diff --git a/.gitignore b/.gitignore index 3288b97e06..53f1416525 100644 --- a/.gitignore +++ b/.gitignore @@ -33,7 +33,7 @@ node_modules .node_repl_history # build -# build +build build-tests # VSCode diff --git a/build/index.js b/build/index.js deleted file mode 100644 index 77fd3d9fd6..0000000000 --- a/build/index.js +++ /dev/null @@ -1,81885 +0,0 @@ -(function webpackUniversalModuleDefinition(root, factory) { - if(typeof exports === 'object' && typeof module === 'object') - module.exports = factory(); - else if(typeof define === 'function' && define.amd) - define([], factory); - else { - var a = factory(); - for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i]; - } -})(typeof self !== 'undefined' ? self : this, function() { -return /******/ (function(modules) { // webpackBootstrap -/******/ // The module cache -/******/ var installedModules = {}; -/******/ -/******/ // The require function -/******/ function __webpack_require__(moduleId) { -/******/ -/******/ // Check if module is in cache -/******/ if(installedModules[moduleId]) { -/******/ return installedModules[moduleId].exports; -/******/ } -/******/ // Create a new module (and put it into the cache) -/******/ var module = installedModules[moduleId] = { -/******/ i: moduleId, -/******/ l: false, -/******/ exports: {} -/******/ }; -/******/ -/******/ // Execute the module function -/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); -/******/ -/******/ // Flag the module as loaded -/******/ module.l = true; -/******/ -/******/ // Return the exports of the module -/******/ return module.exports; -/******/ } -/******/ -/******/ -/******/ // expose the modules object (__webpack_modules__) -/******/ __webpack_require__.m = modules; -/******/ -/******/ // expose the module cache -/******/ __webpack_require__.c = installedModules; -/******/ -/******/ // define getter function for harmony exports -/******/ __webpack_require__.d = function(exports, name, getter) { -/******/ if(!__webpack_require__.o(exports, name)) { -/******/ Object.defineProperty(exports, name, { -/******/ configurable: false, -/******/ enumerable: true, -/******/ get: getter -/******/ }); -/******/ } -/******/ }; -/******/ -/******/ // getDefaultExport function for compatibility with non-harmony modules -/******/ __webpack_require__.n = function(module) { -/******/ var getter = module && module.__esModule ? -/******/ function getDefault() { return module['default']; } : -/******/ function getModuleExports() { return module; }; -/******/ __webpack_require__.d(getter, 'a', getter); -/******/ return getter; -/******/ }; -/******/ -/******/ // Object.prototype.hasOwnProperty.call -/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; -/******/ -/******/ // __webpack_public_path__ -/******/ __webpack_require__.p = ""; -/******/ -/******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 197); -/******/ }) -/************************************************************************/ -/******/ ([ -/* 0 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -function __export(m) { - for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; -} -Object.defineProperty(exports, "__esModule", { value: true }); -__export(__webpack_require__(198)); -__export(__webpack_require__(199)); -__export(__webpack_require__(92)); -__export(__webpack_require__(200)); -__export(__webpack_require__(207)); - - -/***/ }), -/* 1 */ -/***/ (function(module, exports) { - -module.exports = require("util"); - -/***/ }), -/* 2 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(25); -var Stream = __webpack_require__(13).Stream; -var util = __webpack_require__(1); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - - -///--- Internal - -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} - -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} - -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} - -function noop() { - // Why even bother with asserts? -} - - -///--- Exports - -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } -}; - -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; - - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } - - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); - - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; - - return out; -} - -module.exports = _setExports(process.env.NODE_NDEBUG); - - -/***/ }), -/* 3 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -var es5 = __webpack_require__(34); -var canEvaluate = typeof navigator == "undefined"; - -var errorObj = {e: {}}; -var tryCatchTarget; -var globalObject = typeof self !== "undefined" ? self : - typeof window !== "undefined" ? window : - typeof global !== "undefined" ? global : - this !== undefined ? this : null; - -function tryCatcher() { - try { - var target = tryCatchTarget; - tryCatchTarget = null; - return target.apply(this, arguments); - } catch (e) { - errorObj.e = e; - return errorObj; - } -} -function tryCatch(fn) { - tryCatchTarget = fn; - return tryCatcher; -} - -var inherits = function(Child, Parent) { - var hasProp = {}.hasOwnProperty; - - function T() { - this.constructor = Child; - this.constructor$ = Parent; - for (var propertyName in Parent.prototype) { - if (hasProp.call(Parent.prototype, propertyName) && - propertyName.charAt(propertyName.length-1) !== "$" - ) { - this[propertyName + "$"] = Parent.prototype[propertyName]; - } - } - } - T.prototype = Parent.prototype; - Child.prototype = new T(); - return Child.prototype; -}; - - -function isPrimitive(val) { - return val == null || val === true || val === false || - typeof val === "string" || typeof val === "number"; - -} - -function isObject(value) { - return typeof value === "function" || - typeof value === "object" && value !== null; -} - -function maybeWrapAsError(maybeError) { - if (!isPrimitive(maybeError)) return maybeError; - - return new Error(safeToString(maybeError)); -} - -function withAppended(target, appendee) { - var len = target.length; - var ret = new Array(len + 1); - var i; - for (i = 0; i < len; ++i) { - ret[i] = target[i]; - } - ret[i] = appendee; - return ret; -} - -function getDataPropertyOrDefault(obj, key, defaultValue) { - if (es5.isES5) { - var desc = Object.getOwnPropertyDescriptor(obj, key); - - if (desc != null) { - return desc.get == null && desc.set == null - ? desc.value - : defaultValue; - } - } else { - return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined; - } -} - -function notEnumerableProp(obj, name, value) { - if (isPrimitive(obj)) return obj; - var descriptor = { - value: value, - configurable: true, - enumerable: false, - writable: true - }; - es5.defineProperty(obj, name, descriptor); - return obj; -} - -function thrower(r) { - throw r; -} - -var inheritedDataKeys = (function() { - var excludedPrototypes = [ - Array.prototype, - Object.prototype, - Function.prototype - ]; - - var isExcludedProto = function(val) { - for (var i = 0; i < excludedPrototypes.length; ++i) { - if (excludedPrototypes[i] === val) { - return true; - } - } - return false; - }; - - if (es5.isES5) { - var getKeys = Object.getOwnPropertyNames; - return function(obj) { - var ret = []; - var visitedKeys = Object.create(null); - while (obj != null && !isExcludedProto(obj)) { - var keys; - try { - keys = getKeys(obj); - } catch (e) { - return ret; - } - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - if (visitedKeys[key]) continue; - visitedKeys[key] = true; - var desc = Object.getOwnPropertyDescriptor(obj, key); - if (desc != null && desc.get == null && desc.set == null) { - ret.push(key); - } - } - obj = es5.getPrototypeOf(obj); - } - return ret; - }; - } else { - var hasProp = {}.hasOwnProperty; - return function(obj) { - if (isExcludedProto(obj)) return []; - var ret = []; - - /*jshint forin:false */ - enumeration: for (var key in obj) { - if (hasProp.call(obj, key)) { - ret.push(key); - } else { - for (var i = 0; i < excludedPrototypes.length; ++i) { - if (hasProp.call(excludedPrototypes[i], key)) { - continue enumeration; - } - } - ret.push(key); - } - } - return ret; - }; - } - -})(); - -var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/; -function isClass(fn) { - try { - if (typeof fn === "function") { - var keys = es5.names(fn.prototype); - - var hasMethods = es5.isES5 && keys.length > 1; - var hasMethodsOtherThanConstructor = keys.length > 0 && - !(keys.length === 1 && keys[0] === "constructor"); - var hasThisAssignmentAndStaticMethods = - thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0; - - if (hasMethods || hasMethodsOtherThanConstructor || - hasThisAssignmentAndStaticMethods) { - return true; - } - } - return false; - } catch (e) { - return false; - } -} - -function toFastProperties(obj) { - /*jshint -W027,-W055,-W031*/ - function FakeConstructor() {} - FakeConstructor.prototype = obj; - var l = 8; - while (l--) new FakeConstructor(); - return obj; - eval(obj); -} - -var rident = /^[a-z$_][a-z$_0-9]*$/i; -function isIdentifier(str) { - return rident.test(str); -} - -function filledRange(count, prefix, suffix) { - var ret = new Array(count); - for(var i = 0; i < count; ++i) { - ret[i] = prefix + i + suffix; - } - return ret; -} - -function safeToString(obj) { - try { - return obj + ""; - } catch (e) { - return "[no string representation]"; - } -} - -function isError(obj) { - return obj instanceof Error || - (obj !== null && - typeof obj === "object" && - typeof obj.message === "string" && - typeof obj.name === "string"); -} - -function markAsOriginatingFromRejection(e) { - try { - notEnumerableProp(e, "isOperational", true); - } - catch(ignore) {} -} - -function originatesFromRejection(e) { - if (e == null) return false; - return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) || - e["isOperational"] === true); -} - -function canAttachTrace(obj) { - return isError(obj) && es5.propertyIsWritable(obj, "stack"); -} - -var ensureErrorObject = (function() { - if (!("stack" in new Error())) { - return function(value) { - if (canAttachTrace(value)) return value; - try {throw new Error(safeToString(value));} - catch(err) {return err;} - }; - } else { - return function(value) { - if (canAttachTrace(value)) return value; - return new Error(safeToString(value)); - }; - } -})(); - -function classString(obj) { - return {}.toString.call(obj); -} - -function copyDescriptors(from, to, filter) { - var keys = es5.names(from); - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - if (filter(key)) { - try { - es5.defineProperty(to, key, es5.getDescriptor(from, key)); - } catch (ignore) {} - } - } -} - -var asArray = function(v) { - if (es5.isArray(v)) { - return v; - } - return null; -}; - -if (typeof Symbol !== "undefined" && Symbol.iterator) { - var ArrayFrom = typeof Array.from === "function" ? function(v) { - return Array.from(v); - } : function(v) { - var ret = []; - var it = v[Symbol.iterator](); - var itResult; - while (!((itResult = it.next()).done)) { - ret.push(itResult.value); - } - return ret; - }; - - asArray = function(v) { - if (es5.isArray(v)) { - return v; - } else if (v != null && typeof v[Symbol.iterator] === "function") { - return ArrayFrom(v); - } - return null; - }; -} - -var isNode = typeof process !== "undefined" && - classString(process).toLowerCase() === "[object process]"; - -var hasEnvVariables = typeof process !== "undefined" && - typeof process.env !== "undefined"; - -function env(key) { - return hasEnvVariables ? process.env[key] : undefined; -} - -function getNativePromise() { - if (typeof Promise === "function") { - try { - var promise = new Promise(function(){}); - if ({}.toString.call(promise) === "[object Promise]") { - return Promise; - } - } catch (e) {} - } -} - -function domainBind(self, cb) { - return self.bind(cb); -} - -var ret = { - isClass: isClass, - isIdentifier: isIdentifier, - inheritedDataKeys: inheritedDataKeys, - getDataPropertyOrDefault: getDataPropertyOrDefault, - thrower: thrower, - isArray: es5.isArray, - asArray: asArray, - notEnumerableProp: notEnumerableProp, - isPrimitive: isPrimitive, - isObject: isObject, - isError: isError, - canEvaluate: canEvaluate, - errorObj: errorObj, - tryCatch: tryCatch, - inherits: inherits, - withAppended: withAppended, - maybeWrapAsError: maybeWrapAsError, - toFastProperties: toFastProperties, - filledRange: filledRange, - toString: safeToString, - canAttachTrace: canAttachTrace, - ensureErrorObject: ensureErrorObject, - originatesFromRejection: originatesFromRejection, - markAsOriginatingFromRejection: markAsOriginatingFromRejection, - classString: classString, - copyDescriptors: copyDescriptors, - hasDevTools: typeof chrome !== "undefined" && chrome && - typeof chrome.loadTimes === "function", - isNode: isNode, - hasEnvVariables: hasEnvVariables, - env: env, - global: globalObject, - getNativePromise: getNativePromise, - domainBind: domainBind -}; -ret.isRecentNode = ret.isNode && (function() { - var version = process.versions.node.split(".").map(Number); - return (version[0] === 0 && version[1] > 10) || (version[0] > 0); -})(); - -if (ret.isNode) ret.toFastProperties(process); - -try {throw new Error(); } catch (e) {ret.lastLineError = e;} -module.exports = ret; - - -/***/ }), -/* 4 */ -/***/ (function(module, exports) { - -module.exports = require("crypto"); - -/***/ }), -/* 5 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; -/* eslint-disable node/no-deprecated-api */ - - - -var buffer = __webpack_require__(11) -var Buffer = buffer.Buffer - -var safer = {} - -var key - -for (key in buffer) { - if (!buffer.hasOwnProperty(key)) continue - if (key === 'SlowBuffer' || key === 'Buffer') continue - safer[key] = buffer[key] -} - -var Safer = safer.Buffer = {} -for (key in Buffer) { - if (!Buffer.hasOwnProperty(key)) continue - if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue - Safer[key] = Buffer[key] -} - -safer.Buffer.prototype = Buffer.prototype - -if (!Safer.from || Safer.from === Uint8Array.from) { - Safer.from = function (value, encodingOrOffset, length) { - if (typeof value === 'number') { - throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) - } - if (value && typeof value.length === 'undefined') { - throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) - } - return Buffer(value, encodingOrOffset, length) - } -} - -if (!Safer.alloc) { - Safer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) - } - if (size < 0 || size >= 2 * (1 << 30)) { - throw new RangeError('The value "' + size + '" is invalid for option "size"') - } - var buf = Buffer(size) - if (!fill || fill.length === 0) { - buf.fill(0) - } else if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - return buf - } -} - -if (!safer.kStringMaxLength) { - try { - safer.kStringMaxLength = process.binding('buffer').kStringMaxLength - } catch (e) { - // we can't determine kStringMaxLength in environments where process.binding - // is unsupported, so let's not set it - } -} - -if (!safer.constants) { - safer.constants = { - MAX_LENGTH: safer.kMaxLength - } - if (safer.kStringMaxLength) { - safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength - } -} - -module.exports = safer - - -/***/ }), -/* 6 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - calculateED25519Public: calculateED25519Public, - calculateX25519Public: calculateX25519Public, - mpNormalize: mpNormalize, - mpDenormalize: mpDenormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo, - publicFromPrivateECDSA: publicFromPrivateECDSA, - zeroPadToLength: zeroPadToLength, - writeBitString: writeBitString, - readBitString: readBitString -}; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; -var PrivateKey = __webpack_require__(9); -var Key = __webpack_require__(7); -var crypto = __webpack_require__(4); -var algs = __webpack_require__(8); -var asn1 = __webpack_require__(24); - -var ec, jsbn; -var nacl; - -var MAX_CLASS_DEPTH = 3; - -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 7, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = Buffer.alloc(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function readBitString(der, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var buf = der.readString(tag, true); - assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + - 'not supported (0x' + buf[0].toString(16) + ')'); - return (buf.slice(1)); -} - -function writeBitString(der, buf, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - der.writeBuffer(b, tag); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function mpDenormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00) - buf = buf.slice(1); - return (buf); -} - -function zeroPadToLength(buf, len) { - assert.buffer(buf); - assert.number(len); - while (buf.length > len) { - assert.equal(buf[0], 0x00); - buf = buf.slice(1); - } - while (buf.length < len) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = Buffer.from(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - try { - var bigInt = __webpack_require__(27).BigInteger; - } catch (e) { - throw (new Error('To load a PKCS#8 format DSA private key, ' + - 'the node jsbn library is required.')); - } - g = new bigInt(g); - p = new bigInt(p); - x = new bigInt(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function calculateED25519Public(k) { - assert.buffer(k); - - if (nacl === undefined) - nacl = __webpack_require__(23); - - var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function calculateX25519Public(k) { - assert.buffer(k); - - if (nacl === undefined) - nacl = __webpack_require__(23); - - var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - try { - var bigInt = __webpack_require__(27).BigInteger; - } catch (e) { - throw (new Error('To write a PEM private key from ' + - 'this source, the node jsbn lib is required.')); - } - - var d = new bigInt(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new bigInt(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new bigInt(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function publicFromPrivateECDSA(curveName, priv) { - assert.string(curveName, 'curveName'); - assert.buffer(priv); - if (ec === undefined) - ec = __webpack_require__(42); - if (jsbn === undefined) - jsbn = __webpack_require__(27).BigInteger; - var params = algs.curves[curveName]; - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - var d = new jsbn(mpNormalize(priv)); - var pub = G.multiply(d); - pub = Buffer.from(curve.encodePointHex(pub), 'hex'); - - var parts = []; - parts.push({name: 'curve', data: Buffer.from(curveName)}); - parts.push({name: 'Q', data: pub}); - - var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); - return (key); -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} - - -/***/ }), -/* 7 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Key; - -var assert = __webpack_require__(2); -var algs = __webpack_require__(8); -var crypto = __webpack_require__(4); -var Fingerprint = __webpack_require__(40); -var Signature = __webpack_require__(22); -var DiffieHellman = __webpack_require__(79).DiffieHellman; -var errs = __webpack_require__(21); -var utils = __webpack_require__(6); -var PrivateKey = __webpack_require__(9); -var edCompat; - -try { - edCompat = __webpack_require__(168); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; - -var formats = {}; -formats['auto'] = __webpack_require__(169); -formats['pem'] = __webpack_require__(28); -formats['pkcs1'] = __webpack_require__(82); -formats['pkcs8'] = __webpack_require__(43); -formats['rfc4253'] = __webpack_require__(30); -formats['ssh'] = __webpack_require__(171); -formats['ssh-private'] = __webpack_require__(57); -formats['openssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(83); - -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); - - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; - - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; - - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519' || this.type === 'curve25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; -} - -Key.formats = formats; - -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } - - return (formats[format].write(this, options)); -}; - -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); -}; - -Key.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - if (this._hashCache[algo]) - return (this._hashCache[algo]); - var hash = crypto.createHash(algo). - update(this.toBuffer('rfc4253')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; - -Key.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'key', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; - -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); -}; - -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var curve = this.curve; - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - if (signature.curve && self.type === 'ecdsa' && - signature.curve !== curve) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); - - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); - - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); - - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); -}; - -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); - - return (new DiffieHellman(this)); -}; -Key.prototype.createDH = Key.prototype.createDiffieHellman; - -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; - -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); -}; - -/* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version - * [1,6] -- changed ed25519 part names - */ -Key.prototype._sshpkApiVersion = [1, 6]; - -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); -}; - - -/***/ }), -/* 8 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Buffer = __webpack_require__(5).Buffer; - -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['A'], - sizePart: 'A' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; - -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['A', 'k'] - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; - -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: Buffer.from(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: Buffer.from(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: Buffer.from(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: Buffer.from(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; - -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; - - -/***/ }), -/* 9 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = PrivateKey; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var crypto = __webpack_require__(4); -var Fingerprint = __webpack_require__(40); -var Signature = __webpack_require__(22); -var errs = __webpack_require__(21); -var util = __webpack_require__(1); -var utils = __webpack_require__(6); -var dhe = __webpack_require__(79); -var generateECDSA = dhe.generateECDSA; -var generateED25519 = dhe.generateED25519; -var edCompat; -var nacl; - -try { - edCompat = __webpack_require__(168); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var Key = __webpack_require__(7); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; - -var formats = {}; -formats['auto'] = __webpack_require__(169); -formats['pem'] = __webpack_require__(28); -formats['pkcs1'] = __webpack_require__(82); -formats['pkcs8'] = __webpack_require__(43); -formats['rfc4253'] = __webpack_require__(30); -formats['ssh-private'] = __webpack_require__(57); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(83); - -function PrivateKey(opts) { - assert.object(opts, 'options'); - Key.call(this, opts); - - this._pubCache = undefined; -} -util.inherits(PrivateKey, Key); - -PrivateKey.formats = formats; - -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -PrivateKey.prototype.hash = function (algo) { - return (this.toPublic().hash(algo)); -}; - -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); - - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } - - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts - }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); -}; - -PrivateKey.prototype.derive = function (newType) { - assert.string(newType, 'type'); - var priv, pub, pair; - - if (this.type === 'ed25519' && newType === 'curve25519') { - if (nacl === undefined) - nacl = __webpack_require__(23); - - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - if (nacl === undefined) - nacl = __webpack_require__(23); - - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); -}; - -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); -}; - -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - var curve = this.curve; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = Buffer.from(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - sig.curve = curve; - return (sig); - }; - return (v); -}; - -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; - -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); -}; - -PrivateKey.generate = function (type, options) { - if (options === undefined) - options = {}; - assert.object(options, 'options'); - - switch (type) { - case 'ecdsa': - if (options.curve === undefined) - options.curve = 'nistp256'; - assert.string(options.curve, 'options.curve'); - return (generateECDSA(options.curve)); - case 'ed25519': - return (generateED25519()); - default: - throw (new Error('Key generation not supported with key ' + - 'type "' + type + '"')); - } -}; - -/* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version - * [1,5] -- changed ed25519 part names and format - */ -PrivateKey.prototype._sshpkApiVersion = [1, 5]; - -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); - return ([1, 0]); -}; - - -/***/ }), -/* 10 */ -/***/ (function(module, exports) { - -module.exports = require("fs"); - -/***/ }), -/* 11 */ -/***/ (function(module, exports) { - -module.exports = require("buffer"); - -/***/ }), -/* 12 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -function __export(m) { - for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; -} -Object.defineProperty(exports, "__esModule", { value: true }); -__export(__webpack_require__(89)); -__export(__webpack_require__(264)); -__export(__webpack_require__(49)); -__export(__webpack_require__(29)); -__export(__webpack_require__(267)); - - -/***/ }), -/* 13 */ -/***/ (function(module, exports) { - -module.exports = require("stream"); - -/***/ }), -/* 14 */ -/***/ (function(module, exports) { - -module.exports = require("path"); - -/***/ }), -/* 15 */ -/***/ (function(module, exports, __webpack_require__) { - -var Stream = __webpack_require__(13); -if (process.env.READABLE_STREAM === 'disable' && Stream) { - module.exports = Stream; - exports = module.exports = Stream.Readable; - exports.Readable = Stream.Readable; - exports.Writable = Stream.Writable; - exports.Duplex = Stream.Duplex; - exports.Transform = Stream.Transform; - exports.PassThrough = Stream.PassThrough; - exports.Stream = Stream; -} else { - exports = module.exports = __webpack_require__(136); - exports.Stream = Stream || exports; - exports.Readable = exports; - exports.Writable = __webpack_require__(139); - exports.Duplex = __webpack_require__(33); - exports.Transform = __webpack_require__(141); - exports.PassThrough = __webpack_require__(364); -} - - -/***/ }), -/* 16 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_buffer__ = __webpack_require__(11); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_buffer___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_buffer__); - - -const createBuffer = - __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].from && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].alloc && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].allocUnsafe && __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].allocUnsafeSlow - ? __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"].from - : // support for Node < 5.10 - val => new __WEBPACK_IMPORTED_MODULE_0_buffer__["Buffer"](val); - -/* harmony default export */ __webpack_exports__["a"] = (createBuffer); - - -/***/ }), -/* 17 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony default export */ __webpack_exports__["a"] = (function(model, calc) { - const fn = (buf, previous) => calc(buf, previous) >>> 0; - fn.signed = calc; - fn.unsigned = fn; - fn.model = model; - - return fn; -}); - - -/***/ }), -/* 18 */ -/***/ (function(module, exports, __webpack_require__) { - -/* eslint-disable node/no-deprecated-api */ -var buffer = __webpack_require__(11) -var Buffer = buffer.Buffer - -// alternative to using Object.keys for old browsers -function copyProps (src, dst) { - for (var key in src) { - dst[key] = src[key] - } -} -if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { - module.exports = buffer -} else { - // Copy properties from require('buffer') - copyProps(buffer, exports) - exports.Buffer = SafeBuffer -} - -function SafeBuffer (arg, encodingOrOffset, length) { - return Buffer(arg, encodingOrOffset, length) -} - -// Copy static methods from Buffer -copyProps(Buffer, SafeBuffer) - -SafeBuffer.from = function (arg, encodingOrOffset, length) { - if (typeof arg === 'number') { - throw new TypeError('Argument must not be a number') - } - return Buffer(arg, encodingOrOffset, length) -} - -SafeBuffer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - var buf = Buffer(size) - if (fill !== undefined) { - if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - } else { - buf.fill(0) - } - return buf -} - -SafeBuffer.allocUnsafe = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return Buffer(size) -} - -SafeBuffer.allocUnsafeSlow = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return buffer.SlowBuffer(size) -} - - -/***/ }), -/* 19 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -const getAllMatches = function(string, regex) { - const matches = []; - let match = regex.exec(string); - while (match) { - const allmatches = []; - const len = match.length; - for (let index = 0; index < len; index++) { - allmatches.push(match[index]); - } - matches.push(allmatches); - match = regex.exec(string); - } - return matches; -}; - -const doesMatch = function(string, regex) { - const match = regex.exec(string); - return !(match === null || typeof match === "undefined"); -}; - -const doesNotMatch = function(string, regex) { - return !doesMatch(string, regex); -}; - -exports.isExist = function(v) { - return typeof v !== "undefined"; -}; - -exports.isEmptyObject = function(obj) { - return Object.keys(obj).length === 0; -}; - -/** - * Copy all the properties of a into b. - * @param {*} target - * @param {*} a - */ -exports.merge = function(target, a) { - if (a) { - const keys = Object.keys(a); // will return an array of own properties - const len = keys.length; //don't make it inline - for (let i = 0; i < len; i++) { - target[keys[i]] = a[keys[i]]; - } - } -}; -/* exports.merge =function (b,a){ - return Object.assign(b,a); -} */ - -exports.getValue = function(v) { - if (exports.isExist(v)) { - return v; - } else { - return ""; - } -}; - -// const fakeCall = function(a) {return a;}; -// const fakeCallNoReturn = function() {}; - -exports.buildOptions = function(options,defaultOptions,props) { - var newOptions = {}; - if (!options) { - return defaultOptions; //if there are not options - } - - for (let i = 0; i < props.length; i++) { - if ( options[props[i]] !