), gf()]; + set25519(q[0], X); + set25519(q[1], Y); + set25519(q[2], gf1); + M(q[3], X, Y); + scalarmult(p, q, s); +} + +function crypto_sign_keypair(pk, sk, seeded) { + var d = new Uint8Array(64); + var p = [gf(), gf(), gf(), gf()]; + var i; + + if (!seeded) randombytes(sk, 32); + crypto_hash(d, sk, 32); + d[0] &= 248; + d[31] &= 127; + d[31] |= 64; + + scalarbase(p, d); + pack(pk, p); + + for (i = 0; i < 32; i++) sk[i+32] = pk[i]; + return 0; +} + +var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); + +function modL(r, x) { + var carry, i, j, k; + for (i = 63; i >= 32; --i) { + carry = 0; + for (j = i - 32, k = i - 12; j < k; ++j) { + x[j] += carry - 16 * x[i] * L[j - (i - 32)]; + carry = (x[j] + 128) >> 8; + x[j] -= carry * 256; + } + x[j] += carry; + x[i] = 0; + } + carry = 0; + for (j = 0; j < 32; j++) { + x[j] += carry - (x[31] >> 4) * L[j]; + carry = x[j] >> 8; + x[j] &= 255; + } + for (j = 0; j < 32; j++) x[j] -= carry * L[j]; + for (i = 0; i < 32; i++) { + x[i+1] += x[i] >> 8; + r[i] = x[i] & 255; + } +} + +function reduce(r) { + var x = new Float64Array(64), i; + for (i = 0; i < 64; i++) x[i] = r[i]; + for (i = 0; i < 64; i++) r[i] = 0; + modL(r, x); +} + +// Note: difference from C - smlen returned, not passed as argument. +function crypto_sign(sm, m, n, sk) { + var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); + var i, j, x = new Float64Array(64); + var p = [gf(), gf(), gf(), gf()]; + + crypto_hash(d, sk, 32); + d[0] &= 248; + d[31] &= 127; + d[31] |= 64; + + var smlen = n + 64; + for (i = 0; i < n; i++) sm[64 + i] = m[i]; + for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; + + crypto_hash(r, sm.subarray(32), n+32); + reduce(r); + scalarbase(p, r); + pack(sm, p); + + for (i = 32; i < 64; i++) sm[i] = sk[i]; + crypto_hash(h, sm, n + 64); + reduce(h); + + for (i = 0; i < 64; i++) x[i] = 0; + for (i = 0; i < 32; i++) x[i] = r[i]; + for (i = 0; i < 32; i++) { + for (j = 0; j < 32; j++) { + x[i+j] += h[i] * d[j]; + } + } + + modL(sm.subarray(32), x); + return smlen; +} + +function unpackneg(r, p) { + var t = gf(), chk = gf(), num = gf(), + den = gf(), den2 = gf(), den4 = gf(), + den6 = gf(); + + set25519(r[2], gf1); + unpack25519(r[1], p); + S(num, r[1]); + M(den, num, D); + Z(num, num, r[2]); + A(den, r[2], den); + + S(den2, den); + S(den4, den2); + M(den6, den4, den2); + M(t, den6, num); + M(t, t, den); + + pow2523(t, t); + M(t, t, num); + M(t, t, den); + M(t, t, den); + M(r[0], t, den); + + S(chk, r[0]); + M(chk, chk, den); + if (neq25519(chk, num)) M(r[0], r[0], I); + + S(chk, r[0]); + M(chk, chk, den); + if (neq25519(chk, num)) return -1; + + if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); + + M(r[3], r[0], r[1]); + return 0; +} + +function crypto_sign_open(m, sm, n, pk) { + var i, mlen; + var t = new Uint8Array(32), h = new Uint8Array(64); + var p = [gf(), gf(), gf(), gf()], + q = [gf(), gf(), gf(), gf()]; + + mlen = -1; + if (n < 64) return -1; + + if (unpackneg(q, pk)) return -1; + + for (i = 0; i < n; i++) m[i] = sm[i]; + for (i = 0; i < 32; i++) m[i+32] = pk[i]; + crypto_hash(h, m, n); + reduce(h); + scalarmult(p, q, h); + + scalarbase(q, sm.subarray(32)); + add(p, q); + pack(t, p); + + n -= 64; + if (crypto_verify_32(sm, 0, t, 0)) { + for (i = 0; i < n; i++) m[i] = 0; + return -1; + } + + for (i = 0; i < n; i++) m[i] = sm[i + 64]; + mlen = n; + return mlen; +} + +var crypto_secretbox_KEYBYTES = 32, + crypto_secretbox_NONCEBYTES = 24, + crypto_secretbox_ZEROBYTES = 32, + crypto_secretbox_BOXZEROBYTES = 16, + crypto_scalarmult_BYTES = 32, + crypto_scalarmult_SCALARBYTES = 32, + crypto_box_PUBLICKEYBYTES = 32, + crypto_box_SECRETKEYBYTES = 32, + crypto_box_BEFORENMBYTES = 32, + crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, + crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, + crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, + crypto_sign_BYTES = 64, + crypto_sign_PUBLICKEYBYTES = 32, + crypto_sign_SECRETKEYBYTES = 64, + crypto_sign_SEEDBYTES = 32, + crypto_hash_BYTES = 64; + +nacl.lowlevel = { + crypto_core_hsalsa20: crypto_core_hsalsa20, + crypto_stream_xor: crypto_stream_xor, + crypto_stream: crypto_stream, + crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, + crypto_stream_salsa20: crypto_stream_salsa20, + crypto_onetimeauth: crypto_onetimeauth, + crypto_onetimeauth_verify: crypto_onetimeauth_verify, + crypto_verify_16: crypto_verify_16, + crypto_verify_32: crypto_verify_32, + crypto_secretbox: crypto_secretbox, + crypto_secretbox_open: crypto_secretbox_open, + crypto_scalarmult: crypto_scalarmult, + crypto_scalarmult_base: crypto_scalarmult_base, + crypto_box_beforenm: crypto_box_beforenm, + crypto_box_afternm: crypto_box_afternm, + crypto_box: crypto_box, + crypto_box_open: crypto_box_open, + crypto_box_keypair: crypto_box_keypair, + crypto_hash: crypto_hash, + crypto_sign: crypto_sign, + crypto_sign_keypair: crypto_sign_keypair, + crypto_sign_open: crypto_sign_open, + + crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, + crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, + crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, + crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, + crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, + crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, + crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, + crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, + crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, + crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, + crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, + crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, + crypto_sign_BYTES: crypto_sign_BYTES, + crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, + crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, + crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, + crypto_hash_BYTES: crypto_hash_BYTES +}; + +/* High-level API */ + +function checkLengths(k, n) { + if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); + if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); +} + +function checkBoxLengths(pk, sk) { + if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); + if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); +} + +function checkArrayTypes() { + var t, i; + for (i = 0; i < arguments.length; i++) { + if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') + throw new TypeError('unexpected type ' + t + ', use Uint8Array'); + } +} + +function cleanup(arr) { + for (var i = 0; i < arr.length; i++) arr[i] = 0; +} + +// TODO: Completely remove this in v0.15. +if (!nacl.util) { + nacl.util = {}; + nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { + throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); + }; +} + +nacl.randomBytes = function(n) { + var b = new Uint8Array(n); + randombytes(b, n); + return b; +}; + +nacl.secretbox = function(msg, nonce, key) { + checkArrayTypes(msg, nonce, key); + checkLengths(key, nonce); + var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); + var c = new Uint8Array(m.length); + for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; + crypto_secretbox(c, m, m.length, nonce, key); + return c.subarray(crypto_secretbox_BOXZEROBYTES); +}; + +nacl.secretbox.open = function(box, nonce, key) { + checkArrayTypes(box, nonce, key); + checkLengths(key, nonce); + var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); + var m = new Uint8Array(c.length); + for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; + if (c.length < 32) return false; + if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; + return m.subarray(crypto_secretbox_ZEROBYTES); +}; + +nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; +nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; +nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; + +nacl.scalarMult = function(n, p) { + checkArrayTypes(n, p); + if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); + if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); + var q = new Uint8Array(crypto_scalarmult_BYTES); + crypto_scalarmult(q, n, p); + return q; +}; + +nacl.scalarMult.base = function(n) { + checkArrayTypes(n); + if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); + var q = new Uint8Array(crypto_scalarmult_BYTES); + crypto_scalarmult_base(q, n); + return q; +}; + +nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; +nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; + +nacl.box = function(msg, nonce, publicKey, secretKey) { + var k = nacl.box.before(publicKey, secretKey); + return nacl.secretbox(msg, nonce, k); +}; + +nacl.box.before = function(publicKey, secretKey) { + checkArrayTypes(publicKey, secretKey); + checkBoxLengths(publicKey, secretKey); + var k = new Uint8Array(crypto_box_BEFORENMBYTES); + crypto_box_beforenm(k, publicKey, secretKey); + return k; +}; + +nacl.box.after = nacl.secretbox; + +nacl.box.open = function(msg, nonce, publicKey, secretKey) { + var k = nacl.box.before(publicKey, secretKey); + return nacl.secretbox.open(msg, nonce, k); +}; + +nacl.box.open.after = nacl.secretbox.open; + +nacl.box.keyPair = function() { + var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); + crypto_box_keypair(pk, sk); + return {publicKey: pk, secretKey: sk}; +}; + +nacl.box.keyPair.fromSecretKey = function(secretKey) { + checkArrayTypes(secretKey); + if (secretKey.length !== crypto_box_SECRETKEYBYTES) + throw new Error('bad secret key size'); + var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); + crypto_scalarmult_base(pk, secretKey); + return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; +}; + +nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; +nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; +nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; +nacl.box.nonceLength = crypto_box_NONCEBYTES; +nacl.box.overheadLength = nacl.secretbox.overheadLength; + +nacl.sign = function(msg, secretKey) { + checkArrayTypes(msg, secretKey); + if (secretKey.length !== crypto_sign_SECRETKEYBYTES) + throw new Error('bad secret key size'); + var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); + crypto_sign(signedMsg, msg, msg.length, secretKey); + return signedMsg; +}; + +nacl.sign.open = function(signedMsg, publicKey) { + if (arguments.length !== 2) + throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); + checkArrayTypes(signedMsg, publicKey); + if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) + throw new Error('bad public key size'); + var tmp = new Uint8Array(signedMsg.length); + var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); + if (mlen < 0) return null; + var m = new Uint8Array(mlen); + for (var i = 0; i < m.length; i++) m[i] = tmp[i]; + return m; +}; + +nacl.sign.detached = function(msg, secretKey) { + var signedMsg = nacl.sign(msg, secretKey); + var sig = new Uint8Array(crypto_sign_BYTES); + for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; + return sig; +}; + +nacl.sign.detached.verify = function(msg, sig, publicKey) { + checkArrayTypes(msg, sig, publicKey); + if (sig.length !== crypto_sign_BYTES) + throw new Error('bad signature size'); + if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) + throw new Error('bad public key size'); + var sm = new Uint8Array(crypto_sign_BYTES + msg.length); + var m = new Uint8Array(crypto_sign_BYTES + msg.length); + var i; + for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; + for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; + return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); +}; + +nacl.sign.keyPair = function() { + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); + crypto_sign_keypair(pk, sk); + return {publicKey: pk, secretKey: sk}; +}; + +nacl.sign.keyPair.fromSecretKey = function(secretKey) { + checkArrayTypes(secretKey); + if (secretKey.length !== crypto_sign_SECRETKEYBYTES) + throw new Error('bad secret key size'); + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; + return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; +}; + +nacl.sign.keyPair.fromSeed = function(seed) { + checkArrayTypes(seed); + if (seed.length !== crypto_sign_SEEDBYTES) + throw new Error('bad seed size'); + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); + for (var i = 0; i < 32; i++) sk[i] = seed[i]; + crypto_sign_keypair(pk, sk, true); + return {publicKey: pk, secretKey: sk}; +}; + +nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; +nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; +nacl.sign.seedLength = crypto_sign_SEEDBYTES; +nacl.sign.signatureLength = crypto_sign_BYTES; + +nacl.hash = function(msg) { + checkArrayTypes(msg); + var h = new Uint8Array(crypto_hash_BYTES); + crypto_hash(h, msg, msg.length); + return h; +}; + +nacl.hash.hashLength = crypto_hash_BYTES; + +nacl.verify = function(x, y) { + checkArrayTypes(x, y); + // Zero length arguments are considered not equal. + if (x.length === 0 || y.length === 0) return false; + if (x.length !== y.length) return false; + return (vn(x, 0, y, 0, x.length) === 0) ? true : false; +}; + +nacl.setPRNG = function(fn) { + randombytes = fn; +}; + +(function() { + // Initialize PRNG if environment provides CSPRNG. + // If not, methods calling randombytes will throw. + var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; + if (crypto && crypto.getRandomValues) { + // Browsers. + var QUOTA = 65536; + nacl.setPRNG(function(x, n) { + var i, v = new Uint8Array(n); + for (i = 0; i < n; i += QUOTA) { + crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); + } + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } else if (true) { + // Node.js. + crypto = __webpack_require__(4); + if (crypto && crypto.randomBytes) { + nacl.setPRNG(function(x, n) { + var i, v = crypto.randomBytes(n); + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } + } +})(); + +})(typeof module !== 'undefined' && module.exports ? module.exports : (self.nacl = self.nacl || {})); + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2011 Mark Cavage All rights reserved. + +// If you have no idea what ASN.1 or BER is, see this: +// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc + +var Ber = __webpack_require__(457); + + + +///--- Exported API + +module.exports = { + + Ber: Ber, + + BerReader: Ber.Reader, + + BerWriter: Ber.Writer + +}; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports) { + +module.exports = require("assert"); + +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +var es5 = __webpack_require__(34); +var Objectfreeze = es5.freeze; +var util = __webpack_require__(3); +var inherits = util.inherits; +var notEnumerableProp = util.notEnumerableProp; + +function subError(nameProperty, defaultMessage) { + function SubError(message) { + if (!(this instanceof SubError)) return new SubError(message); + notEnumerableProp(this, "message", + typeof message === "string" ? message : defaultMessage); + notEnumerableProp(this, "name", nameProperty); + if (Error.captureStackTrace) { + Error.captureStackTrace(this, this.constructor); + } else { + Error.call(this); + } + } + inherits(SubError, Error); + return SubError; +} + +var _TypeError, _RangeError; +var Warning = subError("Warning", "warning"); +var CancellationError = subError("CancellationError", "cancellation error"); +var TimeoutError = subError("TimeoutError", "timeout error"); +var AggregateError = subError("AggregateError", "aggregate error"); +try { + _TypeError = TypeError; + _RangeError = RangeError; +} catch(e) { + _TypeError = subError("TypeError", "type error"); + _RangeError = subError("RangeError", "range error"); +} + +var methods = ("join pop push shift unshift slice filter forEach some " + + "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" "); + +for (var i = 0; i < methods.length; ++i) { + if (typeof Array.prototype[methods[i]] === "function") { + AggregateError.prototype[methods[i]] = Array.prototype[methods[i]]; + } +} + +es5.defineProperty(AggregateError.prototype, "length", { + value: 0, + configurable: false, + writable: true, + enumerable: true +}); +AggregateError.prototype["isOperational"] = true; +var level = 0; +AggregateError.prototype.toString = function() { + var indent = Array(level * 4 + 1).join(" "); + var ret = "\n" + indent + "AggregateError of:" + "\n"; + level++; + indent = Array(level * 4 + 1).join(" "); + for (var i = 0; i < this.length; ++i) { + var str = this[i] === this ? "[Circular AggregateError]" : this[i] + ""; + var lines = str.split("\n"); + for (var j = 0; j < lines.length; ++j) { + lines[j] = indent + lines[j]; + } + str = lines.join("\n"); + ret += str + "\n"; + } + level--; + return ret; +}; + +function OperationalError(message) { + if (!(this instanceof OperationalError)) + return new OperationalError(message); + notEnumerableProp(this, "name", "OperationalError"); + notEnumerableProp(this, "message", message); + this.cause = message; + this["isOperational"] = true; + + if (message instanceof Error) { + notEnumerableProp(this, "message", message.message); + notEnumerableProp(this, "stack", message.stack); + } else if (Error.captureStackTrace) { + Error.captureStackTrace(this, this.constructor); + } + +} +inherits(OperationalError, Error); + +var errorTypes = Error["__BluebirdErrorTypes__"]; +if (!errorTypes) { + errorTypes = Objectfreeze({ + CancellationError: CancellationError, + TimeoutError: TimeoutError, + OperationalError: OperationalError, + RejectionError: OperationalError, + AggregateError: AggregateError + }); + es5.defineProperty(Error, "__BluebirdErrorTypes__", { + value: errorTypes, + writable: false, + enumerable: false, + configurable: false + }); +} + +module.exports = { + Error: Error, + TypeError: _TypeError, + RangeError: _RangeError, + CancellationError: errorTypes.CancellationError, + OperationalError: errorTypes.OperationalError, + TimeoutError: errorTypes.TimeoutError, + AggregateError: errorTypes.AggregateError, + Warning: Warning +}; + + +/***/ }), +/* 27 */ +/***/ (function(module, exports, __webpack_require__) { + +(function(){ + + // Copyright (c) 2005 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. + + // Basic JavaScript BN library - subset useful for RSA encryption. + + // Bits per digit + var dbits; + + // JavaScript engine analysis + var canary = 0xdeadbeefcafe; + var j_lm = ((canary&0xffffff)==0xefcafe); + + // (public) Constructor + function BigInteger(a,b,c) { + if(a != null) + if("number" == typeof a) this.fromNumber(a,b,c); + else if(b == null && "string" != typeof a) this.fromString(a,256); + else this.fromString(a,b); + } + + // return new, unset BigInteger + function nbi() { return new BigInteger(null); } + + // am: Compute w_j += (x*this_i), propagate carries, + // c is initial carry, returns final carry. + // c < 3*dvalue, x < 2*dvalue, this_i < dvalue + // We need to select the fastest one that works in this environment. + + // am1: use a single mult and divide to get the high bits, + // max digit bits should be 26 because + // max internal value = 2*dvalue^2-2*dvalue (< 2^53) + function am1(i,x,w,j,c,n) { + while(--n >= 0) { + var v = x*this[i++]+w[j]+c; + c = Math.floor(v/0x4000000); + w[j++] = v&0x3ffffff; + } + return c; + } + // am2 avoids a big mult-and-extract completely. + // Max digit bits should be <= 30 because we do bitwise ops + // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) + function am2(i,x,w,j,c,n) { + var xl = x&0x7fff, xh = x>>15; + while(--n >= 0) { + var l = this[i]&0x7fff; + var h = this[i++]>>15; + var m = xh*l+h*xl; + l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); + c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); + w[j++] = l&0x3fffffff; + } + return c; + } + // Alternately, set max digit bits to 28 since some + // browsers slow down when dealing with 32-bit numbers. + function am3(i,x,w,j,c,n) { + var xl = x&0x3fff, xh = x>>14; + while(--n >= 0) { + var l = this[i]&0x3fff; + var h = this[i++]>>14; + var m = xh*l+h*xl; + l = xl*l+((m&0x3fff)<<14)+w[j]+c; + c = (l>>28)+(m>>14)+xh*h; + w[j++] = l&0xfffffff; + } + return c; + } + var inBrowser = typeof navigator !== "undefined"; + if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { + BigInteger.prototype.am = am2; + dbits = 30; + } + else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { + BigInteger.prototype.am = am1; + dbits = 26; + } + else { // Mozilla/Netscape seems to prefer am3 + BigInteger.prototype.am = am3; + dbits = 28; + } + + BigInteger.prototype.DB = dbits; + BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; + r.t = this.t; + r.s = this.s; + } + + // (protected) set from integer value x, -DV <= x < DV + function bnpFromInt(x) { + this.t = 1; + this.s = (x<0)?-1:0; + if(x > 0) this[0] = x; + else if(x < -1) this[0] = x+this.DV; + else this.t = 0; + } + + // return bigint initialized to value + function nbv(i) { var r = nbi(); r.fromInt(i); return r; } + + // (protected) set from string and radix + function bnpFromString(s,b) { + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 256) k = 8; // byte array + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else { this.fromRadix(s,b); return; } + this.t = 0; + this.s = 0; + var i = s.length, mi = false, sh = 0; + while(--i >= 0) { + var x = (k==8)?s[i]&0xff:intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-") mi = true; + continue; + } + mi = false; + if(sh == 0) + this[this.t++] = x; + else if(sh+k > this.DB) { + this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); + } + else + this[this.t-1] |= x<= this.DB) sh -= this.DB; + } + if(k == 8 && (s[0]&0x80) != 0) { + this.s = -1; + if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; + } + + // (public) return string representation in given radix + function bnToString(b) { + if(this.s < 0) return "-"+this.negate().toString(b); + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else return this.toRadix(b); + var km = (1< 0) { + if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } + while(i >= 0) { + if(p < k) { + d = (this[i]&((1<>(p+=this.DB-k); + } + else { + d = (this[i]>>(p-=k))&km; + if(p <= 0) { p += this.DB; --i; } + } + if(d > 0) m = true; + if(m) r += int2char(d); + } + } + return m?r:"0"; + } + + // (public) -this + function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } + + // (public) |this| + function bnAbs() { return (this.s<0)?this.negate():this; } + + // (public) return + if this > a, - if this < a, 0 if equal + function bnCompareTo(a) { + var r = this.s-a.s; + if(r != 0) return r; + var i = this.t; + r = i-a.t; + if(r != 0) return (this.s<0)?-r:r; + while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; + return 0; + } + + // returns bit length of the integer x + function nbits(x) { + var r = 1, t; + if((t=x>>>16) != 0) { x = t; r += 16; } + if((t=x>>8) != 0) { x = t; r += 8; } + if((t=x>>4) != 0) { x = t; r += 4; } + if((t=x>>2) != 0) { x = t; r += 2; } + if((t=x>>1) != 0) { x = t; r += 1; } + return r; + } + + // (public) return the number of bits in "this" + function bnBitLength() { + if(this.t <= 0) return 0; + return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); + } + + // (protected) r = this << n*DB + function bnpDLShiftTo(n,r) { + var i; + for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; + for(i = n-1; i >= 0; --i) r[i] = 0; + r.t = this.t+n; + r.s = this.s; + } + + // (protected) r = this >> n*DB + function bnpDRShiftTo(n,r) { + for(var i = n; i < this.t; ++i) r[i-n] = this[i]; + r.t = Math.max(this.t-n,0); + r.s = this.s; + } + + // (protected) r = this << n + function bnpLShiftTo(n,r) { + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<= 0; --i) { + r[i+ds+1] = (this[i]>>cbs)|c; + c = (this[i]&bm)<= 0; --i) r[i] = 0; + r[ds] = c; + r.t = this.t+ds+1; + r.s = this.s; + r.clamp(); + } + + // (protected) r = this >> n + function bnpRShiftTo(n,r) { + r.s = this.s; + var ds = Math.floor(n/this.DB); + if(ds >= this.t) { r.t = 0; return; } + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<>bs; + for(var i = ds+1; i < this.t; ++i) { + r[i-ds-1] |= (this[i]&bm)<>bs; + } + if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; + } + if(a.t < this.t) { + c -= a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c -= a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c -= a.s; + } + r.s = (c<0)?-1:0; + if(c < -1) r[i++] = this.DV+c; + else if(c > 0) r[i++] = c; + r.t = i; + r.clamp(); + } + + // (protected) r = this * a, r != this,a (HAC 14.12) + // "this" should be the larger one if appropriate. + function bnpMultiplyTo(a,r) { + var x = this.abs(), y = a.abs(); + var i = x.t; + r.t = i+y.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); + r.s = 0; + r.clamp(); + if(this.s != a.s) BigInteger.ZERO.subTo(r,r); + } + + // (protected) r = this^2, r != this (HAC 14.16) + function bnpSquareTo(r) { + var x = this.abs(); + var i = r.t = 2*x.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < x.t-1; ++i) { + var c = x.am(i,x[i],r,2*i,0,1); + if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { + r[i+x.t] -= x.DV; + r[i+x.t+1] = 1; + } + } + if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); + r.s = 0; + r.clamp(); + } + + // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) + // r != q, this != m. q or r may be null. + function bnpDivRemTo(m,q,r) { + var pm = m.abs(); + if(pm.t <= 0) return; + var pt = this.abs(); + if(pt.t < pm.t) { + if(q != null) q.fromInt(0); + if(r != null) this.copyTo(r); + return; + } + if(r == null) r = nbi(); + var y = nbi(), ts = this.s, ms = m.s; + var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus + if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } + else { pm.copyTo(y); pt.copyTo(r); } + var ys = y.t; + var y0 = y[ys-1]; + if(y0 == 0) return; + var yt = y0*(1<1)?y[ys-2]>>this.F2:0); + var d1 = this.FV/yt, d2 = (1<= 0) { + r[r.t++] = 1; + r.subTo(t,r); + } + BigInteger.ONE.dlShiftTo(ys,t); + t.subTo(y,y); // "negative" y so we can replace sub with am later + while(y.t < ys) y[y.t++] = 0; + while(--j >= 0) { + // Estimate quotient digit + var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); + if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out + y.dlShiftTo(j,t); + r.subTo(t,r); + while(r[i] < --qd) r.subTo(t,r); + } + } + if(q != null) { + r.drShiftTo(ys,q); + if(ts != ms) BigInteger.ZERO.subTo(q,q); + } + r.t = ys; + r.clamp(); + if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder + if(ts < 0) BigInteger.ZERO.subTo(r,r); + } + + // (public) this mod a + function bnMod(a) { + var r = nbi(); + this.abs().divRemTo(a,null,r); + if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); + return r; + } + + // Modular reduction using "classic" algorithm + function Classic(m) { this.m = m; } + function cConvert(x) { + if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); + else return x; + } + function cRevert(x) { return x; } + function cReduce(x) { x.divRemTo(this.m,null,x); } + function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + Classic.prototype.convert = cConvert; + Classic.prototype.revert = cRevert; + Classic.prototype.reduce = cReduce; + Classic.prototype.mulTo = cMulTo; + Classic.prototype.sqrTo = cSqrTo; + + // (protected) return "-1/this % 2^DB"; useful for Mont. reduction + // justification: + // xy == 1 (mod m) + // xy = 1+km + // xy(2-xy) = (1+km)(1-km) + // x[y(2-xy)] = 1-k^2m^2 + // x[y(2-xy)] == 1 (mod m^2) + // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 + // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. + // JS multiply "overflows" differently from C/C++, so care is needed here. + function bnpInvDigit() { + if(this.t < 1) return 0; + var x = this[0]; + if((x&1) == 0) return 0; + var y = x&3; // y == 1/x mod 2^2 + y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 + y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 + y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 + // last step - calculate inverse mod DV directly; + // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints + y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits + // we really want the negative inverse, and -DV < y < DV + return (y>0)?this.DV-y:-y; + } + + // Montgomery reduction + function Montgomery(m) { + this.m = m; + this.mp = m.invDigit(); + this.mpl = this.mp&0x7fff; + this.mph = this.mp>>15; + this.um = (1<<(m.DB-15))-1; + this.mt2 = 2*m.t; + } + + // xR mod m + function montConvert(x) { + var r = nbi(); + x.abs().dlShiftTo(this.m.t,r); + r.divRemTo(this.m,null,r); + if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); + return r; + } + + // x/R mod m + function montRevert(x) { + var r = nbi(); + x.copyTo(r); + this.reduce(r); + return r; + } + + // x = x/R mod m (HAC 14.32) + function montReduce(x) { + while(x.t <= this.mt2) // pad x so am has enough room later + x[x.t++] = 0; + for(var i = 0; i < this.m.t; ++i) { + // faster way of calculating u0 = x[i]*mp mod DV + var j = x[i]&0x7fff; + var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; + // use am to combine the multiply-shift-add into one call + j = i+this.m.t; + x[j] += this.m.am(0,u0,x,i,0,this.m.t); + // propagate carry + while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } + } + x.clamp(); + x.drShiftTo(this.m.t,x); + if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + } + + // r = "x^2/R mod m"; x != r + function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + // r = "xy/R mod m"; x,y != r + function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + + Montgomery.prototype.convert = montConvert; + Montgomery.prototype.revert = montRevert; + Montgomery.prototype.reduce = montReduce; + Montgomery.prototype.mulTo = montMulTo; + Montgomery.prototype.sqrTo = montSqrTo; + + // (protected) true iff this is even + function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } + + // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) + function bnpExp(e,z) { + if(e > 0xffffffff || e < 1) return BigInteger.ONE; + var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; + g.copyTo(r); + while(--i >= 0) { + z.sqrTo(r,r2); + if((e&(1< 0) z.mulTo(r2,g,r); + else { var t = r; r = r2; r2 = t; } + } + return z.revert(r); + } + + // (public) this^e % m, 0 <= e < 2^32 + function bnModPowInt(e,m) { + var z; + if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); + return this.exp(e,z); + } + + // protected + BigInteger.prototype.copyTo = bnpCopyTo; + BigInteger.prototype.fromInt = bnpFromInt; + BigInteger.prototype.fromString = bnpFromString; + BigInteger.prototype.clamp = bnpClamp; + BigInteger.prototype.dlShiftTo = bnpDLShiftTo; + BigInteger.prototype.drShiftTo = bnpDRShiftTo; + BigInteger.prototype.lShiftTo = bnpLShiftTo; + BigInteger.prototype.rShiftTo = bnpRShiftTo; + BigInteger.prototype.subTo = bnpSubTo; + BigInteger.prototype.multiplyTo = bnpMultiplyTo; + BigInteger.prototype.squareTo = bnpSquareTo; + BigInteger.prototype.divRemTo = bnpDivRemTo; + BigInteger.prototype.invDigit = bnpInvDigit; + BigInteger.prototype.isEven = bnpIsEven; + BigInteger.prototype.exp = bnpExp; + + // public + BigInteger.prototype.toString = bnToString; + BigInteger.prototype.negate = bnNegate; + BigInteger.prototype.abs = bnAbs; + BigInteger.prototype.compareTo = bnCompareTo; + BigInteger.prototype.bitLength = bnBitLength; + BigInteger.prototype.mod = bnMod; + BigInteger.prototype.modPowInt = bnModPowInt; + + // "constants" + BigInteger.ZERO = nbv(0); + BigInteger.ONE = nbv(1); + + // Copyright (c) 2005-2009 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. + + // Extended JavaScript BN functions, required for RSA private ops. + + // Version 1.1: new BigInteger("0", 10) returns "proper" zero + // Version 1.2: square() API, isProbablePrime fix + + // (public) + function bnClone() { var r = nbi(); this.copyTo(r); return r; } + + // (public) return value as integer + function bnIntValue() { + if(this.s < 0) { + if(this.t == 1) return this[0]-this.DV; + else if(this.t == 0) return -1; + } + else if(this.t == 1) return this[0]; + else if(this.t == 0) return 0; + // assumes 16 < DB < 32 + return ((this[1]&((1<<(32-this.DB))-1))<>24; } + + // (public) return value as short (assumes DB>=16) + function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } + + // (protected) return x s.t. r^x < DV + function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } + + // (public) 0 if this == 0, 1 if this > 0 + function bnSigNum() { + if(this.s < 0) return -1; + else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; + else return 1; + } + + // (protected) convert to radix string + function bnpToRadix(b) { + if(b == null) b = 10; + if(this.signum() == 0 || b < 2 || b > 36) return "0"; + var cs = this.chunkSize(b); + var a = Math.pow(b,cs); + var d = nbv(a), y = nbi(), z = nbi(), r = ""; + this.divRemTo(d,y,z); + while(y.signum() > 0) { + r = (a+z.intValue()).toString(b).substr(1) + r; + y.divRemTo(d,y,z); + } + return z.intValue().toString(b) + r; + } + + // (protected) convert from radix string + function bnpFromRadix(s,b) { + this.fromInt(0); + if(b == null) b = 10; + var cs = this.chunkSize(b); + var d = Math.pow(b,cs), mi = false, j = 0, w = 0; + for(var i = 0; i < s.length; ++i) { + var x = intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-" && this.signum() == 0) mi = true; + continue; + } + w = b*w+x; + if(++j >= cs) { + this.dMultiply(d); + this.dAddOffset(w,0); + j = 0; + w = 0; + } + } + if(j > 0) { + this.dMultiply(Math.pow(b,j)); + this.dAddOffset(w,0); + } + if(mi) BigInteger.ZERO.subTo(this,this); + } + + // (protected) alternate constructor + function bnpFromNumber(a,b,c) { + if("number" == typeof b) { + // new BigInteger(int,int,RNG) + if(a < 2) this.fromInt(1); + else { + this.fromNumber(a,c); + if(!this.testBit(a-1)) // force MSB set + this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); + if(this.isEven()) this.dAddOffset(1,0); // force odd + while(!this.isProbablePrime(b)) { + this.dAddOffset(2,0); + if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); + } + } + } + else { + // new BigInteger(int,RNG) + var x = new Array(), t = a&7; + x.length = (a>>3)+1; + b.nextBytes(x); + if(t > 0) x[0] &= ((1< 0) { + if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) + r[k++] = d|(this.s<<(this.DB-p)); + while(i >= 0) { + if(p < 8) { + d = (this[i]&((1<>(p+=this.DB-8); + } + else { + d = (this[i]>>(p-=8))&0xff; + if(p <= 0) { p += this.DB; --i; } + } + if((d&0x80) != 0) d |= -256; + if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; + if(k > 0 || d != this.s) r[k++] = d; + } + } + return r; + } + + function bnEquals(a) { return(this.compareTo(a)==0); } + function bnMin(a) { return(this.compareTo(a)<0)?this:a; } + function bnMax(a) { return(this.compareTo(a)>0)?this:a; } + + // (protected) r = this op a (bitwise) + function bnpBitwiseTo(a,op,r) { + var i, f, m = Math.min(a.t,this.t); + for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); + if(a.t < this.t) { + f = a.s&this.DM; + for(i = m; i < this.t; ++i) r[i] = op(this[i],f); + r.t = this.t; + } + else { + f = this.s&this.DM; + for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); + r.t = a.t; + } + r.s = op(this.s,a.s); + r.clamp(); + } + + // (public) this & a + function op_and(x,y) { return x&y; } + function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } + + // (public) this | a + function op_or(x,y) { return x|y; } + function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } + + // (public) this ^ a + function op_xor(x,y) { return x^y; } + function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } + + // (public) this & ~a + function op_andnot(x,y) { return x&~y; } + function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } + + // (public) ~this + function bnNot() { + var r = nbi(); + for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; + r.t = this.t; + r.s = ~this.s; + return r; + } + + // (public) this << n + function bnShiftLeft(n) { + var r = nbi(); + if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); + return r; + } + + // (public) this >> n + function bnShiftRight(n) { + var r = nbi(); + if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); + return r; + } + + // return index of lowest 1-bit in x, x < 2^31 + function lbit(x) { + if(x == 0) return -1; + var r = 0; + if((x&0xffff) == 0) { x >>= 16; r += 16; } + if((x&0xff) == 0) { x >>= 8; r += 8; } + if((x&0xf) == 0) { x >>= 4; r += 4; } + if((x&3) == 0) { x >>= 2; r += 2; } + if((x&1) == 0) ++r; + return r; + } + + // (public) returns index of lowest 1-bit (or -1 if none) + function bnGetLowestSetBit() { + for(var i = 0; i < this.t; ++i) + if(this[i] != 0) return i*this.DB+lbit(this[i]); + if(this.s < 0) return this.t*this.DB; + return -1; + } + + // return number of 1 bits in x + function cbit(x) { + var r = 0; + while(x != 0) { x &= x-1; ++r; } + return r; + } + + // (public) return number of set bits + function bnBitCount() { + var r = 0, x = this.s&this.DM; + for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); + return r; + } + + // (public) true iff nth bit is set + function bnTestBit(n) { + var j = Math.floor(n/this.DB); + if(j >= this.t) return(this.s!