== undefined) { - newOptions[props[i]] = options[props[i]]; - }else{ - newOptions[props[i]] = defaultOptions[props[i]]; - } - } - return newOptions; -}; - -exports.doesMatch = doesMatch; -exports.doesNotMatch = doesNotMatch; -exports.getAllMatches = getAllMatches; - - -/***/ }), -/* 20 */ -/***/ (function(module, exports) { - -module.exports = require("url"); - -/***/ }), -/* 21 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(2); -var util = __webpack_require__(1); - -function FingerprintFormatError(fp, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, FingerprintFormatError); - this.name = 'FingerprintFormatError'; - this.fingerprint = fp; - this.format = format; - this.message = 'Fingerprint format is not supported, or is invalid: '; - if (fp !== undefined) - this.message += ' fingerprint = ' + fp; - if (format !== undefined) - this.message += ' format = ' + format; -} -util.inherits(FingerprintFormatError, Error); - -function InvalidAlgorithmError(alg) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, InvalidAlgorithmError); - this.name = 'InvalidAlgorithmError'; - this.algorithm = alg; - this.message = 'Algorithm "' + alg + '" is not supported'; -} -util.inherits(InvalidAlgorithmError, Error); - -function KeyParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyParseError); - this.name = 'KeyParseError'; - this.format = format; - this.keyName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format key: ' + innerErr.message; -} -util.inherits(KeyParseError, Error); - -function SignatureParseError(type, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, SignatureParseError); - this.name = 'SignatureParseError'; - this.type = type; - this.format = format; - this.innerErr = innerErr; - this.message = 'Failed to parse the given data as a ' + type + - ' signature in ' + format + ' format: ' + innerErr.message; -} -util.inherits(SignatureParseError, Error); - -function CertificateParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, CertificateParseError); - this.name = 'CertificateParseError'; - this.format = format; - this.certName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format certificate: ' + innerErr.message; -} -util.inherits(CertificateParseError, Error); - -function KeyEncryptedError(name, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyEncryptedError); - this.name = 'KeyEncryptedError'; - this.format = format; - this.keyName = name; - this.message = 'The ' + format + ' format key ' + name + ' is ' + - 'encrypted (password-protected), and no passphrase was ' + - 'provided in `options`'; -} -util.inherits(KeyEncryptedError, Error); - -module.exports = { - FingerprintFormatError: FingerprintFormatError, - InvalidAlgorithmError: InvalidAlgorithmError, - KeyParseError: KeyParseError, - SignatureParseError: SignatureParseError, - KeyEncryptedError: KeyEncryptedError, - CertificateParseError: CertificateParseError -}; - - -/***/ }), -/* 22 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = Signature; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var crypto = __webpack_require__(4); -var errs = __webpack_require__(21); -var utils = __webpack_require__(6); -var asn1 = __webpack_require__(24); -var SSHBuffer = __webpack_require__(44); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var SignatureParseError = errs.SignatureParseError; - -function Signature(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.hashAlgorithm = opts.hashAlgo; - this.curve = opts.curve; - this.parts = opts.parts; - this.part = partLookup; -} - -Signature.prototype.toBuffer = function (format) { - if (format === undefined) - format = 'asn1'; - assert.string(format, 'format'); - - var buf; - var stype = 'ssh-' + this.type; - - switch (this.type) { - case 'rsa': - switch (this.hashAlgorithm) { - case 'sha256': - stype = 'rsa-sha2-256'; - break; - case 'sha512': - stype = 'rsa-sha2-512'; - break; - case 'sha1': - case undefined: - break; - default: - throw (new Error('SSH signature ' + - 'format does not support hash ' + - 'algorithm ' + this.hashAlgorithm)); - } - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; - - case 'ed25519': - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; - - case 'dsa': - case 'ecdsa': - var r, s; - if (format === 'asn1') { - var der = new asn1.BerWriter(); - der.startSequence(); - r = utils.mpNormalize(this.part.r.data); - s = utils.mpNormalize(this.part.s.data); - der.writeBuffer(r, asn1.Ber.Integer); - der.writeBuffer(s, asn1.Ber.Integer); - der.endSequence(); - return (der.buffer); - } else if (format === 'ssh' && this.type === 'dsa') { - buf = new SSHBuffer({}); - buf.writeString('ssh-dss'); - r = this.part.r.data; - if (r.length > 20 && r[0] === 0x00) - r = r.slice(1); - s = this.part.s.data; - if (s.length > 20 && s[0] === 0x00) - s = s.slice(1); - if ((this.hashAlgorithm && - this.hashAlgorithm !== 'sha1') || - r.length + s.length !== 40) { - throw (new Error('OpenSSH only supports ' + - 'DSA signatures with SHA1 hash')); - } - buf.writeBuffer(Buffer.concat([r, s])); - return (buf.toBuffer()); - } else if (format === 'ssh' && this.type === 'ecdsa') { - var inner = new SSHBuffer({}); - r = this.part.r.data; - inner.writeBuffer(r); - inner.writePart(this.part.s); - - buf = new SSHBuffer({}); - /* XXX: find a more proper way to do this? */ - var curve; - if (r[0] === 0x00) - r = r.slice(1); - var sz = r.length * 8; - if (sz === 256) - curve = 'nistp256'; - else if (sz === 384) - curve = 'nistp384'; - else if (sz === 528) - curve = 'nistp521'; - buf.writeString('ecdsa-sha2-' + curve); - buf.writeBuffer(inner.toBuffer()); - return (buf.toBuffer()); - } - throw (new Error('Invalid signature format')); - default: - throw (new Error('Invalid signature data')); - } -}; - -Signature.prototype.toString = function (format) { - assert.optionalString(format, 'format'); - return (this.toBuffer(format).toString('base64')); -}; - -Signature.parse = function (data, type, format) { - if (typeof (data) === 'string') - data = Buffer.from(data, 'base64'); - assert.buffer(data, 'data'); - assert.string(format, 'format'); - assert.string(type, 'type'); - - var opts = {}; - opts.type = type.toLowerCase(); - opts.parts = []; - - try { - assert.ok(data.length > 0, 'signature must not be empty'); - switch (opts.type) { - case 'rsa': - return (parseOneNum(data, type, format, opts)); - case 'ed25519': - return (parseOneNum(data, type, format, opts)); - - case 'dsa': - case 'ecdsa': - if (format === 'asn1') - return (parseDSAasn1(data, type, format, opts)); - else if (opts.type === 'dsa') - return (parseDSA(data, type, format, opts)); - else - return (parseECDSA(data, type, format, opts)); - - default: - throw (new InvalidAlgorithmError(type)); - } - - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (e); - throw (new SignatureParseError(type, format, e)); - } -}; - -function parseOneNum(data, type, format, opts) { - if (format === 'ssh') { - try { - var buf = new SSHBuffer({buffer: data}); - var head = buf.readString(); - } catch (e) { - /* fall through */ - } - if (buf !== undefined) { - var msg = 'SSH signature does not match expected ' + - 'type (expected ' + type + ', got ' + head + ')'; - switch (head) { - case 'ssh-rsa': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha1'; - break; - case 'rsa-sha2-256': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha256'; - break; - case 'rsa-sha2-512': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha512'; - break; - case 'ssh-ed25519': - assert.strictEqual(type, 'ed25519', msg); - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unknown SSH signature ' + - 'type: ' + head)); - } - var sig = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - sig.name = 'sig'; - opts.parts.push(sig); - return (new Signature(opts)); - } - } - opts.parts.push({name: 'sig', data: data}); - return (new Signature(opts)); -} - -function parseDSAasn1(data, type, format, opts) { - var der = new asn1.BerReader(data); - der.readSequence(); - var r = der.readString(asn1.Ber.Integer, true); - var s = der.readString(asn1.Ber.Integer, true); - - opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); - opts.parts.push({name: 's', data: utils.mpNormalize(s)}); - - return (new Signature(opts)); -} - -function parseDSA(data, type, format, opts) { - if (data.length != 40) { - var buf = new SSHBuffer({buffer: data}); - var d = buf.readBuffer(); - if (d.toString('ascii') === 'ssh-dss') - d = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - assert.strictEqual(d.length, 40, 'invalid inner length'); - data = d; - } - opts.parts.push({name: 'r', data: data.slice(0, 20)}); - opts.parts.push({name: 's', data: data.slice(20, 40)}); - return (new Signature(opts)); -} - -function parseECDSA(data, type, format, opts) { - var buf = new SSHBuffer({buffer: data}); - - var r, s; - var inner = buf.readBuffer(); - var stype = inner.toString('ascii'); - if (stype.slice(0, 6) === 'ecdsa-') { - var parts = stype.split('-'); - assert.strictEqual(parts[0], 'ecdsa'); - assert.strictEqual(parts[1], 'sha2'); - opts.curve = parts[2]; - switch (opts.curve) { - case 'nistp256': - opts.hashAlgo = 'sha256'; - break; - case 'nistp384': - opts.hashAlgo = 'sha384'; - break; - case 'nistp521': - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unsupported ECDSA curve: ' + - opts.curve)); - } - inner = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); - buf = new SSHBuffer({buffer: inner}); - r = buf.readPart(); - } else { - r = {data: inner}; - } - - s = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - - r.name = 'r'; - s.name = 's'; - - opts.parts.push(r); - opts.parts.push(s); - return (new Signature(opts)); -} - -Signature.isSignature = function (obj, ver) { - return (utils.isCompatible(obj, Signature, ver)); -}; - -/* - * API versions for Signature: - * [1,0] -- initial ver - * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent - * hashAlgorithm property - * [2,1] -- first tagged version - */ -Signature.prototype._sshpkApiVersion = [2, 1]; - -Signature._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - if (obj.hasOwnProperty('hashAlgorithm')) - return ([2, 0]); - return ([1, 0]); -}; - - -/***/ }), -/* 23 */ -/***/ (function(module, exports, __webpack_require__) { - -(function(nacl) { -'use strict'; - -// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. -// Public domain. -// -// Implementation derived from TweetNaCl version 20140427. -// See for details: http://tweetnacl.cr.yp.to/ - -var gf = function(init) { - var i, r = new Float64Array(16); - if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; - return r; -}; - -// Pluggable, initialized in high-level API below. -var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; - -var _0 = new Uint8Array(16); -var _9 = new Uint8Array(32); _9[0] = 9; - -var gf0 = gf(), - gf1 = gf([1]), - _121665 = gf([0xdb41, 1]), - D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), - D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), - X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), - Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), - I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); - -function ts64(x, i, h, l) { - x[i] = (h >> 24) & 0xff; - x[i+1] = (h >> 16) & 0xff; - x[i+2] = (h >> 8) & 0xff; - x[i+3] = h & 0xff; - x[i+4] = (l >> 24) & 0xff; - x[i+5] = (l >> 16) & 0xff; - x[i+6] = (l >> 8) & 0xff; - x[i+7] = l & 0xff; -} - -function vn(x, xi, y, yi, n) { - var i,d = 0; - for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; - return (1 & ((d - 1) >>> 8)) - 1; -} - -function crypto_verify_16(x, xi, y, yi) { - return vn(x,xi,y,yi,16); -} - -function crypto_verify_32(x, xi, y, yi) { - return vn(x,xi,y,yi,32); -} - -function core_salsa20(o, p, k, c) { - var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, - j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, - j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, - j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, - j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, - j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, - j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, - j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, - j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, - j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, - j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, - j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, - j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, - j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, - j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, - j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; - - var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, - x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, - x15 = j15, u; - - for (var i = 0; i < 20; i += 2) { - u = x0 + x12 | 0; - x4 ^= u<<7 | u>>>(32-7); - u = x4 + x0 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x4 | 0; - x12 ^= u<<13 | u>>>(32-13); - u = x12 + x8 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x1 | 0; - x9 ^= u<<7 | u>>>(32-7); - u = x9 + x5 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x9 | 0; - x1 ^= u<<13 | u>>>(32-13); - u = x1 + x13 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x6 | 0; - x14 ^= u<<7 | u>>>(32-7); - u = x14 + x10 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x14 | 0; - x6 ^= u<<13 | u>>>(32-13); - u = x6 + x2 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x11 | 0; - x3 ^= u<<7 | u>>>(32-7); - u = x3 + x15 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x3 | 0; - x11 ^= u<<13 | u>>>(32-13); - u = x11 + x7 | 0; - x15 ^= u<<18 | u>>>(32-18); - - u = x0 + x3 | 0; - x1 ^= u<<7 | u>>>(32-7); - u = x1 + x0 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x1 | 0; - x3 ^= u<<13 | u>>>(32-13); - u = x3 + x2 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x4 | 0; - x6 ^= u<<7 | u>>>(32-7); - u = x6 + x5 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x6 | 0; - x4 ^= u<<13 | u>>>(32-13); - u = x4 + x7 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x9 | 0; - x11 ^= u<<7 | u>>>(32-7); - u = x11 + x10 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x11 | 0; - x9 ^= u<<13 | u>>>(32-13); - u = x9 + x8 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x14 | 0; - x12 ^= u<<7 | u>>>(32-7); - u = x12 + x15 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x12 | 0; - x14 ^= u<<13 | u>>>(32-13); - u = x14 + x13 | 0; - x15 ^= u<<18 | u>>>(32-18); - } - x0 = x0 + j0 | 0; - x1 = x1 + j1 | 0; - x2 = x2 + j2 | 0; - x3 = x3 + j3 | 0; - x4 = x4 + j4 | 0; - x5 = x5 + j5 | 0; - x6 = x6 + j6 | 0; - x7 = x7 + j7 | 0; - x8 = x8 + j8 | 0; - x9 = x9 + j9 | 0; - x10 = x10 + j10 | 0; - x11 = x11 + j11 | 0; - x12 = x12 + j12 | 0; - x13 = x13 + j13 | 0; - x14 = x14 + j14 | 0; - x15 = x15 + j15 | 0; - - o[ 0] = x0 >>> 0 & 0xff; - o[ 1] = x0 >>> 8 & 0xff; - o[ 2] = x0 >>> 16 & 0xff; - o[ 3] = x0 >>> 24 & 0xff; - - o[ 4] = x1 >>> 0 & 0xff; - o[ 5] = x1 >>> 8 & 0xff; - o[ 6] = x1 >>> 16 & 0xff; - o[ 7] = x1 >>> 24 & 0xff; - - o[ 8] = x2 >>> 0 & 0xff; - o[ 9] = x2 >>> 8 & 0xff; - o[10] = x2 >>> 16 & 0xff; - o[11] = x2 >>> 24 & 0xff; - - o[12] = x3 >>> 0 & 0xff; - o[13] = x3 >>> 8 & 0xff; - o[14] = x3 >>> 16 & 0xff; - o[15] = x3 >>> 24 & 0xff; - - o[16] = x4 >>> 0 & 0xff; - o[17] = x4 >>> 8 & 0xff; - o[18] = x4 >>> 16 & 0xff; - o[19] = x4 >>> 24 & 0xff; - - o[20] = x5 >>> 0 & 0xff; - o[21] = x5 >>> 8 & 0xff; - o[22] = x5 >>> 16 & 0xff; - o[23] = x5 >>> 24 & 0xff; - - o[24] = x6 >>> 0 & 0xff; - o[25] = x6 >>> 8 & 0xff; - o[26] = x6 >>> 16 & 0xff; - o[27] = x6 >>> 24 & 0xff; - - o[28] = x7 >>> 0 & 0xff; - o[29] = x7 >>> 8 & 0xff; - o[30] = x7 >>> 16 & 0xff; - o[31] = x7 >>> 24 & 0xff; - - o[32] = x8 >>> 0 & 0xff; - o[33] = x8 >>> 8 & 0xff; - o[34] = x8 >>> 16 & 0xff; - o[35] = x8 >>> 24 & 0xff; - - o[36] = x9 >>> 0 & 0xff; - o[37] = x9 >>> 8 & 0xff; - o[38] = x9 >>> 16 & 0xff; - o[39] = x9 >>> 24 & 0xff; - - o[40] = x10 >>> 0 & 0xff; - o[41] = x10 >>> 8 & 0xff; - o[42] = x10 >>> 16 & 0xff; - o[43] = x10 >>> 24 & 0xff; - - o[44] = x11 >>> 0 & 0xff; - o[45] = x11 >>> 8 & 0xff; - o[46] = x11 >>> 16 & 0xff; - o[47] = x11 >>> 24 & 0xff; - - o[48] = x12 >>> 0 & 0xff; - o[49] = x12 >>> 8 & 0xff; - o[50] = x12 >>> 16 & 0xff; - o[51] = x12 >>> 24 & 0xff; - - o[52] = x13 >>> 0 & 0xff; - o[53] = x13 >>> 8 & 0xff; - o[54] = x13 >>> 16 & 0xff; - o[55] = x13 >>> 24 & 0xff; - - o[56] = x14 >>> 0 & 0xff; - o[57] = x14 >>> 8 & 0xff; - o[58] = x14 >>> 16 & 0xff; - o[59] = x14 >>> 24 & 0xff; - - o[60] = x15 >>> 0 & 0xff; - o[61] = x15 >>> 8 & 0xff; - o[62] = x15 >>> 16 & 0xff; - o[63] = x15 >>> 24 & 0xff; -} - -function core_hsalsa20(o,p,k,c) { - var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, - j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, - j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, - j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, - j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, - j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, - j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, - j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, - j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, - j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, - j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, - j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, - j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, - j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, - j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, - j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; - - var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, - x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, - x15 = j15, u; - - for (var i = 0; i < 20; i += 2) { - u = x0 + x12 | 0; - x4 ^= u<<7 | u>>>(32-7); - u = x4 + x0 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x4 | 0; - x12 ^= u<<13 | u>>>(32-13); - u = x12 + x8 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x1 | 0; - x9 ^= u<<7 | u>>>(32-7); - u = x9 + x5 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x9 | 0; - x1 ^= u<<13 | u>>>(32-13); - u = x1 + x13 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x6 | 0; - x14 ^= u<<7 | u>>>(32-7); - u = x14 + x10 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x14 | 0; - x6 ^= u<<13 | u>>>(32-13); - u = x6 + x2 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x11 | 0; - x3 ^= u<<7 | u>>>(32-7); - u = x3 + x15 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x3 | 0; - x11 ^= u<<13 | u>>>(32-13); - u = x11 + x7 | 0; - x15 ^= u<<18 | u>>>(32-18); - - u = x0 + x3 | 0; - x1 ^= u<<7 | u>>>(32-7); - u = x1 + x0 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x1 | 0; - x3 ^= u<<13 | u>>>(32-13); - u = x3 + x2 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x4 | 0; - x6 ^= u<<7 | u>>>(32-7); - u = x6 + x5 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x6 | 0; - x4 ^= u<<13 | u>>>(32-13); - u = x4 + x7 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x9 | 0; - x11 ^= u<<7 | u>>>(32-7); - u = x11 + x10 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x11 | 0; - x9 ^= u<<13 | u>>>(32-13); - u = x9 + x8 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x14 | 0; - x12 ^= u<<7 | u>>>(32-7); - u = x12 + x15 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x12 | 0; - x14 ^= u<<13 | u>>>(32-13); - u = x14 + x13 | 0; - x15 ^= u<<18 | u>>>(32-18); - } - - o[ 0] = x0 >>> 0 & 0xff; - o[ 1] = x0 >>> 8 & 0xff; - o[ 2] = x0 >>> 16 & 0xff; - o[ 3] = x0 >>> 24 & 0xff; - - o[ 4] = x5 >>> 0 & 0xff; - o[ 5] = x5 >>> 8 & 0xff; - o[ 6] = x5 >>> 16 & 0xff; - o[ 7] = x5 >>> 24 & 0xff; - - o[ 8] = x10 >>> 0 & 0xff; - o[ 9] = x10 >>> 8 & 0xff; - o[10] = x10 >>> 16 & 0xff; - o[11] = x10 >>> 24 & 0xff; - - o[12] = x15 >>> 0 & 0xff; - o[13] = x15 >>> 8 & 0xff; - o[14] = x15 >>> 16 & 0xff; - o[15] = x15 >>> 24 & 0xff; - - o[16] = x6 >>> 0 & 0xff; - o[17] = x6 >>> 8 & 0xff; - o[18] = x6 >>> 16 & 0xff; - o[19] = x6 >>> 24 & 0xff; - - o[20] = x7 >>> 0 & 0xff; - o[21] = x7 >>> 8 & 0xff; - o[22] = x7 >>> 16 & 0xff; - o[23] = x7 >>> 24 & 0xff; - - o[24] = x8 >>> 0 & 0xff; - o[25] = x8 >>> 8 & 0xff; - o[26] = x8 >>> 16 & 0xff; - o[27] = x8 >>> 24 & 0xff; - - o[28] = x9 >>> 0 & 0xff; - o[29] = x9 >>> 8 & 0xff; - o[30] = x9 >>> 16 & 0xff; - o[31] = x9 >>> 24 & 0xff; -} - -function crypto_core_salsa20(out,inp,k,c) { - core_salsa20(out,inp,k,c); -} - -function crypto_core_hsalsa20(out,inp,k,c) { - core_hsalsa20(out,inp,k,c); -} - -var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); - // "expand 32-byte k" - -function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { - var z = new Uint8Array(16), x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = u + (z[i] & 0xff) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - mpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; - } - return 0; -} - -function crypto_stream_salsa20(c,cpos,b,n,k) { - var z = new Uint8Array(16), x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < 64; i++) c[cpos+i] = x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = u + (z[i] & 0xff) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < b; i++) c[cpos+i] = x[i]; - } - return 0; -} - -function crypto_stream(c,cpos,d,n,k) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s,n,k,sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i+16]; - return crypto_stream_salsa20(c,cpos,d,sn,s); -} - -function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s,n,k,sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i+16]; - return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); -} - -/* -* Port of Andrew Moon's Poly1305-donna-16. Public domain. -* https://github.com/floodyberry/poly1305-donna -*/ - -var poly1305 = function(key) { - this.buffer = new Uint8Array(16); - this.r = new Uint16Array(10); - this.h = new Uint16Array(10); - this.pad = new Uint16Array(8); - this.leftover = 0; - this.fin = 0; - - var t0, t1, t2, t3, t4, t5, t6, t7; - - t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; - t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; - t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; - this.r[5] = ((t4 >>> 1)) & 0x1ffe; - t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; - t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - this.r[9] = ((t7 >>> 5)) & 0x007f; - - this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; - this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; - this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; - this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; - this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; - this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; - this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; - this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; -}; - -poly1305.prototype.blocks = function(m, mpos, bytes) { - var hibit = this.fin ? 0 : (1 << 11); - var t0, t1, t2, t3, t4, t5, t6, t7, c; - var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; - - var h0 = this.h[0], - h1 = this.h[1], - h2 = this.h[2], - h3 = this.h[3], - h4 = this.h[4], - h5 = this.h[5], - h6 = this.h[6], - h7 = this.h[7], - h8 = this.h[8], - h9 = this.h[9]; - - var r0 = this.r[0], - r1 = this.r[1], - r2 = this.r[2], - r3 = this.r[3], - r4 = this.r[4], - r5 = this.r[5], - r6 = this.r[6], - r7 = this.r[7], - r8 = this.r[8], - r9 = this.r[9]; - - while (bytes >= 16) { - t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; - t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; - t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; - h5 += ((t4 >>> 1)) & 0x1fff; - t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; - t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - h9 += ((t7 >>> 5)) | hibit; - - c = 0; - - d0 = c; - d0 += h0 * r0; - d0 += h1 * (5 * r9); - d0 += h2 * (5 * r8); - d0 += h3 * (5 * r7); - d0 += h4 * (5 * r6); - c = (d0 >>> 13); d0 &= 0x1fff; - d0 += h5 * (5 * r5); - d0 += h6 * (5 * r4); - d0 += h7 * (5 * r3); - d0 += h8 * (5 * r2); - d0 += h9 * (5 * r1); - c += (d0 >>> 13); d0 &= 0x1fff; - - d1 = c; - d1 += h0 * r1; - d1 += h1 * r0; - d1 += h2 * (5 * r9); - d1 += h3 * (5 * r8); - d1 += h4 * (5 * r7); - c = (d1 >>> 13); d1 &= 0x1fff; - d1 += h5 * (5 * r6); - d1 += h6 * (5 * r5); - d1 += h7 * (5 * r4); - d1 += h8 * (5 * r3); - d1 += h9 * (5 * r2); - c += (d1 >>> 13); d1 &= 0x1fff; - - d2 = c; - d2 += h0 * r2; - d2 += h1 * r1; - d2 += h2 * r0; - d2 += h3 * (5 * r9); - d2 += h4 * (5 * r8); - c = (d2 >>> 13); d2 &= 0x1fff; - d2 += h5 * (5 * r7); - d2 += h6 * (5 * r6); - d2 += h7 * (5 * r5); - d2 += h8 * (5 * r4); - d2 += h9 * (5 * r3); - c += (d2 >>> 13); d2 &= 0x1fff; - - d3 = c; - d3 += h0 * r3; - d3 += h1 * r2; - d3 += h2 * r1; - d3 += h3 * r0; - d3 += h4 * (5 * r9); - c = (d3 >>> 13); d3 &= 0x1fff; - d3 += h5 * (5 * r8); - d3 += h6 * (5 * r7); - d3 += h7 * (5 * r6); - d3 += h8 * (5 * r5); - d3 += h9 * (5 * r4); - c += (d3 >>> 13); d3 &= 0x1fff; - - d4 = c; - d4 += h0 * r4; - d4 += h1 * r3; - d4 += h2 * r2; - d4 += h3 * r1; - d4 += h4 * r0; - c = (d4 >>> 13); d4 &= 0x1fff; - d4 += h5 * (5 * r9); - d4 += h6 * (5 * r8); - d4 += h7 * (5 * r7); - d4 += h8 * (5 * r6); - d4 += h9 * (5 * r5); - c += (d4 >>> 13); d4 &= 0x1fff; - - d5 = c; - d5 += h0 * r5; - d5 += h1 * r4; - d5 += h2 * r3; - d5 += h3 * r2; - d5 += h4 * r1; - c = (d5 >>> 13); d5 &= 0x1fff; - d5 += h5 * r0; - d5 += h6 * (5 * r9); - d5 += h7 * (5 * r8); - d5 += h8 * (5 * r7); - d5 += h9 * (5 * r6); - c += (d5 >>> 13); d5 &= 0x1fff; - - d6 = c; - d6 += h0 * r6; - d6 += h1 * r5; - d6 += h2 * r4; - d6 += h3 * r3; - d6 += h4 * r2; - c = (d6 >>> 13); d6 &= 0x1fff; - d6 += h5 * r1; - d6 += h6 * r0; - d6 += h7 * (5 * r9); - d6 += h8 * (5 * r8); - d6 += h9 * (5 * r7); - c += (d6 >>> 13); d6 &= 0x1fff; - - d7 = c; - d7 += h0 * r7; - d7 += h1 * r6; - d7 += h2 * r5; - d7 += h3 * r4; - d7 += h4 * r3; - c = (d7 >>> 13); d7 &= 0x1fff; - d7 += h5 * r2; - d7 += h6 * r1; - d7 += h7 * r0; - d7 += h8 * (5 * r9); - d7 += h9 * (5 * r8); - c += (d7 >>> 13); d7 &= 0x1fff; - - d8 = c; - d8 += h0 * r8; - d8 += h1 * r7; - d8 += h2 * r6; - d8 += h3 * r5; - d8 += h4 * r4; - c = (d8 >>> 13); d8 &= 0x1fff; - d8 += h5 * r3; - d8 += h6 * r2; - d8 += h7 * r1; - d8 += h8 * r0; - d8 += h9 * (5 * r9); - c += (d8 >>> 13); d8 &= 0x1fff; - - d9 = c; - d9 += h0 * r9; - d9 += h1 * r8; - d9 += h2 * r7; - d9 += h3 * r6; - d9 += h4 * r5; - c = (d9 >>> 13); d9 &= 0x1fff; - d9 += h5 * r4; - d9 += h6 * r3; - d9 += h7 * r2; - d9 += h8 * r1; - d9 += h9 * r0; - c += (d9 >>> 13); d9 &= 0x1fff; - - c = (((c << 2) + c)) | 0; - c = (c + d0) | 0; - d0 = c & 0x1fff; - c = (c >>> 13); - d1 += c; - - h0 = d0; - h1 = d1; - h2 = d2; - h3 = d3; - h4 = d4; - h5 = d5; - h6 = d6; - h7 = d7; - h8 = d8; - h9 = d9; - - mpos += 16; - bytes -= 16; - } - this.h[0] = h0; - this.h[1] = h1; - this.h[2] = h2; - this.h[3] = h3; - this.h[4] = h4; - this.h[5] = h5; - this.h[6] = h6; - this.h[7] = h7; - this.h[8] = h8; - this.h[9] = h9; -}; - -poly1305.prototype.finish = function(mac, macpos) { - var g = new Uint16Array(10); - var c, mask, f, i; - - if (this.leftover) { - i = this.leftover; - this.buffer[i++] = 1; - for (; i < 16; i++) this.buffer[i] = 0; - this.fin = 1; - this.blocks(this.buffer, 0, 16); - } - - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - for (i = 2; i < 10; i++) { - this.h[i] += c; - c = this.h[i] >>> 13; - this.h[i] &= 0x1fff; - } - this.h[0] += (c * 5); - c = this.h[0] >>> 13; - this.h[0] &= 0x1fff; - this.h[1] += c; - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - this.h[2] += c; - - g[0] = this.h[0] + 5; - c = g[0] >>> 13; - g[0] &= 0x1fff; - for (i = 1; i < 10; i++) { - g[i] = this.h[i] + c; - c = g[i] >>> 13; - g[i] &= 0x1fff; - } - g[9] -= (1 << 13); - - mask = (c ^ 1) - 1; - for (i = 0; i < 10; i++) g[i] &= mask; - mask = ~mask; - for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; - - this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; - this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; - this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; - this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; - this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; - this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; - this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; - this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; - - f = this.h[0] + this.pad[0]; - this.h[0] = f & 0xffff; - for (i = 1; i < 8; i++) { - f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; - this.h[i] = f & 0xffff; - } - - mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; - mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; - mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; - mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; - mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; - mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; - mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; - mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; - mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; - mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; - mac[macpos+10] = (this.h[5] >>> 0) & 0xff; - mac[macpos+11] = (this.h[5] >>> 8) & 0xff; - mac[macpos+12] = (this.h[6] >>> 0) & 0xff; - mac[macpos+13] = (this.h[6] >>> 8) & 0xff; - mac[macpos+14] = (this.h[7] >>> 0) & 0xff; - mac[macpos+15] = (this.h[7] >>> 8) & 0xff; -}; - -poly1305.prototype.update = function(m, mpos, bytes) { - var i, want; - - if (this.leftover) { - want = (16 - this.leftover); - if (want > bytes) - want = bytes; - for (i = 0; i < want; i++) - this.buffer[this.leftover + i] = m[mpos+i]; - bytes -= want; - mpos += want; - this.leftover += want; - if (this.leftover < 16) - return; - this.blocks(this.buffer, 0, 16); - this.leftover = 0; - } - - if (bytes >= 16) { - want = bytes - (bytes % 16); - this.blocks(m, mpos, want); - mpos += want; - bytes -= want; - } - - if (bytes) { - for (i = 0; i < bytes; i++) - this.buffer[this.leftover + i] = m[mpos+i]; - this.leftover += bytes; - } -}; - -function crypto_onetimeauth(out, outpos, m, mpos, n, k) { - var s = new poly1305(k); - s.update(m, mpos, n); - s.finish(out, outpos); - return 0; -} - -function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { - var x = new Uint8Array(16); - crypto_onetimeauth(x,0,m,mpos,n,k); - return crypto_verify_16(h,hpos,x,0); -} - -function crypto_secretbox(c,m,d,n,k) { - var i; - if (d < 32) return -1; - crypto_stream_xor(c,0,m,0,d,n,k); - crypto_onetimeauth(c, 16, c, 32, d - 32, c); - for (i = 0; i < 16; i++) c[i] = 0; - return 0; -} - -function crypto_secretbox_open(m,c,d,n,k) { - var i; - var x = new Uint8Array(32); - if (d < 32) return -1; - crypto_stream(x,0,32,n,k); - if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; - crypto_stream_xor(m,0,c,0,d,n,k); - for (i = 0; i < 32; i++) m[i] = 0; - return 0; -} - -function set25519(r, a) { - var i; - for (i = 0; i < 16; i++) r[i] = a[i]|0; -} - -function car25519(o) { - var i, v, c = 1; - for (i = 0; i < 16; i++) { - v = o[i] + c + 65535; - c = Math.floor(v / 65536); - o[i] = v - c * 65536; - } - o[0] += c-1 + 37 * (c-1); -} - -function sel25519(p, q, b) { - var t, c = ~(b-1); - for (var i = 0; i < 16; i++) { - t = c & (p[i] ^ q[i]); - p[i] ^= t; - q[i] ^= t; - } -} - -function pack25519(o, n) { - var i, j, b; - var m = gf(), t = gf(); - for (i = 0; i < 16; i++) t[i] = n[i]; - car25519(t); - car25519(t); - car25519(t); - for (j = 0; j < 2; j++) { - m[0] = t[0] - 0xffed; - for (i = 1; i < 15; i++) { - m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); - m[i-1] &= 0xffff; - } - m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); - b = (m[15]>>16) & 1; - m[14] &= 0xffff; - sel25519(t, m, 1-b); - } - for (i = 0; i < 16; i++) { - o[2*i] = t[i] & 0xff; - o[2*i+1] = t[i]>>8; - } -} - -function neq25519(a, b) { - var c = new Uint8Array(32), d = new Uint8Array(32); - pack25519(c, a); - pack25519(d, b); - return crypto_verify_32(c, 0, d, 0); -} - -function par25519(a) { - var d = new Uint8Array(32); - pack25519(d, a); - return d[0] & 1; -} - -function unpack25519(o, n) { - var i; - for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); - o[15] &= 0x7fff; -} - -function A(o, a, b) { - for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; -} - -function Z(o, a, b) { - for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; -} - -function M(o, a, b) { - var v, c, - t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, - t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, - t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, - t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, - b0 = b[0], - b1 = b[1], - b2 = b[2], - b3 = b[3], - b4 = b[4], - b5 = b[5], - b6 = b[6], - b7 = b[7], - b8 = b[8], - b9 = b[9], - b10 = b[10], - b11 = b[11], - b12 = b[12], - b13 = b[13], - b14 = b[14], - b15 = b[15]; - - v = a[0]; - t0 += v * b0; - t1 += v * b1; - t2 += v * b2; - t3 += v * b3; - t4 += v * b4; - t5 += v * b5; - t6 += v * b6; - t7 += v * b7; - t8 += v * b8; - t9 += v * b9; - t10 += v * b10; - t11 += v * b11; - t12 += v * b12; - t13 += v * b13; - t14 += v * b14; - t15 += v * b15; - v = a[1]; - t1 += v * b0; - t2 += v * b1; - t3 += v * b2; - t4 += v * b3; - t5 += v * b4; - t6 += v * b5; - t7 += v * b6; - t8 += v * b7; - t9 += v * b8; - t10 += v * b9; - t11 += v * b10; - t12 += v * b11; - t13 += v * b12; - t14 += v * b13; - t15 += v * b14; - t16 += v * b15; - v = a[2]; - t2 += v * b0; - t3 += v * b1; - t4 += v * b2; - t5 += v * b3; - t6 += v * b4; - t7 += v * b5; - t8 += v * b6; - t9 += v * b7; - t10 += v * b8; - t11 += v * b9; - t12 += v * b10; - t13 += v * b11; - t14 += v * b12; - t15 += v * b13; - t16 += v * b14; - t17 += v * b15; - v = a[3]; - t3 += v * b0; - t4 += v * b1; - t5 += v * b2; - t6 += v * b3; - t7 += v * b4; - t8 += v * b5; - t9 += v * b6; - t10 += v * b7; - t11 += v * b8; - t12 += v * b9; - t13 += v * b10; - t14 += v * b11; - t15 += v * b12; - t16 += v * b13; - t17 += v * b14; - t18 += v * b15; - v = a[4]; - t4 += v * b0; - t5 += v * b1; - t6 += v * b2; - t7 += v * b3; - t8 += v * b4; - t9 += v * b5; - t10 += v * b6; - t11 += v * b7; - t12 += v * b8; - t13 += v * b9; - t14 += v * b10; - t15 += v * b11; - t16 += v * b12; - t17 += v * b13; - t18 += v * b14; - t19 += v * b15; - v = a[5]; - t5 += v * b0; - t6 += v * b1; - t7 += v * b2; - t8 += v * b3; - t9 += v * b4; - t10 += v * b5; - t11 += v * b6; - t12 += v * b7; - t13 += v * b8; - t14 += v * b9; - t15 += v * b10; - t16 += v * b11; - t17 += v * b12; - t18 += v * b13; - t19 += v * b14; - t20 += v * b15; - v = a[6]; - t6 += v * b0; - t7 += v * b1; - t8 += v * b2; - t9 += v * b3; - t10 += v * b4; - t11 += v * b5; - t12 += v * b6; - t13 += v * b7; - t14 += v * b8; - t15 += v * b9; - t16 += v * b10; - t17 += v * b11; - t18 += v * b12; - t19 += v * b13; - t20 += v * b14; - t21 += v * b15; - v = a[7]; - t7 += v * b0; - t8 += v * b1; - t9 += v * b2; - t10 += v * b3; - t11 += v * b4; - t12 += v * b5; - t13 += v * b6; - t14 += v * b7; - t15 += v * b8; - t16 += v * b9; - t17 += v * b10; - t18 += v * b11; - t19 += v * b12; - t20 += v * b13; - t21 += v * b14; - t22 += v * b15; - v = a[8]; - t8 += v * b0; - t9 += v * b1; - t10 += v * b2; - t11 += v * b3; - t12 += v * b4; - t13 += v * b5; - t14 += v * b6; - t15 += v * b7; - t16 += v * b8; - t17 += v * b9; - t18 += v * b10; - t19 += v * b11; - t20 += v * b12; - t21 += v * b13; - t22 += v * b14; - t23 += v * b15; - v = a[9]; - t9 += v * b0; - t10 += v * b1; - t11 += v * b2; - t12 += v * b3; - t13 += v * b4; - t14 += v * b5; - t15 += v * b6; - t16 += v * b7; - t17 += v * b8; - t18 += v * b9; - t19 += v * b10; - t20 += v * b11; - t21 += v * b12; - t22 += v * b13; - t23 += v * b14; - t24 += v * b15; - v = a[10]; - t10 += v * b0; - t11 += v * b1; - t12 += v * b2; - t13 += v * b3; - t14 += v * b4; - t15 += v * b5; - t16 += v * b6; - t17 += v * b7; - t18 += v * b8; - t19 += v * b9; - t20 += v * b10; - t21 += v * b11; - t22 += v * b12; - t23 += v * b13; - t24 += v * b14; - t25 += v * b15; - v = a[11]; - t11 += v * b0; - t12 += v * b1; - t13 += v * b2; - t14 += v * b3; - t15 += v * b4; - t16 += v * b5; - t17 += v * b6; - t18 += v * b7; - t19 += v * b8; - t20 += v * b9; - t21 += v * b10; - t22 += v * b11; - t23 += v * b12; - t24 += v * b13; - t25 += v * b14; - t26 += v * b15; - v = a[12]; - t12 += v * b0; - t13 += v * b1; - t14 += v * b2; - t15 += v * b3; - t16 += v * b4; - t17 += v * b5; - t18 += v * b6; - t19 += v * b7; - t20 += v * b8; - t21 += v * b9; - t22 += v * b10; - t23 += v * b11; - t24 += v * b12; - t25 += v * b13; - t26 += v * b14; - t27 += v * b15; - v = a[13]; - t13 += v * b0; - t14 += v * b1; - t15 += v * b2; - t16 += v * b3; - t17 += v * b4; - t18 += v * b5; - t19 += v * b6; - t20 += v * b7; - t21 += v * b8; - t22 += v * b9; - t23 += v * b10; - t24 += v * b11; - t25 += v * b12; - t26 += v * b13; - t27 += v * b14; - t28 += v * b15; - v = a[14]; - t14 += v * b0; - t15 += v * b1; - t16 += v * b2; - t17 += v * b3; - t18 += v * b4; - t19 += v * b5; - t20 += v * b6; - t21 += v * b7; - t22 += v * b8; - t23 += v * b9; - t24 += v * b10; - t25 += v * b11; - t26 += v * b12; - t27 += v * b13; - t28 += v * b14; - t29 += v * b15; - v = a[15]; - t15 += v * b0; - t16 += v * b1; - t17 += v * b2; - t18 += v * b3; - t19 += v * b4; - t20 += v * b5; - t21 += v * b6; - t22 += v * b7; - t23 += v * b8; - t24 += v * b9; - t25 += v * b10; - t26 += v * b11; - t27 += v * b12; - t28 += v * b13; - t29 += v * b14; - t30 += v * b15; - - t0 += 38 * t16; - t1 += 38 * t17; - t2 += 38 * t18; - t3 += 38 * t19; - t4 += 38 * t20; - t5 += 38 * t21; - t6 += 38 * t22; - t7 += 38 * t23; - t8 += 38 * t24; - t9 += 38 * t25; - t10 += 38 * t26; - t11 += 38 * t27; - t12 += 38 * t28; - t13 += 38 * t29; - t14 += 38 * t30; - // t15 left as is - - // first car - c = 1; - v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; - v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; - v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; - v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; - v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; - v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; - v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; - v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; - v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; - v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; - v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; - v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; - v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; - v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; - v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; - v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; - t0 += c-1 + 37 * (c-1); - - // second car - c = 1; - v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; - v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; - v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; - v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; - v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; - v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; - v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; - v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; - v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; - v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; - v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; - v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; - v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; - v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; - v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; - v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; - t0 += c-1 + 37 * (c-1); - - o[ 0] = t0; - o[ 1] = t1; - o[ 2] = t2; - o[ 3] = t3; - o[ 4] = t4; - o[ 5] = t5; - o[ 6] = t6; - o[ 7] = t7; - o[ 8] = t8; - o[ 9] = t9; - o[10] = t10; - o[11] = t11; - o[12] = t12; - o[13] = t13; - o[14] = t14; - o[15] = t15; -} - -function S(o, a) { - M(o, a, a); -} - -function inv25519(o, i) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 253; a >= 0; a--) { - S(c, c); - if(a !== 2 && a !== 4) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} - -function pow2523(o, i) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 250; a >= 0; a--) { - S(c, c); - if(a !== 1) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} - -function crypto_scalarmult(q, n, p) { - var z = new Uint8Array(32); - var x = new Float64Array(80), r, i; - var a = gf(), b = gf(), c = gf(), - d = gf(), e = gf(), f = gf(); - for (i = 0; i < 31; i++) z[i] = n[i]; - z[31]=(n[31]&127)|64; - z[0]&=248; - unpack25519(x,p); - for (i = 0; i < 16; i++) { - b[i]=x[i]; - d[i]=a[i]=c[i]=0; - } - a[0]=d[0]=1; - for (i=254; i>=0; --i) { - r=(z[i>>>3]>>>(i&7))&1; - sel25519(a,b,r); - sel25519(c,d,r); - A(e,a,c); - Z(a,a,c); - A(c,b,d); - Z(b,b,d); - S(d,e); - S(f,a); - M(a,c,a); - M(c,b,e); - A(e,a,c); - Z(a,a,c); - S(b,a); - Z(c,d,f); - M(a,c,_121665); - A(a,a,d); - M(c,c,a); - M(a,d,f); - M(d,b,x); - S(b,e); - sel25519(a,b,r); - sel25519(c,d,r); - } - for (i = 0; i < 16; i++) { - x[i+16]=a[i]; - x[i+32]=c[i]; - x[i+48]=b[i]; - x[i+64]=d[i]; - } - var x32 = x.subarray(32); - var x16 = x.subarray(16); - inv25519(x32,x32); - M(x16,x16,x32); - pack25519(q,x16); - return 0; -} - -function crypto_scalarmult_base(q, n) { - return crypto_scalarmult(q, n, _9); -} - -function crypto_box_keypair(y, x) { - randombytes(x, 32); - return crypto_scalarmult_base(y, x); -} - -function crypto_box_beforenm(k, y, x) { - var s = new Uint8Array(32); - crypto_scalarmult(s, x, y); - return crypto_core_hsalsa20(k, _0, s, sigma); -} - -var crypto_box_afternm = crypto_secretbox; -var crypto_box_open_afternm = crypto_secretbox_open; - -function crypto_box(c, m, d, n, y, x) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_afternm(c, m, d, n, k); -} - -function crypto_box_open(m, c, d, n, y, x) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_open_afternm(m, c, d, n, k); -} - -var K = [ - 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, - 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, - 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, - 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, - 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, - 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, - 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, - 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, - 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, - 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, - 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, - 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, - 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, - 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, - 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, - 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, - 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, - 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, - 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, - 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, - 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, - 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, - 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, - 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, - 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, - 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, - 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, - 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, - 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, - 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, - 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, - 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, - 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, - 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, - 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, - 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, - 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, - 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, - 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, - 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 -]; - -function crypto_hashblocks_hl(hh, hl, m, n) { - var wh = new Int32Array(16), wl = new Int32Array(16), - bh0, bh1, bh2, bh3, bh4, bh5, bh6, bh7, - bl0, bl1, bl2, bl3, bl4, bl5, bl6, bl7, - th, tl, i, j, h, l, a, b, c, d; - - var ah0 = hh[0], - ah1 = hh[1], - ah2 = hh[2], - ah3 = hh[3], - ah4 = hh[4], - ah5 = hh[5], - ah6 = hh[6], - ah7 = hh[7], - - al0 = hl[0], - al1 = hl[1], - al2 = hl[2], - al3 = hl[3], - al4 = hl[4], - al5 = hl[5], - al6 = hl[6], - al7 = hl[7]; - - var pos = 0; - while (n >= 128) { - for (i = 0; i < 16; i++) { - j = 8 * i + pos; - wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; - wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; - } - for (i = 0; i < 80; i++) { - bh0 = ah0; - bh1 = ah1; - bh2 = ah2; - bh3 = ah3; - bh4 = ah4; - bh5 = ah5; - bh6 = ah6; - bh7 = ah7; - - bl0 = al0; - bl1 = al1; - bl2 = al2; - bl3 = al3; - bl4 = al4; - bl5 = al5; - bl6 = al6; - bl7 = al7; - - // add - h = ah7; - l = al7; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - // Sigma1 - h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); - l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // Ch - h = (ah4 & ah5) ^ (~ah4 & ah6); - l = (al4 & al5) ^ (~al4 & al6); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // K - h = K[i*2]; - l = K[i*2+1]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // w - h = wh[i%16]; - l = wl[i%16]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - th = c & 0xffff | d << 16; - tl = a & 0xffff | b << 16; - - // add - h = th; - l = tl; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - // Sigma0 - h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); - l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // Maj - h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); - l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh7 = (c & 0xffff) | (d << 16); - bl7 = (a & 0xffff) | (b << 16); - - // add - h = bh3; - l = bl3; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = th; - l = tl; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh3 = (c & 0xffff) | (d << 16); - bl3 = (a & 0xffff) | (b << 16); - - ah1 = bh0; - ah2 = bh1; - ah3 = bh2; - ah4 = bh3; - ah5 = bh4; - ah6 = bh5; - ah7 = bh6; - ah0 = bh7; - - al1 = bl0; - al2 = bl1; - al3 = bl2; - al4 = bl3; - al5 = bl4; - al6 = bl5; - al7 = bl6; - al0 = bl7; - - if (i%16 === 15) { - for (j = 0; j < 16; j++) { - // add - h = wh[j]; - l = wl[j]; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = wh[(j+9)%16]; - l = wl[(j+9)%16]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // sigma0 - th = wh[(j+1)%16]; - tl = wl[(j+1)%16]; - h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); - l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // sigma1 - th = wh[(j+14)%16]; - tl = wl[(j+14)%16]; - h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); - l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - wh[j] = (c & 0xffff) | (d << 16); - wl[j] = (a & 0xffff) | (b << 16); - } - } - } - - // add - h = ah0; - l = al0; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[0]; - l = hl[0]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[0] = ah0 = (c & 0xffff) | (d << 16); - hl[0] = al0 = (a & 0xffff) | (b << 16); - - h = ah1; - l = al1; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[1]; - l = hl[1]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[1] = ah1 = (c & 0xffff) | (d << 16); - hl[1] = al1 = (a & 0xffff) | (b << 16); - - h = ah2; - l = al2; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[2]; - l = hl[2]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[2] = ah2 = (c & 0xffff) | (d << 16); - hl[2] = al2 = (a & 0xffff) | (b << 16); - - h = ah3; - l = al3; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[3]; - l = hl[3]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[3] = ah3 = (c & 0xffff) | (d << 16); - hl[3] = al3 = (a & 0xffff) | (b << 16); - - h = ah4; - l = al4; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[4]; - l = hl[4]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[4] = ah4 = (c & 0xffff) | (d << 16); - hl[4] = al4 = (a & 0xffff) | (b << 16); - - h = ah5; - l = al5; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[5]; - l = hl[5]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[5] = ah5 = (c & 0xffff) | (d << 16); - hl[5] = al5 = (a & 0xffff) | (b << 16); - - h = ah6; - l = al6; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[6]; - l = hl[6]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[6] = ah6 = (c & 0xffff) | (d << 16); - hl[6] = al6 = (a & 0xffff) | (b << 16); - - h = ah7; - l = al7; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[7]; - l = hl[7]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[7] = ah7 = (c & 0xffff) | (d << 16); - hl[7] = al7 = (a & 0xffff) | (b << 16); - - pos += 128; - n -= 128; - } - - return n; -} - -function crypto_hash(out, m, n) { - var hh = new Int32Array(8), - hl = new Int32Array(8), - x = new Uint8Array(256), - i, b = n; - - hh[0] = 0x6a09e667; - hh[1] = 0xbb67ae85; - hh[2] = 0x3c6ef372; - hh[3] = 0xa54ff53a; - hh[4] = 0x510e527f; - hh[5] = 0x9b05688c; - hh[6] = 0x1f83d9ab; - hh[7] = 0x5be0cd19; - - hl[0] = 0xf3bcc908; - hl[1] = 0x84caa73b; - hl[2] = 0xfe94f82b; - hl[3] = 0x5f1d36f1; - hl[4] = 0xade682d1; - hl[5] = 0x2b3e6c1f; - hl[6] = 0xfb41bd6b; - hl[7] = 0x137e2179; - - crypto_hashblocks_hl(hh, hl, m, n); - n %= 128; - - for (i = 0; i < n; i++) x[i] = m[b-n+i]; - x[n] = 128; - - n = 256-128*(n<112?1:0); - x[n-9] = 0; - ts64(x, n-8, (b / 0x20000000) | 0, b << 3); - crypto_hashblocks_hl(hh, hl, x, n); - - for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); - - return 0; -} - -function add(p, q) { - var a = gf(), b = gf(), c = gf(), - d = gf(), e = gf(), f = gf(), - g = gf(), h = gf(), t = gf(); - - Z(a, p[1], p[0]); - Z(t, q[1], q[0]); - M(a, a, t); - A(b, p[0], p[1]); - A(t, q[0], q[1]); - M(b, b, t); - M(c, p[3], q[3]); - M(c, c, D2); - M(d, p[2], q[2]); - A(d, d, d); - Z(e, b, a); - Z(f, d, c); - A(g, d, c); - A(h, b, a); - - M(p[0], e, f); - M(p[1], h, g); - M(p[2], g, f); - M(p[3], e, h); -} - -function cswap(p, q, b) { - var i; - for (i = 0; i < 4; i++) { - sel25519(p[i], q[i], b); - } -} - -function pack(r, p) { - var tx = gf(), ty = gf(), zi = gf(); - inv25519(zi, p[2]); - M(tx, p[0], zi); - M(ty, p[1], zi); - pack25519(r, ty); - r[31] ^= par25519(tx) << 7; -} - -function scalarmult(p, q, s) { - var b, i; - set25519(p[0], gf0); - set25519(p[1], gf1); - set25519(p[2], gf1); - set25519(p[3], gf0); - for (i = 255; i >= 0; --i) { - b = (s[(i/8)|0] >> (i&7)) & 1; - cswap(p, q, b); - add(q, p); - add(p, p); - cswap(p, q, b); - } -} - -function scalarbase(p, s) { - var q = [gf(), gf(), gf(), gf()]; - set25519(q[0], X); - set25519(q[1], Y); - set25519(q[2], gf1); - M(q[3], X, Y); - scalarmult(p, q, s); -} - -function crypto_sign_keypair(pk, sk, seeded) { - var d = new Uint8Array(64); - var p = [gf(), gf(), gf(), gf()]; - var i; - - if (!seeded) randombytes(sk, 32); - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - scalarbase(p, d); - pack(pk, p); - - for (i = 0; i < 32; i++) sk[i+32] = pk[i]; - return 0; -} - -var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); - -function modL(r, x) { - var carry, i, j, k; - for (i = 63; i >= 32; --i) { - carry = 0; - for (j = i - 32, k = i - 12; j < k; ++j) { - x[j] += carry - 16 * x[i] * L[j - (i - 32)]; - carry = (x[j] + 128) >> 8; - x[j] -= carry * 256; - } - x[j] += carry; - x[i] = 0; - } - carry = 0; - for (j = 0; j < 32; j++) { - x[j] += carry - (x[31] >> 4) * L[j]; - carry = x[j] >> 8; - x[j] &= 255; - } - for (j = 0; j < 32; j++) x[j] -= carry * L[j]; - for (i = 0; i < 32; i++) { - x[i+1] += x[i] >> 8; - r[i] = x[i] & 255; - } -} - -function reduce(r) { - var x = new Float64Array(64), i; - for (i = 0; i < 64; i++) x[i] = r[i]; - for (i = 0; i < 64; i++) r[i] = 0; - modL(r, x); -} - -// Note: difference from C - smlen returned, not passed as argument. -function crypto_sign(sm, m, n, sk) { - var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); - var i, j, x = new Float64Array(64); - var p = [gf(), gf(), gf(), gf()]; - - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - var smlen = n + 64; - for (i = 0; i < n; i++) sm[64 + i] = m[i]; - for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; - - crypto_hash(r, sm.subarray(32), n+32); - reduce(r); - scalarbase(p, r); - pack(sm, p); - - for (i = 32; i < 64; i++) sm[i] = sk[i]; - crypto_hash(h, sm, n + 64); - reduce(h); - - for (i = 0; i < 64; i++) x[i] = 0; - for (i = 0; i < 32; i++) x[i] = r[i]; - for (i = 0; i < 32; i++) { - for (j = 0; j < 32; j++) { - x[i+j] += h[i] * d[j]; - } - } - - modL(sm.subarray(32), x); - return smlen; -} - -function unpackneg(r, p) { - var t = gf(), chk = gf(), num = gf(), - den = gf(), den2 = gf(), den4 = gf(), - den6 = gf(); - - set25519(r[2], gf1); - unpack25519(r[1], p); - S(num, r[1]); - M(den, num, D); - Z(num, num, r[2]); - A(den, r[2], den); - - S(den2, den); - S(den4, den2); - M(den6, den4, den2); - M(t, den6, num); - M(t, t, den); - - pow2523(t, t); - M(t, t, num); - M(t, t, den); - M(t, t, den); - M(r[0], t, den); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) M(r[0], r[0], I); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) return -1; - - if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); - - M(r[3], r[0], r[1]); - return 0; -} - -function crypto_sign_open(m, sm, n, pk) { - var i, mlen; - var t = new Uint8Array(32), h = new Uint8Array(64); - var p = [gf(), gf(), gf(), gf()], - q = [gf(), gf(), gf(), gf()]; - - mlen = -1; - if (n < 64) return -1; - - if (unpackneg(q, pk)) return -1; - - for (i = 0; i < n; i++) m[i] = sm[i]; - for (i = 0; i < 32; i++) m[i+32] = pk[i]; - crypto_hash(h, m, n); - reduce(h); - scalarmult(p, q, h); - - scalarbase(q, sm.subarray(32)); - add(p, q); - pack(t, p); - - n -= 64; - if (crypto_verify_32(sm, 0, t, 0)) { - for (i = 0; i < n; i++) m[i] = 0; - return -1; - } - - for (i = 0; i < n; i++) m[i] = sm[i + 64]; - mlen = n; - return mlen; -} - -var crypto_secretbox_KEYBYTES = 32, - crypto_secretbox_NONCEBYTES = 24, - crypto_secretbox_ZEROBYTES = 32, - crypto_secretbox_BOXZEROBYTES = 16, - crypto_scalarmult_BYTES = 32, - crypto_scalarmult_SCALARBYTES = 32, - crypto_box_PUBLICKEYBYTES = 32, - crypto_box_SECRETKEYBYTES = 32, - crypto_box_BEFORENMBYTES = 32, - crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, - crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, - crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, - crypto_sign_BYTES = 64, - crypto_sign_PUBLICKEYBYTES = 32, - crypto_sign_SECRETKEYBYTES = 64, - crypto_sign_SEEDBYTES = 32, - crypto_hash_BYTES = 64; - -nacl.lowlevel = { - crypto_core_hsalsa20: crypto_core_hsalsa20, - crypto_stream_xor: crypto_stream_xor, - crypto_stream: crypto_stream, - crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, - crypto_stream_salsa20: crypto_stream_salsa20, - crypto_onetimeauth: crypto_onetimeauth, - crypto_onetimeauth_verify: crypto_onetimeauth_verify, - crypto_verify_16: crypto_verify_16, - crypto_verify_32: crypto_verify_32, - crypto_secretbox: crypto_secretbox, - crypto_secretbox_open: crypto_secretbox_open, - crypto_scalarmult: crypto_scalarmult, - crypto_scalarmult_base: crypto_scalarmult_base, - crypto_box_beforenm: crypto_box_beforenm, - crypto_box_afternm: crypto_box_afternm, - crypto_box: crypto_box, - crypto_box_open: crypto_box_open, - crypto_box_keypair: crypto_box_keypair, - crypto_hash: crypto_hash, - crypto_sign: crypto_sign, - crypto_sign_keypair: crypto_sign_keypair, - crypto_sign_open: crypto_sign_open, - - crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, - crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, - crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, - crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, - crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, - crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, - crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, - crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, - crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, - crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, - crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, - crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, - crypto_sign_BYTES: crypto_sign_BYTES, - crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, - crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, - crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, - crypto_hash_BYTES: crypto_hash_BYTES -}; - -/* High-level API */ - -function checkLengths(k, n) { - if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); - if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); -} - -function checkBoxLengths(pk, sk) { - if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); - if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); -} - -function checkArrayTypes() { - var t, i; - for (i = 0; i < arguments.length; i++) { - if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') - throw new TypeError('unexpected type ' + t + ', use Uint8Array'); - } -} - -function cleanup(arr) { - for (var i = 0; i < arr.length; i++) arr[i] = 0; -} - -// TODO: Completely remove this in v0.15. -if (!nacl.util) { - nacl.util = {}; - nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { - throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); - }; -} - -nacl.randomBytes = function(n) { - var b = new Uint8Array(n); - randombytes(b, n); - return b; -}; - -nacl.secretbox = function(msg, nonce, key) { - checkArrayTypes(msg, nonce, key); - checkLengths(key, nonce); - var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); - var c = new Uint8Array(m.length); - for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; - crypto_secretbox(c, m, m.length, nonce, key); - return c.subarray(crypto_secretbox_BOXZEROBYTES); -}; - -nacl.secretbox.open = function(box, nonce, key) { - checkArrayTypes(box, nonce, key); - checkLengths(key, nonce); - var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); - var m = new Uint8Array(c.length); - for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; - if (c.length < 32) return false; - if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; - return m.subarray(crypto_secretbox_ZEROBYTES); -}; - -nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; -nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; -nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; - -nacl.scalarMult = function(n, p) { - checkArrayTypes(n, p); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); - if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult(q, n, p); - return q; -}; - -nacl.scalarMult.base = function(n) { - checkArrayTypes(n); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult_base(q, n); - return q; -}; - -nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; -nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; - -nacl.box = function(msg, nonce, publicKey, secretKey) { - var k = nacl.box.before(publicKey, secretKey); - return nacl.secretbox(msg, nonce, k); -}; - -nacl.box.before = function(publicKey, secretKey) { - checkArrayTypes(publicKey, secretKey); - checkBoxLengths(publicKey, secretKey); - var k = new Uint8Array(crypto_box_BEFORENMBYTES); - crypto_box_beforenm(k, publicKey, secretKey); - return k; -}; - -nacl.box.after = nacl.secretbox; - -nacl.box.open = function(msg, nonce, publicKey, secretKey) { - var k = nacl.box.before(publicKey, secretKey); - return nacl.secretbox.open(msg, nonce, k); -}; - -nacl.box.open.after = nacl.secretbox.open; - -nacl.box.keyPair = function() { - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); - crypto_box_keypair(pk, sk); - return {publicKey: pk, secretKey: sk}; -}; - -nacl.box.keyPair.fromSecretKey = function(secretKey) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_box_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - crypto_scalarmult_base(pk, secretKey); - return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; -}; - -nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; -nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; -nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; -nacl.box.nonceLength = crypto_box_NONCEBYTES; -nacl.box.overheadLength = nacl.secretbox.overheadLength; - -nacl.sign = function(msg, secretKey) { - checkArrayTypes(msg, secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); - crypto_sign(signedMsg, msg, msg.length, secretKey); - return signedMsg; -}; - -nacl.sign.open = function(signedMsg, publicKey) { - if (arguments.length !== 2) - throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); - checkArrayTypes(signedMsg, publicKey); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error('bad public key size'); - var tmp = new Uint8Array(signedMsg.length); - var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); - if (mlen < 0) return null; - var m = new Uint8Array(mlen); - for (var i = 0; i < m.length; i++) m[i] = tmp[i]; - return m; -}; - -nacl.sign.detached = function(msg, secretKey) { - var signedMsg = nacl.sign(msg, secretKey); - var sig = new Uint8Array(crypto_sign_BYTES); - for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; - return sig; -}; - -nacl.sign.detached.verify = function(msg, sig, publicKey) { - checkArrayTypes(msg, sig, publicKey); - if (sig.length !