=0); + return((this[j]&(1<<(n%this.DB)))!=0); + } + + // (protected) this op (1<>= this.DB; + } + if(a.t < this.t) { + c += a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c += a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += a.s; + } + r.s = (c<0)?-1:0; + if(c > 0) r[i++] = c; + else if(c < -1) r[i++] = this.DV+c; + r.t = i; + r.clamp(); + } + + // (public) this + a + function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } + + // (public) this - a + function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } + + // (public) this * a + function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } + + // (public) this^2 + function bnSquare() { var r = nbi(); this.squareTo(r); return r; } + + // (public) this / a + function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } + + // (public) this % a + function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } + + // (public) [this/a,this%a] + function bnDivideAndRemainder(a) { + var q = nbi(), r = nbi(); + this.divRemTo(a,q,r); + return new Array(q,r); + } + + // (protected) this *= n, this >= 0, 1 < n < DV + function bnpDMultiply(n) { + this[this.t] = this.am(0,n-1,this,0,0,this.t); + ++this.t; + this.clamp(); + } + + // (protected) this += n << w words, this >= 0 + function bnpDAddOffset(n,w) { + if(n == 0) return; + while(this.t <= w) this[this.t++] = 0; + this[w] += n; + while(this[w] >= this.DV) { + this[w] -= this.DV; + if(++w >= this.t) this[this.t++] = 0; + ++this[w]; + } + } + + // A "null" reducer + function NullExp() {} + function nNop(x) { return x; } + function nMulTo(x,y,r) { x.multiplyTo(y,r); } + function nSqrTo(x,r) { x.squareTo(r); } + + NullExp.prototype.convert = nNop; + NullExp.prototype.revert = nNop; + NullExp.prototype.mulTo = nMulTo; + NullExp.prototype.sqrTo = nSqrTo; + + // (public) this^e + function bnPow(e) { return this.exp(e,new NullExp()); } + + // (protected) r = lower n words of "this * a", a.t <= n + // "this" should be the larger one if appropriate. + function bnpMultiplyLowerTo(a,n,r) { + var i = Math.min(this.t+a.t,n); + r.s = 0; // assumes a,this >= 0 + r.t = i; + while(i > 0) r[--i] = 0; + var j; + for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); + for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); + r.clamp(); + } + + // (protected) r = "this * a" without lower n words, n > 0 + // "this" should be the larger one if appropriate. + function bnpMultiplyUpperTo(a,n,r) { + --n; + var i = r.t = this.t+a.t-n; + r.s = 0; // assumes a,this >= 0 + while(--i >= 0) r[i] = 0; + for(i = Math.max(n-this.t,0); i < a.t; ++i) + r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); + r.clamp(); + r.drShiftTo(1,r); + } + + // Barrett modular reduction + function Barrett(m) { + // setup Barrett + this.r2 = nbi(); + this.q3 = nbi(); + BigInteger.ONE.dlShiftTo(2*m.t,this.r2); + this.mu = this.r2.divide(m); + this.m = m; + } + + function barrettConvert(x) { + if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); + else if(x.compareTo(this.m) < 0) return x; + else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } + } + + function barrettRevert(x) { return x; } + + // x = x mod m (HAC 14.42) + function barrettReduce(x) { + x.drShiftTo(this.m.t-1,this.r2); + if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } + this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); + this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); + while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); + x.subTo(this.r2,x); + while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + } + + // r = x^2 mod m; x != r + function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + // r = x*y mod m; x,y != r + function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + + Barrett.prototype.convert = barrettConvert; + Barrett.prototype.revert = barrettRevert; + Barrett.prototype.reduce = barrettReduce; + Barrett.prototype.mulTo = barrettMulTo; + Barrett.prototype.sqrTo = barrettSqrTo; + + // (public) this^e % m (HAC 14.85) + function bnModPow(e,m) { + var i = e.bitLength(), k, r = nbv(1), z; + if(i <= 0) return r; + else if(i < 18) k = 1; + else if(i < 48) k = 3; + else if(i < 144) k = 4; + else if(i < 768) k = 5; + else k = 6; + if(i < 8) + z = new Classic(m); + else if(m.isEven()) + z = new Barrett(m); + else + z = new Montgomery(m); + + // precomputation + var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { + var g2 = nbi(); + z.sqrTo(g[1],g2); + while(n <= km) { + g[n] = nbi(); + z.mulTo(g2,g[n-2],g[n]); + n += 2; + } + } + + var j = e.t-1, w, is1 = true, r2 = nbi(), t; + i = nbits(e[j])-1; + while(j >= 0) { + if(i >= k1) w = (e[j]>>(i-k1))&km; + else { + w = (e[j]&((1<<(i+1))-1))<<(k1-i); + if(j > 0) w |= e[j-1]>>(this.DB+i-k1); + } + + n = k; + while((w&1) == 0) { w >>= 1; --n; } + if((i -= n) < 0) { i += this.DB; --j; } + if(is1) { // ret == 1, don't bother squaring or multiplying it + g[w].copyTo(r); + is1 = false; + } + else { + while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } + if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } + z.mulTo(r2,g[w],r); + } + + while(j >= 0 && (e[j]&(1< 0) { + x.rShiftTo(g,x); + y.rShiftTo(g,y); + } + while(x.signum() > 0) { + if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); + if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); + if(x.compareTo(y) >= 0) { + x.subTo(y,x); + x.rShiftTo(1,x); + } + else { + y.subTo(x,y); + y.rShiftTo(1,y); + } + } + if(g > 0) y.lShiftTo(g,y); + return y; + } + + // (protected) this % n, n < 2^26 + function bnpModInt(n) { + if(n <= 0) return 0; + var d = this.DV%n, r = (this.s<0)?n-1:0; + if(this.t > 0) + if(d == 0) r = this[0]%n; + else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; + return r; + } + + // (public) 1/this % m (HAC 14.61) + function bnModInverse(m) { + var ac = m.isEven(); + if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; + var u = m.clone(), v = this.clone(); + var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); + while(u.signum() != 0) { + while(u.isEven()) { + u.rShiftTo(1,u); + if(ac) { + if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } + a.rShiftTo(1,a); + } + else if(!b.isEven()) b.subTo(m,b); + b.rShiftTo(1,b); + } + while(v.isEven()) { + v.rShiftTo(1,v); + if(ac) { + if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } + c.rShiftTo(1,c); + } + else if(!d.isEven()) d.subTo(m,d); + d.rShiftTo(1,d); + } + if(u.compareTo(v) >= 0) { + u.subTo(v,u); + if(ac) a.subTo(c,a); + b.subTo(d,b); + } + else { + v.subTo(u,v); + if(ac) c.subTo(a,c); + d.subTo(b,d); + } + } + if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; + if(d.compareTo(m) >= 0) return d.subtract(m); + if(d.signum() < 0) d.addTo(m,d); else return d; + if(d.signum() < 0) return d.add(m); else return d; + } + + var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; + var lplim = (1<<26)/lowprimes[lowprimes.length-1]; + + // (public) test primality with certainty >= 1-.5^t + function bnIsProbablePrime(t) { + var i, x = this.abs(); + if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { + for(i = 0; i < lowprimes.length; ++i) + if(x[0] == lowprimes[i]) return true; + return false; + } + if(x.isEven()) return false; + i = 1; + while(i < lowprimes.length) { + var m = lowprimes[i], j = i+1; + while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; + m = x.modInt(m); + while(i < j) if(m%lowprimes[i++] == 0) return false; + } + return x.millerRabin(t); + } + + // (protected) true if probably prime (HAC 4.24, Miller-Rabin) + function bnpMillerRabin(t) { + var n1 = this.subtract(BigInteger.ONE); + var k = n1.getLowestSetBit(); + if(k <= 0) return false; + var r = n1.shiftRight(k); + t = (t+1)>>1; + if(t > lowprimes.length) t = lowprimes.length; + var a = nbi(); + for(var i = 0; i < t; ++i) { + //Pick bases at random, instead of starting at 2 + a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); + var y = a.modPow(r,this); + if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { + var j = 1; + while(j++ < k && y.compareTo(n1) != 0) { + y = y.modPowInt(2,this); + if(y.compareTo(BigInteger.ONE) == 0) return false; + } + if(y.compareTo(n1) != 0) return false; + } + } + return true; + } + + // protected + BigInteger.prototype.chunkSize = bnpChunkSize; + BigInteger.prototype.toRadix = bnpToRadix; + BigInteger.prototype.fromRadix = bnpFromRadix; + BigInteger.prototype.fromNumber = bnpFromNumber; + BigInteger.prototype.bitwiseTo = bnpBitwiseTo; + BigInteger.prototype.changeBit = bnpChangeBit; + BigInteger.prototype.addTo = bnpAddTo; + BigInteger.prototype.dMultiply = bnpDMultiply; + BigInteger.prototype.dAddOffset = bnpDAddOffset; + BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; + BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; + BigInteger.prototype.modInt = bnpModInt; + BigInteger.prototype.millerRabin = bnpMillerRabin; + + // public + BigInteger.prototype.clone = bnClone; + BigInteger.prototype.intValue = bnIntValue; + BigInteger.prototype.byteValue = bnByteValue; + BigInteger.prototype.shortValue = bnShortValue; + BigInteger.prototype.signum = bnSigNum; + BigInteger.prototype.toByteArray = bnToByteArray; + BigInteger.prototype.equals = bnEquals; + BigInteger.prototype.min = bnMin; + BigInteger.prototype.max = bnMax; + BigInteger.prototype.and = bnAnd; + BigInteger.prototype.or = bnOr; + BigInteger.prototype.xor = bnXor; + BigInteger.prototype.andNot = bnAndNot; + BigInteger.prototype.not = bnNot; + BigInteger.prototype.shiftLeft = bnShiftLeft; + BigInteger.prototype.shiftRight = bnShiftRight; + BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; + BigInteger.prototype.bitCount = bnBitCount; + BigInteger.prototype.testBit = bnTestBit; + BigInteger.prototype.setBit = bnSetBit; + BigInteger.prototype.clearBit = bnClearBit; + BigInteger.prototype.flipBit = bnFlipBit; + BigInteger.prototype.add = bnAdd; + BigInteger.prototype.subtract = bnSubtract; + BigInteger.prototype.multiply = bnMultiply; + BigInteger.prototype.divide = bnDivide; + BigInteger.prototype.remainder = bnRemainder; + BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; + BigInteger.prototype.modPow = bnModPow; + BigInteger.prototype.modInverse = bnModInverse; + BigInteger.prototype.pow = bnPow; + BigInteger.prototype.gcd = bnGCD; + BigInteger.prototype.isProbablePrime = bnIsProbablePrime; + + // JSBN-specific extension + BigInteger.prototype.square = bnSquare; + + // Expose the Barrett function + BigInteger.prototype.Barrett = Barrett + + // BigInteger interfaces not implemented in jsbn: + + // BigInteger(int signum, byte[] magnitude) + // double doubleValue() + // float floatValue() + // int hashCode() + // long longValue() + // static BigInteger valueOf(long val) + + // Random number generator - requires a PRNG backend, e.g. prng4.js + + // For best results, put code like + // + // in your main HTML document. + + var rng_state; + var rng_pool; + var rng_pptr; + + // Mix in a 32-bit integer into the pool + function rng_seed_int(x) { + rng_pool[rng_pptr++] ^= x & 255; + rng_pool[rng_pptr++] ^= (x >> 8) & 255; + rng_pool[rng_pptr++] ^= (x >> 16) & 255; + rng_pool[rng_pptr++] ^= (x >> 24) & 255; + if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; + } + + // Mix in the current time (w/milliseconds) into the pool + function rng_seed_time() { + rng_seed_int(new Date().getTime()); + } + + // Initialize the pool with junk if needed. + if(rng_pool == null) { + rng_pool = new Array(); + rng_pptr = 0; + var t; + if(typeof window !== "undefined" && window.crypto) { + if (window.crypto.getRandomValues) { + // Use webcrypto if available + var ua = new Uint8Array(32); + window.crypto.getRandomValues(ua); + for(t = 0; t < 32; ++t) + rng_pool[rng_pptr++] = ua[t]; + } + else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { + // Extract entropy (256 bits) from NS4 RNG if available + var z = window.crypto.random(32); + for(t = 0; t < z.length; ++t) + rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; + } + } + while(rng_pptr < rng_psize) { // extract some randomness from Math.random() + t = Math.floor(65536 * Math.random()); + rng_pool[rng_pptr++] = t >>> 8; + rng_pool[rng_pptr++] = t & 255; + } + rng_pptr = 0; + rng_seed_time(); + //rng_seed_int(window.screenX); + //rng_seed_int(window.screenY); + } + + function rng_get_byte() { + if(rng_state == null) { + rng_seed_time(); + rng_state = prng_newstate(); + rng_state.init(rng_pool); + for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) + rng_pool[rng_pptr] = 0; + rng_pptr = 0; + //rng_pool = null; + } + // TODO: allow reseeding after first request + return rng_state.next(); + } + + function rng_get_bytes(ba) { + var i; + for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); + } + + function SecureRandom() {} + + SecureRandom.prototype.nextBytes = rng_get_bytes; + + // prng4.js - uses Arcfour as a PRNG + + function Arcfour() { + this.i = 0; + this.j = 0; + this.S = new Array(); + } + + // Initialize arcfour context from key, an array of ints, each from [0..255] + function ARC4init(key) { + var i, j, t; + for(i = 0; i < 256; ++i) + this.S[i] = i; + j = 0; + for(i = 0; i < 256; ++i) { + j = (j + this.S[i] + key[i % key.length]) & 255; + t = this.S[i]; + this.S[i] = this.S[j]; + this.S[j] = t; + } + this.i = 0; + this.j = 0; + } + + function ARC4next() { + var t; + this.i = (this.i + 1) & 255; + this.j = (this.j + this.S[this.i]) & 255; + t = this.S[this.i]; + this.S[this.i] = this.S[this.j]; + this.S[this.j] = t; + return this.S[(t + this.S[this.i]) & 255]; + } + + Arcfour.prototype.init = ARC4init; + Arcfour.prototype.next = ARC4next; + + // Plug in your RNG constructor here + function prng_newstate() { + return new Arcfour(); + } + + // Pool size must be a multiple of 4 and greater than 32. + // An array of bytes the size of the pool will be passed to init() + var rng_psize = 256; + + BigInteger.SecureRandom = SecureRandom; + BigInteger.BigInteger = BigInteger; + if (true) { + exports = module.exports = BigInteger; + } else { + this.BigInteger = BigInteger; + this.SecureRandom = SecureRandom; + } + +}).call(this); + + +/***/ }), +/* 28 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + read: read, + write: write +}; + +var assert = __webpack_require__(2); +var asn1 = __webpack_require__(24); +var crypto = __webpack_require__(4); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var utils = __webpack_require__(6); +var Key = __webpack_require__(7); +var PrivateKey = __webpack_require__(9); + +var pkcs1 = __webpack_require__(82); +var pkcs8 = __webpack_require__(43); +var sshpriv = __webpack_require__(57); +var rfc4253 = __webpack_require__(30); + +var errors = __webpack_require__(21); + +/* + * For reading we support both PKCS#1 and PKCS#8. If we find a private key, + * we just take the public component of it and use that. + */ +function read(buf, options, forceType) { + var input = buf; + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + + var lines = buf.trim().split('\n'); + + var m = lines[0].match(/*JSSTYLED*/ + /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); + assert.ok(m, 'invalid PEM header'); + + var m2 = lines[lines.length - 1].match(/*JSSTYLED*/ + /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); + assert.ok(m2, 'invalid PEM footer'); + + /* Begin and end banners must match key type */ + assert.equal(m[2], m2[2]); + var type = m[2].toLowerCase(); + + var alg; + if (m[1]) { + /* They also must match algorithms, if given */ + assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); + alg = m[1].trim(); + } + + var headers = {}; + while (true) { + lines = lines.slice(1); + m = lines[0].match(/*JSSTYLED*/ + /^([A-Za-z0-9-]+): (.+)$/); + if (!m) + break; + headers[m[1].toLowerCase()] = m[2]; + } + + var cipher, key, iv; + if (headers['proc-type']) { + var parts = headers['proc-type'].split(','); + if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from( + options.passphrase, 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'PEM')); + } else { + parts = headers['dek-info'].split(','); + assert.ok(parts.length === 2); + cipher = parts[0].toLowerCase(); + iv = Buffer.from(parts[1], 'hex'); + key = utils.opensslKeyDeriv(cipher, iv, + options.passphrase, 1).key; + } + } + } + + /* Chop off the first and last lines */ + lines = lines.slice(0, -1).join(''); + buf = Buffer.from(lines, 'base64'); + + if (cipher && key && iv) { + var cipherStream = crypto.createDecipheriv(cipher, key, iv); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(buf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + buf = Buffer.concat(chunks); + } + + /* The new OpenSSH internal format abuses PEM headers */ + if (alg && alg.toLowerCase() === 'openssh') + return (sshpriv.readSSHPrivate(type, buf, options)); + if (alg && alg.toLowerCase() === 'ssh2') + return (rfc4253.readType(type, buf, options)); + + var der = new asn1.BerReader(buf); + der.originalInput = input; + + /* + * All of the PEM file types start with a sequence tag, so chop it + * off here + */ + der.readSequence(); + + /* PKCS#1 type keys name an algorithm in the banner explicitly */ + if (alg) { + if (forceType) + assert.strictEqual(forceType, 'pkcs1'); + return (pkcs1.readPkcs1(alg, type, der)); + } else { + if (forceType) + assert.strictEqual(forceType, 'pkcs8'); + return (pkcs8.readPkcs8(alg, type, der)); + } +} + +function write(key, options, type) { + assert.object(key); + + var alg = { + 'ecdsa': 'EC', + 'rsa': 'RSA', + 'dsa': 'DSA', + 'ed25519': 'EdDSA' + }[key.type]; + var header; + + var der = new asn1.BerWriter(); + + if (PrivateKey.isPrivateKey(key)) { + if (type && type === 'pkcs8') { + header = 'PRIVATE KEY'; + pkcs8.writePkcs8(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs1'); + header = alg + ' PRIVATE KEY'; + pkcs1.writePkcs1(der, key); + } + + } else if (Key.isKey(key)) { + if (type && type === 'pkcs1') { + header = alg + ' PUBLIC KEY'; + pkcs1.writePkcs1(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs8'); + header = 'PUBLIC KEY'; + pkcs8.writePkcs8(der, key); + } + + } else { + throw (new Error('key is not a Key or PrivateKey')); + } + + var tmp = der.buffer.toString('base64'); + var len = tmp.length + (tmp.length / 64) + + 18 + 16 + header.length*2 + 10; + var buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 64; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); + + return (buf.slice(0, o)); +} + + +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +function __export(m) { + for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; +} +Object.defineProperty(exports, "__esModule", { value: true }); +__export(__webpack_require__(208)); +__export(__webpack_require__(213)); +__export(__webpack_require__(215)); + + +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + read: read.bind(undefined, false, undefined), + readType: read.bind(undefined, false), + write: write, + /* semi-private api, used by sshpk-agent */ + readPartial: read.bind(undefined, true), + + /* shared with ssh format */ + readInternal: read, + keyTypeToAlg: keyTypeToAlg, + algToKeyType: algToKeyType +}; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var utils = __webpack_require__(6); +var Key = __webpack_require__(7); +var PrivateKey = __webpack_require__(9); +var SSHBuffer = __webpack_require__(44); + +function algToKeyType(alg) { + assert.string(alg); + if (alg === 'ssh-dss') + return ('dsa'); + else if (alg === 'ssh-rsa') + return ('rsa'); + else if (alg === 'ssh-ed25519') + return ('ed25519'); + else if (alg === 'ssh-curve25519') + return ('curve25519'); + else if (alg.match(/^ecdsa-sha2-/)) + return ('ecdsa'); + else + throw (new Error('Unknown algorithm ' + alg)); +} + +function keyTypeToAlg(key) { + assert.object(key); + if (key.type === 'dsa') + return ('ssh-dss'); + else if (key.type === 'rsa') + return ('ssh-rsa'); + else if (key.type === 'ed25519') + return ('ssh-ed25519'); + else if (key.type === 'curve25519') + return ('ssh-curve25519'); + else if (key.type === 'ecdsa') + return ('ecdsa-sha2-' + key.part.curve.data.toString()); + else + throw (new Error('Unknown key type ' + key.type)); +} + +function read(partial, type, buf, options) { + if (typeof (buf) === 'string') + buf = Buffer.from(buf); + assert.buffer(buf, 'buf'); + + var key = {}; + + var parts = key.parts = []; + var sshbuf = new SSHBuffer({buffer: buf}); + + var alg = sshbuf.readString(); + assert.ok(!sshbuf.atEnd(), 'key must have at least one part'); + + key.type = algToKeyType(alg); + + var partCount = algs.info[key.type].parts.length; + if (type && type === 'private') + partCount = algs.privInfo[key.type].parts.length; + + while (!sshbuf.atEnd() && parts.length < partCount) + parts.push(sshbuf.readPart()); + while (!partial && !sshbuf.atEnd()) + parts.push(sshbuf.readPart()); + + assert.ok(parts.length >= 1, + 'key must have at least one part'); + assert.ok(partial || sshbuf.atEnd(), + 'leftover bytes at end of key'); + + var Constructor = Key; + var algInfo = algs.info[key.type]; + if (type === 'private' || algInfo.parts.length !== parts.length) { + algInfo = algs.privInfo[key.type]; + Constructor = PrivateKey; + } + assert.strictEqual(algInfo.parts.length, parts.length); + + if (key.type === 'ecdsa') { + var res = /^ecdsa-sha2-(.+)$/.exec(alg); + assert.ok(res !== null); + assert.strictEqual(res[1], parts[0].data.toString()); + } + + var normalized = true; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = parts[i]; + p.name = algInfo.parts[i]; + /* + * OpenSSH stores ed25519 "private" keys as seed + public key + * concat'd together (k followed by A). We want to keep them + * separate for other formats that don't do this. + */ + if (key.type === 'ed25519' && p.name === 'k') + p.data = p.data.slice(0, 32); + + if (p.name !== 'curve' && algInfo.normalize !== false) { + var nd; + if (key.type === 'ed25519') { + nd = utils.zeroPadToLength(p.data, 32); + } else { + nd = utils.mpNormalize(p.data); + } + if (nd.toString('binary') !== + p.data.toString('binary')) { + p.data = nd; + normalized = false; + } + } + } + + if (normalized) + key._rfc4253Cache = sshbuf.toBuffer(); + + if (partial && typeof (partial) === 'object') { + partial.remainder = sshbuf.remainder(); + partial.consumed = sshbuf._offset; + } + + return (new Constructor(key)); +} + +function write(key, options) { + assert.object(key); + + var alg = keyTypeToAlg(key); + var i; + + var algInfo = algs.info[key.type]; + if (PrivateKey.isPrivateKey(key)) + algInfo = algs.privInfo[key.type]; + var parts = algInfo.parts; + + var buf = new SSHBuffer({}); + + buf.writeString(alg); + + for (i = 0; i < parts.length; ++i) { + var data = key.part[parts[i]].data; + if (algInfo.normalize !== false) { + if (key.type === 'ed25519') + data = utils.zeroPadToLength(data, 32); + else + data = utils.mpNormalize(data); + } + if (key.type === 'ed25519' && parts[i] === 'k') + data = Buffer.concat([data, key.part.A.data]); + buf.writeBuffer(data); + } + + return (buf.toBuffer()); +} + + +/***/ }), +/* 31 */ +/***/ (function(module, exports, __webpack_require__) { + +try { + var util = __webpack_require__(1); + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + module.exports = __webpack_require__(353); +} + + +/***/ }), +/* 32 */ +/***/ (function(module, exports) { + +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} + + +/***/ }), +/* 33 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// a duplex stream is just a stream that is both readable and writable. +// Since JS doesn't have multiple prototypal inheritance, this class +// prototypally inherits from Readable, and then parasitically from +// Writable. + + + +/**/ + +var pna = __webpack_require__(53); +/**/ + +/**/ +var objectKeys = Object.keys || function (obj) { + var keys = []; + for (var key in obj) { + keys.push(key); + }return keys; +}; +/**/ + +module.exports = Duplex; + +/**/ +var util = __webpack_require__(32); +util.inherits = __webpack_require__(31); +/**/ + +var Readable = __webpack_require__(136); +var Writable = __webpack_require__(139); + +util.inherits(Duplex, Readable); + +{ + // avoid scope creep, the keys array can then be collected + var keys = objectKeys(Writable.prototype); + for (var v = 0; v < keys.length; v++) { + var method = keys[v]; + if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method]; + } +} + +function Duplex(options) { + if (!(this instanceof Duplex)) return new Duplex(options); + + Readable.call(this, options); + Writable.call(this, options); + + if (options && options.readable === false) this.readable = false; + + if (options && options.writable === false) this.writable = false; + + this.allowHalfOpen = true; + if (options && options.allowHalfOpen === false) this.allowHalfOpen = false; + + this.once('end', onend); +} + +Object.defineProperty(Duplex.prototype, 'writableHighWaterMark', { + // making it explicit this property is not enumerable + // because otherwise some prototype manipulation in + // userland will fail + enumerable: false, + get: function () { + return this._writableState.highWaterMark; + } +}); + +// the no-half-open enforcer +function onend() { + // if we allow half-open state, or if the writable side ended, + // then we're ok. + if (this.allowHalfOpen || this._writableState.ended) return; + + // no more data can be written. + // But allow more writes to happen in this tick. + pna.nextTick(onEndNT, this); +} + +function onEndNT(self) { + self.end(); +} + +Object.defineProperty(Duplex.prototype, 'destroyed', { + get: function () { + if (this._readableState === undefined || this._writableState === undefined) { + return false; + } + return this._readableState.destroyed && this._writableState.destroyed; + }, + set: function (value) { + // we ignore the value if the stream + // has not been initialized yet + if (this._readableState === undefined || this._writableState === undefined) { + return; + } + + // backward compatibility, the user is explicitly + // managing destroyed + this._readableState.destroyed = value; + this._writableState.destroyed = value; + } +}); + +Duplex.prototype._destroy = function (err, cb) { + this.push(null); + this.end(); + + pna.nextTick(cb, err); +}; + +/***/ }), +/* 34 */ +/***/ (function(module, exports) { + +var isES5 = (function(){ + "use strict"; + return this === undefined; +})(); + +if (isES5) { + module.exports = { + freeze: Object.freeze, + defineProperty: Object.defineProperty, + getDescriptor: Object.getOwnPropertyDescriptor, + keys: Object.keys, + names: Object.getOwnPropertyNames, + getPrototypeOf: Object.getPrototypeOf, + isArray: Array.isArray, + isES5: isES5, + propertyIsWritable: function(obj, prop) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop); + return !!(!descriptor || descriptor.writable || descriptor.set); + } + }; +} else { + var has = {}.hasOwnProperty; + var str = {}.toString; + var proto = {}.constructor.prototype; + + var ObjectKeys = function (o) { + var ret = []; + for (var key in o) { + if (has.call(o, key)) { + ret.push(key); + } + } + return ret; + }; + + var ObjectGetDescriptor = function(o, key) { + return {value: o[key]}; + }; + + var ObjectDefineProperty = function (o, key, desc) { + o[key] = desc.value; + return o; + }; + + var ObjectFreeze = function (obj) { + return obj; + }; + + var ObjectGetPrototypeOf = function (obj) { + try { + return Object(obj).constructor.prototype; + } + catch (e) { + return proto; + } + }; + + var ArrayIsArray = function (obj) { + try { + return str.call(obj) === "[object Array]"; + } + catch(e) { + return false; + } + }; + + module.exports = { + isArray: ArrayIsArray, + keys: ObjectKeys, + names: ObjectKeys, + defineProperty: ObjectDefineProperty, + getDescriptor: ObjectGetDescriptor, + freeze: ObjectFreeze, + getPrototypeOf: ObjectGetPrototypeOf, + isES5: isES5, + propertyIsWritable: function() { + return true; + } + }; +} + + +/***/ }), +/* 35 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + + +module.exports = { + copy: copy, + checkDataType: checkDataType, + checkDataTypes: checkDataTypes, + coerceToTypes: coerceToTypes, + toHash: toHash, + getProperty: getProperty, + escapeQuotes: escapeQuotes, + equal: __webpack_require__(86), + ucs2length: __webpack_require__(487), + varOccurences: varOccurences, + varReplace: varReplace, + cleanUpCode: cleanUpCode, + finalCleanUpCode: finalCleanUpCode, + schemaHasRules: schemaHasRules, + schemaHasRulesExcept: schemaHasRulesExcept, + toQuotedString: toQuotedString, + getPathExpr: getPathExpr, + getPath: getPath, + getData: getData, + unescapeFragment: unescapeFragment, + unescapeJsonPointer: unescapeJsonPointer, + escapeFragment: escapeFragment, + escapeJsonPointer: escapeJsonPointer +}; + + +function copy(o, to) { + to = to || {}; + for (var key in o) to[key] = o[key]; + return to; +} + + +function checkDataType(dataType, data, negate) { + var EQUAL = negate ? ' !== ' : ' === ' + , AND = negate ? ' || ' : ' && ' + , OK = negate ? '!' : '' + , NOT = negate ? '' : '!'; + switch (dataType) { + case 'null': return data + EQUAL + 'null'; + case 'array': return OK + 'Array.isArray(' + data + ')'; + case 'object': return '(' + OK + data + AND + + 'typeof ' + data + EQUAL + '"object"' + AND + + NOT + 'Array.isArray(' + data + '))'; + case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + + NOT + '(' + data + ' % 1)' + + AND + data + EQUAL + data + ')'; + default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; + } +} + + +function checkDataTypes(dataTypes, data) { + switch (dataTypes.length) { + case 1: return checkDataType(dataTypes[0], data, true); + default: + var code = ''; + var types = toHash(dataTypes); + if (types.array && types.object) { + code = types.null ? '(': '(!' + data + ' || '; + code += 'typeof ' + data + ' !== "object")'; + delete types.null; + delete types.array; + delete types.object; + } + if (types.number) delete types.integer; + for (var t in types) + code += (code ? ' && ' : '' ) + checkDataType(t, data, true); + + return code; + } +} + + +var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); +function coerceToTypes(optionCoerceTypes, dataTypes) { + if (Array.isArray(dataTypes)) { + var types = []; + for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); + return paths[lvl - up]; + } + + if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); + data = 'data' + ((lvl - up) || ''); + if (!jsonPointer) return data; + } + + var expr = data; + var segments = jsonPointer.split('/'); + for (var i=0; i 2) { + alg = 'md5'; + if (parts[0].toLowerCase() === 'md5') + parts = parts.slice(1); + parts = parts.join(''); + /*JSSTYLED*/ + var md5RE = /^[a-fA-F0-9]+$/; + if (!md5RE.test(parts)) + throw (new FingerprintFormatError(fp)); + try { + hash = Buffer.from(parts, 'hex'); + } catch (e) { + throw (new FingerprintFormatError(fp)); + } + } + + if (alg === undefined) + throw (new FingerprintFormatError(fp)); + + if (algs.hashAlgs[alg] === undefined) + throw (new InvalidAlgorithmError(alg)); + + if (enAlgs !== undefined) { + enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); + if (enAlgs.indexOf(alg) === -1) + throw (new InvalidAlgorithmError(alg)); + } + + return (new Fingerprint({ + algorithm: alg, + hash: hash, + type: options.type || 'key' + })); +}; + +function addColons(s) { + /*JSSTYLED*/ + return (s.replace(/(.{2})(?=.)/g, '$1:')); +} + +function base64Strip(s) { + /*JSSTYLED*/ + return (s.replace(/=*$/, '')); +} + +function sshBase64Format(alg, h) { + return (alg.toUpperCase() + ':' + base64Strip(h)); +} + +Fingerprint.isFingerprint = function (obj, ver) { + return (utils.isCompatible(obj, Fingerprint, ver)); +}; + +/* + * API versions for Fingerprint: + * [1,0] -- initial ver + * [1,1] -- first tagged ver + */ +Fingerprint.prototype._sshpkApiVersion = [1, 1]; + +Fingerprint._oldVersionDetect = function (obj) { + assert.func(obj.toString); + assert.func(obj.matches); + return ([1, 0]); +}; + + +/***/ }), +/* 41 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2016 Joyent, Inc. + +module.exports = Certificate; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var crypto = __webpack_require__(4); +var Fingerprint = __webpack_require__(40); +var Signature = __webpack_require__(22); +var errs = __webpack_require__(21); +var util = __webpack_require__(1); +var utils = __webpack_require__(6); +var Key = __webpack_require__(7); +var PrivateKey = __webpack_require__(9); +var Identity = __webpack_require__(45); + +var formats = {}; +formats['openssh'] = __webpack_require__(460); +formats['x509'] = __webpack_require__(172); +formats['pem'] = __webpack_require__(461); + +var CertificateParseError = errs.CertificateParseError; +var InvalidAlgorithmError = errs.InvalidAlgorithmError; + +function Certificate(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.subjects, 'options.subjects'); + utils.assertCompatible(opts.subjects[0], Identity, [1, 0], + 'options.subjects'); + utils.assertCompatible(opts.subjectKey, Key, [1, 0], + 'options.subjectKey'); + utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); + if (opts.issuerKey !== undefined) { + utils.assertCompatible(opts.issuerKey, Key, [1, 0], + 'options.issuerKey'); + } + assert.object(opts.signatures, 'options.signatures'); + assert.buffer(opts.serial, 'options.serial'); + assert.date(opts.validFrom, 'options.validFrom'); + assert.date(opts.validUntil, 'optons.validUntil'); + + assert.optionalArrayOfString(opts.purposes, 'options.purposes'); + + this._hashCache = {}; + + this.subjects = opts.subjects; + this.issuer = opts.issuer; + this.subjectKey = opts.subjectKey; + this.issuerKey = opts.issuerKey; + this.signatures = opts.signatures; + this.serial = opts.serial; + this.validFrom = opts.validFrom; + this.validUntil = opts.validUntil; + this.purposes = opts.purposes; +} + +Certificate.formats = formats; + +Certificate.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'x509'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +Certificate.prototype.toString = function (format, options) { + if (format === undefined) + format = 'pem'; + return (this.toBuffer(format, options).toString()); +}; + +Certificate.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'certificate', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; + +Certificate.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); + + if (this._hashCache[algo]) + return (this._hashCache[algo]); + + var hash = crypto.createHash(algo). + update(this.toBuffer('x509')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; + +Certificate.prototype.isExpired = function (when) { + if (when === undefined) + when = new Date(); + return (!((when.getTime() >= this.validFrom.getTime()) && + (when.getTime() < this.validUntil.getTime()))); +}; + +Certificate.prototype.isSignedBy = function (issuerCert) { + utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); + + if (!this.issuer.equals(issuerCert.subjects[0])) + return (false); + if (this.issuer.purposes && this.issuer.purposes.length > 0 && + this.issuer.purposes.indexOf('ca') === -1) { + return (false); + } + + return (this.isSignedByKey(issuerCert.subjectKey)); +}; + +Certificate.prototype.isSignedByKey = function (issuerKey) { + utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); + + if (this.issuerKey !