== crypto_sign_BYTES) - throw new Error('bad signature size'); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error('bad public key size'); - var sm = new Uint8Array(crypto_sign_BYTES + msg.length); - var m = new Uint8Array(crypto_sign_BYTES + msg.length); - var i; - for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; - for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; - return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); -}; - -nacl.sign.keyPair = function() { - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - crypto_sign_keypair(pk, sk); - return {publicKey: pk, secretKey: sk}; -}; - -nacl.sign.keyPair.fromSecretKey = function(secretKey) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; - return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; -}; - -nacl.sign.keyPair.fromSeed = function(seed) { - checkArrayTypes(seed); - if (seed.length !== crypto_sign_SEEDBYTES) - throw new Error('bad seed size'); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - for (var i = 0; i < 32; i++) sk[i] = seed[i]; - crypto_sign_keypair(pk, sk, true); - return {publicKey: pk, secretKey: sk}; -}; - -nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; -nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; -nacl.sign.seedLength = crypto_sign_SEEDBYTES; -nacl.sign.signatureLength = crypto_sign_BYTES; - -nacl.hash = function(msg) { - checkArrayTypes(msg); - var h = new Uint8Array(crypto_hash_BYTES); - crypto_hash(h, msg, msg.length); - return h; -}; - -nacl.hash.hashLength = crypto_hash_BYTES; - -nacl.verify = function(x, y) { - checkArrayTypes(x, y); - // Zero length arguments are considered not equal. - if (x.length === 0 || y.length === 0) return false; - if (x.length !== y.length) return false; - return (vn(x, 0, y, 0, x.length) === 0) ? true : false; -}; - -nacl.setPRNG = function(fn) { - randombytes = fn; -}; - -(function() { - // Initialize PRNG if environment provides CSPRNG. - // If not, methods calling randombytes will throw. - var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; - if (crypto && crypto.getRandomValues) { - // Browsers. - var QUOTA = 65536; - nacl.setPRNG(function(x, n) { - var i, v = new Uint8Array(n); - for (i = 0; i < n; i += QUOTA) { - crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); - } - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } else if (true) { - // Node.js. - crypto = __webpack_require__(4); - if (crypto && crypto.randomBytes) { - nacl.setPRNG(function(x, n) { - var i, v = crypto.randomBytes(n); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } - } -})(); - -})(typeof module !== 'undefined' && module.exports ? module.exports : (self.nacl = self.nacl || {})); - - -/***/ }), -/* 24 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2011 Mark Cavage All rights reserved. - -// If you have no idea what ASN.1 or BER is, see this: -// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc - -var Ber = __webpack_require__(457); - - - -///--- Exported API - -module.exports = { - - Ber: Ber, - - BerReader: Ber.Reader, - - BerWriter: Ber.Writer - -}; - - -/***/ }), -/* 25 */ -/***/ (function(module, exports) { - -module.exports = require("assert"); - -/***/ }), -/* 26 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -var es5 = __webpack_require__(34); -var Objectfreeze = es5.freeze; -var util = __webpack_require__(3); -var inherits = util.inherits; -var notEnumerableProp = util.notEnumerableProp; - -function subError(nameProperty, defaultMessage) { - function SubError(message) { - if (!(this instanceof SubError)) return new SubError(message); - notEnumerableProp(this, "message", - typeof message === "string" ? message : defaultMessage); - notEnumerableProp(this, "name", nameProperty); - if (Error.captureStackTrace) { - Error.captureStackTrace(this, this.constructor); - } else { - Error.call(this); - } - } - inherits(SubError, Error); - return SubError; -} - -var _TypeError, _RangeError; -var Warning = subError("Warning", "warning"); -var CancellationError = subError("CancellationError", "cancellation error"); -var TimeoutError = subError("TimeoutError", "timeout error"); -var AggregateError = subError("AggregateError", "aggregate error"); -try { - _TypeError = TypeError; - _RangeError = RangeError; -} catch(e) { - _TypeError = subError("TypeError", "type error"); - _RangeError = subError("RangeError", "range error"); -} - -var methods = ("join pop push shift unshift slice filter forEach some " + - "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" "); - -for (var i = 0; i < methods.length; ++i) { - if (typeof Array.prototype[methods[i]] === "function") { - AggregateError.prototype[methods[i]] = Array.prototype[methods[i]]; - } -} - -es5.defineProperty(AggregateError.prototype, "length", { - value: 0, - configurable: false, - writable: true, - enumerable: true -}); -AggregateError.prototype["isOperational"] = true; -var level = 0; -AggregateError.prototype.toString = function() { - var indent = Array(level * 4 + 1).join(" "); - var ret = "\n" + indent + "AggregateError of:" + "\n"; - level++; - indent = Array(level * 4 + 1).join(" "); - for (var i = 0; i < this.length; ++i) { - var str = this[i] === this ? "[Circular AggregateError]" : this[i] + ""; - var lines = str.split("\n"); - for (var j = 0; j < lines.length; ++j) { - lines[j] = indent + lines[j]; - } - str = lines.join("\n"); - ret += str + "\n"; - } - level--; - return ret; -}; - -function OperationalError(message) { - if (!(this instanceof OperationalError)) - return new OperationalError(message); - notEnumerableProp(this, "name", "OperationalError"); - notEnumerableProp(this, "message", message); - this.cause = message; - this["isOperational"] = true; - - if (message instanceof Error) { - notEnumerableProp(this, "message", message.message); - notEnumerableProp(this, "stack", message.stack); - } else if (Error.captureStackTrace) { - Error.captureStackTrace(this, this.constructor); - } - -} -inherits(OperationalError, Error); - -var errorTypes = Error["__BluebirdErrorTypes__"]; -if (!errorTypes) { - errorTypes = Objectfreeze({ - CancellationError: CancellationError, - TimeoutError: TimeoutError, - OperationalError: OperationalError, - RejectionError: OperationalError, - AggregateError: AggregateError - }); - es5.defineProperty(Error, "__BluebirdErrorTypes__", { - value: errorTypes, - writable: false, - enumerable: false, - configurable: false - }); -} - -module.exports = { - Error: Error, - TypeError: _TypeError, - RangeError: _RangeError, - CancellationError: errorTypes.CancellationError, - OperationalError: errorTypes.OperationalError, - TimeoutError: errorTypes.TimeoutError, - AggregateError: errorTypes.AggregateError, - Warning: Warning -}; - - -/***/ }), -/* 27 */ -/***/ (function(module, exports, __webpack_require__) { - -(function(){ - - // Copyright (c) 2005 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Basic JavaScript BN library - subset useful for RSA encryption. - - // Bits per digit - var dbits; - - // JavaScript engine analysis - var canary = 0xdeadbeefcafe; - var j_lm = ((canary&0xffffff)==0xefcafe); - - // (public) Constructor - function BigInteger(a,b,c) { - if(a != null) - if("number" == typeof a) this.fromNumber(a,b,c); - else if(b == null && "string" != typeof a) this.fromString(a,256); - else this.fromString(a,b); - } - - // return new, unset BigInteger - function nbi() { return new BigInteger(null); } - - // am: Compute w_j += (x*this_i), propagate carries, - // c is initial carry, returns final carry. - // c < 3*dvalue, x < 2*dvalue, this_i < dvalue - // We need to select the fastest one that works in this environment. - - // am1: use a single mult and divide to get the high bits, - // max digit bits should be 26 because - // max internal value = 2*dvalue^2-2*dvalue (< 2^53) - function am1(i,x,w,j,c,n) { - while(--n >= 0) { - var v = x*this[i++]+w[j]+c; - c = Math.floor(v/0x4000000); - w[j++] = v&0x3ffffff; - } - return c; - } - // am2 avoids a big mult-and-extract completely. - // Max digit bits should be <= 30 because we do bitwise ops - // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) - function am2(i,x,w,j,c,n) { - var xl = x&0x7fff, xh = x>>15; - while(--n >= 0) { - var l = this[i]&0x7fff; - var h = this[i++]>>15; - var m = xh*l+h*xl; - l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); - c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); - w[j++] = l&0x3fffffff; - } - return c; - } - // Alternately, set max digit bits to 28 since some - // browsers slow down when dealing with 32-bit numbers. - function am3(i,x,w,j,c,n) { - var xl = x&0x3fff, xh = x>>14; - while(--n >= 0) { - var l = this[i]&0x3fff; - var h = this[i++]>>14; - var m = xh*l+h*xl; - l = xl*l+((m&0x3fff)<<14)+w[j]+c; - c = (l>>28)+(m>>14)+xh*h; - w[j++] = l&0xfffffff; - } - return c; - } - var inBrowser = typeof navigator !== "undefined"; - if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { - BigInteger.prototype.am = am2; - dbits = 30; - } - else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { - BigInteger.prototype.am = am1; - dbits = 26; - } - else { // Mozilla/Netscape seems to prefer am3 - BigInteger.prototype.am = am3; - dbits = 28; - } - - BigInteger.prototype.DB = dbits; - BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; - r.t = this.t; - r.s = this.s; - } - - // (protected) set from integer value x, -DV <= x < DV - function bnpFromInt(x) { - this.t = 1; - this.s = (x<0)?-1:0; - if(x > 0) this[0] = x; - else if(x < -1) this[0] = x+this.DV; - else this.t = 0; - } - - // return bigint initialized to value - function nbv(i) { var r = nbi(); r.fromInt(i); return r; } - - // (protected) set from string and radix - function bnpFromString(s,b) { - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 256) k = 8; // byte array - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else { this.fromRadix(s,b); return; } - this.t = 0; - this.s = 0; - var i = s.length, mi = false, sh = 0; - while(--i >= 0) { - var x = (k==8)?s[i]&0xff:intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-") mi = true; - continue; - } - mi = false; - if(sh == 0) - this[this.t++] = x; - else if(sh+k > this.DB) { - this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); - } - else - this[this.t-1] |= x<= this.DB) sh -= this.DB; - } - if(k == 8 && (s[0]&0x80) != 0) { - this.s = -1; - if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; - } - - // (public) return string representation in given radix - function bnToString(b) { - if(this.s < 0) return "-"+this.negate().toString(b); - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else return this.toRadix(b); - var km = (1< 0) { - if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } - while(i >= 0) { - if(p < k) { - d = (this[i]&((1<>(p+=this.DB-k); - } - else { - d = (this[i]>>(p-=k))&km; - if(p <= 0) { p += this.DB; --i; } - } - if(d > 0) m = true; - if(m) r += int2char(d); - } - } - return m?r:"0"; - } - - // (public) -this - function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } - - // (public) |this| - function bnAbs() { return (this.s<0)?this.negate():this; } - - // (public) return + if this > a, - if this < a, 0 if equal - function bnCompareTo(a) { - var r = this.s-a.s; - if(r != 0) return r; - var i = this.t; - r = i-a.t; - if(r != 0) return (this.s<0)?-r:r; - while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; - return 0; - } - - // returns bit length of the integer x - function nbits(x) { - var r = 1, t; - if((t=x>>>16) != 0) { x = t; r += 16; } - if((t=x>>8) != 0) { x = t; r += 8; } - if((t=x>>4) != 0) { x = t; r += 4; } - if((t=x>>2) != 0) { x = t; r += 2; } - if((t=x>>1) != 0) { x = t; r += 1; } - return r; - } - - // (public) return the number of bits in "this" - function bnBitLength() { - if(this.t <= 0) return 0; - return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); - } - - // (protected) r = this << n*DB - function bnpDLShiftTo(n,r) { - var i; - for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; - for(i = n-1; i >= 0; --i) r[i] = 0; - r.t = this.t+n; - r.s = this.s; - } - - // (protected) r = this >> n*DB - function bnpDRShiftTo(n,r) { - for(var i = n; i < this.t; ++i) r[i-n] = this[i]; - r.t = Math.max(this.t-n,0); - r.s = this.s; - } - - // (protected) r = this << n - function bnpLShiftTo(n,r) { - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<= 0; --i) { - r[i+ds+1] = (this[i]>>cbs)|c; - c = (this[i]&bm)<= 0; --i) r[i] = 0; - r[ds] = c; - r.t = this.t+ds+1; - r.s = this.s; - r.clamp(); - } - - // (protected) r = this >> n - function bnpRShiftTo(n,r) { - r.s = this.s; - var ds = Math.floor(n/this.DB); - if(ds >= this.t) { r.t = 0; return; } - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<>bs; - for(var i = ds+1; i < this.t; ++i) { - r[i-ds-1] |= (this[i]&bm)<>bs; - } - if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; - } - if(a.t < this.t) { - c -= a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c -= a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c -= a.s; - } - r.s = (c<0)?-1:0; - if(c < -1) r[i++] = this.DV+c; - else if(c > 0) r[i++] = c; - r.t = i; - r.clamp(); - } - - // (protected) r = this * a, r != this,a (HAC 14.12) - // "this" should be the larger one if appropriate. - function bnpMultiplyTo(a,r) { - var x = this.abs(), y = a.abs(); - var i = x.t; - r.t = i+y.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); - r.s = 0; - r.clamp(); - if(this.s != a.s) BigInteger.ZERO.subTo(r,r); - } - - // (protected) r = this^2, r != this (HAC 14.16) - function bnpSquareTo(r) { - var x = this.abs(); - var i = r.t = 2*x.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < x.t-1; ++i) { - var c = x.am(i,x[i],r,2*i,0,1); - if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { - r[i+x.t] -= x.DV; - r[i+x.t+1] = 1; - } - } - if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); - r.s = 0; - r.clamp(); - } - - // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) - // r != q, this != m. q or r may be null. - function bnpDivRemTo(m,q,r) { - var pm = m.abs(); - if(pm.t <= 0) return; - var pt = this.abs(); - if(pt.t < pm.t) { - if(q != null) q.fromInt(0); - if(r != null) this.copyTo(r); - return; - } - if(r == null) r = nbi(); - var y = nbi(), ts = this.s, ms = m.s; - var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus - if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } - else { pm.copyTo(y); pt.copyTo(r); } - var ys = y.t; - var y0 = y[ys-1]; - if(y0 == 0) return; - var yt = y0*(1<1)?y[ys-2]>>this.F2:0); - var d1 = this.FV/yt, d2 = (1<= 0) { - r[r.t++] = 1; - r.subTo(t,r); - } - BigInteger.ONE.dlShiftTo(ys,t); - t.subTo(y,y); // "negative" y so we can replace sub with am later - while(y.t < ys) y[y.t++] = 0; - while(--j >= 0) { - // Estimate quotient digit - var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); - if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out - y.dlShiftTo(j,t); - r.subTo(t,r); - while(r[i] < --qd) r.subTo(t,r); - } - } - if(q != null) { - r.drShiftTo(ys,q); - if(ts != ms) BigInteger.ZERO.subTo(q,q); - } - r.t = ys; - r.clamp(); - if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder - if(ts < 0) BigInteger.ZERO.subTo(r,r); - } - - // (public) this mod a - function bnMod(a) { - var r = nbi(); - this.abs().divRemTo(a,null,r); - if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); - return r; - } - - // Modular reduction using "classic" algorithm - function Classic(m) { this.m = m; } - function cConvert(x) { - if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); - else return x; - } - function cRevert(x) { return x; } - function cReduce(x) { x.divRemTo(this.m,null,x); } - function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - Classic.prototype.convert = cConvert; - Classic.prototype.revert = cRevert; - Classic.prototype.reduce = cReduce; - Classic.prototype.mulTo = cMulTo; - Classic.prototype.sqrTo = cSqrTo; - - // (protected) return "-1/this % 2^DB"; useful for Mont. reduction - // justification: - // xy == 1 (mod m) - // xy = 1+km - // xy(2-xy) = (1+km)(1-km) - // x[y(2-xy)] = 1-k^2m^2 - // x[y(2-xy)] == 1 (mod m^2) - // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 - // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. - // JS multiply "overflows" differently from C/C++, so care is needed here. - function bnpInvDigit() { - if(this.t < 1) return 0; - var x = this[0]; - if((x&1) == 0) return 0; - var y = x&3; // y == 1/x mod 2^2 - y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 - y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 - y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 - // last step - calculate inverse mod DV directly; - // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints - y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits - // we really want the negative inverse, and -DV < y < DV - return (y>0)?this.DV-y:-y; - } - - // Montgomery reduction - function Montgomery(m) { - this.m = m; - this.mp = m.invDigit(); - this.mpl = this.mp&0x7fff; - this.mph = this.mp>>15; - this.um = (1<<(m.DB-15))-1; - this.mt2 = 2*m.t; - } - - // xR mod m - function montConvert(x) { - var r = nbi(); - x.abs().dlShiftTo(this.m.t,r); - r.divRemTo(this.m,null,r); - if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); - return r; - } - - // x/R mod m - function montRevert(x) { - var r = nbi(); - x.copyTo(r); - this.reduce(r); - return r; - } - - // x = x/R mod m (HAC 14.32) - function montReduce(x) { - while(x.t <= this.mt2) // pad x so am has enough room later - x[x.t++] = 0; - for(var i = 0; i < this.m.t; ++i) { - // faster way of calculating u0 = x[i]*mp mod DV - var j = x[i]&0x7fff; - var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; - // use am to combine the multiply-shift-add into one call - j = i+this.m.t; - x[j] += this.m.am(0,u0,x,i,0,this.m.t); - // propagate carry - while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } - } - x.clamp(); - x.drShiftTo(this.m.t,x); - if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } - - // r = "x^2/R mod m"; x != r - function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = "xy/R mod m"; x,y != r - function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Montgomery.prototype.convert = montConvert; - Montgomery.prototype.revert = montRevert; - Montgomery.prototype.reduce = montReduce; - Montgomery.prototype.mulTo = montMulTo; - Montgomery.prototype.sqrTo = montSqrTo; - - // (protected) true iff this is even - function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } - - // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) - function bnpExp(e,z) { - if(e > 0xffffffff || e < 1) return BigInteger.ONE; - var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; - g.copyTo(r); - while(--i >= 0) { - z.sqrTo(r,r2); - if((e&(1< 0) z.mulTo(r2,g,r); - else { var t = r; r = r2; r2 = t; } - } - return z.revert(r); - } - - // (public) this^e % m, 0 <= e < 2^32 - function bnModPowInt(e,m) { - var z; - if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); - return this.exp(e,z); - } - - // protected - BigInteger.prototype.copyTo = bnpCopyTo; - BigInteger.prototype.fromInt = bnpFromInt; - BigInteger.prototype.fromString = bnpFromString; - BigInteger.prototype.clamp = bnpClamp; - BigInteger.prototype.dlShiftTo = bnpDLShiftTo; - BigInteger.prototype.drShiftTo = bnpDRShiftTo; - BigInteger.prototype.lShiftTo = bnpLShiftTo; - BigInteger.prototype.rShiftTo = bnpRShiftTo; - BigInteger.prototype.subTo = bnpSubTo; - BigInteger.prototype.multiplyTo = bnpMultiplyTo; - BigInteger.prototype.squareTo = bnpSquareTo; - BigInteger.prototype.divRemTo = bnpDivRemTo; - BigInteger.prototype.invDigit = bnpInvDigit; - BigInteger.prototype.isEven = bnpIsEven; - BigInteger.prototype.exp = bnpExp; - - // public - BigInteger.prototype.toString = bnToString; - BigInteger.prototype.negate = bnNegate; - BigInteger.prototype.abs = bnAbs; - BigInteger.prototype.compareTo = bnCompareTo; - BigInteger.prototype.bitLength = bnBitLength; - BigInteger.prototype.mod = bnMod; - BigInteger.prototype.modPowInt = bnModPowInt; - - // "constants" - BigInteger.ZERO = nbv(0); - BigInteger.ONE = nbv(1); - - // Copyright (c) 2005-2009 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Extended JavaScript BN functions, required for RSA private ops. - - // Version 1.1: new BigInteger("0", 10) returns "proper" zero - // Version 1.2: square() API, isProbablePrime fix - - // (public) - function bnClone() { var r = nbi(); this.copyTo(r); return r; } - - // (public) return value as integer - function bnIntValue() { - if(this.s < 0) { - if(this.t == 1) return this[0]-this.DV; - else if(this.t == 0) return -1; - } - else if(this.t == 1) return this[0]; - else if(this.t == 0) return 0; - // assumes 16 < DB < 32 - return ((this[1]&((1<<(32-this.DB))-1))<>24; } - - // (public) return value as short (assumes DB>=16) - function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } - - // (protected) return x s.t. r^x < DV - function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } - - // (public) 0 if this == 0, 1 if this > 0 - function bnSigNum() { - if(this.s < 0) return -1; - else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; - else return 1; - } - - // (protected) convert to radix string - function bnpToRadix(b) { - if(b == null) b = 10; - if(this.signum() == 0 || b < 2 || b > 36) return "0"; - var cs = this.chunkSize(b); - var a = Math.pow(b,cs); - var d = nbv(a), y = nbi(), z = nbi(), r = ""; - this.divRemTo(d,y,z); - while(y.signum() > 0) { - r = (a+z.intValue()).toString(b).substr(1) + r; - y.divRemTo(d,y,z); - } - return z.intValue().toString(b) + r; - } - - // (protected) convert from radix string - function bnpFromRadix(s,b) { - this.fromInt(0); - if(b == null) b = 10; - var cs = this.chunkSize(b); - var d = Math.pow(b,cs), mi = false, j = 0, w = 0; - for(var i = 0; i < s.length; ++i) { - var x = intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-" && this.signum() == 0) mi = true; - continue; - } - w = b*w+x; - if(++j >= cs) { - this.dMultiply(d); - this.dAddOffset(w,0); - j = 0; - w = 0; - } - } - if(j > 0) { - this.dMultiply(Math.pow(b,j)); - this.dAddOffset(w,0); - } - if(mi) BigInteger.ZERO.subTo(this,this); - } - - // (protected) alternate constructor - function bnpFromNumber(a,b,c) { - if("number" == typeof b) { - // new BigInteger(int,int,RNG) - if(a < 2) this.fromInt(1); - else { - this.fromNumber(a,c); - if(!this.testBit(a-1)) // force MSB set - this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); - if(this.isEven()) this.dAddOffset(1,0); // force odd - while(!this.isProbablePrime(b)) { - this.dAddOffset(2,0); - if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); - } - } - } - else { - // new BigInteger(int,RNG) - var x = new Array(), t = a&7; - x.length = (a>>3)+1; - b.nextBytes(x); - if(t > 0) x[0] &= ((1< 0) { - if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) - r[k++] = d|(this.s<<(this.DB-p)); - while(i >= 0) { - if(p < 8) { - d = (this[i]&((1<>(p+=this.DB-8); - } - else { - d = (this[i]>>(p-=8))&0xff; - if(p <= 0) { p += this.DB; --i; } - } - if((d&0x80) != 0) d |= -256; - if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; - if(k > 0 || d != this.s) r[k++] = d; - } - } - return r; - } - - function bnEquals(a) { return(this.compareTo(a)==0); } - function bnMin(a) { return(this.compareTo(a)<0)?this:a; } - function bnMax(a) { return(this.compareTo(a)>0)?this:a; } - - // (protected) r = this op a (bitwise) - function bnpBitwiseTo(a,op,r) { - var i, f, m = Math.min(a.t,this.t); - for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); - if(a.t < this.t) { - f = a.s&this.DM; - for(i = m; i < this.t; ++i) r[i] = op(this[i],f); - r.t = this.t; - } - else { - f = this.s&this.DM; - for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); - r.t = a.t; - } - r.s = op(this.s,a.s); - r.clamp(); - } - - // (public) this & a - function op_and(x,y) { return x&y; } - function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } - - // (public) this | a - function op_or(x,y) { return x|y; } - function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } - - // (public) this ^ a - function op_xor(x,y) { return x^y; } - function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } - - // (public) this & ~a - function op_andnot(x,y) { return x&~y; } - function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } - - // (public) ~this - function bnNot() { - var r = nbi(); - for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; - r.t = this.t; - r.s = ~this.s; - return r; - } - - // (public) this << n - function bnShiftLeft(n) { - var r = nbi(); - if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); - return r; - } - - // (public) this >> n - function bnShiftRight(n) { - var r = nbi(); - if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); - return r; - } - - // return index of lowest 1-bit in x, x < 2^31 - function lbit(x) { - if(x == 0) return -1; - var r = 0; - if((x&0xffff) == 0) { x >>= 16; r += 16; } - if((x&0xff) == 0) { x >>= 8; r += 8; } - if((x&0xf) == 0) { x >>= 4; r += 4; } - if((x&3) == 0) { x >>= 2; r += 2; } - if((x&1) == 0) ++r; - return r; - } - - // (public) returns index of lowest 1-bit (or -1 if none) - function bnGetLowestSetBit() { - for(var i = 0; i < this.t; ++i) - if(this[i] != 0) return i*this.DB+lbit(this[i]); - if(this.s < 0) return this.t*this.DB; - return -1; - } - - // return number of 1 bits in x - function cbit(x) { - var r = 0; - while(x != 0) { x &= x-1; ++r; } - return r; - } - - // (public) return number of set bits - function bnBitCount() { - var r = 0, x = this.s&this.DM; - for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); - return r; - } - - // (public) true iff nth bit is set - function bnTestBit(n) { - var j = Math.floor(n/this.DB); - if(j >= this.t) return(this.s!=0); - return((this[j]&(1<<(n%this.DB)))!=0); - } - - // (protected) this op (1<>= this.DB; - } - if(a.t < this.t) { - c += a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c += a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += a.s; - } - r.s = (c<0)?-1:0; - if(c > 0) r[i++] = c; - else if(c < -1) r[i++] = this.DV+c; - r.t = i; - r.clamp(); - } - - // (public) this + a - function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } - - // (public) this - a - function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } - - // (public) this * a - function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } - - // (public) this^2 - function bnSquare() { var r = nbi(); this.squareTo(r); return r; } - - // (public) this / a - function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } - - // (public) this % a - function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } - - // (public) [this/a,this%a] - function bnDivideAndRemainder(a) { - var q = nbi(), r = nbi(); - this.divRemTo(a,q,r); - return new Array(q,r); - } - - // (protected) this *= n, this >= 0, 1 < n < DV - function bnpDMultiply(n) { - this[this.t] = this.am(0,n-1,this,0,0,this.t); - ++this.t; - this.clamp(); - } - - // (protected) this += n << w words, this >= 0 - function bnpDAddOffset(n,w) { - if(n == 0) return; - while(this.t <= w) this[this.t++] = 0; - this[w] += n; - while(this[w] >= this.DV) { - this[w] -= this.DV; - if(++w >= this.t) this[this.t++] = 0; - ++this[w]; - } - } - - // A "null" reducer - function NullExp() {} - function nNop(x) { return x; } - function nMulTo(x,y,r) { x.multiplyTo(y,r); } - function nSqrTo(x,r) { x.squareTo(r); } - - NullExp.prototype.convert = nNop; - NullExp.prototype.revert = nNop; - NullExp.prototype.mulTo = nMulTo; - NullExp.prototype.sqrTo = nSqrTo; - - // (public) this^e - function bnPow(e) { return this.exp(e,new NullExp()); } - - // (protected) r = lower n words of "this * a", a.t <= n - // "this" should be the larger one if appropriate. - function bnpMultiplyLowerTo(a,n,r) { - var i = Math.min(this.t+a.t,n); - r.s = 0; // assumes a,this >= 0 - r.t = i; - while(i > 0) r[--i] = 0; - var j; - for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); - for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); - r.clamp(); - } - - // (protected) r = "this * a" without lower n words, n > 0 - // "this" should be the larger one if appropriate. - function bnpMultiplyUpperTo(a,n,r) { - --n; - var i = r.t = this.t+a.t-n; - r.s = 0; // assumes a,this >= 0 - while(--i >= 0) r[i] = 0; - for(i = Math.max(n-this.t,0); i < a.t; ++i) - r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); - r.clamp(); - r.drShiftTo(1,r); - } - - // Barrett modular reduction - function Barrett(m) { - // setup Barrett - this.r2 = nbi(); - this.q3 = nbi(); - BigInteger.ONE.dlShiftTo(2*m.t,this.r2); - this.mu = this.r2.divide(m); - this.m = m; - } - - function barrettConvert(x) { - if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); - else if(x.compareTo(this.m) < 0) return x; - else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } - } - - function barrettRevert(x) { return x; } - - // x = x mod m (HAC 14.42) - function barrettReduce(x) { - x.drShiftTo(this.m.t-1,this.r2); - if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } - this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); - this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); - while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); - x.subTo(this.r2,x); - while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } - - // r = x^2 mod m; x != r - function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = x*y mod m; x,y != r - function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Barrett.prototype.convert = barrettConvert; - Barrett.prototype.revert = barrettRevert; - Barrett.prototype.reduce = barrettReduce; - Barrett.prototype.mulTo = barrettMulTo; - Barrett.prototype.sqrTo = barrettSqrTo; - - // (public) this^e % m (HAC 14.85) - function bnModPow(e,m) { - var i = e.bitLength(), k, r = nbv(1), z; - if(i <= 0) return r; - else if(i < 18) k = 1; - else if(i < 48) k = 3; - else if(i < 144) k = 4; - else if(i < 768) k = 5; - else k = 6; - if(i < 8) - z = new Classic(m); - else if(m.isEven()) - z = new Barrett(m); - else - z = new Montgomery(m); - - // precomputation - var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { - var g2 = nbi(); - z.sqrTo(g[1],g2); - while(n <= km) { - g[n] = nbi(); - z.mulTo(g2,g[n-2],g[n]); - n += 2; - } - } - - var j = e.t-1, w, is1 = true, r2 = nbi(), t; - i = nbits(e[j])-1; - while(j >= 0) { - if(i >= k1) w = (e[j]>>(i-k1))&km; - else { - w = (e[j]&((1<<(i+1))-1))<<(k1-i); - if(j > 0) w |= e[j-1]>>(this.DB+i-k1); - } - - n = k; - while((w&1) == 0) { w >>= 1; --n; } - if((i -= n) < 0) { i += this.DB; --j; } - if(is1) { // ret == 1, don't bother squaring or multiplying it - g[w].copyTo(r); - is1 = false; - } - else { - while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } - if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } - z.mulTo(r2,g[w],r); - } - - while(j >= 0 && (e[j]&(1< 0) { - x.rShiftTo(g,x); - y.rShiftTo(g,y); - } - while(x.signum() > 