== undefined) { + return (this.issuerKey. + fingerprint('sha512').matches(issuerKey)); + } + + var fmt = Object.keys(this.signatures)[0]; + var valid = formats[fmt].verify(this, issuerKey); + if (valid) + this.issuerKey = issuerKey; + return (valid); +}; + +Certificate.prototype.signWith = function (key) { + utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); + var fmts = Object.keys(formats); + var didOne = false; + for (var i = 0; i < fmts.length; ++i) { + if (fmts[i] !== 'pem') { + var ret = formats[fmts[i]].sign(this, key); + if (ret === true) + didOne = true; + } + } + if (!didOne) { + throw (new Error('Failed to sign the certificate for any ' + + 'available certificate formats')); + } +}; + +Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; + + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); + + utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); + + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); + + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; + + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + + /* Self-signed certs are always CAs. */ + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + + /* + * If we weren't explicitly given any other purposes, do the sensible + * thing and add some basic ones depending on the subject type. + */ + if (purposes.length <= 3) { + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); + }); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); + } + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); + } + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); + } + } + + var cert = new Certificate({ + subjects: subjects, + issuer: subjects[0], + subjectKey: key.toPublic(), + issuerKey: key.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(key); + + return (cert); +}; + +Certificate.create = + function (subjectOrSubjects, key, issuer, issuerKey, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; + + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); + + utils.assertCompatible(key, Key, [1, 0], 'key'); + if (PrivateKey.isPrivateKey(key)) + key = key.toPublic(); + utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); + utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); + + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); + + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; + + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + + if (options.ca === true) { + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + } + + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); + }); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); + } + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); + } + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); + } + + var cert = new Certificate({ + subjects: subjects, + issuer: issuer, + subjectKey: key, + issuerKey: issuerKey.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(issuerKey); + + return (cert); +}; + +Certificate.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + return (k); + } catch (e) { + throw (new CertificateParseError(options.filename, format, e)); + } +}; + +Certificate.isCertificate = function (obj, ver) { + return (utils.isCompatible(obj, Certificate, ver)); +}; + +/* + * API versions for Certificate: + * [1,0] -- initial ver + */ +Certificate.prototype._sshpkApiVersion = [1, 0]; + +Certificate._oldVersionDetect = function (obj) { + return ([1, 0]); +}; + + +/***/ }), +/* 42 */ +/***/ (function(module, exports, __webpack_require__) { + +// Basic Javascript Elliptic Curve implementation +// Ported loosely from BouncyCastle's Java EC code +// Only Fp curves implemented for now + +// Requires jsbn.js and jsbn2.js +var BigInteger = __webpack_require__(27).BigInteger +var Barrett = BigInteger.prototype.Barrett + +// ---------------- +// ECFieldElementFp + +// constructor +function ECFieldElementFp(q,x) { + this.x = x; + // TODO if(x.compareTo(q) >= 0) error + this.q = q; +} + +function feFpEquals(other) { + if(other == this) return true; + return (this.q.equals(other.q) && this.x.equals(other.x)); +} + +function feFpToBigInteger() { + return this.x; +} + +function feFpNegate() { + return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); +} + +function feFpAdd(b) { + return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); +} + +function feFpSubtract(b) { + return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); +} + +function feFpMultiply(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); +} + +function feFpSquare() { + return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); +} + +function feFpDivide(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); +} + +ECFieldElementFp.prototype.equals = feFpEquals; +ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; +ECFieldElementFp.prototype.negate = feFpNegate; +ECFieldElementFp.prototype.add = feFpAdd; +ECFieldElementFp.prototype.subtract = feFpSubtract; +ECFieldElementFp.prototype.multiply = feFpMultiply; +ECFieldElementFp.prototype.square = feFpSquare; +ECFieldElementFp.prototype.divide = feFpDivide; + +// ---------------- +// ECPointFp + +// constructor +function ECPointFp(curve,x,y,z) { + this.curve = curve; + this.x = x; + this.y = y; + // Projective coordinates: either zinv == null or z * zinv == 1 + // z and zinv are just BigIntegers, not fieldElements + if(z == null) { + this.z = BigInteger.ONE; + } + else { + this.z = z; + } + this.zinv = null; + //TODO: compression flag +} + +function pointFpGetX() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.x.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); +} + +function pointFpGetY() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.y.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); +} + +function pointFpEquals(other) { + if(other == this) return true; + if(this.isInfinity()) return other.isInfinity(); + if(other.isInfinity()) return this.isInfinity(); + var u, v; + // u = Y2 * Z1 - Y1 * Z2 + u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); + if(!u.equals(BigInteger.ZERO)) return false; + // v = X2 * Z1 - X1 * Z2 + v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); + return v.equals(BigInteger.ZERO); +} + +function pointFpIsInfinity() { + if((this.x == null) && (this.y == null)) return true; + return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); +} + +function pointFpNegate() { + return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); +} + +function pointFpAdd(b) { + if(this.isInfinity()) return b; + if(b.isInfinity()) return this; + + // u = Y2 * Z1 - Y1 * Z2 + var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); + // v = X2 * Z1 - X1 * Z2 + var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); + + if(BigInteger.ZERO.equals(v)) { + if(BigInteger.ZERO.equals(u)) { + return this.twice(); // this == b, so double + } + return this.curve.getInfinity(); // this = -b, so infinity + } + + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); + var x2 = b.x.toBigInteger(); + var y2 = b.y.toBigInteger(); + + var v2 = v.square(); + var v3 = v2.multiply(v); + var x1v2 = x1.multiply(v2); + var zu2 = u.square().multiply(this.z); + + // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) + var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); + // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 + var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); + // z3 = v^3 * z1 * z2 + var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); + + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} + +function pointFpTwice() { + if(this.isInfinity()) return this; + if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); + + // TODO: optimized handling of constants + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); + + var y1z1 = y1.multiply(this.z); + var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); + var a = this.curve.a.toBigInteger(); + + // w = 3 * x1^2 + a * z1^2 + var w = x1.square().multiply(THREE); + if(!BigInteger.ZERO.equals(a)) { + w = w.add(this.z.square().multiply(a)); + } + w = w.mod(this.curve.q); + //this.curve.reduce(w); + // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) + var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); + // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 + var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); + // z3 = 8 * (y1 * z1)^3 + var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); + + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} + +// Simple NAF (Non-Adjacent Form) multiplication algorithm +// TODO: modularize the multiplication algorithm +function pointFpMultiply(k) { + if(this.isInfinity()) return this; + if(k.signum() == 0) return this.curve.getInfinity(); + + var e = k; + var h = e.multiply(new BigInteger("3")); + + var neg = this.negate(); + var R = this; + + var i; + for(i = h.bitLength() - 2; i > 0; --i) { + R = R.twice(); + + var hBit = h.testBit(i); + var eBit = e.testBit(i); + + if (hBit != eBit) { + R = R.add(hBit ? this : neg); + } + } + + return R; +} + +// Compute this*j + x*k (simultaneous multiplication) +function pointFpMultiplyTwo(j,x,k) { + var i; + if(j.bitLength() > k.bitLength()) + i = j.bitLength() - 1; + else + i = k.bitLength() - 1; + + var R = this.curve.getInfinity(); + var both = this.add(x); + while(i >= 0) { + R = R.twice(); + if(j.testBit(i)) { + if(k.testBit(i)) { + R = R.add(both); + } + else { + R = R.add(this); + } + } + else { + if(k.testBit(i)) { + R = R.add(x); + } + } + --i; + } + + return R; +} + +ECPointFp.prototype.getX = pointFpGetX; +ECPointFp.prototype.getY = pointFpGetY; +ECPointFp.prototype.equals = pointFpEquals; +ECPointFp.prototype.isInfinity = pointFpIsInfinity; +ECPointFp.prototype.negate = pointFpNegate; +ECPointFp.prototype.add = pointFpAdd; +ECPointFp.prototype.twice = pointFpTwice; +ECPointFp.prototype.multiply = pointFpMultiply; +ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; + +// ---------------- +// ECCurveFp + +// constructor +function ECCurveFp(q,a,b) { + this.q = q; + this.a = this.fromBigInteger(a); + this.b = this.fromBigInteger(b); + this.infinity = new ECPointFp(this, null, null); + this.reducer = new Barrett(this.q); +} + +function curveFpGetQ() { + return this.q; +} + +function curveFpGetA() { + return this.a; +} + +function curveFpGetB() { + return this.b; +} + +function curveFpEquals(other) { + if(other == this) return true; + return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); +} + +function curveFpGetInfinity() { + return this.infinity; +} + +function curveFpFromBigInteger(x) { + return new ECFieldElementFp(this.q, x); +} + +function curveReduce(x) { + this.reducer.reduce(x); +} + +// for now, work with hex strings because they're easier in JS +function curveFpDecodePointHex(s) { + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + case 3: + // point compression not supported yet + return null; + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); + + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); + + default: // unsupported + return null; + } +} + +function curveFpEncodePointHex(p) { + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var yHex = p.getY().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) { + xHex = "0" + xHex; + } + while (yHex.length < oLen) { + yHex = "0" + yHex; + } + return "04" + xHex + yHex; +} + +ECCurveFp.prototype.getQ = curveFpGetQ; +ECCurveFp.prototype.getA = curveFpGetA; +ECCurveFp.prototype.getB = curveFpGetB; +ECCurveFp.prototype.equals = curveFpEquals; +ECCurveFp.prototype.getInfinity = curveFpGetInfinity; +ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; +ECCurveFp.prototype.reduce = curveReduce; +//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; +ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; + +// from: https://github.com/kaielvin/jsbn-ec-point-compression +ECCurveFp.prototype.decodePointHex = function(s) +{ + var yIsEven; + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + yIsEven = false; + case 3: + if(yIsEven == undefined) yIsEven = true; + var len = s.length - 2; + var xHex = s.substr(2, len); + var x = this.fromBigInteger(new BigInteger(xHex,16)); + var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); + var beta = alpha.sqrt(); + + if (beta == null) throw "Invalid point compression"; + + var betaValue = beta.toBigInteger(); + if (betaValue.testBit(0) != yIsEven) + { + // Use the other root + beta = this.fromBigInteger(this.getQ().subtract(betaValue)); + } + return new ECPointFp(this,x,beta); + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); + + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); + + default: // unsupported + return null; + } +} +ECCurveFp.prototype.encodeCompressedPointHex = function(p) +{ + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) + xHex = "0" + xHex; + var yPrefix; + if(p.getY().toBigInteger().isEven()) yPrefix = "02"; + else yPrefix = "03"; + + return yPrefix + xHex; +} + + +ECFieldElementFp.prototype.getR = function() +{ + if(this.r != undefined) return this.r; + + this.r = null; + var bitLength = this.q.bitLength(); + if (bitLength > 128) + { + var firstWord = this.q.shiftRight(bitLength - 64); + if (firstWord.intValue() == -1) + { + this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); + } + } + return this.r; +} +ECFieldElementFp.prototype.modMult = function(x1,x2) +{ + return this.modReduce(x1.multiply(x2)); +} +ECFieldElementFp.prototype.modReduce = function(x) +{ + if (this.getR() != null) + { + var qLen = q.bitLength(); + while (x.bitLength() > (qLen + 1)) + { + var u = x.shiftRight(qLen); + var v = x.subtract(u.shiftLeft(qLen)); + if (!this.getR().equals(BigInteger.ONE)) + { + u = u.multiply(this.getR()); + } + x = u.add(v); + } + while (x.compareTo(q) >= 0) + { + x = x.subtract(q); + } + } + else + { + x = x.mod(q); + } + return x; +} +ECFieldElementFp.prototype.sqrt = function() +{ + if (!this.q.testBit(0)) throw "unsupported"; + + // p mod 4 == 3 + if (this.q.testBit(1)) + { + var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); + return z.square().equals(this) ? z : null; + } + + // p mod 4 == 1 + var qMinusOne = this.q.subtract(BigInteger.ONE); + + var legendreExponent = qMinusOne.shiftRight(1); + if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) + { + return null; + } + + var u = qMinusOne.shiftRight(2); + var k = u.shiftLeft(1).add(BigInteger.ONE); + + var Q = this.x; + var fourQ = modDouble(modDouble(Q)); + + var U, V; + do + { + var P; + do + { + P = new BigInteger(this.q.bitLength(), new SecureRandom()); + } + while (P.compareTo(this.q) >= 0 + || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); + + var result = this.lucasSequence(P, Q, k); + U = result[0]; + V = result[1]; + + if (this.modMult(V, V).equals(fourQ)) + { + // Integer division by 2, mod q + if (V.testBit(0)) + { + V = V.add(q); + } + + V = V.shiftRight(1); + + return new ECFieldElementFp(q,V); + } + } + while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); + + return null; +} +ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) +{ + var n = k.bitLength(); + var s = k.getLowestSetBit(); + + var Uh = BigInteger.ONE; + var Vl = BigInteger.TWO; + var Vh = P; + var Ql = BigInteger.ONE; + var Qh = BigInteger.ONE; + + for (var j = n - 1; j >= s + 1; --j) + { + Ql = this.modMult(Ql, Qh); + + if (k.testBit(j)) + { + Qh = this.modMult(Ql, Q); + Uh = this.modMult(Uh, Vh); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); + } + else + { + Qh = Ql; + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + } + } + + Ql = this.modMult(Ql, Qh); + Qh = this.modMult(Ql, Q); + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Ql = this.modMult(Ql, Qh); + + for (var j = 1; j <= s; ++j) + { + Uh = this.modMult(Uh, Vl); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + Ql = this.modMult(Ql, Ql); + } + + return [ Uh, Vl ]; +} + +var exports = { + ECCurveFp: ECCurveFp, + ECPointFp: ECPointFp, + ECFieldElementFp: ECFieldElementFp +} + +module.exports = exports + + +/***/ }), +/* 43 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + read: read, + readPkcs8: readPkcs8, + write: write, + writePkcs8: writePkcs8, + + readECDSACurve: readECDSACurve, + writeECDSACurve: writeECDSACurve +}; + +var assert = __webpack_require__(2); +var asn1 = __webpack_require__(24); +var Buffer = __webpack_require__(5).Buffer; +var algs = __webpack_require__(8); +var utils = __webpack_require__(6); +var Key = __webpack_require__(7); +var PrivateKey = __webpack_require__(9); +var pem = __webpack_require__(28); + +function read(buf, options) { + return (pem.read(buf, options, 'pkcs8')); +} + +function write(key, options) { + return (pem.write(key, options, 'pkcs8')); +} + +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +} + +function readPkcs8(alg, type, der) { + /* Private keys in pkcs#8 format have a weird extra int */ + if (der.peek() === asn1.Ber.Integer) { + assert.strictEqual(type, 'private', + 'unexpected Integer at start of public key'); + der.readString(asn1.Ber.Integer, true); + } + + der.readSequence(); + var next = der.offset + der.length; + + var oid = der.readOID(); + switch (oid) { + case '1.2.840.113549.1.1.1': + der._offset = next; + if (type === 'public') + return (readPkcs8RSAPublic(der)); + else + return (readPkcs8RSAPrivate(der)); + case '1.2.840.10040.4.1': + if (type === 'public') + return (readPkcs8DSAPublic(der)); + else + return (readPkcs8DSAPrivate(der)); + case '1.2.840.10045.2.1': + if (type === 'public') + return (readPkcs8ECDSAPublic(der)); + else + return (readPkcs8ECDSAPrivate(der)); + case '1.3.101.112': + if (type === 'public') { + return (readPkcs8EdDSAPublic(der)); + } else { + return (readPkcs8EdDSAPrivate(der)); + } + case '1.3.101.110': + if (type === 'public') { + return (readPkcs8X25519Public(der)); + } else { + return (readPkcs8X25519Private(der)); + } + default: + throw (new Error('Unknown key type OID ' + oid)); + } +} + +function readPkcs8RSAPublic(der) { + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); + der.readSequence(); + + // modulus + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'exponent'); + + // now, make the key + var key = { + type: 'rsa', + source: der.originalInput, + parts: [ + { name: 'e', data: e }, + { name: 'n', data: n } + ] + }; + + return (new Key(key)); +} + +function readPkcs8RSAPrivate(der) { + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + + var ver = readMPInt(der, 'version'); + assert.equal(ver[0], 0x0, 'unknown RSA private key version'); + + // modulus then public exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'public exponent'); + var d = readMPInt(der, 'private exponent'); + var p = readMPInt(der, 'prime1'); + var q = readMPInt(der, 'prime2'); + var dmodp = readMPInt(der, 'exponent1'); + var dmodq = readMPInt(der, 'exponent2'); + var iqmp = readMPInt(der, 'iqmp'); + + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'n', data: n }, + { name: 'e', data: e }, + { name: 'd', data: d }, + { name: 'iqmp', data: iqmp }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'dmodp', data: dmodp }, + { name: 'dmodq', data: dmodq } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs8DSAPublic(der) { + der.readSequence(); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); + + var y = readMPInt(der, 'y'); + + // now, make the key + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y } + ] + }; + + return (new Key(key)); +} + +function readPkcs8DSAPrivate(der) { + der.readSequence(); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + der.readSequence(asn1.Ber.OctetString); + var x = readMPInt(der, 'x'); + + /* The pkcs#8 format does not include the public key */ + var y = utils.calculateDSAPublic(g, p, x); + + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y }, + { name: 'x', data: x } + ] + }; + + return (new PrivateKey(key)); +} + +function readECDSACurve(der) { + var curveName, curveNames; + var j, c, cd; + + if (der.peek() === asn1.Ber.OID) { + var oid = der.readOID(); + + curveNames = Object.keys(algs.curves); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + if (cd.pkcs8oid === oid) { + curveName = c; + break; + } + } + + } else { + // ECParameters sequence + der.readSequence(); + var version = der.readString(asn1.Ber.Integer, true); + assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); + + var curve = {}; + + // FieldID sequence + der.readSequence(); + var fieldTypeOid = der.readOID(); + assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', + 'ECDSA key is not from a prime-field'); + var p = curve.p = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + /* + * p always starts with a 1 bit, so count the zeros to get its + * real size. + */ + curve.size = p.length * 8 - utils.countZeros(p); + + // Curve sequence + der.readSequence(); + curve.a = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + curve.b = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + if (der.peek() === asn1.Ber.BitString) + curve.s = der.readString(asn1.Ber.BitString, true); + + // Combined Gx and Gy + curve.G = der.readString(asn1.Ber.OctetString, true); + assert.strictEqual(curve.G[0], 0x4, + 'uncompressed G is required'); + + curve.n = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + curve.h = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + + 'required'); + + curveNames = Object.keys(algs.curves); + var ks = Object.keys(curve); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + var equal = true; + for (var i = 0; i < ks.length; ++i) { + var k = ks[i]; + if (cd[k] === undefined) + continue; + if (typeof (cd[k]) === 'object' && + cd[k].equals !== undefined) { + if (!cd[k].equals(curve[k])) { + equal = false; + break; + } + } else if (Buffer.isBuffer(cd[k])) { + if (cd[k].toString('binary') + !== curve[k].toString('binary')) { + equal = false; + break; + } + } else { + if (cd[k] !== curve[k]) { + equal = false; + break; + } + } + } + if (equal) { + curveName = c; + break; + } + } + } + return (curveName); +} + +function readPkcs8ECDSAPrivate(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); + + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + + var version = readMPInt(der, 'version'); + assert.equal(version[0], 1, 'unknown version of ECDSA key'); + + var d = der.readString(asn1.Ber.OctetString, true); + der.readSequence(0xa1); + + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q }, + { name: 'd', data: d } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs8ECDSAPublic(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); + + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q } + ] + }; + + return (new Key(key)); +} + +function readPkcs8EdDSAPublic(der) { + if (der.peek() === 0x00) + der.readByte(); + + var A = utils.readBitString(der); + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; + + return (new Key(key)); +} + +function readPkcs8X25519Public(der) { + var A = utils.readBitString(der); + + var key = { + type: 'curve25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; + + return (new Key(key)); +} + +function readPkcs8EdDSAPrivate(der) { + if (der.peek() === 0x00) + der.readByte(); + + der.readSequence(asn1.Ber.OctetString); + var k = der.readString(asn1.Ber.OctetString, true); + k = utils.zeroPadToLength(k, 32); + + var A; + if (der.peek() === asn1.Ber.BitString) { + A = utils.readBitString(der); + A = utils.zeroPadToLength(A, 32); + } else { + A = utils.calculateED25519Public(k); + } + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: utils.zeroPadToLength(k, 32) } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs8X25519Private(der) { + if (der.peek() === 0x00) + der.readByte(); + + der.readSequence(asn1.Ber.OctetString); + var k = der.readString(asn1.Ber.OctetString, true); + k = utils.zeroPadToLength(k, 32); + + var A = utils.calculateX25519Public(k); + + var key = { + type: 'curve25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: utils.zeroPadToLength(k, 32) } + ] + }; + + return (new PrivateKey(key)); +} + +function writePkcs8(der, key) { + der.startSequence(); + + if (PrivateKey.isPrivateKey(key)) { + var sillyInt = Buffer.from([0]); + der.writeBuffer(sillyInt, asn1.Ber.Integer); + } + + der.startSequence(); + switch (key.type) { + case 'rsa': + der.writeOID('1.2.840.113549.1.1.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8RSAPrivate(key, der); + else + writePkcs8RSAPublic(key, der); + break; + case 'dsa': + der.writeOID('1.2.840.10040.4.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8DSAPrivate(key, der); + else + writePkcs8DSAPublic(key, der); + break; + case 'ecdsa': + der.writeOID('1.2.840.10045.2.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8ECDSAPrivate(key, der); + else + writePkcs8ECDSAPublic(key, der); + break; + case 'ed25519': + der.writeOID('1.3.101.112'); + if (PrivateKey.isPrivateKey(key)) + throw (new Error('Ed25519 private keys in pkcs8 ' + + 'format are not supported')); + writePkcs8EdDSAPublic(key, der); + break; + default: + throw (new Error('Unsupported key type: ' + key.type)); + } + + der.endSequence(); +} + +function writePkcs8RSAPrivate(key, der) { + der.writeNull(); + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + + var version = Buffer.from([0]); + der.writeBuffer(version, asn1.Ber.Integer); + + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.writeBuffer(key.part.d.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + if (!key.part.dmodp || !key.part.dmodq) + utils.addRSAMissing(key); + der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); + der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); + der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); + + der.endSequence(); + der.endSequence(); +} + +function writePkcs8RSAPublic(key, der) { + der.writeNull(); + der.endSequence(); + + der.startSequence(asn1.Ber.BitString); + der.writeByte(0x00); + + der.startSequence(); + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.endSequence(); + + der.endSequence(); +} + +function writePkcs8DSAPrivate(key, der) { + der.startSequence(); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.endSequence(); + + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.writeBuffer(key.part.x.data, asn1.Ber.Integer); + der.endSequence(); +} + +function writePkcs8DSAPublic(key, der) { + der.startSequence(); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.endSequence(); + der.endSequence(); + + der.startSequence(asn1.Ber.BitString); + der.writeByte(0x00); + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.endSequence(); +} + +function writeECDSACurve(key, der) { + var curve = algs.curves[key.curve]; + if (curve.pkcs8oid) { + /* This one has a name in pkcs#8, so just write the oid */ + der.writeOID(curve.pkcs8oid); + + } else { + // ECParameters sequence + der.startSequence(); + + var version = Buffer.from([1]); + der.writeBuffer(version, asn1.Ber.Integer); + + // FieldID sequence + der.startSequence(); + der.writeOID('1.2.840.10045.1.1'); // prime-field + der.writeBuffer(curve.p, asn1.Ber.Integer); + der.endSequence(); + + // Curve sequence + der.startSequence(); + var a = curve.p; + if (a[0] === 0x0) + a = a.slice(1); + der.writeBuffer(a, asn1.Ber.OctetString); + der.writeBuffer(curve.b, asn1.Ber.OctetString); + der.writeBuffer(curve.s, asn1.Ber.BitString); + der.endSequence(); + + der.writeBuffer(curve.G, asn1.Ber.OctetString); + der.writeBuffer(curve.n, asn1.Ber.Integer); + var h = curve.h; + if (!h) { + h = Buffer.from([1]); + } + der.writeBuffer(h, asn1.Ber.Integer); + + // ECParameters + der.endSequence(); + } +} + +function writePkcs8ECDSAPublic(key, der) { + writeECDSACurve(key, der); + der.endSequence(); + + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); +} + +function writePkcs8ECDSAPrivate(key, der) { + writeECDSACurve(key, der); + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + + var version = Buffer.from([1]); + der.writeBuffer(version, asn1.Ber.Integer); + + der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); + + der.startSequence(0xa1); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); + der.endSequence(); + + der.endSequence(); + der.endSequence(); +} + +function writePkcs8EdDSAPublic(key, der) { + der.endSequence(); + + utils.writeBitString(der, key.part.A.data); +} + +function writePkcs8EdDSAPrivate(key, der) { + der.endSequence(); + + var k = utils.mpNormalize(key.part.k.data, true); + der.startSequence(asn1.Ber.OctetString); + der.writeBuffer(k, asn1.Ber.OctetString); + der.endSequence(); +} + + +/***/ }), +/* 44 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = SSHBuffer; + +var assert = __webpack_require__(2); +var Buffer = __webpack_require__(5).Buffer; + +function SSHBuffer(opts) { + assert.object(opts, 'options'); + if (opts.buffer !== undefined) + assert.buffer(opts.buffer, 'options.buffer'); + + this._size = opts.buffer ? opts.buffer.length : 1024; + this._buffer = opts.buffer || Buffer.alloc(this._size); + this._offset = 0; +} + +SSHBuffer.prototype.toBuffer = function () { + return (this._buffer.slice(0, this._offset)); +}; + +SSHBuffer.prototype.atEnd = function () { + return (this._offset >= this._buffer.length); +}; + +SSHBuffer.prototype.remainder = function () { + return (this._buffer.slice(this._offset)); +}; + +SSHBuffer.prototype.skip = function (n) { + this._offset += n; +}; + +SSHBuffer.prototype.expand = function () { + this._size *= 2; + var buf = Buffer.alloc(this._size); + this._buffer.copy(buf, 0); + this._buffer = buf; +}; + +SSHBuffer.prototype.readPart = function () { + return ({data: this.readBuffer()}); +}; + +SSHBuffer.prototype.readBuffer = function () { + var len = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + assert.ok(this._offset + len <= this._buffer.length, + 'length out of bounds at +0x' + this._offset.toString(16) + + ' (data truncated?)'); + var buf = this._buffer.slice(this._offset, this._offset + len); + this._offset += len; + return (buf); +}; + +SSHBuffer.prototype.readString = function () { + return (this.readBuffer().toString()); +}; + +SSHBuffer.prototype.readCString = function () { + var offset = this._offset; + while (offset < this._buffer.length && + this._buffer[offset] !== 0x00) + offset++; + assert.ok(offset < this._buffer.length, 'c string does not terminate'); + var str = this._buffer.slice(this._offset, offset).toString(); + this._offset = offset + 1; + return (str); +}; + +SSHBuffer.prototype.readInt = function () { + var v = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + return (v); +}; + +SSHBuffer.prototype.readInt64 = function () { + assert.ok(this._offset + 8 < this._buffer.length, + 'buffer not long enough to read Int64'); + var v = this._buffer.slice(this._offset, this._offset + 8); + this._offset += 8; + return (v); +}; + +SSHBuffer.prototype.readChar = function () { + var v = this._buffer[this._offset++]; + return (v); +}; + +SSHBuffer.prototype.writeBuffer = function (buf) { + while (this._offset + 4 + buf.length > this._size) + this.expand(); + this._buffer.writeUInt32BE(buf.length, this._offset); + this._offset += 4; + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; + +SSHBuffer.prototype.writeString = function (str) { + this.writeBuffer(Buffer.from(str, 'utf8')); +}; + +SSHBuffer.prototype.writeCString = function (str) { + while (this._offset + 1 + str.length > this._size) + this.expand(); + this._buffer.write(str, this._offset); + this._offset += str.length; + this._buffer[this._offset++] = 0; +}; + +SSHBuffer.prototype.writeInt = function (v) { + while (this._offset + 4 > this._size) + this.expand(); + this._buffer.writeUInt32BE(v, this._offset); + this._offset += 4; +}; + +SSHBuffer.prototype.writeInt64 = function (v) { + assert.buffer(v, 'value'); + if (v.length > 8) { + var lead = v.slice(0, v.length - 8); + for (var i = 0; i < lead.length; ++i) { + assert.strictEqual(lead[i], 0, + 'must fit in 64 bits of precision'); + } + v = v.slice(v.length - 8, v.length); + } + while (this._offset + 8 > this._size) + this.expand(); + v.copy(this._buffer, this._offset); + this._offset += 8; +}; + +SSHBuffer.prototype.writeChar = function (v) { + while (this._offset + 1 > this._size) + this.expand(); + this._buffer[this._offset++] = v; +}; + +SSHBuffer.prototype.writePart = function (p) { + this.writeBuffer(p.data); +}; + +SSHBuffer.prototype.write = function (buf) { + while (this._offset + buf.length > this._size) + this.expand(); + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; + + +/***/ }), +/* 45 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = Identity; + +var assert = __webpack_require__(2); +var algs = __webpack_require__(8); +var crypto = __webpack_require__(4); +var Fingerprint = __webpack_require__(40); +var Signature = __webpack_require__(22); +var errs = __webpack_require__(21); +var util = __webpack_require__(1); +var utils = __webpack_require__(6); +var asn1 = __webpack_require__(24); +var Buffer = __webpack_require__(5).Buffer; + +/*JSSTYLED*/ +var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; + +var oids = {}; +oids.cn = '2.5.4.3'; +oids.o = '2.5.4.10'; +oids.ou = '2.5.4.11'; +oids.l = '2.5.4.7'; +oids.s = '2.5.4.8'; +oids.c = '2.5.4.6'; +oids.sn = '2.5.4.4'; +oids.dc = '0.9.2342.19200300.100.1.25'; +oids.uid = '0.9.2342.19200300.100.1.1'; +oids.mail = '0.9.2342.19200300.100.1.3'; + +var unoids = {}; +Object.keys(oids).forEach(function (k) { + unoids[oids[k]] = k; +}); + +function Identity(opts) { + var self = this; + assert.object(opts, 'options'); + assert.arrayOfObject(opts.components, 'options.components'); + this.components = opts.components; + this.componentLookup = {}; + this.components.forEach(function (c) { + if (c.name && !c.oid) + c.oid = oids[c.name]; + if (c.oid && !c.name) + c.name = unoids[c.oid]; + if (self.componentLookup[c.name] === undefined) + self.componentLookup[c.name] = []; + self.componentLookup[c.name].push(c); + }); + if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { + this.cn = this.componentLookup.cn[0].value; + } + assert.optionalString(opts.type, 'options.type'); + if (opts.type === undefined) { + if (this.components.length === 1 && + this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; + + } else if (this.componentLookup.dc && + this.components.length === this.componentLookup.dc.length) { + this.type = 'host'; + this.hostname = this.componentLookup.dc.map( + function (c) { + return (c.value); + }).join('.'); + + } else if (this.componentLookup.uid && + this.components.length === + this.componentLookup.uid.length) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; + + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; + + } else if (this.componentLookup.uid && + this.componentLookup.uid.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; + + } else if (this.componentLookup.mail && + this.componentLookup.mail.length === 1) { + this.type = 'email'; + this.email = this.componentLookup.mail[0].value; + + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.cn[0].value; + + } else { + this.type = 'unknown'; + } + } else { + this.type = opts.type; + if (this.type === 'host') + this.hostname = opts.hostname; + else if (this.type === 'user') + this.uid = opts.uid; + else if (this.type === 'email') + this.email = opts.email; + else + throw (new Error('Unknown type ' + this.type)); + } +} + +Identity.prototype.toString = function () { + return (this.components.map(function (c) { + return (c.name.toUpperCase() + '=' + c.value); + }).join(', ')); +}; + +/* + * These are from X.680 -- PrintableString allowed chars are in section 37.4 + * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to + * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 + * (the basic ASCII character set). + */ +/* JSSTYLED */ +var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; +/* JSSTYLED */ +var NOT_IA5 = /[^\x00-\x7f]/; + +Identity.prototype.toAsn1 = function (der, tag) { + der.startSequence(tag); + this.components.forEach(function (c) { + der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); + der.startSequence(); + der.writeOID(c.oid); + /* + * If we fit in a PrintableString, use that. Otherwise use an + * IA5String or UTF8String. + * + * If this identity was parsed from a DN, use the ASN.1 types + * from the original representation (otherwise this might not + * be a full match for the original in some validators). + */ + if (c.asn1type === asn1.Ber.Utf8String || + c.value.match(NOT_IA5)) { + var v = Buffer.from(c.value, 'utf8'); + der.writeBuffer(v, asn1.Ber.Utf8String); + + } else if (c.asn1type === asn1.Ber.IA5String || + c.value.match(NOT_PRINTABLE)) { + der.writeString(c.value, asn1.Ber.IA5String); + + } else { + var type = asn1.Ber.PrintableString; + if (c.asn1type !