0) { - if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); - if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); - if(x.compareTo(y) >= 0) { - x.subTo(y,x); - x.rShiftTo(1,x); - } - else { - y.subTo(x,y); - y.rShiftTo(1,y); - } - } - if(g > 0) y.lShiftTo(g,y); - return y; - } - - // (protected) this % n, n < 2^26 - function bnpModInt(n) { - if(n <= 0) return 0; - var d = this.DV%n, r = (this.s<0)?n-1:0; - if(this.t > 0) - if(d == 0) r = this[0]%n; - else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; - return r; - } - - // (public) 1/this % m (HAC 14.61) - function bnModInverse(m) { - var ac = m.isEven(); - if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; - var u = m.clone(), v = this.clone(); - var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); - while(u.signum() != 0) { - while(u.isEven()) { - u.rShiftTo(1,u); - if(ac) { - if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } - a.rShiftTo(1,a); - } - else if(!b.isEven()) b.subTo(m,b); - b.rShiftTo(1,b); - } - while(v.isEven()) { - v.rShiftTo(1,v); - if(ac) { - if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } - c.rShiftTo(1,c); - } - else if(!d.isEven()) d.subTo(m,d); - d.rShiftTo(1,d); - } - if(u.compareTo(v) >= 0) { - u.subTo(v,u); - if(ac) a.subTo(c,a); - b.subTo(d,b); - } - else { - v.subTo(u,v); - if(ac) c.subTo(a,c); - d.subTo(b,d); - } - } - if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; - if(d.compareTo(m) >= 0) return d.subtract(m); - if(d.signum() < 0) d.addTo(m,d); else return d; - if(d.signum() < 0) return d.add(m); else return d; - } - - var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; - var lplim = (1<<26)/lowprimes[lowprimes.length-1]; - - // (public) test primality with certainty >= 1-.5^t - function bnIsProbablePrime(t) { - var i, x = this.abs(); - if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { - for(i = 0; i < lowprimes.length; ++i) - if(x[0] == lowprimes[i]) return true; - return false; - } - if(x.isEven()) return false; - i = 1; - while(i < lowprimes.length) { - var m = lowprimes[i], j = i+1; - while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; - m = x.modInt(m); - while(i < j) if(m%lowprimes[i++] == 0) return false; - } - return x.millerRabin(t); - } - - // (protected) true if probably prime (HAC 4.24, Miller-Rabin) - function bnpMillerRabin(t) { - var n1 = this.subtract(BigInteger.ONE); - var k = n1.getLowestSetBit(); - if(k <= 0) return false; - var r = n1.shiftRight(k); - t = (t+1)>>1; - if(t > lowprimes.length) t = lowprimes.length; - var a = nbi(); - for(var i = 0; i < t; ++i) { - //Pick bases at random, instead of starting at 2 - a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); - var y = a.modPow(r,this); - if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { - var j = 1; - while(j++ < k && y.compareTo(n1) != 0) { - y = y.modPowInt(2,this); - if(y.compareTo(BigInteger.ONE) == 0) return false; - } - if(y.compareTo(n1) != 0) return false; - } - } - return true; - } - - // protected - BigInteger.prototype.chunkSize = bnpChunkSize; - BigInteger.prototype.toRadix = bnpToRadix; - BigInteger.prototype.fromRadix = bnpFromRadix; - BigInteger.prototype.fromNumber = bnpFromNumber; - BigInteger.prototype.bitwiseTo = bnpBitwiseTo; - BigInteger.prototype.changeBit = bnpChangeBit; - BigInteger.prototype.addTo = bnpAddTo; - BigInteger.prototype.dMultiply = bnpDMultiply; - BigInteger.prototype.dAddOffset = bnpDAddOffset; - BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; - BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; - BigInteger.prototype.modInt = bnpModInt; - BigInteger.prototype.millerRabin = bnpMillerRabin; - - // public - BigInteger.prototype.clone = bnClone; - BigInteger.prototype.intValue = bnIntValue; - BigInteger.prototype.byteValue = bnByteValue; - BigInteger.prototype.shortValue = bnShortValue; - BigInteger.prototype.signum = bnSigNum; - BigInteger.prototype.toByteArray = bnToByteArray; - BigInteger.prototype.equals = bnEquals; - BigInteger.prototype.min = bnMin; - BigInteger.prototype.max = bnMax; - BigInteger.prototype.and = bnAnd; - BigInteger.prototype.or = bnOr; - BigInteger.prototype.xor = bnXor; - BigInteger.prototype.andNot = bnAndNot; - BigInteger.prototype.not = bnNot; - BigInteger.prototype.shiftLeft = bnShiftLeft; - BigInteger.prototype.shiftRight = bnShiftRight; - BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; - BigInteger.prototype.bitCount = bnBitCount; - BigInteger.prototype.testBit = bnTestBit; - BigInteger.prototype.setBit = bnSetBit; - BigInteger.prototype.clearBit = bnClearBit; - BigInteger.prototype.flipBit = bnFlipBit; - BigInteger.prototype.add = bnAdd; - BigInteger.prototype.subtract = bnSubtract; - BigInteger.prototype.multiply = bnMultiply; - BigInteger.prototype.divide = bnDivide; - BigInteger.prototype.remainder = bnRemainder; - BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; - BigInteger.prototype.modPow = bnModPow; - BigInteger.prototype.modInverse = bnModInverse; - BigInteger.prototype.pow = bnPow; - BigInteger.prototype.gcd = bnGCD; - BigInteger.prototype.isProbablePrime = bnIsProbablePrime; - - // JSBN-specific extension - BigInteger.prototype.square = bnSquare; - - // Expose the Barrett function - BigInteger.prototype.Barrett = Barrett - - // BigInteger interfaces not implemented in jsbn: - - // BigInteger(int signum, byte[] magnitude) - // double doubleValue() - // float floatValue() - // int hashCode() - // long longValue() - // static BigInteger valueOf(long val) - - // Random number generator - requires a PRNG backend, e.g. prng4.js - - // For best results, put code like - // - // in your main HTML document. - - var rng_state; - var rng_pool; - var rng_pptr; - - // Mix in a 32-bit integer into the pool - function rng_seed_int(x) { - rng_pool[rng_pptr++] ^= x & 255; - rng_pool[rng_pptr++] ^= (x >> 8) & 255; - rng_pool[rng_pptr++] ^= (x >> 16) & 255; - rng_pool[rng_pptr++] ^= (x >> 24) & 255; - if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; - } - - // Mix in the current time (w/milliseconds) into the pool - function rng_seed_time() { - rng_seed_int(new Date().getTime()); - } - - // Initialize the pool with junk if needed. - if(rng_pool == null) { - rng_pool = new Array(); - rng_pptr = 0; - var t; - if(typeof window !== "undefined" && window.crypto) { - if (window.crypto.getRandomValues) { - // Use webcrypto if available - var ua = new Uint8Array(32); - window.crypto.getRandomValues(ua); - for(t = 0; t < 32; ++t) - rng_pool[rng_pptr++] = ua[t]; - } - else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { - // Extract entropy (256 bits) from NS4 RNG if available - var z = window.crypto.random(32); - for(t = 0; t < z.length; ++t) - rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; - } - } - while(rng_pptr < rng_psize) { // extract some randomness from Math.random() - t = Math.floor(65536 * Math.random()); - rng_pool[rng_pptr++] = t >>> 8; - rng_pool[rng_pptr++] = t & 255; - } - rng_pptr = 0; - rng_seed_time(); - //rng_seed_int(window.screenX); - //rng_seed_int(window.screenY); - } - - function rng_get_byte() { - if(rng_state == null) { - rng_seed_time(); - rng_state = prng_newstate(); - rng_state.init(rng_pool); - for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) - rng_pool[rng_pptr] = 0; - rng_pptr = 0; - //rng_pool = null; - } - // TODO: allow reseeding after first request - return rng_state.next(); - } - - function rng_get_bytes(ba) { - var i; - for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); - } - - function SecureRandom() {} - - SecureRandom.prototype.nextBytes = rng_get_bytes; - - // prng4.js - uses Arcfour as a PRNG - - function Arcfour() { - this.i = 0; - this.j = 0; - this.S = new Array(); - } - - // Initialize arcfour context from key, an array of ints, each from [0..255] - function ARC4init(key) { - var i, j, t; - for(i = 0; i < 256; ++i) - this.S[i] = i; - j = 0; - for(i = 0; i < 256; ++i) { - j = (j + this.S[i] + key[i % key.length]) & 255; - t = this.S[i]; - this.S[i] = this.S[j]; - this.S[j] = t; - } - this.i = 0; - this.j = 0; - } - - function ARC4next() { - var t; - this.i = (this.i + 1) & 255; - this.j = (this.j + this.S[this.i]) & 255; - t = this.S[this.i]; - this.S[this.i] = this.S[this.j]; - this.S[this.j] = t; - return this.S[(t + this.S[this.i]) & 255]; - } - - Arcfour.prototype.init = ARC4init; - Arcfour.prototype.next = ARC4next; - - // Plug in your RNG constructor here - function prng_newstate() { - return new Arcfour(); - } - - // Pool size must be a multiple of 4 and greater than 32. - // An array of bytes the size of the pool will be passed to init() - var rng_psize = 256; - - BigInteger.SecureRandom = SecureRandom; - BigInteger.BigInteger = BigInteger; - if (true) { - exports = module.exports = BigInteger; - } else { - this.BigInteger = BigInteger; - this.SecureRandom = SecureRandom; - } - -}).call(this); - - -/***/ }), -/* 28 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - write: write -}; - -var assert = __webpack_require__(2); -var asn1 = __webpack_require__(24); -var crypto = __webpack_require__(4); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var utils = __webpack_require__(6); -var Key = __webpack_require__(7); -var PrivateKey = __webpack_require__(9); - -var pkcs1 = __webpack_require__(82); -var pkcs8 = __webpack_require__(43); -var sshpriv = __webpack_require__(57); -var rfc4253 = __webpack_require__(30); - -var errors = __webpack_require__(21); - -/* - * For reading we support both PKCS#1 and PKCS#8. If we find a private key, - * we just take the public component of it and use that. - */ -function read(buf, options, forceType) { - var input = buf; - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } - - var lines = buf.trim().split('\n'); - - var m = lines[0].match(/*JSSTYLED*/ - /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - assert.ok(m, 'invalid PEM header'); - - var m2 = lines[lines.length - 1].match(/*JSSTYLED*/ - /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - assert.ok(m2, 'invalid PEM footer'); - - /* Begin and end banners must match key type */ - assert.equal(m[2], m2[2]); - var type = m[2].toLowerCase(); - - var alg; - if (m[1]) { - /* They also must match algorithms, if given */ - assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); - alg = m[1].trim(); - } - - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; - } - - var cipher, key, iv; - if (headers['proc-type']) { - var parts = headers['proc-type'].split(','); - if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } else { - parts = headers['dek-info'].split(','); - assert.ok(parts.length === 2); - cipher = parts[0].toLowerCase(); - iv = Buffer.from(parts[1], 'hex'); - key = utils.opensslKeyDeriv(cipher, iv, - options.passphrase, 1).key; - } - } - } - - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); - - if (cipher && key && iv) { - var cipherStream = crypto.createDecipheriv(cipher, key, iv); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(buf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - buf = Buffer.concat(chunks); - } - - /* The new OpenSSH internal format abuses PEM headers */ - if (alg && alg.toLowerCase() === 'openssh') - return (sshpriv.readSSHPrivate(type, buf, options)); - if (alg && alg.toLowerCase() === 'ssh2') - return (rfc4253.readType(type, buf, options)); - - var der = new asn1.BerReader(buf); - der.originalInput = input; - - /* - * All of the PEM file types start with a sequence tag, so chop it - * off here - */ - der.readSequence(); - - /* PKCS#1 type keys name an algorithm in the banner explicitly */ - if (alg) { - if (forceType) - assert.strictEqual(forceType, 'pkcs1'); - return (pkcs1.readPkcs1(alg, type, der)); - } else { - if (forceType) - assert.strictEqual(forceType, 'pkcs8'); - return (pkcs8.readPkcs8(alg, type, der)); - } -} - -function write(key, options, type) { - assert.object(key); - - var alg = { - 'ecdsa': 'EC', - 'rsa': 'RSA', - 'dsa': 'DSA', - 'ed25519': 'EdDSA' - }[key.type]; - var header; - - var der = new asn1.BerWriter(); - - if (PrivateKey.isPrivateKey(key)) { - if (type && type === 'pkcs8') { - header = 'PRIVATE KEY'; - pkcs8.writePkcs8(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs1'); - header = alg + ' PRIVATE KEY'; - pkcs1.writePkcs1(der, key); - } - - } else if (Key.isKey(key)) { - if (type && type === 'pkcs1') { - header = alg + ' PUBLIC KEY'; - pkcs1.writePkcs1(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs8'); - header = 'PUBLIC KEY'; - pkcs8.writePkcs8(der, key); - } - - } else { - throw (new Error('key is not a Key or PrivateKey')); - } - - var tmp = der.buffer.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); - - return (buf.slice(0, o)); -} - - -/***/ }), -/* 29 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -function __export(m) { - for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; -} -Object.defineProperty(exports, "__esModule", { value: true }); -__export(__webpack_require__(208)); -__export(__webpack_require__(213)); -__export(__webpack_require__(215)); - - -/***/ }), -/* 30 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read.bind(undefined, false, undefined), - readType: read.bind(undefined, false), - write: write, - /* semi-private api, used by sshpk-agent */ - readPartial: read.bind(undefined, true), - - /* shared with ssh format */ - readInternal: read, - keyTypeToAlg: keyTypeToAlg, - algToKeyType: algToKeyType -}; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var utils = __webpack_require__(6); -var Key = __webpack_require__(7); -var PrivateKey = __webpack_require__(9); -var SSHBuffer = __webpack_require__(44); - -function algToKeyType(alg) { - assert.string(alg); - if (alg === 'ssh-dss') - return ('dsa'); - else if (alg === 'ssh-rsa') - return ('rsa'); - else if (alg === 'ssh-ed25519') - return ('ed25519'); - else if (alg === 'ssh-curve25519') - return ('curve25519'); - else if (alg.match(/^ecdsa-sha2-/)) - return ('ecdsa'); - else - throw (new Error('Unknown algorithm ' + alg)); -} - -function keyTypeToAlg(key) { - assert.object(key); - if (key.type === 'dsa') - return ('ssh-dss'); - else if (key.type === 'rsa') - return ('ssh-rsa'); - else if (key.type === 'ed25519') - return ('ssh-ed25519'); - else if (key.type === 'curve25519') - return ('ssh-curve25519'); - else if (key.type === 'ecdsa') - return ('ecdsa-sha2-' + key.part.curve.data.toString()); - else - throw (new Error('Unknown key type ' + key.type)); -} - -function read(partial, type, buf, options) { - if (typeof (buf) === 'string') - buf = Buffer.from(buf); - assert.buffer(buf, 'buf'); - - var key = {}; - - var parts = key.parts = []; - var sshbuf = new SSHBuffer({buffer: buf}); - - var alg = sshbuf.readString(); - assert.ok(!sshbuf.atEnd(), 'key must have at least one part'); - - key.type = algToKeyType(alg); - - var partCount = algs.info[key.type].parts.length; - if (type && type === 'private') - partCount = algs.privInfo[key.type].parts.length; - - while (!sshbuf.atEnd() && parts.length < partCount) - parts.push(sshbuf.readPart()); - while (!partial && !sshbuf.atEnd()) - parts.push(sshbuf.readPart()); - - assert.ok(parts.length >= 1, - 'key must have at least one part'); - assert.ok(partial || sshbuf.atEnd(), - 'leftover bytes at end of key'); - - var Constructor = Key; - var algInfo = algs.info[key.type]; - if (type === 'private' || algInfo.parts.length !== parts.length) { - algInfo = algs.privInfo[key.type]; - Constructor = PrivateKey; - } - assert.strictEqual(algInfo.parts.length, parts.length); - - if (key.type === 'ecdsa') { - var res = /^ecdsa-sha2-(.+)$/.exec(alg); - assert.ok(res !== null); - assert.strictEqual(res[1], parts[0].data.toString()); - } - - var normalized = true; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = parts[i]; - p.name = algInfo.parts[i]; - /* - * OpenSSH stores ed25519 "private" keys as seed + public key - * concat'd together (k followed by A). We want to keep them - * separate for other formats that don't do this. - */ - if (key.type === 'ed25519' && p.name === 'k') - p.data = p.data.slice(0, 32); - - if (p.name !== 'curve' && algInfo.normalize !== false) { - var nd; - if (key.type === 'ed25519') { - nd = utils.zeroPadToLength(p.data, 32); - } else { - nd = utils.mpNormalize(p.data); - } - if (nd.toString('binary') !== - p.data.toString('binary')) { - p.data = nd; - normalized = false; - } - } - } - - if (normalized) - key._rfc4253Cache = sshbuf.toBuffer(); - - if (partial && typeof (partial) === 'object') { - partial.remainder = sshbuf.remainder(); - partial.consumed = sshbuf._offset; - } - - return (new Constructor(key)); -} - -function write(key, options) { - assert.object(key); - - var alg = keyTypeToAlg(key); - var i; - - var algInfo = algs.info[key.type]; - if (PrivateKey.isPrivateKey(key)) - algInfo = algs.privInfo[key.type]; - var parts = algInfo.parts; - - var buf = new SSHBuffer({}); - - buf.writeString(alg); - - for (i = 0; i < parts.length; ++i) { - var data = key.part[parts[i]].data; - if (algInfo.normalize !== false) { - if (key.type === 'ed25519') - data = utils.zeroPadToLength(data, 32); - else - data = utils.mpNormalize(data); - } - if (key.type === 'ed25519' && parts[i] === 'k') - data = Buffer.concat([data, key.part.A.data]); - buf.writeBuffer(data); - } - - return (buf.toBuffer()); -} - - -/***/ }), -/* 31 */ -/***/ (function(module, exports, __webpack_require__) { - -try { - var util = __webpack_require__(1); - if (typeof util.inherits !== 'function') throw ''; - module.exports = util.inherits; -} catch (e) { - module.exports = __webpack_require__(353); -} - - -/***/ }), -/* 32 */ -/***/ (function(module, exports) { - -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// NOTE: These type checking functions intentionally don't use `instanceof` -// because it is fragile and can be easily faked with `Object.create()`. - -function isArray(arg) { - if (Array.isArray) { - return Array.isArray(arg); - } - return objectToString(arg) === '[object Array]'; -} -exports.isArray = isArray; - -function isBoolean(arg) { - return typeof arg === 'boolean'; -} -exports.isBoolean = isBoolean; - -function isNull(arg) { - return arg === null; -} -exports.isNull = isNull; - -function isNullOrUndefined(arg) { - return arg == null; -} -exports.isNullOrUndefined = isNullOrUndefined; - -function isNumber(arg) { - return typeof arg === 'number'; -} -exports.isNumber = isNumber; - -function isString(arg) { - return typeof arg === 'string'; -} -exports.isString = isString; - -function isSymbol(arg) { - return typeof arg === 'symbol'; -} -exports.isSymbol = isSymbol; - -function isUndefined(arg) { - return arg === void 0; -} -exports.isUndefined = isUndefined; - -function isRegExp(re) { - return objectToString(re) === '[object RegExp]'; -} -exports.isRegExp = isRegExp; - -function isObject(arg) { - return typeof arg === 'object' && arg !== null; -} -exports.isObject = isObject; - -function isDate(d) { - return objectToString(d) === '[object Date]'; -} -exports.isDate = isDate; - -function isError(e) { - return (objectToString(e) === '[object Error]' || e instanceof Error); -} -exports.isError = isError; - -function isFunction(arg) { - return typeof arg === 'function'; -} -exports.isFunction = isFunction; - -function isPrimitive(arg) { - return arg === null || - typeof arg === 'boolean' || - typeof arg === 'number' || - typeof arg === 'string' || - typeof arg === 'symbol' || // ES6 symbol - typeof arg === 'undefined'; -} -exports.isPrimitive = isPrimitive; - -exports.isBuffer = Buffer.isBuffer; - -function objectToString(o) { - return Object.prototype.toString.call(o); -} - - -/***/ }), -/* 33 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// a duplex stream is just a stream that is both readable and writable. -// Since JS doesn't have multiple prototypal inheritance, this class -// prototypally inherits from Readable, and then parasitically from -// Writable. - - - -/**/ - -var pna = __webpack_require__(53); -/**/ - -/**/ -var objectKeys = Object.keys || function (obj) { - var keys = []; - for (var key in obj) { - keys.push(key); - }return keys; -}; -/**/ - -module.exports = Duplex; - -/**/ -var util = __webpack_require__(32); -util.inherits = __webpack_require__(31); -/**/ - -var Readable = __webpack_require__(136); -var Writable = __webpack_require__(139); - -util.inherits(Duplex, Readable); - -{ - // avoid scope creep, the keys array can then be collected - var keys = objectKeys(Writable.prototype); - for (var v = 0; v < keys.length; v++) { - var method = keys[v]; - if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method]; - } -} - -function Duplex(options) { - if (!(this instanceof Duplex)) return new Duplex(options); - - Readable.call(this, options); - Writable.call(this, options); - - if (options && options.readable === false) this.readable = false; - - if (options && options.writable === false) this.writable = false; - - this.allowHalfOpen = true; - if (options && options.allowHalfOpen === false) this.allowHalfOpen = false; - - this.once('end', onend); -} - -Object.defineProperty(Duplex.prototype, 'writableHighWaterMark', { - // making it explicit this property is not enumerable - // because otherwise some prototype manipulation in - // userland will fail - enumerable: false, - get: function () { - return this._writableState.highWaterMark; - } -}); - -// the no-half-open enforcer -function onend() { - // if we allow half-open state, or if the writable side ended, - // then we're ok. - if (this.allowHalfOpen || this._writableState.ended) return; - - // no more data can be written. - // But allow more writes to happen in this tick. - pna.nextTick(onEndNT, this); -} - -function onEndNT(self) { - self.end(); -} - -Object.defineProperty(Duplex.prototype, 'destroyed', { - get: function () { - if (this._readableState === undefined || this._writableState === undefined) { - return false; - } - return this._readableState.destroyed && this._writableState.destroyed; - }, - set: function (value) { - // we ignore the value if the stream - // has not been initialized yet - if (this._readableState === undefined || this._writableState === undefined) { - return; - } - - // backward compatibility, the user is explicitly - // managing destroyed - this._readableState.destroyed = value; - this._writableState.destroyed = value; - } -}); - -Duplex.prototype._destroy = function (err, cb) { - this.push(null); - this.end(); - - pna.nextTick(cb, err); -}; - -/***/ }), -/* 34 */ -/***/ (function(module, exports) { - -var isES5 = (function(){ - "use strict"; - return this === undefined; -})(); - -if (isES5) { - module.exports = { - freeze: Object.freeze, - defineProperty: Object.defineProperty, - getDescriptor: Object.getOwnPropertyDescriptor, - keys: Object.keys, - names: Object.getOwnPropertyNames, - getPrototypeOf: Object.getPrototypeOf, - isArray: Array.isArray, - isES5: isES5, - propertyIsWritable: function(obj, prop) { - var descriptor = Object.getOwnPropertyDescriptor(obj, prop); - return !!(!descriptor || descriptor.writable || descriptor.set); - } - }; -} else { - var has = {}.hasOwnProperty; - var str = {}.toString; - var proto = {}.constructor.prototype; - - var ObjectKeys = function (o) { - var ret = []; - for (var key in o) { - if (has.call(o, key)) { - ret.push(key); - } - } - return ret; - }; - - var ObjectGetDescriptor = function(o, key) { - return {value: o[key]}; - }; - - var ObjectDefineProperty = function (o, key, desc) { - o[key] = desc.value; - return o; - }; - - var ObjectFreeze = function (obj) { - return obj; - }; - - var ObjectGetPrototypeOf = function (obj) { - try { - return Object(obj).constructor.prototype; - } - catch (e) { - return proto; - } - }; - - var ArrayIsArray = function (obj) { - try { - return str.call(obj) === "[object Array]"; - } - catch(e) { - return false; - } - }; - - module.exports = { - isArray: ArrayIsArray, - keys: ObjectKeys, - names: ObjectKeys, - defineProperty: ObjectDefineProperty, - getDescriptor: ObjectGetDescriptor, - freeze: ObjectFreeze, - getPrototypeOf: ObjectGetPrototypeOf, - isES5: isES5, - propertyIsWritable: function() { - return true; - } - }; -} - - -/***/ }), -/* 35 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - - -module.exports = { - copy: copy, - checkDataType: checkDataType, - checkDataTypes: checkDataTypes, - coerceToTypes: coerceToTypes, - toHash: toHash, - getProperty: getProperty, - escapeQuotes: escapeQuotes, - equal: __webpack_require__(86), - ucs2length: __webpack_require__(487), - varOccurences: varOccurences, - varReplace: varReplace, - cleanUpCode: cleanUpCode, - finalCleanUpCode: finalCleanUpCode, - schemaHasRules: schemaHasRules, - schemaHasRulesExcept: schemaHasRulesExcept, - toQuotedString: toQuotedString, - getPathExpr: getPathExpr, - getPath: getPath, - getData: getData, - unescapeFragment: unescapeFragment, - unescapeJsonPointer: unescapeJsonPointer, - escapeFragment: escapeFragment, - escapeJsonPointer: escapeJsonPointer -}; - - -function copy(o, to) { - to = to || {}; - for (var key in o) to[key] = o[key]; - return to; -} - - -function checkDataType(dataType, data, negate) { - var EQUAL = negate ? ' !== ' : ' === ' - , AND = negate ? ' || ' : ' && ' - , OK = negate ? '!' : '' - , NOT = negate ? '' : '!'; - switch (dataType) { - case 'null': return data + EQUAL + 'null'; - case 'array': return OK + 'Array.isArray(' + data + ')'; - case 'object': return '(' + OK + data + AND + - 'typeof ' + data + EQUAL + '"object"' + AND + - NOT + 'Array.isArray(' + data + '))'; - case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + - NOT + '(' + data + ' % 1)' + - AND + data + EQUAL + data + ')'; - default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; - } -} - - -function checkDataTypes(dataTypes, data) { - switch (dataTypes.length) { - case 1: return checkDataType(dataTypes[0], data, true); - default: - var code = ''; - var types = toHash(dataTypes); - if (types.array && types.object) { - code = types.null ? '(': '(!' + data + ' || '; - code += 'typeof ' + data + ' !== "object")'; - delete types.null; - delete types.array; - delete types.object; - } - if (types.number) delete types.integer; - for (var t in types) - code += (code ? ' && ' : '' ) + checkDataType(t, data, true); - - return code; - } -} - - -var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); -function coerceToTypes(optionCoerceTypes, dataTypes) { - if (Array.isArray(dataTypes)) { - var types = []; - for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); - return paths[lvl - up]; - } - - if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); - data = 'data' + ((lvl - up) || ''); - if (!jsonPointer) return data; - } - - var expr = data; - var segments = jsonPointer.split('/'); - for (var i=0; i 2) { - alg = 'md5'; - if (parts[0].toLowerCase() === 'md5') - parts = parts.slice(1); - parts = parts.join(''); - /*JSSTYLED*/ - var md5RE = /^[a-fA-F0-9]+$/; - if (!md5RE.test(parts)) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts, 'hex'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } - - if (alg === undefined) - throw (new FingerprintFormatError(fp)); - - if (algs.hashAlgs[alg] === undefined) - throw (new InvalidAlgorithmError(alg)); - - if (enAlgs !== undefined) { - enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); - if (enAlgs.indexOf(alg) === -1) - throw (new InvalidAlgorithmError(alg)); - } - - return (new Fingerprint({ - algorithm: alg, - hash: hash, - type: options.type || 'key' - })); -}; - -function addColons(s) { - /*JSSTYLED*/ - return (s.replace(/(.{2})(?=.)/g, '$1:')); -} - -function base64Strip(s) { - /*JSSTYLED*/ - return (s.replace(/=*$/, '')); -} - -function sshBase64Format(alg, h) { - return (alg.toUpperCase() + ':' + base64Strip(h)); -} - -Fingerprint.isFingerprint = function (obj, ver) { - return (utils.isCompatible(obj, Fingerprint, ver)); -}; - -/* - * API versions for Fingerprint: - * [1,0] -- initial ver - * [1,1] -- first tagged ver - */ -Fingerprint.prototype._sshpkApiVersion = [1, 1]; - -Fingerprint._oldVersionDetect = function (obj) { - assert.func(obj.toString); - assert.func(obj.matches); - return ([1, 0]); -}; - - -/***/ }), -/* 41 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2016 Joyent, Inc. - -module.exports = Certificate; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var crypto = __webpack_require__(4); -var Fingerprint = __webpack_require__(40); -var Signature = __webpack_require__(22); -var errs = __webpack_require__(21); -var util = __webpack_require__(1); -var utils = __webpack_require__(6); -var Key = __webpack_require__(7); -var PrivateKey = __webpack_require__(9); -var Identity = __webpack_require__(45); - -var formats = {}; -formats['openssh'] = __webpack_require__(460); -formats['x509'] = __webpack_require__(172); -formats['pem'] = __webpack_require__(461); - -var CertificateParseError = errs.CertificateParseError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; - -function Certificate(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.subjects, 'options.subjects'); - utils.assertCompatible(opts.subjects[0], Identity, [1, 0], - 'options.subjects'); - utils.assertCompatible(opts.subjectKey, Key, [1, 0], - 'options.subjectKey'); - utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); - if (opts.issuerKey !== undefined) { - utils.assertCompatible(opts.issuerKey, Key, [1, 0], - 'options.issuerKey'); - } - assert.object(opts.signatures, 'options.signatures'); - assert.buffer(opts.serial, 'options.serial'); - assert.date(opts.validFrom, 'options.validFrom'); - assert.date(opts.validUntil, 'optons.validUntil'); - - assert.optionalArrayOfString(opts.purposes, 'options.purposes'); - - this._hashCache = {}; - - this.subjects = opts.subjects; - this.issuer = opts.issuer; - this.subjectKey = opts.subjectKey; - this.issuerKey = opts.issuerKey; - this.signatures = opts.signatures; - this.serial = opts.serial; - this.validFrom = opts.validFrom; - this.validUntil = opts.validUntil; - this.purposes = opts.purposes; -} - -Certificate.formats = formats; - -Certificate.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'x509'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -Certificate.prototype.toString = function (format, options) { - if (format === undefined) - format = 'pem'; - return (this.toBuffer(format, options).toString()); -}; - -Certificate.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'certificate', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; - -Certificate.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - if (this._hashCache[algo]) - return (this._hashCache[algo]); - - var hash = crypto.createHash(algo). - update(this.toBuffer('x509')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; - -Certificate.prototype.isExpired = function (when) { - if (when === undefined) - when = new Date(); - return (!((when.getTime() >= this.validFrom.getTime()) && - (when.getTime() < this.validUntil.getTime()))); -}; - -Certificate.prototype.isSignedBy = function (issuerCert) { - utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); - - if (!this.issuer.equals(issuerCert.subjects[0])) - return (false); - if (this.issuer.purposes && this.issuer.purposes.length > 0 && - this.issuer.purposes.indexOf('ca') === -1) { - return (false); - } - - return (this.isSignedByKey(issuerCert.subjectKey)); -}; - -Certificate.prototype.isSignedByKey = function (issuerKey) { - utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); - - if (this.issuerKey !== undefined) { - return (this.issuerKey. - fingerprint('sha512').matches(issuerKey)); - } - - var fmt = Object.keys(this.signatures)[0]; - var valid = formats[fmt].verify(this, issuerKey); - if (valid) - this.issuerKey = issuerKey; - return (valid); -}; - -Certificate.prototype.signWith = function (key) { - utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); - var fmts = Object.keys(formats); - var didOne = false; - for (var i = 0; i < fmts.length; ++i) { - if (fmts[i] !== 'pem') { - var ret = formats[fmts[i]].sign(this, key); - if (ret === true) - didOne = true; - } - } - if (!didOne) { - throw (new Error('Failed to sign the certificate for any ' + - 'available certificate formats')); - } -}; - -Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; - - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); - - utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); - - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); - - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; - - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); - - /* Self-signed certs are always CAs. */ - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); - - /* - * If we weren't explicitly given any other purposes, do the sensible - * thing and add some basic ones depending on the subject type. - */ - if (purposes.length <= 3) { - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } - } - - var cert = new Certificate({ - subjects: subjects, - issuer: subjects[0], - subjectKey: key.toPublic(), - issuerKey: key.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(key); - - return (cert); -}; - -Certificate.create = - function (subjectOrSubjects, key, issuer, issuerKey, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; - - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); - - utils.assertCompatible(key, Key, [1, 0], 'key'); - if (PrivateKey.isPrivateKey(key)) - key = key.toPublic(); - utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); - utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); - - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); - - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; - - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); - - if (options.ca === true) { - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); - } - - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } - - var cert = new Certificate({ - subjects: subjects, - issuer: issuer, - subjectKey: key, - issuerKey: issuerKey.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(issuerKey); - - return (cert); -}; - -Certificate.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - return (k); - } catch (e) { - throw (new CertificateParseError(options.filename, format, e)); - } -}; - -Certificate.isCertificate = function (obj, ver) { - return (utils.isCompatible(obj, Certificate, ver)); -}; - -/* - * API versions for Certificate: - * [1,0] -- initial ver - */ -Certificate.prototype._sshpkApiVersion = [1, 0]; - -Certificate._oldVersionDetect = function (obj) { - return ([1, 0]); -}; - - -/***/ }), -/* 42 */ -/***/ (function(module, exports, __webpack_require__) { - -// Basic Javascript Elliptic Curve implementation -// Ported loosely from BouncyCastle's Java EC code -// Only Fp curves implemented for now - -// Requires jsbn.js and jsbn2.js -var BigInteger = __webpack_require__(27).BigInteger -var Barrett = BigInteger.prototype.Barrett - -// ---------------- -// ECFieldElementFp - -// constructor -function ECFieldElementFp(q,x) { - this.x = x; - // TODO if(x.compareTo(q) >= 0) error - this.q = q; -} - -function feFpEquals(other) { - if(other == this) return true; - return (this.q.equals(other.q) && this.x.equals(other.x)); -} - -function feFpToBigInteger() { - return this.x; -} - -function feFpNegate() { - return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); -} - -function feFpAdd(b) { - return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); -} - -function feFpSubtract(b) { - return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); -} - -function feFpMultiply(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); -} - -function feFpSquare() { - return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); -} - -function feFpDivide(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); -} - -ECFieldElementFp.prototype.equals = feFpEquals; -ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; -ECFieldElementFp.prototype.negate = feFpNegate; -ECFieldElementFp.prototype.add = feFpAdd; -ECFieldElementFp.prototype.subtract = feFpSubtract; -ECFieldElementFp.prototype.multiply = feFpMultiply; -ECFieldElementFp.prototype.square = feFpSquare; -ECFieldElementFp.prototype.divide = feFpDivide; - -// ---------------- -// ECPointFp - -// constructor -function ECPointFp(curve,x,y,z) { - this.curve = curve; - this.x = x; - this.y = y; - // Projective coordinates: either zinv == null or z * zinv == 1 - // z and zinv are just BigIntegers, not fieldElements - if(z == null) { - this.z = BigInteger.ONE; - } - else { - this.z = z; - } - this.zinv = null; - //TODO: compression flag -} - -function pointFpGetX() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.x.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} - -function pointFpGetY() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.y.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} - -function pointFpEquals(other) { - if(other == this) return true; - if(this.isInfinity()) return other.isInfinity(); - if(other.isInfinity()) return this.isInfinity(); - var u, v; - // u = Y2 * Z1 - Y1 * Z2 - u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); - if(!u.equals(BigInteger.ZERO)) return false; - // v = X2 * Z1 - X1 * Z2 - v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); - return v.equals(BigInteger.ZERO); -} - -function pointFpIsInfinity() { - if((this.x == null) && (this.y == null)) return true; - return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); -} - -function pointFpNegate() { - return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); -} - -function pointFpAdd(b) { - if(this.isInfinity()) return b; - if(b.isInfinity()) return this; - - // u = Y2 * Z1 - Y1 * Z2 - var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); - // v = X2 * Z1 - X1 * Z2 - var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); - - if(BigInteger.ZERO.equals(v)) { - if(BigInteger.ZERO.equals(u)) { - return this.twice(); // this == b, so double - } - return this.curve.getInfinity(); // this = -b, so infinity - } - - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); - var x2 = b.x.toBigInteger(); - var y2 = b.y.toBigInteger(); - - var v2 = v.square(); - var v3 = v2.multiply(v); - var x1v2 = x1.multiply(v2); - var zu2 = u.square().multiply(this.z); - - // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) - var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); - // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 - var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); - // z3 = v^3 * z1 * z2 - var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); - - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); -} - -function pointFpTwice() { - if(this.isInfinity()) return this; - if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); - - // TODO: optimized handling of constants - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); - - var y1z1 = y1.multiply(this.z); - var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); - var a = this.curve.a.toBigInteger(); - - // w = 3 * x1^2 + a * z1^2 - var w = x1.square().multiply(THREE); - if(!BigInteger.ZERO.equals(a)) { - w = w.add(this.z.square().multiply(a)); - } - w = w.mod(this.curve.q); - //this.curve.reduce(w); - // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) - var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); - // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 - var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); - // z3 = 8 * (y1 * z1)^3 - var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); - - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); -} - -// Simple NAF (Non-Adjacent Form) multiplication algorithm -// TODO: modularize the multiplication algorithm -function pointFpMultiply(k) { - if(this.isInfinity()) return this; - if(k.signum() == 0) return this.curve.getInfinity(); - - var e = k; - var h = e.multiply(new BigInteger("3")); - - var neg = this.negate(); - var R = this; - - var i; - for(i = h.bitLength() - 2; i > 0; --i) { - R = R.twice(); - - var hBit = h.testBit(i); - var eBit = e.testBit(i); - - if (hBit != eBit) { - R = R.add(hBit ? this : neg); - } - } - - return R; -} - -// Compute this*j + x*k (simultaneous multiplication) -function pointFpMultiplyTwo(j,x,k) { - var i; - if(j.bitLength() > k.bitLength()) - i = j.bitLength() - 1; - else - i = k.bitLength() - 1; - - var R = this.curve.getInfinity(); - var both = this.add(x); - while(i >= 0) { - R = R.twice(); - if(j.testBit(i)) { - if(k.testBit(i)) { - R = R.add(both); - } - else { - R = R.add(this); - } - } - else { - if(k.testBit(i)) { - R = R.add(x); - } - } - --i; - } - - return R; -} - -ECPointFp.prototype.getX = pointFpGetX; -ECPointFp.prototype.getY = pointFpGetY; -ECPointFp.prototype.equals = pointFpEquals; -ECPointFp.prototype.isInfinity = pointFpIsInfinity; -ECPointFp.prototype.negate = pointFpNegate; -ECPointFp.prototype.add = pointFpAdd; -ECPointFp.prototype.twice = pointFpTwice; -ECPointFp.prototype.multiply = pointFpMultiply; -ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; - -// ---------------- -// ECCurveFp - -// constructor -function ECCurveFp(q,a,b) { - this.q = q; - this.a = this.fromBigInteger(a); - this.b = this.fromBigInteger(b); - this.infinity = new ECPointFp(this, null, null); - this.reducer = new Barrett(this.q); -} - -function curveFpGetQ() { - return this.q; -} - -function curveFpGetA() { - return this.a; -} - -function curveFpGetB() { - return this.b; -} - -function curveFpEquals(other) { - if(other == this) return true; - return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); -} - -function curveFpGetInfinity() { - return this.infinity; -} - -function curveFpFromBigInteger(x) { - return new ECFieldElementFp(this.q, x); -} - -function curveReduce(x) { - this.reducer.reduce(x); -} - -// for now, work with hex strings because they're easier in JS -function curveFpDecodePointHex(s) { - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - case 3: - // point compression not supported yet - return null; - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); - - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); - - default: // unsupported - return null; - } -} - -function curveFpEncodePointHex(p) { - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var yHex = p.getY().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) { - xHex = "0" + xHex; - } - while (yHex.length < oLen) { - yHex = "0" + yHex; - } - return "04" + xHex + yHex; -} - -ECCurveFp.prototype.getQ = curveFpGetQ; -ECCurveFp.prototype.getA = curveFpGetA; -ECCurveFp.prototype.getB = curveFpGetB; -ECCurveFp.prototype.equals = curveFpEquals; -ECCurveFp.prototype.getInfinity = curveFpGetInfinity; -ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; -ECCurveFp.prototype.reduce = curveReduce; -//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; -ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; - -// from: https://github.com/kaielvin/jsbn-ec-point-compression -ECCurveFp.prototype.decodePointHex = function(s) -{ - var yIsEven; - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - yIsEven = false; - case 3: - if(yIsEven == undefined) yIsEven = true; - var len = s.length - 2; - var xHex = s.substr(2, len); - var x = this.fromBigInteger(new BigInteger(xHex,16)); - var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); - var beta = alpha.sqrt(); - - if (beta == null) throw "Invalid point compression"; - - var betaValue = beta.toBigInteger(); - if (betaValue.testBit(0) != yIsEven) - { - // Use the other root - beta = this.fromBigInteger(this.getQ().subtract(betaValue)); - } - return new ECPointFp(this,x,beta); - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); - - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); - - default: // unsupported - return null; - } -} -ECCurveFp.prototype.encodeCompressedPointHex = function(p) -{ - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) - xHex = "0" + xHex; - var yPrefix; - if(p.getY().toBigInteger().isEven()) yPrefix = "02"; - else yPrefix = "03"; - - return yPrefix + xHex; -} - - -ECFieldElementFp.prototype.getR = function() -{ - if(this.r != undefined) return this.r; - - this.r = null; - var bitLength = this.q.bitLength(); - if (bitLength > 128) - { - var firstWord = this.q.shiftRight(bitLength - 64); - if (firstWord.intValue() == -1) - { - this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); - } - } - return this.r; -} -ECFieldElementFp.prototype.modMult = function(x1,x2) -{ - return this.modReduce(x1.multiply(x2)); -} -ECFieldElementFp.prototype.modReduce = function(x) -{ - if (this.getR() != null) - { - var qLen = q.bitLength(); - while (x.bitLength() > (qLen + 1)) - { - var u = x.shiftRight(qLen); - var v = x.subtract(u.shiftLeft(qLen)); - if (!this.getR().equals(BigInteger.ONE)) - { - u = u.multiply(this.getR()); - } - x = u.add(v); - } - while (x.compareTo(q) >= 0) - { - x = x.subtract(q); - } - } - else - { - x = x.mod(q); - } - return x; -} -ECFieldElementFp.prototype.sqrt = function() -{ - if (!this.q.testBit(0)) throw "unsupported"; - - // p mod 4 == 3 - if (this.q.testBit(1)) - { - var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); - return z.square().equals(this) ? z : null; - } - - // p mod 4 == 1 - var qMinusOne = this.q.subtract(BigInteger.ONE); - - var legendreExponent = qMinusOne.shiftRight(1); - if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) - { - return null; - } - - var u = qMinusOne.shiftRight(2); - var k = u.shiftLeft(1).add(BigInteger.ONE); - - var Q = this.x; - var fourQ = modDouble(modDouble(Q)); - - var U, V; - do - { - var P; - do - { - P = new BigInteger(this.q.bitLength(), new SecureRandom()); - } - while (P.compareTo(this.q) >= 0 - || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); - - var result = this.lucasSequence(P, Q, k); - U = result[0]; - V = result[1]; - - if (this.modMult(V, V).equals(fourQ)) - { - // Integer division by 2, mod q - if (V.testBit(0)) - { - V = V.add(q); - } - - V = V.shiftRight(1); - - return new ECFieldElementFp(q,V); - } - } - while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); - - return null; -} -ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) -{ - var n = k.bitLength(); - var s = k.getLowestSetBit(); - - var Uh = BigInteger.ONE; - var Vl = BigInteger.TWO; - var Vh = P; - var Ql = BigInteger.ONE; - var Qh = BigInteger.ONE; - - for (var j = n - 1; j >= s + 1; --j) - { - Ql = this.modMult(Ql, Qh); - - if (k.testBit(j)) - { - Qh = this.modMult(Ql, Q); - Uh = this.modMult(Uh, Vh); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); - } - else - { - Qh = Ql; - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - } - } - - Ql = this.modMult(Ql, Qh); - Qh = this.modMult(Ql, Q); - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Ql = this.modMult(Ql, Qh); - - for (var j = 1; j <= s; ++j) - { - Uh = this.modMult(Uh, Vl); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - Ql = this.modMult(Ql, Ql); - } - - return [ Uh, Vl ]; -} - -var exports = { - ECCurveFp: ECCurveFp, - ECPointFp: ECPointFp, - ECFieldElementFp: ECFieldElementFp -} - -module.exports = exports - - -/***/ }), -/* 43 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - readPkcs8: readPkcs8, - write: write, - writePkcs8: writePkcs8, - - readECDSACurve: readECDSACurve, - writeECDSACurve: writeECDSACurve -}; - -var assert = __webpack_require__(2); -var asn1 = __webpack_require__(24); -var Buffer = __webpack_require__(5).Buffer; -var algs = __webpack_require__(8); -var utils = __webpack_require__(6); -var Key = __webpack_require__(7); -var PrivateKey = __webpack_require__(9); -var pem = __webpack_require__(28); - -function read(buf, options) { - return (pem.read(buf, options, 'pkcs8')); -} - -function write(key, options) { - return (pem.write(key, options, 'pkcs8')); -} - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function readPkcs8(alg, type, der) { - /* Private keys in pkcs#8 format have a weird extra int */ - if (der.peek() === asn1.Ber.Integer) { - assert.strictEqual(type, 'private', - 'unexpected Integer at start of public key'); - der.readString(asn1.Ber.Integer, true); - } - - der.readSequence(); - var next = der.offset + der.length; - - var oid = der.readOID(); - switch (oid) { - case '1.2.840.113549.1.1.1': - der._offset = next; - if (type === 'public') - return (readPkcs8RSAPublic(der)); - else - return (readPkcs8RSAPrivate(der)); - case '1.2.840.10040.4.1': - if (type === 'public') - return (readPkcs8DSAPublic(der)); - else - return (readPkcs8DSAPrivate(der)); - case '1.2.840.10045.2.1': - if (type === 'public') - return (readPkcs8ECDSAPublic(der)); - else - return (readPkcs8ECDSAPrivate(der)); - case '1.3.101.112': - if (type === 'public') { - return (readPkcs8EdDSAPublic(der)); - } else { - return (readPkcs8EdDSAPrivate(der)); - } - case '1.3.101.110': - if (type === 'public') { - return (readPkcs8X25519Public(der)); - } else { - return (readPkcs8X25519Private(der)); - } - default: - throw (new Error('Unknown key type OID ' + oid)); - } -} - -function readPkcs8RSAPublic(der) { - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - der.readSequence(); - - // modulus - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); - - // now, make the key - var key = { - type: 'rsa', - source: der.originalInput, - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; - - return (new Key(key)); -} - -function readPkcs8RSAPrivate(der) { - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - - var ver = readMPInt(der, 'version'); - assert.equal(ver[0], 0x0, 'unknown RSA private key version'); - - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8DSAPublic(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - - var y = readMPInt(der, 'y'); - - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y } - ] - }; - - return (new Key(key)); -} - -function readPkcs8DSAPrivate(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - der.readSequence(asn1.Ber.OctetString); - var x = readMPInt(der, 'x'); - - /* The pkcs#8 format does not include the public key */ - var y = utils.calculateDSAPublic(g, p, x); - - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; - - return (new PrivateKey(key)); -} - -function readECDSACurve(der) { - var curveName, curveNames; - var j, c, cd; - - if (der.peek() === asn1.Ber.OID) { - var oid = der.readOID(); - - curveNames = Object.keys(algs.curves); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - if (cd.pkcs8oid === oid) { - curveName = c; - break; - } - } - - } else { - // ECParameters sequence - der.readSequence(); - var version = der.readString(asn1.Ber.Integer, true); - assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); - - var curve = {}; - - // FieldID sequence - der.readSequence(); - var fieldTypeOid = der.readOID(); - assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', - 'ECDSA key is not from a prime-field'); - var p = curve.p = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - /* - * p always starts with a 1 bit, so count the zeros to get its - * real size. - */ - curve.size = p.length * 8 - utils.countZeros(p); - - // Curve sequence - der.readSequence(); - curve.a = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - curve.b = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - if (der.peek() === asn1.Ber.BitString) - curve.s = der.readString(asn1.Ber.BitString, true); - - // Combined Gx and Gy - curve.G = der.readString(asn1.Ber.OctetString, true); - assert.strictEqual(curve.G[0], 0x4, - 'uncompressed G is required'); - - curve.n = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - curve.h = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + - 'required'); - - curveNames = Object.keys(algs.curves); - var ks = Object.keys(curve); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - var equal = true; - for (var i = 0; i < ks.length; ++i) { - var k = ks[i]; - if (cd[k] === undefined) - continue; - if (typeof (cd[k]) === 'object' && - cd[k].equals !== undefined) { - if (!cd[k].equals(curve[k])) { - equal = false; - break; - } - } else if (Buffer.isBuffer(cd[k])) { - if (cd[k].toString('binary') - !== curve[k].toString('binary')) { - equal = false; - break; - } - } else { - if (cd[k] !== curve[k]) { - equal = false; - break; - } - } - } - if (equal) { - curveName = c; - break; - } - } - } - return (curveName); -} - -function readPkcs8ECDSAPrivate(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); - - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - - var version = readMPInt(der, 'version'); - assert.equal(version[0], 1, 'unknown version of ECDSA key'); - - var d = der.readString(asn1.Ber.OctetString, true); - der.readSequence(0xa1); - - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8ECDSAPublic(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); - - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q } - ] - }; - - return (new Key(key)); -} - -function readPkcs8EdDSAPublic(der) { - if (der.peek() === 0x00) - der.readByte(); - - var A = utils.readBitString(der); - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; - - return (new Key(key)); -} - -function readPkcs8X25519Public(der) { - var A = utils.readBitString(der); - - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; - - return (new Key(key)); -} - -function readPkcs8EdDSAPrivate(der) { - if (der.peek() === 0x00) - der.readByte(); - - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); - - var A; - if (der.peek() === asn1.Ber.BitString) { - A = utils.readBitString(der); - A = utils.zeroPadToLength(A, 32); - } else { - A = utils.calculateED25519Public(k); - } - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8X25519Private(der) { - if (der.peek() === 0x00) - der.readByte(); - - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); - - var A = utils.calculateX25519Public(k); - - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; - - return (new PrivateKey(key)); -} - -function writePkcs8(der, key) { - der.startSequence(); - - if (PrivateKey.isPrivateKey(key)) { - var sillyInt = Buffer.from([0]); - der.writeBuffer(sillyInt, asn1.Ber.Integer); - } - - der.startSequence(); - switch (key.type) { - case 'rsa': - der.writeOID('1.2.840.113549.1.1.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8RSAPrivate(key, der); - else - writePkcs8RSAPublic(key, der); - break; - case 'dsa': - der.writeOID('1.2.840.10040.4.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8DSAPrivate(key, der); - else - writePkcs8DSAPublic(key, der); - break; - case 'ecdsa': - der.writeOID('1.2.840.10045.2.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8ECDSAPrivate(key, der); - else - writePkcs8ECDSAPublic(key, der); - break; - case 'ed25519': - der.writeOID('1.3.101.112'); - if (PrivateKey.isPrivateKey(key)) - throw (new Error('Ed25519 private keys in pkcs8 ' + - 'format are not supported')); - writePkcs8EdDSAPublic(key, der); - break; - default: - throw (new Error('Unsupported key type: ' + key.type)); - } - - der.endSequence(); -} - -function writePkcs8RSAPrivate(key, der) { - der.writeNull(); - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - - var version = Buffer.from([0]); - der.writeBuffer(version, asn1.Ber.Integer); - - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); - - der.endSequence(); - der.endSequence(); -} - -function writePkcs8RSAPublic(key, der) { - der.writeNull(); - der.endSequence(); - - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); - - der.startSequence(); - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.endSequence(); - - der.endSequence(); -} - -function writePkcs8DSAPrivate(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); - - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); - der.endSequence(); -} - -function writePkcs8DSAPublic(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); - der.endSequence(); - - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.endSequence(); -} - -function writeECDSACurve(key, der) { - var curve = algs.curves[key.curve]; - if (curve.pkcs8oid) { - /* This one has a name in pkcs#8, so just write the oid */ - der.writeOID(curve.pkcs8oid); - - } else { - // ECParameters sequence - der.startSequence(); - - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); - - // FieldID sequence - der.startSequence(); - der.writeOID('1.2.840.10045.1.1'); // prime-field - der.writeBuffer(curve.p, asn1.Ber.Integer); - der.endSequence(); - - // Curve sequence - der.startSequence(); - var a = curve.p; - if (a[0] === 0x0) - a = a.slice(1); - der.writeBuffer(a, asn1.Ber.OctetString); - der.writeBuffer(curve.b, asn1.Ber.OctetString); - der.writeBuffer(curve.s, asn1.Ber.BitString); - der.endSequence(); - - der.writeBuffer(curve.G, asn1.Ber.OctetString); - der.writeBuffer(curve.n, asn1.Ber.Integer); - var h = curve.h; - if (!h) { - h = Buffer.from([1]); - } - der.writeBuffer(h, asn1.Ber.Integer); - - // ECParameters - der.endSequence(); - } -} - -function writePkcs8ECDSAPublic(key, der) { - writeECDSACurve(key, der); - der.endSequence(); - - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); -} - -function writePkcs8ECDSAPrivate(key, der) { - writeECDSACurve(key, der); - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); - - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); - - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); - - der.endSequence(); - der.endSequence(); -} - -function writePkcs8EdDSAPublic(key, der) { - der.endSequence(); - - utils.writeBitString(der, key.part.A.data); -} - -function writePkcs8EdDSAPrivate(key, der) { - der.endSequence(); - - var k = utils.mpNormalize(key.part.k.data, true); - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(k, asn1.Ber.OctetString); - der.endSequence(); -} - - -/***/ }), -/* 44 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = SSHBuffer; - -var assert = __webpack_require__(2); -var Buffer = __webpack_require__(5).Buffer; - -function SSHBuffer(opts) { - assert.object(opts, 'options'); - if (opts.buffer !== undefined) - assert.buffer(opts.buffer, 'options.buffer'); - - this._size = opts.buffer ? opts.buffer.length : 1024; - this._buffer = opts.buffer || Buffer.alloc(this._size); - this._offset = 0; -} - -SSHBuffer.prototype.toBuffer = function () { - return (this._buffer.slice(0, this._offset)); -}; - -SSHBuffer.prototype.atEnd = function () { - return (this._offset >= this._buffer.length); -}; - -SSHBuffer.prototype.remainder = function () { - return (this._buffer.slice(this._offset)); -}; - -SSHBuffer.prototype.skip = function (n) { - this._offset += n; -}; - -SSHBuffer.prototype.expand = function () { - this._size *= 2; - var buf = Buffer.alloc(this._size); - this._buffer.copy(buf, 0); - this._buffer = buf; -}; - -SSHBuffer.prototype.readPart = function () { - return ({data: this.readBuffer()}); -}; - -SSHBuffer.prototype.readBuffer = function () { - var len = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - assert.ok(this._offset + len <= this._buffer.length, - 'length out of bounds at +0x' + this._offset.toString(16) + - ' (data truncated?)'); - var buf = this._buffer.slice(this._offset, this._offset + len); - this._offset += len; - return (buf); -}; - -SSHBuffer.prototype.readString = function () { - return (this.readBuffer().toString()); -}; - -SSHBuffer.prototype.readCString = function () { - var offset = this._offset; - while (offset < this._buffer.length && - this._buffer[offset] !== 0x00) - offset++; - assert.ok(offset < this._buffer.length, 'c string does not terminate'); - var str = this._buffer.slice(this._offset, offset).toString(); - this._offset = offset + 1; - return (str); -}; - -SSHBuffer.prototype.readInt = function () { - var v = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - return (v); -}; - -SSHBuffer.prototype.readInt64 = function () { - assert.ok(this._offset + 8 < this._buffer.length, - 'buffer not long enough to read Int64'); - var v = this._buffer.slice(this._offset, this._offset + 8); - this._offset += 8; - return (v); -}; - -SSHBuffer.prototype.readChar = function () { - var v = this._buffer[this._offset++]; - return (v); -}; - -SSHBuffer.prototype.writeBuffer = function (buf) { - while (this._offset + 4 + buf.length > this._size) - this.expand(); - this._buffer.writeUInt32BE(buf.length, this._offset); - this._offset += 4; - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; - -SSHBuffer.prototype.writeString = function (str) { - this.writeBuffer(Buffer.from(str, 'utf8')); -}; - -SSHBuffer.prototype.writeCString = function (str) { - while (this._offset + 1 + str.length > this._size) - this.expand(); - this._buffer.write(str, this._offset); - this._offset += str.length; - this._buffer[this._offset++] = 0; -}; - -SSHBuffer.prototype.writeInt = function (v) { - while (this._offset + 4 > this._size) - this.expand(); - this._buffer.writeUInt32BE(v, this._offset); - this._offset += 4; -}; - -SSHBuffer.prototype.writeInt64 = function (v) { - assert.buffer(v, 'value'); - if (v.length > 8) { - var lead = v.slice(0, v.length - 8); - for (var i = 0; i < lead.length; ++i) { - assert.strictEqual(lead[i], 0, - 'must fit in 64 bits of precision'); - } - v = v.slice(v.length - 8, v.length); - } - while (this._offset + 8 > this._size) - this.expand(); - v.copy(this._buffer, this._offset); - this._offset += 8; -}; - -SSHBuffer.prototype.writeChar = function (v) { - while (this._offset + 1 > this._size) - this.expand(); - this._buffer[this._offset++] = v; -}; - -SSHBuffer.prototype.writePart = function (p) { - this.writeBuffer(p.data); -}; - -SSHBuffer.prototype.write = function (buf) { - while (this._offset + buf.length > this._size) - this.expand(); - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; - - -/***/ }), -/* 45 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Identity; - -var assert = __webpack_require__(2); -var algs = __webpack_require__(8); -var crypto = __webpack_require__(4); -var Fingerprint = __webpack_require__(40); -var Signature = __webpack_require__(22); -var errs = __webpack_require__(21); -var util = __webpack_require__(1); -var utils = __webpack_require__(6); -var asn1 = __webpack_require__(24); -var Buffer = __webpack_require__(5).Buffer; - -/*JSSTYLED*/ -var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; - -var oids = {}; -oids.cn = '2.5.4.3'; -oids.o = '2.5.4.10'; -oids.ou = '2.5.4.11'; -oids.l = '2.5.4.7'; -oids.s = '2.5.4.8'; -oids.c = '2.5.4.6'; -oids.sn = '2.5.4.4'; -oids.dc = '0.9.2342.19200300.100.1.25'; -oids.uid = '0.9.2342.19200300.100.1.1'; -oids.mail = '0.9.2342.19200300.100.1.3'; - -var unoids = {}; -Object.keys(oids).forEach(function (k) { - unoids[oids[k]] = k; -}); - -function Identity(opts) { - var self = this; - assert.object(opts, 'options'); - assert.arrayOfObject(opts.components, 'options.components'); - this.components = opts.components; - this.componentLookup = {}; - this.components.forEach(function (c) { - if (c.name && !c.oid) - c.oid = oids[c.name]; - if (c.oid && !c.name) - c.name = unoids[c.oid]; - if (self.componentLookup[c.name] === undefined) - self.componentLookup[c.name] = []; - self.componentLookup[c.name].push(c); - }); - if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { - this.cn = this.componentLookup.cn[0].value; - } - assert.optionalString(opts.type, 'options.type'); - if (opts.type === undefined) { - if (this.components.length === 1 && - this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.dc && - this.components.length === this.componentLookup.dc.length) { - this.type = 'host'; - this.hostname = this.componentLookup.dc.map( - function (c) { - return (c.value); - }).join('.'); - - } else if (this.componentLookup.uid && - this.components.length === - this.componentLookup.uid.length) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.uid && - this.componentLookup.uid.