== undefined) + type = c.asn1type; + der.writeString(c.value, type); + } + der.endSequence(); + der.endSequence(); + }); + der.endSequence(); +}; + +function globMatch(a, b) { + if (a === '**' || b === '**') + return (true); + var aParts = a.split('.'); + var bParts = b.split('.'); + if (aParts.length !== bParts.length) + return (false); + for (var i = 0; i < aParts.length; ++i) { + if (aParts[i] === '*' || bParts[i] === '*') + continue; + if (aParts[i] !== bParts[i]) + return (false); + } + return (true); +} + +Identity.prototype.equals = function (other) { + if (!Identity.isIdentity(other, [1, 0])) + return (false); + if (other.components.length !== this.components.length) + return (false); + for (var i = 0; i < this.components.length; ++i) { + if (this.components[i].oid !== other.components[i].oid) + return (false); + if (!globMatch(this.components[i].value, + other.components[i].value)) { + return (false); + } + } + return (true); +}; + +Identity.forHost = function (hostname) { + assert.string(hostname, 'hostname'); + return (new Identity({ + type: 'host', + hostname: hostname, + components: [ { name: 'cn', value: hostname } ] + })); +}; + +Identity.forUser = function (uid) { + assert.string(uid, 'uid'); + return (new Identity({ + type: 'user', + uid: uid, + components: [ { name: 'uid', value: uid } ] + })); +}; + +Identity.forEmail = function (email) { + assert.string(email, 'email'); + return (new Identity({ + type: 'email', + email: email, + components: [ { name: 'mail', value: email } ] + })); +}; + +Identity.parseDN = function (dn) { + assert.string(dn, 'dn'); + var parts = dn.split(','); + var cmps = parts.map(function (c) { + c = c.trim(); + var eqPos = c.indexOf('='); + var name = c.slice(0, eqPos).toLowerCase(); + var value = c.slice(eqPos + 1); + return ({ name: name, value: value }); + }); + return (new Identity({ components: cmps })); +}; + +Identity.parseAsn1 = function (der, top) { + var components = []; + der.readSequence(top); + var end = der.offset + der.length; + while (der.offset < end) { + der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); + var after = der.offset + der.length; + der.readSequence(); + var oid = der.readOID(); + var type = der.peek(); + var value; + switch (type) { + case asn1.Ber.PrintableString: + case asn1.Ber.IA5String: + case asn1.Ber.OctetString: + case asn1.Ber.T61String: + value = der.readString(type); + break; + case asn1.Ber.Utf8String: + value = der.readString(type, true); + value = value.toString('utf8'); + break; + case asn1.Ber.CharacterString: + case asn1.Ber.BMPString: + value = der.readString(type, true); + value = value.toString('utf16le'); + break; + default: + throw (new Error('Unknown asn1 type ' + type)); + } + components.push({ oid: oid, asn1type: type, value: value }); + der._offset = after; + } + der._offset = end; + return (new Identity({ + components: components + })); +}; + +Identity.isIdentity = function (obj, ver) { + return (utils.isCompatible(obj, Identity, ver)); +}; + +/* + * API versions for Identity: + * [1,0] -- initial ver + */ +Identity.prototype._sshpkApiVersion = [1, 0]; + +Identity._oldVersionDetect = function (obj) { + return ([1, 0]); +}; + + +/***/ }), +/* 46 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +const util = __webpack_require__(19); +const buildOptions = __webpack_require__(19).buildOptions; +const xmlNode = __webpack_require__(202); +const TagType = {"OPENING": 1, "CLOSING": 2, "SELF": 3, "CDATA": 4}; +let regx = "<((!\\[CDATA\\[([\\s\\S]*?)(]]>))|(([\\w:\\-._]*:)?([\\w:\\-._]+))([^>]*)>|((\\/)(([\\w:\\-._]*:)?([\\w:\\-._]+))\\s*>))([^<]*)"; + +//const tagsRegx = new RegExp("<(\\/?[\\w:\\-\._]+)([^>]*)>(\\s*"+cdataRegx+")*([^<]+)?","g"); +//const tagsRegx = new RegExp("<(\\/?)((\\w*:)?([\\w:\\-\._]+))([^>]*)>([^<]*)("+cdataRegx+"([^<]*))*([^<]+)?","g"); + +//treat cdata as a tag + +const defaultOptions = { + attributeNamePrefix: "@_", + attrNodeName: false, + textNodeName: "#text", + ignoreAttributes: true, + ignoreNameSpace: false, + allowBooleanAttributes: false, //a tag can have attributes without any value + //ignoreRootElement : false, + parseNodeValue: true, + parseAttributeValue: false, + arrayMode: false, + trimValues: true, //Trim string values of tag and attributes + cdataTagName: false, + cdataPositionChar: "\\c", + localeRange: "", + tagValueProcessor: function(a) {return a}, + attrValueProcessor: function(a) {return a} + //decodeStrict: false, +}; + +exports.defaultOptions = defaultOptions; + +const props = ["attributeNamePrefix", "attrNodeName", "textNodeName", "ignoreAttributes", "ignoreNameSpace", "allowBooleanAttributes", "parseNodeValue", "parseAttributeValue", "arrayMode", "trimValues", "cdataTagName", "cdataPositionChar", "localeRange", "tagValueProcessor", "attrValueProcessor"]; +exports.props = props; + +const getTraversalObj = function(xmlData, options) { + options = buildOptions(options,defaultOptions,props); + //xmlData = xmlData.replace(/\r?\n/g, " ");//make it single line + xmlData = xmlData.replace(//g, "");//Remove comments + + const xmlObj = new xmlNode("!xml"); + let currentNode = xmlObj; + + regx = regx.replace(/\[\\w/g, "[" + options.localeRange + "\\w"); + const tagsRegx = new RegExp(regx, "g"); + let tag = tagsRegx.exec(xmlData); + let nextTag = tagsRegx.exec(xmlData); + while (tag) { + const tagType = checkForTagType(tag); + + if (tagType === TagType.CLOSING) { + //add parsed data to parent node + if (currentNode.parent && tag[14]) { + currentNode.parent.val = util.getValue(currentNode.parent.val) + "" + processTagValue(tag[14], options); + } + + currentNode = currentNode.parent; + } else if (tagType === TagType.CDATA) { + if (options.cdataTagName) { + //add cdata node + const childNode = new xmlNode(options.cdataTagName, currentNode, tag[3]); + childNode.attrsMap = buildAttributesMap(tag[8], options); + currentNode.addChild(childNode); + //for backtracking + currentNode.val = util.getValue(currentNode.val) + options.cdataPositionChar; + //add rest value to parent node + if (tag[14]) { + currentNode.val += processTagValue(tag[14], options); + } + } else { + currentNode.val = (currentNode.val || "") + (tag[3] || "") + processTagValue(tag[14], options); + } + } else if (tagType === TagType.SELF) { + if (currentNode && tag[14]) { + currentNode.val = util.getValue(currentNode.val) + "" + processTagValue(tag[14], options); + } + + const childNode = new xmlNode(options.ignoreNameSpace ? tag[7] : tag[5], currentNode, ""); + if (tag[8] && tag[8].length > 1) { + tag[8] = tag[8].substr(0, tag[8].length - 1); + } + childNode.attrsMap = buildAttributesMap(tag[8], options); + currentNode.addChild(childNode); + } else {//TagType.OPENING + const childNode = new xmlNode(options.ignoreNameSpace ? tag[7] : tag[5], currentNode, processTagValue(tag[14], options)); + childNode.attrsMap = buildAttributesMap(tag[8], options); + currentNode.addChild(childNode); + currentNode = childNode; + } + + tag = nextTag; + nextTag = tagsRegx.exec(xmlData); + } + + return xmlObj; +}; + +function processTagValue(val, options) { + if (val) { + if (options.trimValues) { + val = val.trim(); + } + val = options.tagValueProcessor(val); + val = parseValue(val, options.parseNodeValue); + } + + return val; +} + +function checkForTagType(match) { + if (match[4] === "]]>") { + return TagType.CDATA; + } else if (match[10] === "/") { + return TagType.CLOSING; + } else if (typeof match[8] !== "undefined" && match[8].substr(match[8].length - 1) === "/") { + return TagType.SELF; + } else { + return TagType.OPENING; + } +} + +function resolveNameSpace(tagname, options) { + if (options.ignoreNameSpace) { + const tags = tagname.split(":"); + const prefix = tagname.charAt(0) === "/" ? "/" : ""; + if (tags[0] === "xmlns") { + return ""; + } + if (tags.length === 2) { + tagname = prefix + tags[1]; + } + } + return tagname; +} + +function parseValue(val, shouldParse) { + if (shouldParse && typeof val === "string") { + if (val.trim() === "" || isNaN(val)) { + val = val === "true" ? true : val === "false" ? false : val; + } else { + if (val.indexOf(".") !== -1) { + val = Number.parseFloat(val); + } else { + val = Number.parseInt(val, 10); + } + } + return val; + } else { + if (util.isExist(val)) { + return val; + } else { + return ""; + } + } +} + +//TODO: change regex to capture NS +//const attrsRegx = new RegExp("([\\w\\-\\.\\:]+)\\s*=\\s*(['\"])((.|\n)*?)\\2","gm"); +const attrsRegx = new RegExp("([^\\s=]+)\\s*(=\\s*(['\"])(.*?)\\3)?", "g"); + +function buildAttributesMap(attrStr, options) { + if (!options.ignoreAttributes && typeof attrStr === "string") { + attrStr = attrStr.replace(/\r?\n/g, " "); + //attrStr = attrStr || attrStr.trim(); + + const matches = util.getAllMatches(attrStr, attrsRegx); + const len = matches.length; //don't make it inline + const attrs = {}; + for (let i = 0; i < len; i++) { + const attrName = resolveNameSpace(matches[i][1], options); + if (attrName.length) { + if (matches[i][4] !== undefined) { + if (options.trimValues) { + matches[i][4] = matches[i][4].trim(); + } + matches[i][4] = options.attrValueProcessor(matches[i][4]); + attrs[options.attributeNamePrefix + attrName] = parseValue(matches[i][4], options.parseAttributeValue); + } else if (options.allowBooleanAttributes) { + attrs[options.attributeNamePrefix + attrName] = true; + } + + } + } + if (!Object.keys(attrs).length) { + return; + } + if (options.attrNodeName) { + const attrCollection = {}; + attrCollection[options.attrNodeName] = attrs; + return attrCollection; + } + return attrs; + } +} + +exports.getTraversalObj = getTraversalObj; + + +/***/ }), +/* 47 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ +;(function() { + + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; + + /** Used as the semantic version number. */ + var VERSION = '4.17.10'; + + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; + + /** Error message constants. */ + var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; + + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; + + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; + + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; + + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; + + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; + + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; + + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; + + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; + + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; + + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG] + ]; + + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; + + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; + + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); + + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; + + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; + + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; + + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; + + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; + + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; + + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; + + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; + + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; + + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; + + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; + + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; + + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; + + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', + rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; + + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); + + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); + + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); + + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp([ + rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', + rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji + ].join('|'), 'g'); + + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); + + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', + 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' + ]; + + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; + + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = + typedArrayTags[errorTag] = typedArrayTags[funcTag] = + typedArrayTags[mapTag] = typedArrayTags[numberTag] = + typedArrayTags[objectTag] = typedArrayTags[regexpTag] = + typedArrayTags[setTag] = typedArrayTags[stringTag] = + typedArrayTags[weakMapTag] = false; + + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = + cloneableTags[boolTag] = cloneableTags[dateTag] = + cloneableTags[float32Tag] = cloneableTags[float64Tag] = + cloneableTags[int8Tag] = cloneableTags[int16Tag] = + cloneableTags[int32Tag] = cloneableTags[mapTag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[setTag] = + cloneableTags[stringTag] = cloneableTags[symbolTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[weakMapTag] = false; + + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss', + // Latin Extended-A block. + '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', + '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', + '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', + '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', + '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', + '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', + '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', + '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', + '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', + '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', + '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', + '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', + '\u0134': 'J', '\u0135': 'j', + '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', + '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', + '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', + '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', + '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', + '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', + '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', + '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', + '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', + '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', + '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', + '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', + '\u0163': 't', '\u0165': 't', '\u0167': 't', + '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', + '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', + '\u0174': 'W', '\u0175': 'w', + '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', + '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', + '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', + '\u0132': 'IJ', '\u0133': 'ij', + '\u0152': 'Oe', '\u0153': 'oe', + '\u0149': "'n", '\u017f': 's' + }; + + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' + }; + + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'" + }; + + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; + + /** Detect free variable `global` from Node.js. */ + var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + + /** Detect free variable `self`. */ + var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); + + /** Detect free variable `exports`. */ + var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; + + /** Detect free variable `module`. */ + var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; + + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; + + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; + + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + // Use `util.types` for Node.js 10+. + var types = freeModule && freeModule.require && freeModule.require('util').types; + + if (types) { + return types; + } + + // Legacy `process.binding('util')` for Node.js < 10. + return freeProcess && freeProcess.binding && freeProcess.binding('util'); + } catch (e) {} + }()); + + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; + + /*--------------------------------------------------------------------------*/ + + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: return func.call(thisArg); + case 1: return func.call(thisArg, args[0]); + case 2: return func.call(thisArg, args[0], args[1]); + case 3: return func.call(thisArg, args[0], args[1], args[2]); + } + return func.apply(thisArg, args); + } + + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); + } + return accumulator; + } + + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; + + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } + } + return true; + } + + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } + + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { + return true; + } + } + return false; + } + + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); + + while (++index < length) { + result[index] = iteratee(array[index], index, array); + } + return result; + } + + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; + + while (++index < length) { + array[offset + index] = values[index]; + } + return array; + } + + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; + + if (initAccum && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; + } + + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } + + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; + } + } + return false; + } + + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); + + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } + + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } + + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; + } + }); + return result; + } + + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); + + while ((fromRight ? index-- : ++index < length)) { + if (predicate(array[index], index, array)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } + + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (comparator(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } + + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? (baseSum(array, iteratee) / length) : NAN; + } + + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? (initAccum = false, value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; + + array.sort(comparer); + while (length--) { + array[length] = array[length].value; + } + return array; + } + + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; + + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : (result + current); + } + } + return result; + } + + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); + } + return result; + } + + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } + + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } + + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } + + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } + + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; + + while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; + + while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; + + while (length--) { + if (array[length] === placeholder) { + ++result; + } + } + return result; + } + + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); + + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); + + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } + + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } + + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } + + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } + + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; + + while (!(data = iterator.next()).done) { + result.push(data.value); + } + return result; + } + + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); + + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } + + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } + + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; + } + } + return result; + } + + /** + * Gets the value at `key`, unless `key` is "__proto__". + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function safeGet(object, key) { + return key == '__proto__' + ? undefined + : object[key]; + } + + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } + + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } + + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; + } + } + return index; + } + + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) + ? unicodeSize(string) + : asciiSize(string); + } + + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = reUnicode.lastIndex = 0; + while (reUnicode.test(string)) { + ++result; + } + return result; + } + + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } + + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = (function runInContext(context) { + context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); + + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; + + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; + }()); + + /** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + }()); + + /** Mocked built-ins. */ + var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. + * + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true + */ + function lodash(value) { + if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } + } + return new LodashWrapper(value); + } + + /** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. + */ + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; + } + if (objectCreate) { + return objectCreate(proto); + } + object.prototype = proto; + var result = new object; + object.prototype = undefined; + return result; + }; + }()); + + /** + * The function whose prototype chain sequence wrappers inherit from. + * + * @private + */ + function baseLodash() { + // No operation performed. + } + + /** + * The base constructor for creating `lodash` wrapper objects. + * + * @private + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. + */ + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; + } + + /** + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. + * + * @static + * @memberOf _ + * @type {Object} + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'escape': reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + '_': lodash + } + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. + * + * @private + * @constructor + * @param {*} value The value to wrap. + */ + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; + } + + /** + * Creates a clone of the lazy wrapper object. + * + * @private + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. + */ + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; + } + + /** + * Reverses the direction of lazy iteration. + * + * @private + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. + */ + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; + } + return result; + } + + /** + * Extracts the unwrapped value from its lazy wrapper. + * + * @private + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. + */ + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : (start - 1), + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); + + if (!isArr || (!isRight && arrLength == length && takeCount == length)) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; + + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + result[resIndex++] = value; + } + return result; + } + + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a hash object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Hash(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the hash. + * + * @private + * @name clear + * @memberOf Hash + */ + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; + } + + /** + * Removes `key` and its value from the hash. + * + * @private + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the hash value for `key`. + * + * @private + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; + } + return hasOwnProperty.call(data, key) ? data[key] : undefined; + } + + /** + * Checks if a hash value for `key` exists. + * + * @private + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function hashHas(key) { + var data = this.__data__; + return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); + } + + /** + * Sets the hash `key` to `value`. + * + * @private + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. + */ + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; + } + + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an list cache object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the list cache. + * + * @private + * @name clear + * @memberOf ListCache + */ + function listCacheClear() { + this.__data__ = []; + this.size = 0; + } + + /** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; + } + + /** + * Gets the list cache value for `key`. + * + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; + } + + /** + * Checks if a list cache value for `key` exists. + * + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; + } + + /** + * Sets the list cache `key` to `value`. + * + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. + */ + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; + } + return this; + } + + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a map cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function MapCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the map. + * + * @private + * @name clear + * @memberOf MapCache + */ + function mapCacheClear() { + this.size = 0; + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; + } + + /** + * Removes `key` and its value from the map. + * + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the map value for `key`. + * + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function mapCacheGet(key) { + return getMapData(this, key).get(key); + } + + /** + * Checks if a map value for `key` exists. + * + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function mapCacheHas(key) { + return getMapData(this, key).has(key); + } + + /** + * Sets the map `key` to `value`. + * + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. + */ + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; + } + + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * + * Creates an array cache object to store unique values. + * + * @private + * @constructor + * @param {Array} [values] The values to cache. + */ + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache; + while (++index < length) { + this.add(values[index]); + } + } + + /** + * Adds `value` to the array cache. + * + * @private + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. + */ + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; + } + + /** + * Checks if `value` is in the array cache. + * + * @private + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. + */ + function setCacheHas(value) { + return this.__data__.has(value); + } + + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a stack cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Stack(entries) { + var data = this.__data__ = new ListCache(entries); + this.size = data.size; + } + + /** + * Removes all key-value entries from the stack. + * + * @private + * @name clear + * @memberOf Stack + */ + function stackClear() { + this.__data__ = new ListCache; + this.size = 0; + } + + /** + * Removes `key` and its value from the stack. + * + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); + + this.size = data.size; + return result; + } + + /** + * Gets the stack value for `key`. + * + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function stackGet(key) { + return this.__data__.get(key); + } + + /** + * Checks if a stack value for `key` exists. + * + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function stackHas(key) { + return this.__data__.has(key); + } + + /** + * Sets the stack `key` to `value`. + * + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. + */ + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + this.size = ++data.size; + return this; + } + data = this.__data__ = new MapCache(pairs); + } + data.set(key, value); + this.size = data.size; + return this; + } + + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of the enumerable property names of the array-like `value`. + * + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. + */ + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; + + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && ( + // Safari 9 has enumerable `arguments.length` in strict mode. + key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length) + ))) { + result.push(key); + } + } + return result; + } + + /** + * A specialized version of `_.sample` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. + */ + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; + } + + /** + * A specialized version of `_.sampleSize` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function arraySampleSize(array, n) { + return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); + } + + /** + * A specialized version of `_.shuffle` for arrays. + * + * @private + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); + } + + /** + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignMergeValue(object, key, value) { + if ((value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Gets the index at which the `key` is found in `array` of key-value pairs. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } + } + return -1; + } + + /** + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); + } + + /** + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); + } + + /** + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + 'configurable': true, + 'enumerable': true, + 'value': value, + 'writable': true + }); + } else { + object[key] = value; + } + } + + /** + * The base implementation of `_.at` without support for individual paths. + * + * @private + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. + */ + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; + + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; + } + + /** + * The base implementation of `_.clamp` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + */ + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; + } + if (lower !== undefined) { + number = number >= lower ? number : lower; + } + } + return number; + } + + /** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. + */ + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; + + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = (isFlat || isFunc) ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + if (isSet(value)) { + value.forEach(function(subValue) { + result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); + }); + + return result; + } + + if (isMap(value)) { + value.forEach(function(subValue, key) { + result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + + return result; + } + + var keysFunc = isFull + ? (isFlat ? getAllKeysIn : getAllKeys) + : (isFlat ? keysIn : keys); + + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + return result; + } + + /** + * The base implementation of `_.conforms` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. + */ + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; + } + + /** + * The base implementation of `_.conformsTo` which accepts `props` to check. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + */ + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; + } + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; + + if ((value === undefined && !(key in object)) || !predicate(value)) { + return false; + } + } + return true; + } + + /** + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. + */ + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, args); }, wait); + } + + /** + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + */ + function baseDifference(array, values, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; + + if (!length) { + return result; + } + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); + } + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; + } + else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } + } + result.push(value); + } + else if (!includes(values, computed, comparator)) { + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.forEach` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEach = createBaseEach(baseForOwn); + + /** + * The base implementation of `_.forEachRight` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); + + /** + * The base implementation of `_.every` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; + } + + /** + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. + */ + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; + + while (++index < length) { + var value = array[index], + current = iteratee(value); + + if (current != null && (computed === undefined + ? (current === current && !isSymbol(current)) + : comparator(current, computed) + )) { + var computed = current, + result = value; + } + } + return result; + } + + /** + * The base implementation of `_.fill` without an iteratee call guard. + * + * @private + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + */ + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (end === undefined || end > length) ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; + } + + /** + * The base implementation of `_.filter` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; + } + + /** + * The base implementation of `_.flatten` with support for restricting flattening. + * + * @private + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. + */ + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; + } + } + return result; + } + + /** + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseFor = createBaseFor(); + + /** + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseForRight = createBaseFor(true); + + /** + * The base implementation of `_.forOwn` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); + } + + /** + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); + } + + /** + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. + * + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. + */ + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); + } + + /** + * The base implementation of `_.get` without support for default values. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. + */ + function baseGet(object, path) { + path = castPath(path, object); + + var index = 0, + length = path.length; + + while (object != null && index < length) { + object = object[toKey(path[index++])]; + } + return (index && index == length) ? object : undefined; + } + + /** + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. + */ + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); + } + + /** + * The base implementation of `getTag` without fallbacks for buggy environments. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); + } + + /** + * The base implementation of `_.gt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + */ + function baseGt(value, other) { + return value > other; + } + + /** + * The base implementation of `_.has` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); + } + + /** + * The base implementation of `_.hasIn` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHasIn(object, key) { + return object != null && key in Object(object); + } + + /** + * The base implementation of `_.inRange` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + */ + function baseInRange(number, start, end) { + return number >= nativeMin(start, end) && number < nativeMax(start, end); + } + + /** + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of shared values. + */ + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; + + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); + } + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; + } + array = arrays[0]; + + var index = -1, + seen = caches[0]; + + outer: + while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (!(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator) + )) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if (!(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. + */ + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); + }); + return accumulator; + } + + /** + * The base implementation of `_.invoke` without support for individual + * method arguments. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + */ + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); + } + + /** + * The base implementation of `_.isArguments`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + */ + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; + } + + /** + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + */ + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + } + + /** + * The base implementation of `_.isDate` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + */ + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; + } + + /** + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + */ + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; + } + if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { + return value !== value && other !== other; + } + return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); + } + + /** + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; + } + if (isSameTag && !objIsObj) { + stack || (stack = new Stack); + return (objIsArr || isTypedArray(object)) + ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) + : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); + } + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack); + return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack); + return equalObjects(object, other, bitmask, customizer, equalFunc, stack); + } + + /** + * The base implementation of `_.isMap` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + */ + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; + } + + /** + * The base implementation of `_.isMatch` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + */ + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; + + if (object == null) { + return !length; + } + object = Object(object); + while (index--) { + var data = matchData[index]; + if ((noCustomizer && data[2]) + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } + } + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; + + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack; + if (customizer) { + var result = customizer(objValue, srcValue, key, object, source, stack); + } + if (!(result === undefined + ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) + : result + )) { + return false; + } + } + } + return true; + } + + /** + * The base implementation of `_.isNative` without bad shim checks. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + */ + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); + } + + /** + * The base implementation of `_.isRegExp` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + */ + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; + } + + /** + * The base implementation of `_.isSet` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + */ + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; + } + + /** + * The base implementation of `_.isTypedArray` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + */ + function baseIsTypedArray(value) { + return isObjectLike(value) && + isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; + } + + /** + * The base implementation of `_.iteratee`. + * + * @private + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. + */ + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; + } + if (value == null) { + return identity; + } + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); + } + return property(value); + } + + /** + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); + } + var isProto = isPrototype(object), + result = []; + + for (var key in object) { + if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.lt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + */ + function baseLt(value, other) { + return value < other; + } + + /** + * The base implementation of `_.map` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); + return result; + } + + /** + * The base implementation of `_.matches` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable(matchData[0][0], matchData[0][1]); + } + return function(object) { + return object === source || baseIsMatch(object, source, matchData); + }; + } + + /** + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. + * + * @private + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return (objValue === undefined && objValue === srcValue) + ? hasIn(object, path) + : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); + }; + } + + /** + * The base implementation of `_.merge` without support for multiple sources. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; + } + baseFor(source, function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack); + baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); + } + else { + var newValue = customizer + ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) + : undefined; + + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, keysIn); + } + + /** + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { + var objValue = safeGet(object, key), + srcValue = safeGet(source, key), + stacked = stack.get(srcValue); + + if (stacked) { + assignMergeValue(object, key, stacked); + return; + } + var newValue = customizer + ? customizer(objValue, srcValue, (key + ''), object, source, stack) + : undefined; + + var isCommon = newValue === undefined; + + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); + + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } + else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } + else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } + else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } + else { + newValue = []; + } + } + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } + else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { + newValue = initCloneObject(srcValue); + } + } + else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); + } + + /** + * The base implementation of `_.nth` which doesn't coerce arguments. + * + * @private + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. + */ + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; + } + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; + } + + /** + * The base implementation of `_.orderBy` without param guards. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. + */ + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + + var result = baseMap(collection, function(value, key, collection) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { 'criteria': criteria, 'index': ++index, 'value': value }; + }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); + } + + /** + * The base implementation of `_.pick` without support for individual + * property identifiers. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. + */ + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); + } + + /** + * The base implementation of `_.pickBy` without support for iteratee shorthands. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. + */ + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } + } + return result; + } + + /** + * A specialized version of `baseProperty` which supports deep paths. + * + * @private + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; + } + + /** + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + */ + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; + + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; + + while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } + } + return array; + } + + /** + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. + * + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. + */ + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; + + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } + } + return array; + } + + /** + * The base implementation of `_.random` without support for returning + * floating-point numbers. + * + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. + */ + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } + + /** + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. + * + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. + */ + function baseRange(start, end, step, fromRight) { + var index = -1, + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); + + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; + } + return result; + } + + /** + * The base implementation of `_.repeat` which doesn't coerce arguments. + * + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. + */ + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); + + return result; + } + + /** + * The base implementation of `_.rest` which doesn't validate or coerce arguments. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + */ + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } + + /** + * The base implementation of `_.sample`. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + */ + function baseSample(collection) { + return arraySample(values(collection)); + } + + /** + * The base implementation of `_.sampleSize` without param guards. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); + } + + /** + * The base implementation of `_.set`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; + } + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer ? customizer(objValue, key, nested) : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : (isIndex(path[index + 1]) ? [] : {}); + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; + } + + /** + * The base implementation of `setData` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; + + /** + * The base implementation of `setToString` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var baseSetToString = !defineProperty ? identity : function(func, string) { + return defineProperty(func, 'toString', { + 'configurable': true, + 'enumerable': false, + 'value': constant(string), + 'writable': true + }); + }; + + /** + * The base implementation of `_.shuffle`. + * + * @private + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function baseShuffle(collection) { + return shuffleSelf(values(collection)); + } + + /** + * The base implementation of `_.slice` without an iteratee call guard. + * + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = end > length ? length : end; + if (end < 0) { + end += length; + } + length = start > end ? 0 : ((end - start) >>> 0); + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; + } + + /** + * The base implementation of `_.some` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (computed !== null && !isSymbol(computed) && + (retHighest ? (computed <= value) : (computed < value))) { + low = mid + 1; + } else { + high = mid; + } + } + return high; + } + return baseSortedIndexBy(array, value, identity, retHighest); + } + + /** + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } + + /** + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; + } + + /** + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. + * + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. + */ + function baseToNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + return +value; + } + + /** + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * The base implementation of `_.uniqBy` without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseUniq(array, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; + } + else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); + } + isCommon = false; + includes = cacheHas; + seen = new SetCache; + } + else { + seen = iteratee ? [] : result; + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } + else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.unset`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + */ + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; + } + + /** + * The base implementation of `_.update`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseUpdate(object, path, updater, customizer) { + return baseSet(object, path, updater(baseGet(object, path)), customizer); + } + + /** + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the slice of `array`. + */ + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ((fromRight ? index-- : ++index < length) && + predicate(array[index], index, array)) {} + + return isDrop + ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) + : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); + } + + /** + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. + * + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. + */ + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce(actions, function(result, action) { + return action.func.apply(action.thisArg, arrayPush([result], action.args)); + }, result); + } + + /** + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. + */ + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; + } + var index = -1, + result = Array(length); + + while (++index < length) { + var array = arrays[index], + othIndex = -1; + + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); + } + } + } + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } + + /** + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. + */ + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; + + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); + } + return result; + } + + /** + * Casts `value` to an empty array if it's not an array like object. + * + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. + */ + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; + } + + /** + * Casts `value` to `identity` if it's not a function. + * + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. + */ + function castFunction(value) { + return typeof value == 'function' ? value : identity; + } + + /** + * Casts `value` to a path array if it's not one. + * + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. + */ + function castPath(value, object) { + if (isArray(value)) { + return value; + } + return isKey(value, object) ? [value] : stringToPath(toString(value)); + } + + /** + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. + * + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. + * + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. + */ + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return (!start && end >= length) ? array : baseSlice(array, start, end); + } + + /** + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). + * + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. + */ + var clearTimeout = ctxClearTimeout || function(id) { + return root.clearTimeout(id); + }; + + /** + * Creates a clone of `buffer`. + * + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. + */ + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var length = buffer.length, + result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); + + buffer.copy(result); + return result; + } + + /** + * Creates a clone of `arrayBuffer`. + * + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; + } + + /** + * Creates a clone of `dataView`. + * + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. + */ + function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); + } + + /** + * Creates a clone of `regexp`. + * + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ + function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; + return result; + } + + /** + * Creates a clone of the `symbol` object. + * + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } + + /** + * Creates a clone of `typedArray`. + * + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. + */ + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); + } + + /** + * Compares values to sort them in ascending order. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. + */ + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || + (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive) { + return 1; + } + if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || + (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive) { + return -1; + } + } + return 0; + } + + /** + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. + * + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; + + while (++index < length) { + var result = compareAscending(objCriteria[index], othCriteria[index]); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; + } + + /** + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; + } + } + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; + } + + /** + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; + } + + /** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ + function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } + + /** + * Copies properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. + */ + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); + } + } + return object; + } + + /** + * Copies own symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); + } + + /** + * Copies own and inherited symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); + } + + /** + * Creates a function like `_.groupBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. + */ + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) ? arrayAggregator : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func(collection, setter, getIteratee(iteratee, 2), accumulator); + }; + } + + /** + * Creates a function like `_.assign`. + * + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. + */ + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = (assigner.length > 3 && typeof customizer == 'function') + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); + } + + /** + * Creates a `baseEach` or `baseEachRight` function. + * + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while ((fromRight ? index-- : ++index < length)) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; + } + + /** + * Creates a base function for methods like `_.forIn` and `_.forOwn`. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return fn.apply(isBind ? thisArg : this, arguments); + } + return wrapper; + } + + /** + * Creates a function like `_.lowerFirst`. + * + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. + */ + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); + + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols + ? strSymbols[0] + : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; + } + + /** + * Creates a function like `_.camelCase`. + * + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. + */ + function createCompounder(callback) { + return function(string) { + return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); + }; + } + + /** + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. + */ + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: return new Ctor; + case 1: return new Ctor(args[0]); + case 2: return new Ctor(args[0], args[1]); + case 3: return new Ctor(args[0], args[1], args[2]); + case 4: return new Ctor(args[0], args[1], args[2], args[3]); + case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); + case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); + case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } + + /** + * Creates a function that wraps `func` to enable currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, undefined, + args, holders, undefined, undefined, arity - length); + } + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return apply(fn, this, args); + } + return wrapper; + } + + /** + * Creates a `_.find` or `_.findLast` function. + * + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. + */ + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { return iteratee(iterable[key], key, iterable); }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; + }; + } + + /** + * Creates a `_.flow` or `_.flowRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. + */ + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; + + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; + + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if (data && isLaziable(data[0]) && + data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && + !data[4].length && data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); + } else { + wrapper = (func.length == 1 && isLaziable(func)) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); + } + + /** + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight, isCurried); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, thisArg, + args, newHolders, argPos, ary, arity - length + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); + } + return fn.apply(thisBinding, args); + } + return wrapper; + } + + /** + * Creates a function like `_.invertBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. + */ + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; + } + + /** + * Creates a function that performs a mathematical operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. + */ + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; + } + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; + } + + /** + * Creates a function like `_.over`. + * + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. + */ + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); + }); + } + + /** + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. + * + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. + */ + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); + + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; + } + var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); + } + + /** + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. + */ + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); + } + return wrapper; + } + + /** + * Creates a `_.range` or `_.rangeRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. + */ + function createRange(fromRight) { + return function(start, end, step) { + if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; + } + + /** + * Creates a function that performs a relational operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. + */ + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; + } + + /** + * Creates a function that wraps `func` to continue currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, + newHoldersRight, argPos, ary, arity + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); + } + + /** + * Creates a function like `_.round`. + * + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. + */ + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); + + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; + } + + /** + * Creates a set object of `values`. + * + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. + */ + var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { + return new Set(values); + }; + + /** + * Creates a `_.toPairs` or `_.toPairsIn` function. + * + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. + */ + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; + } + + /** + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, + argPos, ary, arity + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = newData[9] === undefined + ? (isBindKey ? 0 : func.length) + : nativeMax(newData[9] - length, 0); + + if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { + result = createCurry(func, bitmask, arity); + } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); + } + + /** + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. + */ + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if (objValue === undefined || + (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { + return srcValue; + } + return objValue; + } + + /** + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. + */ + function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); + stack['delete'](srcValue); + } + return objValue; + } + + /** + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. + * + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. + */ + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; + } + + /** + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. + * + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + */ + function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if (arrLength != othLength && !(isPartial && othLength > arrLength)) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; + } + var index = -1, + result = true, + seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; + + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer(arrValue, othValue, index, array, other, stack); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if (!arraySome(other, function(othValue, othIndex) { + if (!cacheHas(seen, othIndex) && + (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { + return seen.push(othIndex); + } + })) { + result = false; + break; + } + } else if (!( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + )) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. + * + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { + switch (tag) { + case dataViewTag: + if ((object.byteLength != other.byteLength) || + (object.byteOffset != other.byteOffset)) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ((object.byteLength != other.byteLength) || + !equalFunc(new Uint8Array(object), new Uint8Array(other))) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return object.name == other.name && object.message == other.message; + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == (other + ''); + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return symbolValueOf.call(object) == symbolValueOf.call(other); + } + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; + } + var index = objLength; + while (index--) { + var key = objProps[index]; + if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); + + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if (!(compared === undefined + ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) + : compared + )) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && + ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && + typeof othCtor == 'function' && othCtor instanceof othCtor)) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseRest` which flattens the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); + } + + /** + * Creates an array of own enumerable property names and symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); + } + + /** + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); + } + + /** + * Gets metadata for `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the name of `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. + */ + function getFuncName(func) { + var result = (func.name + ''), + array = realNames[result], + length = hasOwnProperty.call(realNames, result) ? array.length : 0; + + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; + } + } + return result; + } + + /** + * Gets the argument placeholder value for `func`. + * + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. + */ + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; + return object.placeholder; + } + + /** + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. + * + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. + */ + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length ? result(arguments[0], arguments[1]) : result; + } + + /** + * Gets the data for `map`. + * + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. + */ + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } + + /** + * Gets the property names, values, and compare flags of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. + */ + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; + } + return result; + } + + /** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; + } + + /** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } + + /** + * Creates an array of the own enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbols = !nativeGetSymbols ? stubArray : function(object) { + if (object == null) { + return []; + } + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function(symbol) { + return propertyIsEnumerable.call(object, symbol); + }); + }; + + /** + * Creates an array of the own and inherited enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); + } + return result; + }; + + /** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; + } + + /** + * Gets the view, applying any `transforms` to the `start` and `end` positions. + * + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; + } + + /** + * Extracts wrapper details from the `source` body comment. + * + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. + */ + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; + } + + /** + * Checks if `path` exists on `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + */ + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; + } + if (result || ++index != length) { + return result; + } + length = object == null ? 0 : object.length; + return !!length && isLength(length) && isIndex(key, length) && + (isArray(object) || isArguments(object)); + } + + /** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ + function initCloneArray(array) { + var length = array.length, + result = new array.constructor(length); + + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; + } + + /** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; + } + + /** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneByTag(object, tag, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return new Ctor; + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return new Ctor; + + case symbolTag: + return cloneSymbol(object); + } + } + + /** + * Inserts wrapper `details` in a comment at the top of the `source` body. + * + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. + */ + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); + } + + /** + * Checks if `value` is a flattenable `arguments` object or array. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. + */ + function isFlattenable(value) { + return isArray(value) || isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]); + } + + /** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + var type = typeof value; + length = length == null ? MAX_SAFE_INTEGER : length; + + return !!length && + (type == 'number' || + (type != 'symbol' && reIsUint.test(value))) && + (value > -1 && value % 1 == 0 && value < length); + } + + /** + * Checks if the given arguments are from an iteratee call. + * + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. + */ + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; + } + var type = typeof index; + if (type == 'number' + ? (isArrayLike(object) && isIndex(index, object.length)) + : (type == 'string' && index in object) + ) { + return eq(object[index], value); + } + return false; + } + + /** + * Checks if `value` is a property name and not a property path. + * + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + */ + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if (type == 'number' || type == 'symbol' || type == 'boolean' || + value == null || isSymbol(value)) { + return true; + } + return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || + (object != null && value in Object(object)); + } + + /** + * Checks if `value` is suitable for use as unique object key. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + */ + function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); + } + + /** + * Checks if `func` has a lazy counterpart. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. + */ + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; + + if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; + } + + /** + * Checks if `func` has its source masked. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ + function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); + } + + /** + * Checks if `func` is capable of being masked. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. + */ + function isStrictComparable(value) { + return value === value && !isObject(value); + } + + /** + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. + * + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return object[key] === srcValue && + (srcValue !== undefined || (key in Object(object))); + }; + } + + /** + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. + * + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. + * + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. + * + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || + ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : value; + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } + } + return result; + } + + /** + * Converts `value` to a string using `Object.prototype.toString`. + * + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. + */ + function overRest(func, start, transform) { + start = nativeMax(start === undefined ? (func.length - 1) : start, 0); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); + + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } + + /** + * Gets the parent value at `path` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. + */ + function parent(object, path) { + return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. + * + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. + * + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. + */ + var setTimeout = ctxSetTimeout || function(func, wait) { + return root.setTimeout(func, wait); + }; + + /** + * Sets the `toString` method of `func` to return `string`. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. + * + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. + */ + function setWrapToString(wrapper, reference, bitmask) { + var source = (reference + ''); + return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); + } + + /** + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. + * + * @private + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new shortable function. + */ + function shortOut(func) { + var count = 0, + lastCalled = 0; + + return function() { + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; + } + return func.apply(undefined, arguments); + }; + } + + /** + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. + */ + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (string.charCodeAt(0) === 46 /* . */) { + result.push(''); + } + string.replace(rePropName, function(match, number, quote, subString) { + result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); + }); + return result; + }); + + /** + * Converts `value` to a string key if it's not a string or symbol. + * + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. + */ + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * Converts `func` to its source code. + * + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. + */ + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} + } + return ''; + } + + /** + * Updates wrapper `details` based on `bitmask` flags. + * + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. + * + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. + */ + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the new array of chunks. + * @example + * + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] + * + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] + */ + function chunk(array, size, guard) { + if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } + return result; + } + + /** + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * Creates a new array concatenating `array` with any additional arrays + * and/or values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. + * @example + * + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); + * + * console.log(other); + * // => [1, 2, 3, [4]] + * + * console.log(array); + * // => [1] + */ + function concat() { + var length = arguments.length; + if (!length) { + return []; + } + var args = Array(length - 1), + array = arguments[0], + index = length; + + while (index--) { + args[index - 1] = arguments[index]; + } + return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); + } + + /** + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor + * @example + * + * _.difference([2, 1], [2, 3]); + * // => [1] + */ + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] + * + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] + */ + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) + : []; + }); + + /** + * Creates a slice of `array` with `n` elements dropped from the beginning. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.drop([1, 2, 3]); + * // => [2, 3] + * + * _.drop([1, 2, 3], 2); + * // => [3] + * + * _.drop([1, 2, 3], 5); + * // => [] + * + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRight([1, 2, 3]); + * // => [1, 2] + * + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] + * + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] + * + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; + } + + /** + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } + + /** + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. + * + * **Note:** This method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] + * + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] + */ + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } + + /** + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 + * + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 + */ + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } + + /** + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 + * + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 + */ + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex(array, getIteratee(predicate, 3), index, true); + } + + /** + * Flattens `array` a single level deep. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] + */ + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; + } + + /** + * Recursively flattens `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] + */ + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; + } + + /** + * Recursively flatten `array` up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * var array = [1, [2, [3, [4]], 5]]; + * + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] + * + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] + */ + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); + } + + /** + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. + * @example + * + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } + */ + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; + } + + /** + * Gets the first element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. + * @example + * + * _.head([1, 2, 3]); + * // => 1 + * + * _.head([]); + * // => undefined + */ + function head(array) { + return (array && array.length) ? array[0] : undefined; + } + + /** + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 + * + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 + */ + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseIndexOf(array, value, index); + } + + /** + * Gets all but the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.initial([1, 2, 3]); + * // => [1, 2] + */ + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; + } + + /** + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersection([2, 1], [2, 3]); + * // => [2] + */ + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] + * + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] + */ + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] + */ + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + comparator = typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, undefined, comparator) + : []; + }); + + /** + * Converts all elements in `array` into a string separated by `separator`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. + * @example + * + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' + */ + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); + } + + /** + * Gets the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. + * @example + * + * _.last([1, 2, 3]); + * // => 3 + */ + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; + } + + /** + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 + * + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } + + /** + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. + * + * @static + * @memberOf _ + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * + * _.nth(array, 1); + * // => 'b' + * + * _.nth(array, -2); + * // => 'c'; + */ + function nth(array, n) { + return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + } + + /** + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] + */ + var pull = baseRest(pullAll); + + /** + * This method is like `_.pull` except that it accepts an array of values to remove. + * + * **Note:** Unlike `_.difference`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] + */ + function pullAll(array, values) { + return (array && array.length && values && values.length) + ? basePullAll(array, values) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). + * + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] + */ + function pullAllBy(array, values, iteratee) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + */ + function pullAllWith(array, values, comparator) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, undefined, comparator) + : array; + } + + /** + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. + * + * **Note:** Unlike `_.at`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); + * + * console.log(array); + * // => ['a', 'c'] + * + * console.log(pulled); + * // => ['b', 'd'] + */ + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt(array, arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending)); + + return result; + }); + + /** + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). + * + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); + * + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] + */ + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; + + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; + } + + /** + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; + } + else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); + } + return baseSlice(array, start, end); + } + + /** + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedIndex([30, 50], 40); + * // => 1 + */ + function sortedIndex(array, value) { + return baseSortedIndex(array, value); + } + + /** + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 + */ + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); + } + + /** + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 + * + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 + */ + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + } + + /** + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 + */ + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] + */ + function sortedUniq(array) { + return (array && array.length) + ? baseSortedUniq(array) + : []; + } + + /** + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] + */ + function sortedUniqBy(array, iteratee) { + return (array && array.length) + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; + } + + /** + * Gets all but the first element of `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.tail([1, 2, 3]); + * // => [2, 3] + */ + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; + } + + /** + * Creates a slice of `array` with `n` elements taken from the beginning. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.take([1, 2, 3]); + * // => [1] + * + * _.take([1, 2, 3], 2); + * // => [1, 2] + * + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] + */ + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements taken from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] + */ + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] + */ + function takeRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; + } + + /** + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] + */ + function takeWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } + + /** + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([2], [1, 2]); + * // => [2, 1] + */ + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); + }); + + /** + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); + }); + + /** + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniq([2, 1, 2]); + * // => [2, 1] + */ + function uniq(array) { + return (array && array.length) ? baseUniq(array) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + function uniqBy(array, iteratee) { + return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + */ + function uniqWith(array, comparator) { + comparator = typeof comparator == 'function' ? comparator : undefined; + return (array && array.length) ? baseUniq(array, undefined, comparator) : []; + } + + /** + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. + * + * @static + * @memberOf _ + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + * + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] + */ + function unzip(array) { + if (!(array && array.length)) { + return []; + } + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); + } + + /** + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] + * + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] + */ + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; + } + var result = unzip(array); + if (iteratee == null) { + return result; + } + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); + } + + /** + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.pull`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor + * @example + * + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] + */ + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); + + /** + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without + * @example + * + * _.xor([2, 1], [2, 3]); + * // => [1, 3] + */ + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); + }); + + /** + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] + * + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); + }); + + /** + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + */ + var zip = baseRest(unzip); + + /** + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. + * + * @static + * @memberOf _ + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObject(['a', 'b'], [1, 2]); + * // => { 'a': 1, 'b': 2 } + */ + function zipObject(props, values) { + return baseZipObject(props || [], values || [], assignValue); + } + + /** + * This method is like `_.zipObject` except that it supports property paths. + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); + * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + */ + function zipObjectDeep(props, values) { + return baseZipObject(props || [], values || [], baseSet); + } + + /** + * This method is like `_.zip` except that it accepts `iteratee` to specify + * how grouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @param {Function} [iteratee=_.identity] The function to combine + * grouped values. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { + * return a + b + c; + * }); + * // => [111, 222] + */ + var zipWith = baseRest(function(arrays) { + var length = arrays.length, + iteratee = length > 1 ? arrays[length - 1] : undefined; + + iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; + return unzipWith(arrays, iteratee); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` wrapper instance that wraps `value` with explicit method + * chain sequences enabled. The result of such sequences must be unwrapped + * with `_#value`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Seq + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; + * + * var youngest = _ + * .chain(users) + * .sortBy('age') + * .map(function(o) { + * return o.user + ' is ' + o.age; + * }) + * .head() + * .value(); + * // => 'pebbles is 1' + */ + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; + } + + /** + * This method invokes `interceptor` and returns `value`. The interceptor + * is invoked with one argument; (value). The purpose of this method is to + * "tap into" a method chain sequence in order to modify intermediate results. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns `value`. + * @example + * + * _([1, 2, 3]) + * .tap(function(array) { + * // Mutate input array. + * array.pop(); + * }) + * .reverse() + * .value(); + * // => [2, 1] + */ + function tap(value, interceptor) { + interceptor(value); + return value; + } + + /** + * This method is like `_.tap` except that it returns the result of `interceptor`. + * The purpose of this method is to "pass thru" values replacing intermediate + * results in a method chain sequence. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns the result of `interceptor`. + * @example + * + * _(' abc ') + * .chain() + * .trim() + * .thru(function(value) { + * return [value]; + * }) + * .value(); + * // => ['abc'] + */ + function thru(value, interceptor) { + return interceptor(value); + } + + /** + * This method is the wrapper version of `_.at`. + * + * @name at + * @memberOf _ + * @since 1.0.0 + * @category Seq + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _(object).at(['a[0].b.c', 'a[1]']).value(); + * // => [3, 4] + */ + var wrapperAt = flatRest(function(paths) { + var length = paths.length, + start = length ? paths[0] : 0, + value = this.__wrapped__, + interceptor = function(object) { return baseAt(object, paths); }; + + if (length > 1 || this.__actions__.length || + !(value instanceof LazyWrapper) || !isIndex(start)) { + return this.thru(interceptor); + } + value = value.slice(start, +start + (length ? 1 : 0)); + value.__actions__.push({ + 'func': thru, + 'args': [interceptor], + 'thisArg': undefined + }); + return new LodashWrapper(value, this.__chain__).thru(function(array) { + if (length && !array.length) { + array.push(undefined); + } + return array; + }); + }); + + /** + * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. + * + * @name chain + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // A sequence without explicit chaining. + * _(users).head(); + * // => { 'user': 'barney', 'age': 36 } + * + * // A sequence with explicit chaining. + * _(users) + * .chain() + * .head() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } + */ + function wrapperChain() { + return chain(this); + } + + /** + * Executes the chain sequence and returns the wrapped result. + * + * @name commit + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2]; + * var wrapped = _(array).push(3); + * + * console.log(array); + * // => [1, 2] + * + * wrapped = wrapped.commit(); + * console.log(array); + * // => [1, 2, 3] + * + * wrapped.last(); + * // => 3 + * + * console.log(array); + * // => [1, 2, 3] + */ + function wrapperCommit() { + return new LodashWrapper(this.value(), this.__chain__); + } + + /** + * Gets the next value on a wrapped object following the + * [iterator protocol](https://mdn.io/iteration_protocols#iterator). + * + * @name next + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the next iterator value. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped.next(); + * // => { 'done': false, 'value': 1 } + * + * wrapped.next(); + * // => { 'done': false, 'value': 2 } + * + * wrapped.next(); + * // => { 'done': true, 'value': undefined } + */ + function wrapperNext() { + if (this.__values__ === undefined) { + this.__values__ = toArray(this.value()); + } + var done = this.__index__ >= this.__values__.length, + value = done ? undefined : this.__values__[this.__index__++]; + + return { 'done': done, 'value': value }; + } + + /** + * Enables the wrapper to be iterable. + * + * @name Symbol.iterator + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the wrapper object. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped[Symbol.iterator]() === wrapped; + * // => true + * + * Array.from(wrapped); + * // => [1, 2] + */ + function wrapperToIterator() { + return this; + } + + /** + * Creates a clone of the chain sequence planting `value` as the wrapped value. + * + * @name plant + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @param {*} value The value to plant. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2]).map(square); + * var other = wrapped.plant([3, 4]); + * + * other.value(); + * // => [9, 16] + * + * wrapped.value(); + * // => [1, 4] + */ + function wrapperPlant(value) { + var result, + parent = this; + + while (parent instanceof baseLodash) { + var clone = wrapperClone(parent); + clone.__index__ = 0; + clone.__values__ = undefined; + if (result) { + previous.__wrapped__ = clone; + } else { + result = clone; + } + var previous = clone; + parent = parent.__wrapped__; + } + previous.__wrapped__ = value; + return result; + } + + /** + * This method is the wrapper version of `_.reverse`. + * + * **Note:** This method mutates the wrapped array. + * + * @name reverse + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2, 3]; + * + * _(array).reverse().value() + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + var wrapped = value; + if (this.__actions__.length) { + wrapped = new LazyWrapper(this); + } + wrapped = wrapped.reverse(); + wrapped.__actions__.push({ + 'func': thru, + 'args': [reverse], + 'thisArg': undefined + }); + return new LodashWrapper(wrapped, this.__chain__); + } + return this.thru(reverse); + } + + /** + * Executes the chain sequence to resolve the unwrapped value. + * + * @name value + * @memberOf _ + * @since 0.1.0 + * @alias toJSON, valueOf + * @category Seq + * @returns {*} Returns the resolved unwrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the number of times the key was returned by `iteratee`. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': 1, '6': 2 } + * + * // The `_.property` iteratee shorthand. + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + ++result[key]; + } else { + baseAssignValue(result, key, 1); + } + }); + + /** + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * Iteration is stopped once `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * **Note:** This method returns `true` for + * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because + * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of + * elements of empty collections. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.every(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.every(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.every(users, 'active'); + * // => false + */ + function every(collection, predicate, guard) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * **Note:** Unlike `_.remove`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.reject + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * _.filter(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.filter(users, { 'age': 36, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.filter(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.filter(users, 'active'); + * // => objects for ['barney'] + */ + function filter(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': true } + * ]; + * + * _.find(users, function(o) { return o.age < 40; }); + * // => object for 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.find(users, { 'age': 1, 'active': true }); + * // => object for 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.find(users, ['active', false]); + * // => object for 'fred' + * + * // The `_.property` iteratee shorthand. + * _.find(users, 'active'); + * // => object for 'barney' + */ + var find = createFind(findIndex); + + /** + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=collection.length-1] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { + * return n % 2 == 1; + * }); + * // => 3 + */ + var findLast = createFind(findLastIndex); + + /** + * Creates a flattened array of values by running each element in `collection` + * thru `iteratee` and flattening the mapped results. The iteratee is invoked + * with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [n, n]; + * } + * + * _.flatMap([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMap(collection, iteratee) { + return baseFlatten(map(collection, iteratee), 1); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDeep([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMapDeep(collection, iteratee) { + return baseFlatten(map(collection, iteratee), INFINITY); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDepth([1, 2], duplicate, 2); + * // => [[1, 1], [2, 2]] + */ + function flatMapDepth(collection, iteratee, depth) { + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(map(collection, iteratee), depth); + } + + /** + * Iterates over elements of `collection` and invokes `iteratee` for each element. + * The iteratee is invoked with three arguments: (value, index|key, collection). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * **Note:** As with other "Collections" methods, objects with a "length" + * property are iterated like arrays. To avoid this behavior use `_.forIn` + * or `_.forOwn` for object iteration. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias each + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEachRight + * @example + * + * _.forEach([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `1` then `2`. + * + * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forEach(collection, iteratee) { + var func = isArray(collection) ? arrayEach : baseEach; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @alias eachRight + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEach + * @example + * + * _.forEachRight([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `2` then `1`. + */ + function forEachRight(collection, iteratee) { + var func = isArray(collection) ? arrayEachRight : baseEachRight; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The order of grouped values + * is determined by the order they occur in `collection`. The corresponding + * value of each key is an array of elements responsible for generating the + * key. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': [4.2], '6': [6.1, 6.3] } + * + * // The `_.property` iteratee shorthand. + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + baseAssignValue(result, key, [value]); + } + }); + + /** + * Checks if `value` is in `collection`. If `collection` is a string, it's + * checked for a substring of `value`, otherwise + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * is used for equality comparisons. If `fromIndex` is negative, it's used as + * the offset from the end of `collection`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {boolean} Returns `true` if `value` is found, else `false`. + * @example + * + * _.includes([1, 2, 3], 1); + * // => true + * + * _.includes([1, 2, 3], 1, 2); + * // => false + * + * _.includes({ 'a': 1, 'b': 2 }, 1); + * // => true + * + * _.includes('abcd', 'bc'); + * // => true + */ + function includes(collection, value, fromIndex, guard) { + collection = isArrayLike(collection) ? collection : values(collection); + fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + + var length = collection.length; + if (fromIndex < 0) { + fromIndex = nativeMax(length + fromIndex, 0); + } + return isString(collection) + ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) + : (!!length && baseIndexOf(collection, value, fromIndex) > -1); + } + + /** + * Invokes the method at `path` of each element in `collection`, returning + * an array of the results of each invoked method. Any additional arguments + * are provided to each invoked method. If `path` is a function, it's invoked + * for, and `this` bound to, each element in `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array|Function|string} path The path of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke each method with. + * @returns {Array} Returns the array of results. + * @example + * + * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invokeMap([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invokeMap = baseRest(function(collection, path, args) { + var index = -1, + isFunc = typeof path == 'function', + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value) { + result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); + }); + return result; + }); + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the last element responsible for generating the key. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * var array = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; + * + * _.keyBy(array, function(o) { + * return String.fromCharCode(o.code); + * }); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.keyBy(array, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + */ + var keyBy = createAggregator(function(result, value, key) { + baseAssignValue(result, key, value); + }); + + /** + * Creates an array of values by running each element in `collection` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. + * + * The guarded methods are: + * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, + * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, + * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, + * `template`, `trim`, `trimEnd`, `trimStart`, and `words` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + * @example + * + * function square(n) { + * return n * n; + * } + * + * _.map([4, 8], square); + * // => [16, 64] + * + * _.map({ 'a': 4, 'b': 8 }, square); + * // => [16, 64] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // The `_.property` iteratee shorthand. + * _.map(users, 'user'); + * // => ['barney', 'fred'] + */ + function map(collection, iteratee) { + var func = isArray(collection) ? arrayMap : baseMap; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.sortBy` except that it allows specifying the sort + * orders of the iteratees to sort by. If `orders` is unspecified, all values + * are sorted in ascending order. Otherwise, specify an order of "desc" for + * descending or "asc" for ascending sort order of corresponding values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] + * The iteratees to sort by. + * @param {string[]} [orders] The sort orders of `iteratees`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 34 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 36 } + * ]; + * + * // Sort by `user` in ascending order and by `age` in descending order. + * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + */ + function orderBy(collection, iteratees, orders, guard) { + if (collection == null) { + return []; + } + if (!isArray(iteratees)) { + iteratees = iteratees == null ? [] : [iteratees]; + } + orders = guard ? undefined : orders; + if (!isArray(orders)) { + orders = orders == null ? [] : [orders]; + } + return baseOrderBy(collection, iteratees, orders); + } + + /** + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, the second of which + * contains elements `predicate` returns falsey for. The predicate is + * invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the array of grouped elements. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.partition(users, function(o) { return o.active; }); + * // => objects for [['fred'], ['barney', 'pebbles']] + * + * // The `_.matches` iteratee shorthand. + * _.partition(users, { 'age': 1, 'active': false }); + * // => objects for [['pebbles'], ['barney', 'fred']] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.partition(users, ['active', false]); + * // => objects for [['barney', 'pebbles'], ['fred']] + * + * // The `_.property` iteratee shorthand. + * _.partition(users, 'active'); + * // => objects for [['fred'], ['barney', 'pebbles']] + */ + var partition = createAggregator(function(result, value, key) { + result[key ? 0 : 1].push(value); + }, function() { return [[], []]; }); + + /** + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` thru `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not given, the first element of `collection` is used as the initial + * value. The iteratee is invoked with four arguments: + * (accumulator, value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.reduce`, `_.reduceRight`, and `_.transform`. + * + * The guarded methods are: + * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, + * and `sortBy` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduceRight + * @example + * + * _.reduce([1, 2], function(sum, n) { + * return sum + n; + * }, 0); + * // => 3 + * + * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * return result; + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + */ + function reduce(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduce : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); + } + + /** + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduce + * @example + * + * var array = [[0, 1], [2, 3], [4, 5]]; + * + * _.reduceRight(array, function(flattened, other) { + * return flattened.concat(other); + * }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduceRight : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); + } + + /** + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.filter + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * _.reject(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.reject(users, { 'age': 40, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.reject(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.reject(users, 'active'); + * // => objects for ['barney'] + */ + function reject(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, negate(getIteratee(predicate, 3))); + } + + /** + * Gets a random element from `collection`. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + * @example + * + * _.sample([1, 2, 3, 4]); + * // => 2 + */ + function sample(collection) { + var func = isArray(collection) ? arraySample : baseSample; + return func(collection); + } + + /** + * Gets `n` random elements at unique keys from `collection` up to the + * size of `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @param {number} [n=1] The number of elements to sample. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the random elements. + * @example + * + * _.sampleSize([1, 2, 3], 2); + * // => [3, 1] + * + * _.sampleSize([1, 2, 3], 4); + * // => [2, 3, 1] + */ + function sampleSize(collection, n, guard) { + if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + var func = isArray(collection) ? arraySampleSize : baseSampleSize; + return func(collection, n); + } + + /** + * Creates an array of shuffled values, using a version of the + * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] + */ + function shuffle(collection) { + var func = isArray(collection) ? arrayShuffle : baseShuffle; + return func(collection); + } + + /** + * Gets the size of `collection` by returning its length for array-like + * values or the number of own enumerable string keyed properties for objects. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the collection size. + * @example + * + * _.size([1, 2, 3]); + * // => 3 + * + * _.size({ 'a': 1, 'b': 2 }); + * // => 2 + * + * _.size('pebbles'); + * // => 7 + */ + function size(collection) { + if (collection == null) { + return 0; + } + if (isArrayLike(collection)) { + return isString(collection) ? stringSize(collection) : collection.length; + } + var tag = getTag(collection); + if (tag == mapTag || tag == setTag) { + return collection.size; + } + return baseKeys(collection).length; + } + + /** + * Checks if `predicate` returns truthy for **any** element of `collection`. + * Iteration is stopped once `predicate` returns truthy. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + * @example + * + * _.some([null, 0, 'yes', false], Boolean); + * // => true + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.some(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.some(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.some(users, 'active'); + * // => true + */ + function some(collection, predicate, guard) { + var func = isArray(collection) ? arraySome : baseSome; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection thru each iteratee. This method + * performs a stable sort, that is, it preserves the original sort order of + * equal elements. The iteratees are invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {...(Function|Function[])} [iteratees=[_.identity]] + * The iteratees to sort by. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 34 } + * ]; + * + * _.sortBy(users, [function(o) { return o.user; }]); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * + * _.sortBy(users, ['user', 'age']); + * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + */ + var sortBy = baseRest(function(collection, iteratees) { + if (collection == null) { + return []; + } + var length = iteratees.length; + if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { + iteratees = []; + } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { + iteratees = [iteratees[0]]; + } + return baseOrderBy(collection, baseFlatten(iteratees, 1), []); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ + var now = ctxNow || function() { + return root.Date.now(); + }; + + /*------------------------------------------------------------------------*/ + + /** + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it's called `n` or more times. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var saves = ['profile', 'settings']; + * + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); + * + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => Logs 'done saving!' after the two async saves have completed. + */ + function after(n, func) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a function that invokes `func`, with up to `n` arguments, + * ignoring any additional arguments. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + n = guard ? undefined : n; + n = (func && n == null) ? func.length : n; + return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it's called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * jQuery(element).on('click', _.before(5, addContactToList)); + * // => Allows adding up to 4 contacts to the list. + */ + function before(n, func) { + var result; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } + if (n <= 1) { + func = undefined; + } + return result; + }; + } + + /** + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and `partials` prepended to the arguments it receives. + * + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" + * property of bound functions. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * function greet(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * + * var object = { 'user': 'fred' }; + * + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // Bound with placeholders. + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' + */ + var bind = baseRest(function(func, thisArg, partials) { + var bitmask = WRAP_BIND_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bind)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(func, bitmask, thisArg, partials, holders); + }); + + /** + * Creates a function that invokes the method at `object[key]` with `partials` + * prepended to the arguments it receives. + * + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. See + * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Function + * @param {Object} object The object to invoke the method on. + * @param {string} key The key of the method. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; + * + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // Bound with placeholders. + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' + */ + var bindKey = baseRest(function(object, key, partials) { + var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bindKey)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(key, bitmask, object, partials, holders); + }); + + /** + * Creates a function that accepts arguments of `func` and either invokes + * `func` returning its result, if at least `arity` number of arguments have + * been provided, or returns a function that accepts the remaining `func` + * arguments, and so on. The arity of `func` may be specified if `func.length` + * is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(1)(_, 3)(2); + * // => [1, 2, 3] + */ + function curry(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curry.placeholder; + return result; + } + + /** + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curryRight(abc); + * + * curried(3)(2)(1); + * // => [1, 2, 3] + * + * curried(2, 3)(1); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(3)(1, _)(2); + * // => [1, 2, 3] + */ + function curryRight(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curryRight.placeholder; + return result; + } + + /** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ + function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + timeWaiting = wait - timeSinceLastCall; + + return maxing + ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) + : timeWaiting; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; + } + + /** + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.defer(function(text) { + * console.log(text); + * }, 'deferred'); + * // => Logs 'deferred' after one millisecond. + */ + var defer = baseRest(function(func, args) { + return baseDelay(func, 1, args); + }); + + /** + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.delay(function(text) { + * console.log(text); + * }, 1000, 'later'); + * // => Logs 'later' after one second. + */ + var delay = baseRest(function(func, wait, args) { + return baseDelay(func, toNumber(wait) || 0, args); + }); + + /** + * Creates a function that invokes `func` with arguments reversed. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to flip arguments for. + * @returns {Function} Returns the new flipped function. + * @example + * + * var flipped = _.flip(function() { + * return _.toArray(arguments); + * }); + * + * flipped('a', 'b', 'c', 'd'); + * // => ['d', 'c', 'b', 'a'] + */ + function flip(func) { + return createWrap(func, WRAP_FLIP_FLAG); + } + + /** + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided, it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is used as the map cache key. The `func` + * is invoked with the `this` binding of the memoized function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the + * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) + * method interface of `clear`, `delete`, `get`, `has`, and `set`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoized function. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * var other = { 'c': 3, 'd': 4 }; + * + * var values = _.memoize(_.values); + * values(object); + * // => [1, 2] + * + * values(other); + * // => [3, 4] + * + * object.a = 2; + * values(object); + * // => [1, 2] + * + * // Modify the result cache. + * values.cache.set(object, ['a', 'b']); + * values(object); + * // => ['a', 'b'] + * + * // Replace `_.memoize.Cache`. + * _.memoize.Cache = WeakMap; + */ + function memoize(func, resolver) { + if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var args = arguments, + key = resolver ? resolver.apply(this, args) : args[0], + cache = memoized.cache; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, args); + memoized.cache = cache.set(key, result) || cache; + return result; + }; + memoized.cache = new (memoize.Cache || MapCache); + return memoized; + } + + // Expose `MapCache`. + memoize.Cache = MapCache; + + /** + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new negated function. + * @example + * + * function isEven(n) { + * return n % 2 == 0; + * } + * + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] + */ + function negate(predicate) { + if (typeof predicate != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var args = arguments; + switch (args.length) { + case 0: return !predicate.call(this); + case 1: return !predicate.call(this, args[0]); + case 2: return !predicate.call(this, args[0], args[1]); + case 3: return !predicate.call(this, args[0], args[1], args[2]); + } + return !predicate.apply(this, args); + }; + } + + /** + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first invocation. The `func` is + * invoked with the `this` binding and arguments of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // => `createApplication` is invoked once + */ + function once(func) { + return before(2, func); + } + + /** + * Creates a function that invokes `func` with its arguments transformed. + * + * @static + * @since 4.0.0 + * @memberOf _ + * @category Function + * @param {Function} func The function to wrap. + * @param {...(Function|Function[])} [transforms=[_.identity]] + * The argument transforms. + * @returns {Function} Returns the new function. + * @example + * + * function doubled(n) { + * return n * 2; + * } + * + * function square(n) { + * return n * n; + * } + * + * var func = _.overArgs(function(x, y) { + * return [x, y]; + * }, [square, doubled]); + * + * func(9, 3); + * // => [81, 6] + * + * func(10, 5); + * // => [100, 10] + */ + var overArgs = castRest(function(func, transforms) { + transforms = (transforms.length == 1 && isArray(transforms[0])) + ? arrayMap(transforms[0], baseUnary(getIteratee())) + : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); + + var funcsLength = transforms.length; + return baseRest(function(args) { + var index = -1, + length = nativeMin(args.length, funcsLength); + + while (++index < length) { + args[index] = transforms[index].call(this, args[index]); + } + return apply(func, this, args); + }); + }); + + /** + * Creates a function that invokes `func` with `partials` prepended to the + * arguments it receives. This method is like `_.bind` except it does **not** + * alter the `this` binding. + * + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 0.2.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // Partially applied with placeholders. + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + */ + var partial = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partial)); + return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); + }); + + /** + * This method is like `_.partial` except that partially applied arguments + * are appended to the arguments it receives. + * + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + * + * // Partially applied with placeholders. + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' + */ + var partialRight = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partialRight)); + return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); + }); + + /** + * Creates a function that invokes `func` with arguments arranged according + * to the specified `indexes` where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes. + * @returns {Function} Returns the new function. + * @example + * + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, [2, 0, 1]); + * + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] + */ + var rearg = flatRest(function(func, indexes) { + return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); + }); + + /** + * Creates a function that invokes `func` with the `this` binding of the + * created function and arguments from `start` and beyond provided as + * an array. + * + * **Note:** This method is based on the + * [rest parameter](https://mdn.io/rest_parameters). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.rest(function(what, names) { + * return what + ' ' + _.initial(names).join(', ') + + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); + * }); + * + * say('hello', 'fred', 'barney', 'pebbles'); + * // => 'hello fred, barney, & pebbles' + */ + function rest(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start === undefined ? start : toInteger(start); + return baseRest(func, start); + } + + /** + * Creates a function that invokes `func` with the `this` binding of the + * create function and an array of arguments much like + * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). + * + * **Note:** This method is based on the + * [spread operator](https://mdn.io/spread_operator). + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Function + * @param {Function} func The function to spread arguments over. + * @param {number} [start=0] The start position of the spread. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.spread(function(who, what) { + * return who + ' says ' + what; + * }); + * + * say(['fred', 'hello']); + * // => 'fred says hello' + * + * var numbers = Promise.all([ + * Promise.resolve(40), + * Promise.resolve(36) + * ]); + * + * numbers.then(_.spread(function(x, y) { + * return x + y; + * })); + * // => a Promise of 76 + */ + function spread(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start == null ? 0 : nativeMax(toInteger(start), 0); + return baseRest(function(args) { + var array = args[start], + otherArgs = castSlice(args, 0, start); + + if (array) { + arrayPush(otherArgs, array); + } + return apply(func, this, otherArgs); + }); + } + + /** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); + } + + /** + * Creates a function that accepts up to one argument, ignoring any + * additional arguments. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.unary(parseInt)); + * // => [6, 8, 10] + */ + function unary(func) { + return ary(func, 1); + } + + /** + * Creates a function that provides `value` to `wrapper` as its first + * argument. Any additional arguments provided to the function are appended + * to those provided to the `wrapper`. The wrapper is invoked with the `this` + * binding of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {*} value The value to wrap. + * @param {Function} [wrapper=identity] The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' + */ + function wrap(value, wrapper) { + return partial(castFunction(wrapper), value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Casts `value` as an array if it's not one. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Lang + * @param {*} value The value to inspect. + * @returns {Array} Returns the cast array. + * @example + * + * _.castArray(1); + * // => [1] + * + * _.castArray({ 'a': 1 }); + * // => [{ 'a': 1 }] + * + * _.castArray('abc'); + * // => ['abc'] + * + * _.castArray(null); + * // => [null] + * + * _.castArray(undefined); + * // => [undefined] + * + * _.castArray(); + * // => [] + * + * var array = [1, 2, 3]; + * console.log(_.castArray(array) === array); + * // => true + */ + function castArray() { + if (!arguments.length) { + return []; + } + var value = arguments[0]; + return isArray(value) ? value : [value]; + } + + /** + * Creates a shallow clone of `value`. + * + * **Note:** This method is loosely based on the + * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) + * and supports cloning arrays, array buffers, booleans, date objects, maps, + * numbers, `Object` objects, regexes, sets, strings, symbols, and typed + * arrays. The own enumerable properties of `arguments` objects are cloned + * as plain objects. An empty object is returned for uncloneable values such + * as error objects, functions, DOM nodes, and WeakMaps. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to clone. + * @returns {*} Returns the cloned value. + * @see _.cloneDeep + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var shallow = _.clone(objects); + * console.log(shallow[0] === objects[0]); + * // => true + */ + function clone(value) { + return baseClone(value, CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.clone` except that it accepts `customizer` which + * is invoked to produce the cloned value. If `customizer` returns `undefined`, + * cloning is handled by the method instead. The `customizer` is invoked with + * up to four arguments; (value [, index|key, object, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the cloned value. + * @see _.cloneDeepWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(false); + * } + * } + * + * var el = _.cloneWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 0 + */ + function cloneWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * This method is like `_.clone` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false + */ + function cloneDeep(value) { + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.cloneWith` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the deep cloned value. + * @see _.cloneWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(true); + * } + * } + * + * var el = _.cloneDeepWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 20 + */ + function cloneDeepWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * Checks if `object` conforms to `source` by invoking the predicate + * properties of `source` with the corresponding property values of `object`. + * + * **Note:** This method is equivalent to `_.conforms` when `source` is + * partially applied. + * + * @static + * @memberOf _ + * @since 4.14.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); + * // => true + * + * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); + * // => false + */ + function conformsTo(object, source) { + return source == null || baseConformsTo(object, source, keys(source)); + } + + /** + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true + */ + function eq(value, other) { + return value === other || (value !== value && other !== other); + } + + /** + * Checks if `value` is greater than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + * @see _.lt + * @example + * + * _.gt(3, 1); + * // => true + * + * _.gt(3, 3); + * // => false + * + * _.gt(1, 3); + * // => false + */ + var gt = createRelationalOperation(baseGt); + + /** + * Checks if `value` is greater than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than or equal to + * `other`, else `false`. + * @see _.lte + * @example + * + * _.gte(3, 1); + * // => true + * + * _.gte(3, 3); + * // => true + * + * _.gte(1, 3); + * // => false + */ + var gte = createRelationalOperation(function(value, other) { + return value >= other; + }); + + /** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { + return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && + !propertyIsEnumerable.call(value, 'callee'); + }; + + /** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ + var isArray = Array.isArray; + + /** + * Checks if `value` is classified as an `ArrayBuffer` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + * @example + * + * _.isArrayBuffer(new ArrayBuffer(2)); + * // => true + * + * _.isArrayBuffer(new Array(2)); + * // => false + */ + var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; + + /** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ + function isArrayLike(value) { + return value != null && isLength(value.length) && !isFunction(value); + } + + /** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ + function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); + } + + /** + * Checks if `value` is classified as a boolean primitive or object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. + * @example + * + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return value === true || value === false || + (isObjectLike(value) && baseGetTag(value) == boolTag); + } + + /** + * Checks if `value` is a buffer. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @example + * + * _.isBuffer(new Buffer(2)); + * // => true + * + * _.isBuffer(new Uint8Array(2)); + * // => false + */ + var isBuffer = nativeIsBuffer || stubFalse; + + /** + * Checks if `value` is classified as a `Date` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + * + * _.isDate('Mon April 23 2012'); + * // => false + */ + var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + + /** + * Checks if `value` is likely a DOM element. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + * + * _.isElement(''); + * // => false + */ + function isElement(value) { + return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); + } + + /** + * Checks if `value` is an empty object, collection, map, or set. + * + * Objects are considered empty if they have no own enumerable string keyed + * properties. + * + * Array-like values such as `arguments` objects, arrays, buffers, strings, or + * jQuery-like collections are considered empty if they have a `length` of `0`. + * Similarly, maps and sets are considered empty if they have a `size` of `0`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @example + * + * _.isEmpty(null); + * // => true + * + * _.isEmpty(true); + * // => true + * + * _.isEmpty(1); + * // => true + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({ 'a': 1 }); + * // => false + */ + function isEmpty(value) { + if (value == null) { + return true; + } + if (isArrayLike(value) && + (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || + isBuffer(value) || isTypedArray(value) || isArguments(value))) { + return !value.length; + } + var tag = getTag(value); + if (tag == mapTag || tag == setTag) { + return !value.size; + } + if (isPrototype(value)) { + return !baseKeys(value).length; + } + for (var key in value) { + if (hasOwnProperty.call(value, key)) { + return false; + } + } + return true; + } + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent. + * + * **Note:** This method supports comparing arrays, array buffers, booleans, + * date objects, error objects, maps, numbers, `Object` objects, regexes, + * sets, strings, symbols, and typed arrays. `Object` objects are compared + * by their own, not inherited, enumerable properties. Functions and DOM + * nodes are compared by strict equality, i.e. `===`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.isEqual(object, other); + * // => true + * + * object === other; + * // => false + */ + function isEqual(value, other) { + return baseIsEqual(value, other); + } + + /** + * This method is like `_.isEqual` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with up to + * six arguments: (objValue, othValue [, index|key, object, other, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, othValue) { + * if (isGreeting(objValue) && isGreeting(othValue)) { + * return true; + * } + * } + * + * var array = ['hello', 'goodbye']; + * var other = ['hi', 'goodbye']; + * + * _.isEqualWith(array, other, customizer); + * // => true + */ + function isEqualWith(value, other, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + var result = customizer ? customizer(value, other) : undefined; + return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; + } + + /** + * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, + * `SyntaxError`, `TypeError`, or `URIError` object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @example + * + * _.isError(new Error); + * // => true + * + * _.isError(Error); + * // => false + */ + function isError(value) { + if (!isObjectLike(value)) { + return false; + } + var tag = baseGetTag(value); + return tag == errorTag || tag == domExcTag || + (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); + } + + /** + * Checks if `value` is a finite primitive number. + * + * **Note:** This method is based on + * [`Number.isFinite`](https://mdn.io/Number/isFinite). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @example + * + * _.isFinite(3); + * // => true + * + * _.isFinite(Number.MIN_VALUE); + * // => true + * + * _.isFinite(Infinity); + * // => false + * + * _.isFinite('3'); + * // => false + */ + function isFinite(value) { + return typeof value == 'number' && nativeIsFinite(value); + } + + /** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ + function isFunction(value) { + if (!isObject(value)) { + return false; + } + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 9 which returns 'object' for typed arrays and other constructors. + var tag = baseGetTag(value); + return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; + } + + /** + * Checks if `value` is an integer. + * + * **Note:** This method is based on + * [`Number.isInteger`](https://mdn.io/Number/isInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an integer, else `false`. + * @example + * + * _.isInteger(3); + * // => true + * + * _.isInteger(Number.MIN_VALUE); + * // => false + * + * _.isInteger(Infinity); + * // => false + * + * _.isInteger('3'); + * // => false + */ + function isInteger(value) { + return typeof value == 'number' && value == toInteger(value); + } + + /** + * Checks if `value` is a valid array-like length. + * + * **Note:** This method is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ + function isLength(value) { + return typeof value == 'number' && + value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ + function isObject(value) { + var type = typeof value; + return value != null && (type == 'object' || type == 'function'); + } + + /** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ + function isObjectLike(value) { + return value != null && typeof value == 'object'; + } + + /** + * Checks if `value` is classified as a `Map` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + * @example + * + * _.isMap(new Map); + * // => true + * + * _.isMap(new WeakMap); + * // => false + */ + var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + + /** + * Performs a partial deep comparison between `object` and `source` to + * determine if `object` contains equivalent property values. + * + * **Note:** This method is equivalent to `_.matches` when `source` is + * partially applied. + * + * Partial comparisons will match empty array and empty object `source` + * values against any array or object value, respectively. See `_.isEqual` + * for a list of supported value comparisons. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.isMatch(object, { 'b': 2 }); + * // => true + * + * _.isMatch(object, { 'b': 1 }); + * // => false + */ + function isMatch(object, source) { + return object === source || baseIsMatch(object, source, getMatchData(source)); + } + + /** + * This method is like `_.isMatch` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with five + * arguments: (objValue, srcValue, index|key, object, source). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, srcValue) { + * if (isGreeting(objValue) && isGreeting(srcValue)) { + * return true; + * } + * } + * + * var object = { 'greeting': 'hello' }; + * var source = { 'greeting': 'hi' }; + * + * _.isMatchWith(object, source, customizer); + * // => true + */ + function isMatchWith(object, source, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseIsMatch(object, source, getMatchData(source), customizer); + } + + /** + * Checks if `value` is `NaN`. + * + * **Note:** This method is based on + * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as + * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for + * `undefined` and other non-number values. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // An `NaN` primitive is the only value that is not equal to itself. + // Perform the `toStringTag` check first to avoid errors with some + // ActiveX objects in IE. + return isNumber(value) && value != +value; + } + + /** + * Checks if `value` is a pristine native function. + * + * **Note:** This method can't reliably detect native functions in the presence + * of the core-js package because core-js circumvents this kind of detection. + * Despite multiple requests, the core-js maintainer has made it clear: any + * attempt to fix the detection will be obstructed. As a result, we're left + * with little choice but to throw an error. Unfortunately, this also affects + * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), + * which rely on core-js. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ + function isNative(value) { + if (isMaskable(value)) { + throw new Error(CORE_ERROR_TEXT); + } + return baseIsNative(value); + } + + /** + * Checks if `value` is `null`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(void 0); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is `null` or `undefined`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is nullish, else `false`. + * @example + * + * _.isNil(null); + * // => true + * + * _.isNil(void 0); + * // => true + * + * _.isNil(NaN); + * // => false + */ + function isNil(value) { + return value == null; + } + + /** + * Checks if `value` is classified as a `Number` primitive or object. + * + * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are + * classified as numbers, use the `_.isFinite` method. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a number, else `false`. + * @example + * + * _.isNumber(3); + * // => true + * + * _.isNumber(Number.MIN_VALUE); + * // => true + * + * _.isNumber(Infinity); + * // => true + * + * _.isNumber('3'); + * // => false + */ + function isNumber(value) { + return typeof value == 'number' || + (isObjectLike(value) && baseGetTag(value) == numberTag); + } + + /** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * @static + * @memberOf _ + * @since 0.8.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ + function isPlainObject(value) { + if (!isObjectLike(value) || baseGetTag(value) != objectTag) { + return false; + } + var proto = getPrototype(value); + if (proto === null) { + return true; + } + var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; + return typeof Ctor == 'function' && Ctor instanceof Ctor && + funcToString.call(Ctor) == objectCtorString; + } + + /** + * Checks if `value` is classified as a `RegExp` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + * @example + * + * _.isRegExp(/abc/); + * // => true + * + * _.isRegExp('/abc/'); + * // => false + */ + var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; + + /** + * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 + * double precision number which isn't the result of a rounded unsafe integer. + * + * **Note:** This method is based on + * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. + * @example + * + * _.isSafeInteger(3); + * // => true + * + * _.isSafeInteger(Number.MIN_VALUE); + * // => false + * + * _.isSafeInteger(Infinity); + * // => false + * + * _.isSafeInteger('3'); + * // => false + */ + function isSafeInteger(value) { + return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is classified as a `Set` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + * @example + * + * _.isSet(new Set); + * // => true + * + * _.isSet(new WeakSet); + * // => false + */ + var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + + /** + * Checks if `value` is classified as a `String` primitive or object. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a string, else `false`. + * @example + * + * _.isString('abc'); + * // => true + * + * _.isString(1); + * // => false + */ + function isString(value) { + return typeof value == 'string' || + (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); + } + + /** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ + function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && baseGetTag(value) == symbolTag); + } + + /** + * Checks if `value` is classified as a typed array. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + * @example + * + * _.isTypedArray(new Uint8Array); + * // => true + * + * _.isTypedArray([]); + * // => false + */ + var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; + + /** + * Checks if `value` is `undefined`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + * + * _.isUndefined(null); + * // => false + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Checks if `value` is classified as a `WeakMap` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. + * @example + * + * _.isWeakMap(new WeakMap); + * // => true + * + * _.isWeakMap(new Map); + * // => false + */ + function isWeakMap(value) { + return isObjectLike(value) && getTag(value) == weakMapTag; + } + + /** + * Checks if `value` is classified as a `WeakSet` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. + * @example + * + * _.isWeakSet(new WeakSet); + * // => true + * + * _.isWeakSet(new Set); + * // => false + */ + function isWeakSet(value) { + return isObjectLike(value) && baseGetTag(value) == weakSetTag; + } + + /** + * Checks if `value` is less than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + * @see _.gt + * @example + * + * _.lt(1, 3); + * // => true + * + * _.lt(3, 3); + * // => false + * + * _.lt(3, 1); + * // => false + */ + var lt = createRelationalOperation(baseLt); + + /** + * Checks if `value` is less than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than or equal to + * `other`, else `false`. + * @see _.gte + * @example + * + * _.lte(1, 3); + * // => true + * + * _.lte(3, 3); + * // => true + * + * _.lte(3, 1); + * // => false + */ + var lte = createRelationalOperation(function(value, other) { + return value <= other; + }); + + /** + * Converts `value` to an array. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Array} Returns the converted array. + * @example + * + * _.toArray({ 'a': 1, 'b': 2 }); + * // => [1, 2] + * + * _.toArray('abc'); + * // => ['a', 'b', 'c'] + * + * _.toArray(1); + * // => [] + * + * _.toArray(null); + * // => [] + */ + function toArray(value) { + if (!value) { + return []; + } + if (isArrayLike(value)) { + return isString(value) ? stringToArray(value) : copyArray(value); + } + if (symIterator && value[symIterator]) { + return iteratorToArray(value[symIterator]()); + } + var tag = getTag(value), + func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); + + return func(value); + } + + /** + * Converts `value` to a finite number. + * + * @static + * @memberOf _ + * @since 4.12.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted number. + * @example + * + * _.toFinite(3.2); + * // => 3.2 + * + * _.toFinite(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toFinite(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toFinite('3.2'); + * // => 3.2 + */ + function toFinite(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + return value === value ? value : 0; + } + + /** + * Converts `value` to an integer. + * + * **Note:** This method is loosely based on + * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3.2); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3.2'); + * // => 3 + */ + function toInteger(value) { + var result = toFinite(value), + remainder = result % 1; + + return result === result ? (remainder ? result - remainder : result) : 0; + } + + /** + * Converts `value` to an integer suitable for use as the length of an + * array-like object. + * + * **Note:** This method is based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toLength(3.2); + * // => 3 + * + * _.toLength(Number.MIN_VALUE); + * // => 0 + * + * _.toLength(Infinity); + * // => 4294967295 + * + * _.toLength('3.2'); + * // => 3 + */ + function toLength(value) { + return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; + } + + /** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ + function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); + } + + /** + * Converts `value` to a plain object flattening inherited enumerable string + * keyed properties of `value` to own properties of the plain object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {Object} Returns the converted plain object. + * @example + * + * function Foo() { + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.assign({ 'a': 1 }, new Foo); + * // => { 'a': 1, 'b': 2 } + * + * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); + * // => { 'a': 1, 'b': 2, 'c': 3 } + */ + function toPlainObject(value) { + return copyObject(value, keysIn(value)); + } + + /** + * Converts `value` to a safe integer. A safe integer can be compared and + * represented correctly. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toSafeInteger(3.2); + * // => 3 + * + * _.toSafeInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toSafeInteger(Infinity); + * // => 9007199254740991 + * + * _.toSafeInteger('3.2'); + * // => 3 + */ + function toSafeInteger(value) { + return value + ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) + : (value === 0 ? value : 0); + } + + /** + * Converts `value` to a string. An empty string is returned for `null` + * and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ + function toString(value) { + return value == null ? '' : baseToString(value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Assigns own enumerable string keyed properties of source objects to the + * destination object. Source objects are applied from left to right. + * Subsequent sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object` and is loosely based on + * [`Object.assign`](https://mdn.io/Object/assign). + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assignIn + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assign({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'c': 3 } + */ + var assign = createAssigner(function(object, source) { + if (isPrototype(source) || isArrayLike(source)) { + copyObject(source, keys(source), object); + return; + } + for (var key in source) { + if (hasOwnProperty.call(source, key)) { + assignValue(object, key, source[key]); + } + } + }); + + /** + * This method is like `_.assign` except that it iterates over own and + * inherited source properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extend + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assign + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assignIn({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + */ + var assignIn = createAssigner(function(object, source) { + copyObject(source, keysIn(source), object); + }); + + /** + * This method is like `_.assignIn` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extendWith + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignInWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keysIn(source), object, customizer); + }); + + /** + * This method is like `_.assign` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignInWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keys(source), object, customizer); + }); + + /** + * Creates an array of values corresponding to `paths` of `object`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Array} Returns the picked values. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _.at(object, ['a[0].b.c', 'a[1]']); + * // => [3, 4] + */ + var at = flatRest(baseAt); + + /** + * Creates an object that inherits from the `prototype` object. If a + * `properties` object is given, its own enumerable string keyed properties + * are assigned to the created object. + * + * @static + * @memberOf _ + * @since 2.3.0 + * @category Object + * @param {Object} prototype The object to inherit from. + * @param {Object} [properties] The properties to assign to the object. + * @returns {Object} Returns the new object. + * @example + * + * function Shape() { + * this.x = 0; + * this.y = 0; + * } + * + * function Circle() { + * Shape.call(this); + * } + * + * Circle.prototype = _.create(Shape.prototype, { + * 'constructor': Circle + * }); + * + * var circle = new Circle; + * circle instanceof Circle; + * // => true + * + * circle instanceof Shape; + * // => true + */ + function create(prototype, properties) { + var result = baseCreate(prototype); + return properties == null ? result : baseAssign(result, properties); + } + + /** + * Assigns own and inherited enumerable string keyed properties of source + * objects to the destination object for all destination properties that + * resolve to `undefined`. Source objects are applied from left to right. + * Once a property is set, additional values of the same property are ignored. + * + * **Note:** This method mutates `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaultsDeep + * @example + * + * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var defaults = baseRest(function(object, sources) { + object = Object(object); + + var index = -1; + var length = sources.length; + var guard = length > 2 ? sources[2] : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + length = 1; + } + + while (++index < length) { + var source = sources[index]; + var props = keysIn(source); + var propsIndex = -1; + var propsLength = props.length; + + while (++propsIndex < propsLength) { + var key = props[propsIndex]; + var value = object[key]; + + if (value === undefined || + (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { + object[key] = source[key]; + } + } + } + + return object; + }); + + /** + * This method is like `_.defaults` except that it recursively assigns + * default properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaults + * @example + * + * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); + * // => { 'a': { 'b': 2, 'c': 3 } } + */ + var defaultsDeep = baseRest(function(args) { + args.push(undefined, customDefaultsMerge); + return apply(mergeWith, undefined, args); + }); + + /** + * This method is like `_.find` except that it returns the key of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findKey(users, function(o) { return o.age < 40; }); + * // => 'barney' (iteration order is not guaranteed) + * + * // The `_.matches` iteratee shorthand. + * _.findKey(users, { 'age': 1, 'active': true }); + * // => 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findKey(users, 'active'); + * // => 'barney' + */ + function findKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); + } + + /** + * This method is like `_.findKey` except that it iterates over elements of + * a collection in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findLastKey(users, function(o) { return o.age < 40; }); + * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.findLastKey(users, { 'age': 36, 'active': true }); + * // => 'barney' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findLastKey(users, 'active'); + * // => 'pebbles' + */ + function findLastKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); + } + + /** + * Iterates over own and inherited enumerable string keyed properties of an + * object and invokes `iteratee` for each property. The iteratee is invoked + * with three arguments: (value, key, object). Iteratee functions may exit + * iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forInRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forIn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + */ + function forIn(object, iteratee) { + return object == null + ? object + : baseFor(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * This method is like `_.forIn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forIn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forInRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + */ + function forInRight(object, iteratee) { + return object == null + ? object + : baseForRight(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * Iterates over own enumerable string keyed properties of an object and + * invokes `iteratee` for each property. The iteratee is invoked with three + * arguments: (value, key, object). Iteratee functions may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwnRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forOwn(object, iteratee) { + return object && baseForOwn(object, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forOwn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwnRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + */ + function forOwnRight(object, iteratee) { + return object && baseForOwnRight(object, getIteratee(iteratee, 3)); + } + + /** + * Creates an array of function property names from own enumerable properties + * of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functionsIn + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functions(new Foo); + * // => ['a', 'b'] + */ + function functions(object) { + return object == null ? [] : baseFunctions(object, keys(object)); + } + + /** + * Creates an array of function property names from own and inherited + * enumerable properties of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functions + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functionsIn(new Foo); + * // => ['a', 'b', 'c'] + */ + function functionsIn(object) { + return object == null ? [] : baseFunctions(object, keysIn(object)); + } + + /** + * Gets the value at `path` of `object`. If the resolved value is + * `undefined`, the `defaultValue` is returned in its place. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.get(object, 'a[0].b.c'); + * // => 3 + * + * _.get(object, ['a', '0', 'b', 'c']); + * // => 3 + * + * _.get(object, 'a.b.c', 'default'); + * // => 'default' + */ + function get(object, path, defaultValue) { + var result = object == null ? undefined : baseGet(object, path); + return result === undefined ? defaultValue : result; + } + + /** + * Checks if `path` is a direct property of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = { 'a': { 'b': 2 } }; + * var other = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.has(object, 'a'); + * // => true + * + * _.has(object, 'a.b'); + * // => true + * + * _.has(object, ['a', 'b']); + * // => true + * + * _.has(other, 'a'); + * // => false + */ + function has(object, path) { + return object != null && hasPath(object, path, baseHas); + } + + /** + * Checks if `path` is a direct or inherited property of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.hasIn(object, 'a'); + * // => true + * + * _.hasIn(object, 'a.b'); + * // => true + * + * _.hasIn(object, ['a', 'b']); + * // => true + * + * _.hasIn(object, 'b'); + * // => false + */ + function hasIn(object, path) { + return object != null && hasPath(object, path, baseHasIn); + } + + /** + * Creates an object composed of the inverted keys and values of `object`. + * If `object` contains duplicate values, subsequent values overwrite + * property assignments of previous values. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Object + * @param {Object} object The object to invert. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invert(object); + * // => { '1': 'c', '2': 'b' } + */ + var invert = createInverter(function(result, value, key) { + if (value != null && + typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + result[value] = key; + }, constant(identity)); + + /** + * This method is like `_.invert` except that the inverted object is generated + * from the results of running each element of `object` thru `iteratee`. The + * corresponding inverted value of each inverted key is an array of keys + * responsible for generating the inverted value. The iteratee is invoked + * with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Object + * @param {Object} object The object to invert. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invertBy(object); + * // => { '1': ['a', 'c'], '2': ['b'] } + * + * _.invertBy(object, function(value) { + * return 'group' + value; + * }); + * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + */ + var invertBy = createInverter(function(result, value, key) { + if (value != null && + typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + if (hasOwnProperty.call(result, value)) { + result[value].push(key); + } else { + result[value] = [key]; + } + }, getIteratee); + + /** + * Invokes the method at `path` of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {...*} [args] The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + * @example + * + * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * + * _.invoke(object, 'a[0].b.c.slice', 1, 3); + * // => [2, 3] + */ + var invoke = baseRest(baseInvoke); + + /** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * for more details. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ + function keys(object) { + return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); + } + + /** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ + function keysIn(object) { + return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); + } + + /** + * The opposite of `_.mapValues`; this method creates an object with the + * same values as `object` and keys generated by running each own enumerable + * string keyed property of `object` thru `iteratee`. The iteratee is invoked + * with three arguments: (value, key, object). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapValues + * @example + * + * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { + * return key + value; + * }); + * // => { 'a1': 1, 'b2': 2 } + */ + function mapKeys(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, iteratee(value, key, object), value); + }); + return result; + } + + /** + * Creates an object with the same keys as `object` and values generated + * by running each own enumerable string keyed property of `object` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, key, object). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapKeys + * @example + * + * var users = { + * 'fred': { 'user': 'fred', 'age': 40 }, + * 'pebbles': { 'user': 'pebbles', 'age': 1 } + * }; + * + * _.mapValues(users, function(o) { return o.age; }); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * + * // The `_.property` iteratee shorthand. + * _.mapValues(users, 'age'); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + */ + function mapValues(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, key, iteratee(value, key, object)); + }); + return result; + } + + /** + * This method is like `_.assign` except that it recursively merges own and + * inherited enumerable string keyed properties of source objects into the + * destination object. Source properties that resolve to `undefined` are + * skipped if a destination value exists. Array and plain object properties + * are merged recursively. Other objects and value types are overridden by + * assignment. Source objects are applied from left to right. Subsequent + * sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @example + * + * var object = { + * 'a': [{ 'b': 2 }, { 'd': 4 }] + * }; + * + * var other = { + * 'a': [{ 'c': 3 }, { 'e': 5 }] + * }; + * + * _.merge(object, other); + * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + */ + var merge = createAssigner(function(object, source, srcIndex) { + baseMerge(object, source, srcIndex); + }); + + /** + * This method is like `_.merge` except that it accepts `customizer` which + * is invoked to produce the merged values of the destination and source + * properties. If `customizer` returns `undefined`, merging is handled by the + * method instead. The `customizer` is invoked with six arguments: + * (objValue, srcValue, key, object, source, stack). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} customizer The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * function customizer(objValue, srcValue) { + * if (_.isArray(objValue)) { + * return objValue.concat(srcValue); + * } + * } + * + * var object = { 'a': [1], 'b': [2] }; + * var other = { 'a': [3], 'b': [4] }; + * + * _.mergeWith(object, other, customizer); + * // => { 'a': [1, 3], 'b': [2, 4] } + */ + var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { + baseMerge(object, source, srcIndex, customizer); + }); + + /** + * The opposite of `_.pick`; this method creates an object composed of the + * own and inherited enumerable property paths of `object` that are not omitted. + * + * **Note:** This method is considerably slower than `_.pick`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to omit. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omit(object, ['a', 'c']); + * // => { 'b': '2' } + */ + var omit = flatRest(function(object, paths) { + var result = {}; + if (object == null) { + return result; + } + var isDeep = false; + paths = arrayMap(paths, function(path) { + path = castPath(path, object); + isDeep || (isDeep = path.length > 1); + return path; + }); + copyObject(object, getAllKeysIn(object), result); + if (isDeep) { + result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); + } + var length = paths.length; + while (length--) { + baseUnset(result, paths[length]); + } + return result; + }); + + /** + * The opposite of `_.pickBy`; this method creates an object composed of + * the own and inherited enumerable string keyed properties of `object` that + * `predicate` doesn't return truthy for. The predicate is invoked with two + * arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omitBy(object, _.isNumber); + * // => { 'b': '2' } + */ + function omitBy(object, predicate) { + return pickBy(object, negate(getIteratee(predicate))); + } + + /** + * Creates an object composed of the picked `object` properties. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pick(object, ['a', 'c']); + * // => { 'a': 1, 'c': 3 } + */ + var pick = flatRest(function(object, paths) { + return object == null ? {} : basePick(object, paths); + }); + + /** + * Creates an object composed of the `object` properties `predicate` returns + * truthy for. The predicate is invoked with two arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pickBy(object, _.isNumber); + * // => { 'a': 1, 'c': 3 } + */ + function pickBy(object, predicate) { + if (object == null) { + return {}; + } + var props = arrayMap(getAllKeysIn(object), function(prop) { + return [prop]; + }); + predicate = getIteratee(predicate); + return basePickBy(object, props, function(value, path) { + return predicate(value, path[0]); + }); + } + + /** + * This method is like `_.get` except that if the resolved value is a + * function it's invoked with the `this` binding of its parent object and + * its result is returned. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to resolve. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; + * + * _.result(object, 'a[0].b.c1'); + * // => 3 + * + * _.result(object, 'a[0].b.c2'); + * // => 4 + * + * _.result(object, 'a[0].b.c3', 'default'); + * // => 'default' + * + * _.result(object, 'a[0].b.c3', _.constant('default')); + * // => 'default' + */ + function result(object, path, defaultValue) { + path = castPath(path, object); + + var index = -1, + length = path.length; + + // Ensure the loop is entered when path is empty. + if (!length) { + length = 1; + object = undefined; + } + while (++index < length) { + var value = object == null ? undefined : object[toKey(path[index])]; + if (value === undefined) { + index = length; + value = defaultValue; + } + object = isFunction(value) ? value.call(object) : value; + } + return object; + } + + /** + * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, + * it's created. Arrays are created for missing index properties while objects + * are created for all other missing properties. Use `_.setWith` to customize + * `path` creation. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.set(object, 'a[0].b.c', 4); + * console.log(object.a[0].b.c); + * // => 4 + * + * _.set(object, ['x', '0', 'y', 'z'], 5); + * console.log(object.x[0].y.z); + * // => 5 + */ + function set(object, path, value) { + return object == null ? object : baseSet(object, path, value); + } + + /** + * This method is like `_.set` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.setWith(object, '[0][1]', 'a', Object); + * // => { '0': { '1': 'a' } } + */ + function setWith(object, path, value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseSet(object, path, value, customizer); + } + + /** + * Creates an array of own enumerable string keyed-value pairs for `object` + * which can be consumed by `_.fromPairs`. If `object` is a map or set, its + * entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entries + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairs(new Foo); + * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + */ + var toPairs = createToPairs(keys); + + /** + * Creates an array of own and inherited enumerable string keyed-value pairs + * for `object` which can be consumed by `_.fromPairs`. If `object` is a map + * or set, its entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entriesIn + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairsIn(new Foo); + * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) + */ + var toPairsIn = createToPairs(keysIn); + + /** + * An alternative to `_.reduce`; this method transforms `object` to a new + * `accumulator` object which is the result of running each of its own + * enumerable string keyed properties thru `iteratee`, with each invocation + * potentially mutating the `accumulator` object. If `accumulator` is not + * provided, a new object with the same `[[Prototype]]` will be used. The + * iteratee is invoked with four arguments: (accumulator, value, key, object). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The custom accumulator value. + * @returns {*} Returns the accumulated value. + * @example + * + * _.transform([2, 3, 4], function(result, n) { + * result.push(n *= n); + * return n % 2 == 0; + * }, []); + * // => [4, 9] + * + * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } + */ + function transform(object, iteratee, accumulator) { + var isArr = isArray(object), + isArrLike = isArr || isBuffer(object) || isTypedArray(object); + + iteratee = getIteratee(iteratee, 4); + if (accumulator == null) { + var Ctor = object && object.constructor; + if (isArrLike) { + accumulator = isArr ? new Ctor : []; + } + else if (isObject(object)) { + accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; + } + else { + accumulator = {}; + } + } + (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { + return iteratee(accumulator, value, index, object); + }); + return accumulator; + } + + /** + * Removes the property at `path` of `object`. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 7 } }] }; + * _.unset(object, 'a[0].b.c'); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + * + * _.unset(object, ['a', '0', 'b', 'c']); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + */ + function unset(object, path) { + return object == null ? true : baseUnset(object, path); + } + + /** + * This method is like `_.set` except that accepts `updater` to produce the + * value to set. Use `_.updateWith` to customize `path` creation. The `updater` + * is invoked with one argument: (value). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.update(object, 'a[0].b.c', function(n) { return n * n; }); + * console.log(object.a[0].b.c); + * // => 9 + * + * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); + * console.log(object.x[0].y.z); + * // => 0 + */ + function update(object, path, updater) { + return object == null ? object : baseUpdate(object, path, castFunction(updater)); + } + + /** + * This method is like `_.update` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.updateWith(object, '[0][1]', _.constant('a'), Object); + * // => { '0': { '1': 'a' } } + */ + function updateWith(object, path, updater, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); + } + + /** + * Creates an array of the own enumerable string keyed property values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.values(new Foo); + * // => [1, 2] (iteration order is not guaranteed) + * + * _.values('hi'); + * // => ['h', 'i'] + */ + function values(object) { + return object == null ? [] : baseValues(object, keys(object)); + } + + /** + * Creates an array of the own and inherited enumerable string keyed property + * values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.valuesIn(new Foo); + * // => [1, 2, 3] (iteration order is not guaranteed) + */ + function valuesIn(object) { + return object == null ? [] : baseValues(object, keysIn(object)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Clamps `number` within the inclusive `lower` and `upper` bounds. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Number + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + * @example + * + * _.clamp(-10, -5, 5); + * // => -5 + * + * _.clamp(10, -5, 5); + * // => 5 + */ + function clamp(number, lower, upper) { + if (upper === undefined) { + upper = lower; + lower = undefined; + } + if (upper !== undefined) { + upper = toNumber(upper); + upper = upper === upper ? upper : 0; + } + if (lower !== undefined) { + lower = toNumber(lower); + lower = lower === lower ? lower : 0; + } + return baseClamp(toNumber(number), lower, upper); + } + + /** + * Checks if `n` is between `start` and up to, but not including, `end`. If + * `end` is not specified, it's set to `start` with `start` then set to `0`. + * If `start` is greater than `end` the params are swapped to support + * negative ranges. + * + * @static + * @memberOf _ + * @since 3.3.0 + * @category Number + * @param {number} number The number to check. + * @param {number} [start=0] The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + * @see _.range, _.rangeRight + * @example + * + * _.inRange(3, 2, 4); + * // => true + * + * _.inRange(4, 8); + * // => true + * + * _.inRange(4, 2); + * // => false + * + * _.inRange(2, 2); + * // => false + * + * _.inRange(1.2, 2); + * // => true + * + * _.inRange(5.2, 4); + * // => false + * + * _.inRange(-3, -2, -6); + * // => true + */ + function inRange(number, start, end) { + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + number = toNumber(number); + return baseInRange(number, start, end); + } + + /** + * Produces a random number between the inclusive `lower` and `upper` bounds. + * If only one argument is provided a number between `0` and the given number + * is returned. If `floating` is `true`, or either `lower` or `upper` are + * floats, a floating-point number is returned instead of an integer. + * + * **Note:** JavaScript follows the IEEE-754 standard for resolving + * floating-point values which can produce unexpected results. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Number + * @param {number} [lower=0] The lower bound. + * @param {number} [upper=1] The upper bound. + * @param {boolean} [floating] Specify returning a floating-point number. + * @returns {number} Returns the random number. + * @example + * + * _.random(0, 5); + * // => an integer between 0 and 5 + * + * _.random(5); + * // => also an integer between 0 and 5 + * + * _.random(5, true); + * // => a floating-point number between 0 and 5 + * + * _.random(1.2, 5.2); + * // => a floating-point number between 1.2 and 5.2 + */ + function random(lower, upper, floating) { + if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { + upper = floating = undefined; + } + if (floating === undefined) { + if (typeof upper == 'boolean') { + floating = upper; + upper = undefined; + } + else if (typeof lower == 'boolean') { + floating = lower; + lower = undefined; + } + } + if (lower === undefined && upper === undefined) { + lower = 0; + upper = 1; + } + else { + lower = toFinite(lower); + if (upper === undefined) { + upper = lower; + lower = 0; + } else { + upper = toFinite(upper); + } + } + if (lower > upper) { + var temp = lower; + lower = upper; + upper = temp; + } + if (floating || lower % 1 || upper % 1) { + var rand = nativeRandom(); + return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); + } + return baseRandom(lower, upper); + } + + /*------------------------------------------------------------------------*/ + + /** + * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the camel cased string. + * @example + * + * _.camelCase('Foo Bar'); + * // => 'fooBar' + * + * _.camelCase('--foo-bar--'); + * // => 'fooBar' + * + * _.camelCase('__FOO_BAR__'); + * // => 'fooBar' + */ + var camelCase = createCompounder(function(result, word, index) { + word = word.toLowerCase(); + return result + (index ? capitalize(word) : word); + }); + + /** + * Converts the first character of `string` to upper case and the remaining + * to lower case. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to capitalize. + * @returns {string} Returns the capitalized string. + * @example + * + * _.capitalize('FRED'); + * // => 'Fred' + */ + function capitalize(string) { + return upperFirst(toString(string).toLowerCase()); + } + + /** + * Deburrs `string` by converting + * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) + * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) + * letters to basic Latin letters and removing + * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to deburr. + * @returns {string} Returns the deburred string. + * @example + * + * _.deburr('déjà vu'); + * // => 'deja vu' + */ + function deburr(string) { + string = toString(string); + return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); + } + + /** + * Checks if `string` ends with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=string.length] The position to search up to. + * @returns {boolean} Returns `true` if `string` ends with `target`, + * else `false`. + * @example + * + * _.endsWith('abc', 'c'); + * // => true + * + * _.endsWith('abc', 'b'); + * // => false + * + * _.endsWith('abc', 'b', 2); + * // => true + */ + function endsWith(string, target, position) { + string = toString(string); + target = baseToString(target); + + var length = string.length; + position = position === undefined + ? length + : baseClamp(toInteger(position), 0, length); + + var end = position; + position -= target.length; + return position >= 0 && string.slice(position, end) == target; + } + + /** + * Converts the characters "&", "<", ">", '"', and "'" in `string` to their + * corresponding HTML entities. + * + * **Note:** No other characters are escaped. To escape additional + * characters use a third-party library like [_he_](https://mths.be/he). + * + * Though the ">" character is escaped for symmetry, characters like + * ">" and "/" don't need escaping in HTML and have no special meaning + * unless they're part of a tag or unquoted attribute value. See + * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) + * (under "semi-related fun fact") for more details. + * + * When working with HTML you should always + * [quote attribute values](http://wonko.com/post/html-escaping) to reduce + * XSS vectors. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escape('fred, barney, & pebbles'); + * // => 'fred, barney, & pebbles' + */ + function escape(string) { + string = toString(string); + return (string && reHasUnescapedHtml.test(string)) + ? string.replace(reUnescapedHtml, escapeHtmlChar) + : string; + } + + /** + * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", + * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escapeRegExp('[lodash](https://lodash.com/)'); + * // => '\[lodash\]\(https://lodash\.com/\)' + */ + function escapeRegExp(string) { + string = toString(string); + return (string && reHasRegExpChar.test(string)) + ? string.replace(reRegExpChar, '\\$&') + : string; + } + + /** + * Converts `string` to + * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the kebab cased string. + * @example + * + * _.kebabCase('Foo Bar'); + * // => 'foo-bar' + * + * _.kebabCase('fooBar'); + * // => 'foo-bar' + * + * _.kebabCase('__FOO_BAR__'); + * // => 'foo-bar' + */ + var kebabCase = createCompounder(function(result, word, index) { + return result + (index ? '-' : '') + word.toLowerCase(); + }); + + /** + * Converts `string`, as space separated words, to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the lower cased string. + * @example + * + * _.lowerCase('--Foo-Bar--'); + * // => 'foo bar' + * + * _.lowerCase('fooBar'); + * // => 'foo bar' + * + * _.lowerCase('__FOO_BAR__'); + * // => 'foo bar' + */ + var lowerCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + word.toLowerCase(); + }); + + /** + * Converts the first character of `string` to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.lowerFirst('Fred'); + * // => 'fred' + * + * _.lowerFirst('FRED'); + * // => 'fRED' + */ + var lowerFirst = createCaseFirst('toLowerCase'); + + /** + * Pads `string` on the left and right sides if it's shorter than `length`. + * Padding characters are truncated if they can't be evenly divided by `length`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ + function pad(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + if (!length || strLength >= length) { + return string; + } + var mid = (length - strLength) / 2; + return ( + createPadding(nativeFloor(mid), chars) + + string + + createPadding(nativeCeil(mid), chars) + ); + } + + /** + * Pads `string` on the right side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padEnd('abc', 6); + * // => 'abc ' + * + * _.padEnd('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padEnd('abc', 3); + * // => 'abc' + */ + function padEnd(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (string + createPadding(length - strLength, chars)) + : string; + } + + /** + * Pads `string` on the left side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padStart('abc', 6); + * // => ' abc' + * + * _.padStart('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padStart('abc', 3); + * // => 'abc' + */ + function padStart(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (createPadding(length - strLength, chars) + string) + : string; + } + + /** + * Converts `string` to an integer of the specified radix. If `radix` is + * `undefined` or `0`, a `radix` of `10` is used unless `value` is a + * hexadecimal, in which case a `radix` of `16` is used. + * + * **Note:** This method aligns with the + * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category String + * @param {string} string The string to convert. + * @param {number} [radix=10] The radix to interpret `value` by. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {number} Returns the converted integer. + * @example + * + * _.parseInt('08'); + * // => 8 + * + * _.map(['6', '08', '10'], _.parseInt); + * // => [6, 8, 10] + */ + function parseInt(string, radix, guard) { + if (guard || radix == null) { + radix = 0; + } else if (radix) { + radix = +radix; + } + return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); + } + + /** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=1] The number of times to repeat the string. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ + function repeat(string, n, guard) { + if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + return baseRepeat(toString(string), n); + } + + /** + * Replaces matches for `pattern` in `string` with `replacement`. + * + * **Note:** This method is based on + * [`String#replace`](https://mdn.io/String/replace). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to modify. + * @param {RegExp|string} pattern The pattern to replace. + * @param {Function|string} replacement The match replacement. + * @returns {string} Returns the modified string. + * @example + * + * _.replace('Hi Fred', 'Fred', 'Barney'); + * // => 'Hi Barney' + */ + function replace() { + var args = arguments, + string = toString(args[0]); + + return args.length < 3 ? string : string.replace(args[1], args[2]); + } + + /** + * Converts `string` to + * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the snake cased string. + * @example + * + * _.snakeCase('Foo Bar'); + * // => 'foo_bar' + * + * _.snakeCase('fooBar'); + * // => 'foo_bar' + * + * _.snakeCase('--FOO-BAR--'); + * // => 'foo_bar' + */ + var snakeCase = createCompounder(function(result, word, index) { + return result + (index ? '_' : '') + word.toLowerCase(); + }); + + /** + * Splits `string` by `separator`. + * + * **Note:** This method is based on + * [`String#split`](https://mdn.io/String/split). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to split. + * @param {RegExp|string} separator The separator pattern to split by. + * @param {number} [limit] The length to truncate results to. + * @returns {Array} Returns the string segments. + * @example + * + * _.split('a-b-c', '-', 2); + * // => ['a', 'b'] + */ + function split(string, separator, limit) { + if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { + separator = limit = undefined; + } + limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; + if (!limit) { + return []; + } + string = toString(string); + if (string && ( + typeof separator == 'string' || + (separator != null && !isRegExp(separator)) + )) { + separator = baseToString(separator); + if (!separator && hasUnicode(string)) { + return castSlice(stringToArray(string), 0, limit); + } + } + return string.split(separator, limit); + } + + /** + * Converts `string` to + * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * + * @static + * @memberOf _ + * @since 3.1.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the start cased string. + * @example + * + * _.startCase('--foo-bar--'); + * // => 'Foo Bar' + * + * _.startCase('fooBar'); + * // => 'Foo Bar' + * + * _.startCase('__FOO_BAR__'); + * // => 'FOO BAR' + */ + var startCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + upperFirst(word); + }); + + /** + * Checks if `string` starts with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=0] The position to search from. + * @returns {boolean} Returns `true` if `string` starts with `target`, + * else `false`. + * @example + * + * _.startsWith('abc', 'a'); + * // => true + * + * _.startsWith('abc', 'b'); + * // => false + * + * _.startsWith('abc', 'b', 1); + * // => true + */ + function startsWith(string, target, position) { + string = toString(string); + position = position == null + ? 0 + : baseClamp(toInteger(position), 0, string.length); + + target = baseToString(target); + return string.slice(position, position + target.length) == target; + } + + /** + * Creates a compiled template function that can interpolate data properties + * in "interpolate" delimiters, HTML-escape interpolated data properties in + * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data + * properties may be accessed as free variables in the template. If a setting + * object is given, it takes precedence over `_.templateSettings` values. + * + * **Note:** In the development build `_.template` utilizes + * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) + * for easier debugging. + * + * For more information on precompiling templates see + * [lodash's custom builds documentation](https://lodash.com/custom-builds). + * + * For more information on Chrome extension sandboxes see + * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The template string. + * @param {Object} [options={}] The options object. + * @param {RegExp} [options.escape=_.templateSettings.escape] + * The HTML "escape" delimiter. + * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] + * The "evaluate" delimiter. + * @param {Object} [options.imports=_.templateSettings.imports] + * An object to import into the template as free variables. + * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] + * The "interpolate" delimiter. + * @param {string} [options.sourceURL='lodash.templateSources[n]'] + * The sourceURL of the compiled template. + * @param {string} [options.variable='obj'] + * The data object variable name. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the compiled template function. + * @example + * + * // Use the "interpolate" delimiter to create a compiled template. + * var compiled = _.template('hello <%= user %>!'); + * compiled({ 'user': 'fred' }); + * // => 'hello fred!' + * + * // Use the HTML "escape" delimiter to escape data property values. + * var compiled = _.template('<%- value %>'); + * compiled({ 'value': '