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.mail && - this.componentLookup.mail.length === 1) { - this.type = 'email'; - this.email = this.componentLookup.mail[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.cn[0].value; - - } else { - this.type = 'unknown'; - } - } else { - this.type = opts.type; - if (this.type === 'host') - this.hostname = opts.hostname; - else if (this.type === 'user') - this.uid = opts.uid; - else if (this.type === 'email') - this.email = opts.email; - else - throw (new Error('Unknown type ' + this.type)); - } -} - -Identity.prototype.toString = function () { - return (this.components.map(function (c) { - return (c.name.toUpperCase() + '=' + c.value); - }).join(', ')); -}; - -/* - * These are from X.680 -- PrintableString allowed chars are in section 37.4 - * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to - * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 - * (the basic ASCII character set). - */ -/* JSSTYLED */ -var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; -/* JSSTYLED */ -var NOT_IA5 = /[^\x00-\x7f]/; - -Identity.prototype.toAsn1 = function (der, tag) { - der.startSequence(tag); - this.components.forEach(function (c) { - der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); - der.startSequence(); - der.writeOID(c.oid); - /* - * If we fit in a PrintableString, use that. Otherwise use an - * IA5String or UTF8String. - * - * If this identity was parsed from a DN, use the ASN.1 types - * from the original representation (otherwise this might not - * be a full match for the original in some validators). - */ - if (c.asn1type === asn1.Ber.Utf8String || - c.value.match(NOT_IA5)) { - var v = Buffer.from(c.value, 'utf8'); - der.writeBuffer(v, asn1.Ber.Utf8String); - - } else if (c.asn1type === asn1.Ber.IA5String || - c.value.match(NOT_PRINTABLE)) { - der.writeString(c.value, asn1.Ber.IA5String); - - } else { - var type = asn1.Ber.PrintableString; - if (c.asn1type !== undefined) - type = c.asn1type; - der.writeString(c.value, type); - } - der.endSequence(); - der.endSequence(); - }); - der.endSequence(); -}; - -function globMatch(a, b) { - if (a === '**' || b === '**') - return (true); - var aParts = a.split('.'); - var bParts = b.split('.'); - if (aParts.length !== bParts.length) - return (false); - for (var i = 0; i < aParts.length; ++i) { - if (aParts[i] === '*' || bParts[i] === '*') - continue; - if (aParts[i] !== bParts[i]) - return (false); - } - return (true); -} - -Identity.prototype.equals = function (other) { - if (!Identity.isIdentity(other, [1, 0])) - return (false); - if (other.components.length !== this.components.length) - return (false); - for (var i = 0; i < this.components.length; ++i) { - if (this.components[i].oid !== other.components[i].oid) - return (false); - if (!globMatch(this.components[i].value, - other.components[i].value)) { - return (false); - } - } - return (true); -}; - -Identity.forHost = function (hostname) { - assert.string(hostname, 'hostname'); - return (new Identity({ - type: 'host', - hostname: hostname, - components: [ { name: 'cn', value: hostname } ] - })); -}; - -Identity.forUser = function (uid) { - assert.string(uid, 'uid'); - return (new Identity({ - type: 'user', - uid: uid, - components: [ { name: 'uid', value: uid } ] - })); -}; - -Identity.forEmail = function (email) { - assert.string(email, 'email'); - return (new Identity({ - type: 'email', - email: email, - components: [ { name: 'mail', value: email } ] - })); -}; - -Identity.parseDN = function (dn) { - assert.string(dn, 'dn'); - var parts = dn.split(','); - var cmps = parts.map(function (c) { - c = c.trim(); - var eqPos = c.indexOf('='); - var name = c.slice(0, eqPos).toLowerCase(); - var value = c.slice(eqPos + 1); - return ({ name: name, value: value }); - }); - return (new Identity({ components: cmps })); -}; - -Identity.parseAsn1 = function (der, top) { - var components = []; - der.readSequence(top); - var end = der.offset + der.length; - while (der.offset < end) { - der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); - var after = der.offset + der.length; - der.readSequence(); - var oid = der.readOID(); - var type = der.peek(); - var value; - switch (type) { - case asn1.Ber.PrintableString: - case asn1.Ber.IA5String: - case asn1.Ber.OctetString: - case asn1.Ber.T61String: - value = der.readString(type); - break; - case asn1.Ber.Utf8String: - value = der.readString(type, true); - value = value.toString('utf8'); - break; - case asn1.Ber.CharacterString: - case asn1.Ber.BMPString: - value = der.readString(type, true); - value = value.toString('utf16le'); - break; - default: - throw (new Error('Unknown asn1 type ' + type)); - } - components.push({ oid: oid, asn1type: type, value: value }); - der._offset = after; - } - der._offset = end; - return (new Identity({ - components: components - })); -}; - -Identity.isIdentity = function (obj, ver) { - return (utils.isCompatible(obj, Identity, ver)); -}; - -/* - * API versions for Identity: - * [1,0] -- initial ver - */ -Identity.prototype._sshpkApiVersion = [1, 0]; - -Identity._oldVersionDetect = function (obj) { - return ([1, 0]); -}; - - -/***/ }), -/* 46 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -const util = __webpack_require__(19); -const buildOptions = __webpack_require__(19).buildOptions; -const xmlNode = __webpack_require__(202); -const TagType = {"OPENING": 1, "CLOSING": 2, "SELF": 3, "CDATA": 4}; -let regx = "<((!\\[CDATA\\[([\\s\\S]*?)(]]>))|(([\\w:\\-._]*:)?([\\w:\\-._]+))([^>]*)>|((\\/)(([\\w:\\-._]*:)?([\\w:\\-._]+))\\s*>))([^<]*)"; - -//const tagsRegx = new RegExp("<(\\/?[\\w:\\-\._]+)([^>]*)>(\\s*"+cdataRegx+")*([^<]+)?","g"); -//const tagsRegx = new RegExp("<(\\/?)((\\w*:)?([\\w:\\-\._]+))([^>]*)>([^<]*)("+cdataRegx+"([^<]*))*([^<]+)?","g"); - -//treat cdata as a tag - -const defaultOptions = { - attributeNamePrefix: "@_", - attrNodeName: false, - textNodeName: "#text", - ignoreAttributes: true, - ignoreNameSpace: false, - allowBooleanAttributes: false, //a tag can have attributes without any value - //ignoreRootElement : false, - parseNodeValue: true, - parseAttributeValue: false, - arrayMode: false, - trimValues: true, //Trim string values of tag and attributes - cdataTagName: false, - cdataPositionChar: "\\c", - localeRange: "", - tagValueProcessor: function(a) {return a}, - attrValueProcessor: function(a) {return a} - //decodeStrict: false, -}; - -exports.defaultOptions = defaultOptions; - -const props = ["attributeNamePrefix", "attrNodeName", "textNodeName", "ignoreAttributes", "ignoreNameSpace", "allowBooleanAttributes", "parseNodeValue", "parseAttributeValue", "arrayMode", "trimValues", "cdataTagName", "cdataPositionChar", "localeRange", "tagValueProcessor", "attrValueProcessor"]; -exports.props = props; - -const getTraversalObj = function(xmlData, options) { - options = buildOptions(options,defaultOptions,props); - //xmlData = xmlData.replace(/\r?\n/g, " ");//make it single line - xmlData = xmlData.replace(//g, "");//Remove comments - - const xmlObj = new xmlNode("!xml"); - let currentNode = xmlObj; - - regx = regx.replace(/\[\\w/g, "[" + options.localeRange + "\\w"); - const tagsRegx = new RegExp(regx, "g"); - let tag = tagsRegx.exec(xmlData); - let nextTag = tagsRegx.exec(xmlData); - while (tag) { - const tagType = checkForTagType(tag); - - if (tagType === TagType.CLOSING) { - //add parsed data to parent node - if (currentNode.parent && tag[14]) { - currentNode.parent.val = util.getValue(currentNode.parent.val) + "" + processTagValue(tag[14], options); - } - - currentNode = currentNode.parent; - } else if (tagType === TagType.CDATA) { - if (options.cdataTagName) { - //add cdata node - const childNode = new xmlNode(options.cdataTagName, currentNode, tag[3]); - childNode.attrsMap = buildAttributesMap(tag[8], options); - currentNode.addChild(childNode); - //for backtracking - currentNode.val = util.getValue(currentNode.val) + options.cdataPositionChar; - //add rest value to parent node - if (tag[14]) { - currentNode.val += processTagValue(tag[14], options); - } - } else { - currentNode.val = (currentNode.val || "") + (tag[3] || "") + processTagValue(tag[14], options); - } - } else if (tagType === TagType.SELF) { - if (currentNode && tag[14]) { - currentNode.val = util.getValue(currentNode.val) + "" + processTagValue(tag[14], options); - } - - const childNode = new xmlNode(options.ignoreNameSpace ? tag[7] : tag[5], currentNode, ""); - if (tag[8] && tag[8].length > 1) { - tag[8] = tag[8].substr(0, tag[8].length - 1); - } - childNode.attrsMap = buildAttributesMap(tag[8], options); - currentNode.addChild(childNode); - } else {//TagType.OPENING - const childNode = new xmlNode(options.ignoreNameSpace ? tag[7] : tag[5], currentNode, processTagValue(tag[14], options)); - childNode.attrsMap = buildAttributesMap(tag[8], options); - currentNode.addChild(childNode); - currentNode = childNode; - } - - tag = nextTag; - nextTag = tagsRegx.exec(xmlData); - } - - return xmlObj; -}; - -function processTagValue(val, options) { - if (val) { - if (options.trimValues) { - val = val.trim(); - } - val = options.tagValueProcessor(val); - val = parseValue(val, options.parseNodeValue); - } - - return val; -} - -function checkForTagType(match) { - if (match[4] === "]]>") { - return TagType.CDATA; - } else if (match[10] === "/") { - return TagType.CLOSING; - } else if (typeof match[8] !== "undefined" && match[8].substr(match[8].length - 1) === "/") { - return TagType.SELF; - } else { - return TagType.OPENING; - } -} - -function resolveNameSpace(tagname, options) { - if (options.ignoreNameSpace) { - const tags = tagname.split(":"); - const prefix = tagname.charAt(0) === "/" ? "/" : ""; - if (tags[0] === "xmlns") { - return ""; - } - if (tags.length === 2) { - tagname = prefix + tags[1]; - } - } - return tagname; -} - -function parseValue(val, shouldParse) { - if (shouldParse && typeof val === "string") { - if (val.trim() === "" || isNaN(val)) { - val = val === "true" ? true : val === "false" ? false : val; - } else { - if (val.indexOf(".") !== -1) { - val = Number.parseFloat(val); - } else { - val = Number.parseInt(val, 10); - } - } - return val; - } else { - if (util.isExist(val)) { - return val; - } else { - return ""; - } - } -} - -//TODO: change regex to capture NS -//const attrsRegx = new RegExp("([\\w\\-\\.\\:]+)\\s*=\\s*(['\"])((.|\n)*?)\\2","gm"); -const attrsRegx = new RegExp("([^\\s=]+)\\s*(=\\s*(['\"])(.*?)\\3)?", "g"); - -function buildAttributesMap(attrStr, options) { - if (!options.ignoreAttributes && typeof attrStr === "string") { - attrStr = attrStr.replace(/\r?\n/g, " "); - //attrStr = attrStr || attrStr.trim(); - - const matches = util.getAllMatches(attrStr, attrsRegx); - const len = matches.length; //don't make it inline - const attrs = {}; - for (let i = 0; i < len; i++) { - const attrName = resolveNameSpace(matches[i][1], options); - if (attrName.length) { - if (matches[i][4] !== undefined) { - if (options.trimValues) { - matches[i][4] = matches[i][4].trim(); - } - matches[i][4] = options.attrValueProcessor(matches[i][4]); - attrs[options.attributeNamePrefix + attrName] = parseValue(matches[i][4], options.parseAttributeValue); - } else if (options.allowBooleanAttributes) { - attrs[options.attributeNamePrefix + attrName] = true; - } - - } - } - if (!Object.keys(attrs).length) { - return; - } - if (options.attrNodeName) { - const attrCollection = {}; - attrCollection[options.attrNodeName] = attrs; - return attrCollection; - } - return attrs; - } -} - -exports.getTraversalObj = getTraversalObj; - - -/***/ }), -/* 47 */ -/***/ (function(module, exports, __webpack_require__) { - -/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** - * @license - * Lodash - * Copyright JS Foundation and other contributors - * Released under MIT license - * Based on Underscore.js 1.8.3 - * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors - */ -;(function() { - - /** Used as a safe reference for `undefined` in pre-ES5 environments. */ - var undefined; - - /** Used as the semantic version number. */ - var VERSION = '4.17.10'; - - /** Used as the size to enable large array optimizations. */ - var LARGE_ARRAY_SIZE = 200; - - /** Error message constants. */ - var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', - FUNC_ERROR_TEXT = 'Expected a function'; - - /** Used to stand-in for `undefined` hash values. */ - var HASH_UNDEFINED = '__lodash_hash_undefined__'; - - /** Used as the maximum memoize cache size. */ - var MAX_MEMOIZE_SIZE = 500; - - /** Used as the internal argument placeholder. */ - var PLACEHOLDER = '__lodash_placeholder__'; - - /** Used to compose bitmasks for cloning. */ - var CLONE_DEEP_FLAG = 1, - CLONE_FLAT_FLAG = 2, - CLONE_SYMBOLS_FLAG = 4; - - /** Used to compose bitmasks for value comparisons. */ - var COMPARE_PARTIAL_FLAG = 1, - COMPARE_UNORDERED_FLAG = 2; - - /** Used to compose bitmasks for function metadata. */ - var WRAP_BIND_FLAG = 1, - WRAP_BIND_KEY_FLAG = 2, - WRAP_CURRY_BOUND_FLAG = 4, - WRAP_CURRY_FLAG = 8, - WRAP_CURRY_RIGHT_FLAG = 16, - WRAP_PARTIAL_FLAG = 32, - WRAP_PARTIAL_RIGHT_FLAG = 64, - WRAP_ARY_FLAG = 128, - WRAP_REARG_FLAG = 256, - WRAP_FLIP_FLAG = 512; - - /** Used as default options for `_.truncate`. */ - var DEFAULT_TRUNC_LENGTH = 30, - DEFAULT_TRUNC_OMISSION = '...'; - - /** Used to detect hot functions by number of calls within a span of milliseconds. */ - var HOT_COUNT = 800, - HOT_SPAN = 16; - - /** Used to indicate the type of lazy iteratees. */ - var LAZY_FILTER_FLAG = 1, - LAZY_MAP_FLAG = 2, - LAZY_WHILE_FLAG = 3; - - /** Used as references for various `Number` constants. */ - var INFINITY = 1 / 0, - MAX_SAFE_INTEGER = 9007199254740991, - MAX_INTEGER = 1.7976931348623157e+308, - NAN = 0 / 0; - - /** Used as references for the maximum length and index of an array. */ - var MAX_ARRAY_LENGTH = 4294967295, - MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, - HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; - - /** Used to associate wrap methods with their bit flags. */ - var wrapFlags = [ - ['ary', WRAP_ARY_FLAG], - ['bind', WRAP_BIND_FLAG], - ['bindKey', WRAP_BIND_KEY_FLAG], - ['curry', WRAP_CURRY_FLAG], - ['curryRight', WRAP_CURRY_RIGHT_FLAG], - ['flip', WRAP_FLIP_FLAG], - ['partial', WRAP_PARTIAL_FLAG], - ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], - ['rearg', WRAP_REARG_FLAG] - ]; - - /** `Object#toString` result references. */ - var argsTag = '[object Arguments]', - arrayTag = '[object Array]', - asyncTag = '[object AsyncFunction]', - boolTag = '[object Boolean]', - dateTag = '[object Date]', - domExcTag = '[object DOMException]', - errorTag = '[object Error]', - funcTag = '[object Function]', - genTag = '[object GeneratorFunction]', - mapTag = '[object Map]', - numberTag = '[object Number]', - nullTag = '[object Null]', - objectTag = '[object Object]', - promiseTag = '[object Promise]', - proxyTag = '[object Proxy]', - regexpTag = '[object RegExp]', - setTag = '[object Set]', - stringTag = '[object String]', - symbolTag = '[object Symbol]', - undefinedTag = '[object Undefined]', - weakMapTag = '[object WeakMap]', - weakSetTag = '[object WeakSet]'; - - var arrayBufferTag = '[object ArrayBuffer]', - dataViewTag = '[object DataView]', - float32Tag = '[object Float32Array]', - float64Tag = '[object Float64Array]', - int8Tag = '[object Int8Array]', - int16Tag = '[object Int16Array]', - int32Tag = '[object Int32Array]', - uint8Tag = '[object Uint8Array]', - uint8ClampedTag = '[object Uint8ClampedArray]', - uint16Tag = '[object Uint16Array]', - uint32Tag = '[object Uint32Array]'; - - /** Used to match empty string literals in compiled template source. */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - - /** Used to match HTML entities and HTML characters. */ - var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, - reUnescapedHtml = /[&<>"']/g, - reHasEscapedHtml = RegExp(reEscapedHtml.source), - reHasUnescapedHtml = RegExp(reUnescapedHtml.source); - - /** Used to match template delimiters. */ - var reEscape = /<%-([\s\S]+?)%>/g, - reEvaluate = /<%([\s\S]+?)%>/g, - reInterpolate = /<%=([\s\S]+?)%>/g; - - /** Used to match property names within property paths. */ - var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, - reIsPlainProp = /^\w*$/, - rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; - - /** - * Used to match `RegExp` - * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). - */ - var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, - reHasRegExpChar = RegExp(reRegExpChar.source); - - /** Used to match leading and trailing whitespace. */ - var reTrim = /^\s+|\s+$/g, - reTrimStart = /^\s+/, - reTrimEnd = /\s+$/; - - /** Used to match wrap detail comments. */ - var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, - reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, - reSplitDetails = /,? & /; - - /** Used to match words composed of alphanumeric characters. */ - var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; - - /** Used to match backslashes in property paths. */ - var reEscapeChar = /\\(\\)?/g; - - /** - * Used to match - * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). - */ - var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; - - /** Used to match `RegExp` flags from their coerced string values. */ - var reFlags = /\w*$/; - - /** Used to detect bad signed hexadecimal string values. */ - var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; - - /** Used to detect binary string values. */ - var reIsBinary = /^0b[01]+$/i; - - /** Used to detect host constructors (Safari). */ - var reIsHostCtor = /^\[object .+?Constructor\]$/; - - /** Used to detect octal string values. */ - var reIsOctal = /^0o[0-7]+$/i; - - /** Used to detect unsigned integer values. */ - var reIsUint = /^(?:0|[1-9]\d*)$/; - - /** Used to match Latin Unicode letters (excluding mathematical operators). */ - var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - - /** Used to ensure capturing order of template delimiters. */ - var reNoMatch = /($^)/; - - /** Used to match unescaped characters in compiled string literals. */ - var reUnescapedString = /['\n\r\u2028\u2029\\]/g; - - /** Used to compose unicode character classes. */ - var rsAstralRange = '\\ud800-\\udfff', - rsComboMarksRange = '\\u0300-\\u036f', - reComboHalfMarksRange = '\\ufe20-\\ufe2f', - rsComboSymbolsRange = '\\u20d0-\\u20ff', - rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, - rsDingbatRange = '\\u2700-\\u27bf', - rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', - rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', - rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', - rsPunctuationRange = '\\u2000-\\u206f', - rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', - rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', - rsVarRange = '\\ufe0e\\ufe0f', - rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; - - /** Used to compose unicode capture groups. */ - var rsApos = "['\u2019]", - rsAstral = '[' + rsAstralRange + ']', - rsBreak = '[' + rsBreakRange + ']', - rsCombo = '[' + rsComboRange + ']', - rsDigits = '\\d+', - rsDingbat = '[' + rsDingbatRange + ']', - rsLower = '[' + rsLowerRange + ']', - rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', - rsFitz = '\\ud83c[\\udffb-\\udfff]', - rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', - rsNonAstral = '[^' + rsAstralRange + ']', - rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', - rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', - rsUpper = '[' + rsUpperRange + ']', - rsZWJ = '\\u200d'; - - /** Used to compose unicode regexes. */ - var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', - rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', - rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', - rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', - reOptMod = rsModifier + '?', - rsOptVar = '[' + rsVarRange + ']?', - rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', - rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', - rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', - rsSeq = rsOptVar + reOptMod + rsOptJoin, - rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, - rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - - /** Used to match apostrophes. */ - var reApos = RegExp(rsApos, 'g'); - - /** - * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and - * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). - */ - var reComboMark = RegExp(rsCombo, 'g'); - - /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ - var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - - /** Used to match complex or compound words. */ - var reUnicodeWord = RegExp([ - rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', - rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', - rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, - rsUpper + '+' + rsOptContrUpper, - rsOrdUpper, - rsOrdLower, - rsDigits, - rsEmoji - ].join('|'), 'g'); - - /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ - var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); - - /** Used to detect strings that need a more robust regexp to match words. */ - var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; - - /** Used to assign default `context` object properties. */ - var contextProps = [ - 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', - 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', - 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', - 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', - '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' - ]; - - /** Used to make template sourceURLs easier to identify. */ - var templateCounter = -1; - - /** Used to identify `toStringTag` values of typed arrays. */ - var typedArrayTags = {}; - typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = - typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = - typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = - typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = - typedArrayTags[uint32Tag] = true; - typedArrayTags[argsTag] = typedArrayTags[arrayTag] = - typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = - typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = - typedArrayTags[errorTag] = typedArrayTags[funcTag] = - typedArrayTags[mapTag] = typedArrayTags[numberTag] = - typedArrayTags[objectTag] = typedArrayTags[regexpTag] = - typedArrayTags[setTag] = typedArrayTags[stringTag] = - typedArrayTags[weakMapTag] = false; - - /** Used to identify `toStringTag` values supported by `_.clone`. */ - var cloneableTags = {}; - cloneableTags[argsTag] = cloneableTags[arrayTag] = - cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = - cloneableTags[boolTag] = cloneableTags[dateTag] = - cloneableTags[float32Tag] = cloneableTags[float64Tag] = - cloneableTags[int8Tag] = cloneableTags[int16Tag] = - cloneableTags[int32Tag] = cloneableTags[mapTag] = - cloneableTags[numberTag] = cloneableTags[objectTag] = - cloneableTags[regexpTag] = cloneableTags[setTag] = - cloneableTags[stringTag] = cloneableTags[symbolTag] = - cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = - cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; - cloneableTags[errorTag] = cloneableTags[funcTag] = - cloneableTags[weakMapTag] = false; - - /** Used to map Latin Unicode letters to basic Latin letters. */ - var deburredLetters = { - // Latin-1 Supplement block. - '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', - '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', - '\xc7': 'C', '\xe7': 'c', - '\xd0': 'D', '\xf0': 'd', - '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', - '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', - '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', - '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', - '\xd1': 'N', '\xf1': 'n', - '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', - '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', - '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', - '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', - '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', - '\xc6': 'Ae', '\xe6': 'ae', - '\xde': 'Th', '\xfe': 'th', - '\xdf': 'ss', - // Latin Extended-A block. - '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', - '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', - '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', - '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', - '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', - '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', - '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', - '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', - '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', - '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', - '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', - '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', - '\u0134': 'J', '\u0135': 'j', - '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', - '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', - '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', - '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', - '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', - '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', - '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', - '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', - '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', - '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', - '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', - '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', - '\u0163': 't', '\u0165': 't', '\u0167': 't', - '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', - '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', - '\u0174': 'W', '\u0175': 'w', - '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', - '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', - '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', - '\u0132': 'IJ', '\u0133': 'ij', - '\u0152': 'Oe', '\u0153': 'oe', - '\u0149': "'n", '\u017f': 's' - }; - - /** Used to map characters to HTML entities. */ - var htmlEscapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - "'": ''' - }; - - /** Used to map HTML entities to characters. */ - var htmlUnescapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - ''': "'" - }; - - /** Used to escape characters for inclusion in compiled string literals. */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; - - /** Built-in method references without a dependency on `root`. */ - var freeParseFloat = parseFloat, - freeParseInt = parseInt; - - /** Detect free variable `global` from Node.js. */ - var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; - - /** Detect free variable `self`. */ - var freeSelf = typeof self == 'object' && self && self.Object === Object && self; - - /** Used as a reference to the global object. */ - var root = freeGlobal || freeSelf || Function('return this')(); - - /** Detect free variable `exports`. */ - var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; - - /** Detect free variable `module`. */ - var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; - - /** Detect the popular CommonJS extension `module.exports`. */ - var moduleExports = freeModule && freeModule.exports === freeExports; - - /** Detect free variable `process` from Node.js. */ - var freeProcess = moduleExports && freeGlobal.process; - - /** Used to access faster Node.js helpers. */ - var nodeUtil = (function() { - try { - // Use `util.types` for Node.js 10+. - var types = freeModule && freeModule.require && freeModule.require('util').types; - - if (types) { - return types; - } - - // Legacy `process.binding('util')` for Node.js < 10. - return freeProcess && freeProcess.binding && freeProcess.binding('util'); - } catch (e) {} - }()); - - /* Node.js helper references. */ - var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, - nodeIsDate = nodeUtil && nodeUtil.isDate, - nodeIsMap = nodeUtil && nodeUtil.isMap, - nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, - nodeIsSet = nodeUtil && nodeUtil.isSet, - nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; - - /*--------------------------------------------------------------------------*/ - - /** - * A faster alternative to `Function#apply`, this function invokes `func` - * with the `this` binding of `thisArg` and the arguments of `args`. - * - * @private - * @param {Function} func The function to invoke. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} args The arguments to invoke `func` with. - * @returns {*} Returns the result of `func`. - */ - function apply(func, thisArg, args) { - switch (args.length) { - case 0: return func.call(thisArg); - case 1: return func.call(thisArg, args[0]); - case 2: return func.call(thisArg, args[0], args[1]); - case 3: return func.call(thisArg, args[0], args[1], args[2]); - } - return func.apply(thisArg, args); - } - - /** - * A specialized version of `baseAggregator` for arrays. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function arrayAggregator(array, setter, iteratee, accumulator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - var value = array[index]; - setter(accumulator, value, iteratee(value), array); - } - return accumulator; - } - - /** - * A specialized version of `_.forEach` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEach(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (iteratee(array[index], index, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.forEachRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEachRight(array, iteratee) { - var length = array == null ? 0 : array.length; - - while (length--) { - if (iteratee(array[length], length, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.every` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - */ - function arrayEvery(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (!predicate(array[index], index, array)) { - return false; - } - } - return true; - } - - /** - * A specialized version of `_.filter` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function arrayFilter(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * A specialized version of `_.includes` for arrays without support for - * specifying an index to search from. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludes(array, value) { - var length = array == null ? 0 : array.length; - return !!length && baseIndexOf(array, value, 0) > -1; - } - - /** - * This function is like `arrayIncludes` except that it accepts a comparator. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @param {Function} comparator The comparator invoked per element. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludesWith(array, value, comparator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (comparator(value, array[index])) { - return true; - } - } - return false; - } - - /** - * A specialized version of `_.map` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function arrayMap(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length, - result = Array(length); - - while (++index < length) { - result[index] = iteratee(array[index], index, array); - } - return result; - } - - /** - * Appends the elements of `values` to `array`. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to append. - * @returns {Array} Returns `array`. - */ - function arrayPush(array, values) { - var index = -1, - length = values.length, - offset = array.length; - - while (++index < length) { - array[offset + index] = values[index]; - } - return array; - } - - /** - * A specialized version of `_.reduce` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the first element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduce(array, iteratee, accumulator, initAccum) { - var index = -1, - length = array == null ? 0 : array.length; - - if (initAccum && length) { - accumulator = array[++index]; - } - while (++index < length) { - accumulator = iteratee(accumulator, array[index], index, array); - } - return accumulator; - } - - /** - * A specialized version of `_.reduceRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the last element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduceRight(array, iteratee, accumulator, initAccum) { - var length = array == null ? 0 : array.length; - if (initAccum && length) { - accumulator = array[--length]; - } - while (length--) { - accumulator = iteratee(accumulator, array[length], length, array); - } - return accumulator; - } - - /** - * A specialized version of `_.some` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function arraySome(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (predicate(array[index], index, array)) { - return true; - } - } - return false; - } - - /** - * Gets the size of an ASCII `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - var asciiSize = baseProperty('length'); - - /** - * Converts an ASCII `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function asciiToArray(string) { - return string.split(''); - } - - /** - * Splits an ASCII `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function asciiWords(string) { - return string.match(reAsciiWord) || []; - } - - /** - * The base implementation of methods like `_.findKey` and `_.findLastKey`, - * without support for iteratee shorthands, which iterates over `collection` - * using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the found element or its key, else `undefined`. - */ - function baseFindKey(collection, predicate, eachFunc) { - var result; - eachFunc(collection, function(value, key, collection) { - if (predicate(value, key, collection)) { - result = key; - return false; - } - }); - return result; - } - - /** - * The base implementation of `_.findIndex` and `_.findLastIndex` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {number} fromIndex The index to search from. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseFindIndex(array, predicate, fromIndex, fromRight) { - var length = array.length, - index = fromIndex + (fromRight ? 1 : -1); - - while ((fromRight ? index-- : ++index < length)) { - if (predicate(array[index], index, array)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.indexOf` without `fromIndex` bounds checks. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOf(array, value, fromIndex) { - return value === value - ? strictIndexOf(array, value, fromIndex) - : baseFindIndex(array, baseIsNaN, fromIndex); - } - - /** - * This function is like `baseIndexOf` except that it accepts a comparator. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @param {Function} comparator The comparator invoked per element. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOfWith(array, value, fromIndex, comparator) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (comparator(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.isNaN` without support for number objects. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - */ - function baseIsNaN(value) { - return value !== value; - } - - /** - * The base implementation of `_.mean` and `_.meanBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the mean. - */ - function baseMean(array, iteratee) { - var length = array == null ? 0 : array.length; - return length ? (baseSum(array, iteratee) / length) : NAN; - } - - /** - * The base implementation of `_.property` without support for deep paths. - * - * @private - * @param {string} key The key of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function baseProperty(key) { - return function(object) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.propertyOf` without support for deep paths. - * - * @private - * @param {Object} object The object to query. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyOf(object) { - return function(key) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.reduce` and `_.reduceRight`, without support - * for iteratee shorthands, which iterates over `collection` using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} accumulator The initial value. - * @param {boolean} initAccum Specify using the first or last element of - * `collection` as the initial value. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the accumulated value. - */ - function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { - eachFunc(collection, function(value, index, collection) { - accumulator = initAccum - ? (initAccum = false, value) - : iteratee(accumulator, value, index, collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.sortBy` which uses `comparer` to define the - * sort order of `array` and replaces criteria objects with their corresponding - * values. - * - * @private - * @param {Array} array The array to sort. - * @param {Function} comparer The function to define sort order. - * @returns {Array} Returns `array`. - */ - function baseSortBy(array, comparer) { - var length = array.length; - - array.sort(comparer); - while (length--) { - array[length] = array[length].value; - } - return array; - } - - /** - * The base implementation of `_.sum` and `_.sumBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the sum. - */ - function baseSum(array, iteratee) { - var result, - index = -1, - length = array.length; - - while (++index < length) { - var current = iteratee(array[index]); - if (current !== undefined) { - result = result === undefined ? current : (result + current); - } - } - return result; - } - - /** - * The base implementation of `_.times` without support for iteratee shorthands - * or max array length checks. - * - * @private - * @param {number} n The number of times to invoke `iteratee`. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the array of results. - */ - function baseTimes(n, iteratee) { - var index = -1, - result = Array(n); - - while (++index < n) { - result[index] = iteratee(index); - } - return result; - } - - /** - * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array - * of key-value pairs for `object` corresponding to the property names of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the key-value pairs. - */ - function baseToPairs(object, props) { - return arrayMap(props, function(key) { - return [key, object[key]]; - }); - } - - /** - * The base implementation of `_.unary` without support for storing metadata. - * - * @private - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - */ - function baseUnary(func) { - return function(value) { - return func(value); - }; - } - - /** - * The base implementation of `_.values` and `_.valuesIn` which creates an - * array of `object` property values corresponding to the property names - * of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the array of property values. - */ - function baseValues(object, props) { - return arrayMap(props, function(key) { - return object[key]; - }); - } - - /** - * Checks if a `cache` value for `key` exists. - * - * @private - * @param {Object} cache The cache to query. - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function cacheHas(cache, key) { - return cache.has(key); - } - - /** - * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the first unmatched string symbol. - */ - function charsStartIndex(strSymbols, chrSymbols) { - var index = -1, - length = strSymbols.length; - - while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the last unmatched string symbol. - */ - function charsEndIndex(strSymbols, chrSymbols) { - var index = strSymbols.length; - - while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Gets the number of `placeholder` occurrences in `array`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} placeholder The placeholder to search for. - * @returns {number} Returns the placeholder count. - */ - function countHolders(array, placeholder) { - var length = array.length, - result = 0; - - while (length--) { - if (array[length] === placeholder) { - ++result; - } - } - return result; - } - - /** - * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A - * letters to basic Latin letters. - * - * @private - * @param {string} letter The matched letter to deburr. - * @returns {string} Returns the deburred letter. - */ - var deburrLetter = basePropertyOf(deburredLetters); - - /** - * Used by `_.escape` to convert characters to HTML entities. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - var escapeHtmlChar = basePropertyOf(htmlEscapes); - - /** - * Used by `_.template` to escape characters for inclusion in compiled string literals. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - function escapeStringChar(chr) { - return '\\' + stringEscapes[chr]; - } - - /** - * Gets the value at `key` of `object`. - * - * @private - * @param {Object} [object] The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function getValue(object, key) { - return object == null ? undefined : object[key]; - } - - /** - * Checks if `string` contains Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a symbol is found, else `false`. - */ - function hasUnicode(string) { - return reHasUnicode.test(string); - } - - /** - * Checks if `string` contains a word composed of Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a word is found, else `false`. - */ - function hasUnicodeWord(string) { - return reHasUnicodeWord.test(string); - } - - /** - * Converts `iterator` to an array. - * - * @private - * @param {Object} iterator The iterator to convert. - * @returns {Array} Returns the converted array. - */ - function iteratorToArray(iterator) { - var data, - result = []; - - while (!(data = iterator.next()).done) { - result.push(data.value); - } - return result; - } - - /** - * Converts `map` to its key-value pairs. - * - * @private - * @param {Object} map The map to convert. - * @returns {Array} Returns the key-value pairs. - */ - function mapToArray(map) { - var index = -1, - result = Array(map.size); - - map.forEach(function(value, key) { - result[++index] = [key, value]; - }); - return result; - } - - /** - * Creates a unary function that invokes `func` with its argument transformed. - * - * @private - * @param {Function} func The function to wrap. - * @param {Function} transform The argument transform. - * @returns {Function} Returns the new function. - */ - function overArg(func, transform) { - return function(arg) { - return func(transform(arg)); - }; - } - - /** - * Replaces all `placeholder` elements in `array` with an internal placeholder - * and returns an array of their indexes. - * - * @private - * @param {Array} array The array to modify. - * @param {*} placeholder The placeholder to replace. - * @returns {Array} Returns the new array of placeholder indexes. - */ - function replaceHolders(array, placeholder) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value === placeholder || value === PLACEHOLDER) { - array[index] = PLACEHOLDER; - result[resIndex++] = index; - } - } - return result; - } - - /** - * Gets the value at `key`, unless `key` is "__proto__". - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function safeGet(object, key) { - return key == '__proto__' - ? undefined - : object[key]; - } - - /** - * Converts `set` to an array of its values. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the values. - */ - function setToArray(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = value; - }); - return result; - } - - /** - * Converts `set` to its value-value pairs. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the value-value pairs. - */ - function setToPairs(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = [value, value]; - }); - return result; - } - - /** - * A specialized version of `_.indexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictIndexOf(array, value, fromIndex) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } - - /** - * A specialized version of `_.lastIndexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictLastIndexOf(array, value, fromIndex) { - var index = fromIndex + 1; - while (index--) { - if (array[index] === value) { - return index; - } - } - return index; - } - - /** - * Gets the number of symbols in `string`. - * - * @private - * @param {string} string The string to inspect. - * @returns {number} Returns the string size. - */ - function stringSize(string) { - return hasUnicode(string) - ? unicodeSize(string) - : asciiSize(string); - } - - /** - * Converts `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function stringToArray(string) { - return hasUnicode(string) - ? unicodeToArray(string) - : asciiToArray(string); - } - - /** - * Used by `_.unescape` to convert HTML entities to characters. - * - * @private - * @param {string} chr The matched character to unescape. - * @returns {string} Returns the unescaped character. - */ - var unescapeHtmlChar = basePropertyOf(htmlUnescapes); - - /** - * Gets the size of a Unicode `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - function unicodeSize(string) { - var result = reUnicode.lastIndex = 0; - while (reUnicode.test(string)) { - ++result; - } - return result; - } - - /** - * Converts a Unicode `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function unicodeToArray(string) { - return string.match(reUnicode) || []; - } - - /** - * Splits a Unicode `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function unicodeWords(string) { - return string.match(reUnicodeWord) || []; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Create a new pristine `lodash` function using the `context` object. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Util - * @param {Object} [context=root] The context object. - * @returns {Function} Returns a new `lodash` function. - * @example - * - * _.mixin({ 'foo': _.constant('foo') }); - * - * var lodash = _.runInContext(); - * lodash.mixin({ 'bar': lodash.constant('bar') }); - * - * _.isFunction(_.foo); - * // => true - * _.isFunction(_.bar); - * // => false - * - * lodash.isFunction(lodash.foo); - * // => false - * lodash.isFunction(lodash.bar); - * // => true - * - * // Create a suped-up `defer` in Node.js. - * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; - */ - var runInContext = (function runInContext(context) { - context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); - - /** Built-in constructor references. */ - var Array = context.Array, - Date = context.Date, - Error = context.Error, - Function = context.Function, - Math = context.Math, - Object = context.Object, - RegExp = context.RegExp, - String = context.String, - TypeError = context.TypeError; - - /** Used for built-in method references. */ - var arrayProto = Array.prototype, - funcProto = Function.prototype, - objectProto = Object.prototype; - - /** Used to detect overreaching core-js shims. */ - var coreJsData = context['__core-js_shared__']; - - /** Used to resolve the decompiled source of functions. */ - var funcToString = funcProto.toString; - - /** Used to check objects for own properties. */ - var hasOwnProperty = objectProto.hasOwnProperty; - - /** Used to generate unique IDs. */ - var idCounter = 0; - - /** Used to detect methods masquerading as native. */ - var maskSrcKey = (function() { - var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); - return uid ? ('Symbol(src)_1.' + uid) : ''; - }()); - - /** - * Used to resolve the - * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) - * of values. - */ - var nativeObjectToString = objectProto.toString; - - /** Used to infer the `Object` constructor. */ - var objectCtorString = funcToString.call(Object); - - /** Used to restore the original `_` reference in `_.noConflict`. */ - var oldDash = root._; - - /** Used to detect if a method is native. */ - var reIsNative = RegExp('^' + - funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') - .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' - ); - - /** Built-in value references. */ - var Buffer = moduleExports ? context.Buffer : undefined, - Symbol = context.Symbol, - Uint8Array = context.Uint8Array, - allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, - getPrototype = overArg(Object.getPrototypeOf, Object), - objectCreate = Object.create, - propertyIsEnumerable = objectProto.propertyIsEnumerable, - splice = arrayProto.splice, - spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, - symIterator = Symbol ? Symbol.iterator : undefined, - symToStringTag = Symbol ? Symbol.toStringTag : undefined; - - var defineProperty = (function() { - try { - var func = getNative(Object, 'defineProperty'); - func({}, '', {}); - return func; - } catch (e) {} - }()); - - /** Mocked built-ins. */ - var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, - ctxNow = Date && Date.now !== root.Date.now && Date.now, - ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; - - /* Built-in method references for those with the same name as other `lodash` methods. */ - var nativeCeil = Math.ceil, - nativeFloor = Math.floor, - nativeGetSymbols = Object.getOwnPropertySymbols, - nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, - nativeIsFinite = context.isFinite, - nativeJoin = arrayProto.join, - nativeKeys = overArg(Object.keys, Object), - nativeMax = Math.max, - nativeMin = Math.min, - nativeNow = Date.now, - nativeParseInt = context.parseInt, - nativeRandom = Math.random, - nativeReverse = arrayProto.reverse; - - /* Built-in method references that are verified to be native. */ - var DataView = getNative(context, 'DataView'), - Map = getNative(context, 'Map'), - Promise = getNative(context, 'Promise'), - Set = getNative(context, 'Set'), - WeakMap = getNative(context, 'WeakMap'), - nativeCreate = getNative(Object, 'create'); - - /** Used to store function metadata. */ - var metaMap = WeakMap && new WeakMap; - - /** Used to lookup unminified function names. */ - var realNames = {}; - - /** Used to detect maps, sets, and weakmaps. */ - var dataViewCtorString = toSource(DataView), - mapCtorString = toSource(Map), - promiseCtorString = toSource(Promise), - setCtorString = toSource(Set), - weakMapCtorString = toSource(WeakMap); - - /** Used to convert symbols to primitives and strings. */ - var symbolProto = Symbol ? Symbol.prototype : undefined, - symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, - symbolToString = symbolProto ? symbolProto.toString : undefined; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` object which wraps `value` to enable implicit method - * chain sequences. Methods that operate on and return arrays, collections, - * and functions can be chained together. Methods that retrieve a single value - * or may return a primitive value will automatically end the chain sequence - * and return the unwrapped value. Otherwise, the value must be unwrapped - * with `_#value`. - * - * Explicit chain sequences, which must be unwrapped with `_#value`, may be - * enabled using `_.chain`. - * - * The execution of chained methods is lazy, that is, it's deferred until - * `_#value` is implicitly or explicitly called. - * - * Lazy evaluation allows several methods to support shortcut fusion. - * Shortcut fusion is an optimization to merge iteratee calls; this avoids - * the creation of intermediate arrays and can greatly reduce the number of - * iteratee executions. Sections of a chain sequence qualify for shortcut - * fusion if the section is applied to an array and iteratees accept only - * one argument. The heuristic for whether a section qualifies for shortcut - * fusion is subject to change. - * - * Chaining is supported in custom builds as long as the `_#value` method is - * directly or indirectly included in the build. - * - * In addition to lodash methods, wrappers have `Array` and `String` methods. - * - * The wrapper `Array` methods are: - * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` - * - * The wrapper `String` methods are: - * `replace` and `split` - * - * The wrapper methods that support shortcut fusion are: - * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, - * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, - * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` - * - * The chainable wrapper methods are: - * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, - * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, - * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, - * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, - * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, - * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, - * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, - * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, - * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, - * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, - * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, - * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, - * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, - * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, - * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, - * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, - * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, - * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, - * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, - * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, - * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, - * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, - * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, - * `zipObject`, `zipObjectDeep`, and `zipWith` - * - * The wrapper methods that are **not** chainable by default are: - * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, - * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, - * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, - * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, - * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, - * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, - * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, - * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, - * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, - * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, - * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, - * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, - * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, - * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, - * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, - * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, - * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, - * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, - * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, - * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, - * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, - * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, - * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, - * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, - * `upperFirst`, `value`, and `words` - * - * @name _ - * @constructor - * @category Seq - * @param {*} value The value to wrap in a `lodash` instance. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2, 3]); - * - * // Returns an unwrapped value. - * wrapped.reduce(_.add); - * // => 6 - * - * // Returns a wrapped value. - * var squares = wrapped.map(square); - * - * _.isArray(squares); - * // => false - * - * _.isArray(squares.value()); - * // => true - */ - function lodash(value) { - if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { - if (value instanceof LodashWrapper) { - return value; - } - if (hasOwnProperty.call(value, '__wrapped__')) { - return wrapperClone(value); - } - } - return new LodashWrapper(value); - } - - /** - * The base implementation of `_.create` without support for assigning - * properties to the created object. - * - * @private - * @param {Object} proto The object to inherit from. - * @returns {Object} Returns the new object. - */ - var baseCreate = (function() { - function object() {} - return function(proto) { - if (!isObject(proto)) { - return {}; - } - if (objectCreate) { - return objectCreate(proto); - } - object.prototype = proto; - var result = new object; - object.prototype = undefined; - return result; - }; - }()); - - /** - * The function whose prototype chain sequence wrappers inherit from. - * - * @private - */ - function baseLodash() { - // No operation performed. - } - - /** - * The base constructor for creating `lodash` wrapper objects. - * - * @private - * @param {*} value The value to wrap. - * @param {boolean} [chainAll] Enable explicit method chain sequences. - */ - function LodashWrapper(value, chainAll) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__chain__ = !!chainAll; - this.__index__ = 0; - this.__values__ = undefined; - } - - /** - * By default, the template delimiters used by lodash are like those in - * embedded Ruby (ERB) as well as ES2015 template strings. Change the - * following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type {Object} - */ - lodash.templateSettings = { - - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'escape': reEscape, - - /** - * Used to detect code to be evaluated. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'evaluate': reEvaluate, - - /** - * Used to detect `data` property values to inject. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'interpolate': reInterpolate, - - /** - * Used to reference the data object in the template text. - * - * @memberOf _.templateSettings - * @type {string} - */ - 'variable': '', - - /** - * Used to import variables into the compiled template. - * - * @memberOf _.templateSettings - * @type {Object} - */ - 'imports': { - - /** - * A reference to the `lodash` function. - * - * @memberOf _.templateSettings.imports - * @type {Function} - */ - '_': lodash - } - }; - - // Ensure wrappers are instances of `baseLodash`. - lodash.prototype = baseLodash.prototype; - lodash.prototype.constructor = lodash; - - LodashWrapper.prototype = baseCreate(baseLodash.prototype); - LodashWrapper.prototype.constructor = LodashWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. - * - * @private - * @constructor - * @param {*} value The value to wrap. - */ - function LazyWrapper(value) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__dir__ = 1; - this.__filtered__ = false; - this.__iteratees__ = []; - this.__takeCount__ = MAX_ARRAY_LENGTH; - this.__views__ = []; - } - - /** - * Creates a clone of the lazy wrapper object. - * - * @private - * @name clone - * @memberOf LazyWrapper - * @returns {Object} Returns the cloned `LazyWrapper` object. - */ - function lazyClone() { - var result = new LazyWrapper(this.__wrapped__); - result.__actions__ = copyArray(this.__actions__); - result.__dir__ = this.__dir__; - result.__filtered__ = this.__filtered__; - result.__iteratees__ = copyArray(this.__iteratees__); - result.__takeCount__ = this.__takeCount__; - result.__views__ = copyArray(this.__views__); - return result; - } - - /** - * Reverses the direction of lazy iteration. - * - * @private - * @name reverse - * @memberOf LazyWrapper - * @returns {Object} Returns the new reversed `LazyWrapper` object. - */ - function lazyReverse() { - if (this.__filtered__) { - var result = new LazyWrapper(this); - result.__dir__ = -1; - result.__filtered__ = true; - } else { - result = this.clone(); - result.__dir__ *= -1; - } - return result; - } - - /** - * Extracts the unwrapped value from its lazy wrapper. - * - * @private - * @name value - * @memberOf LazyWrapper - * @returns {*} Returns the unwrapped value. - */ - function lazyValue() { - var array = this.__wrapped__.value(), - dir = this.__dir__, - isArr = isArray(array), - isRight = dir < 0, - arrLength = isArr ? array.length : 0, - view = getView(0, arrLength, this.__views__), - start = view.start, - end = view.end, - length = end - start, - index = isRight ? end : (start - 1), - iteratees = this.__iteratees__, - iterLength = iteratees.length, - resIndex = 0, - takeCount = nativeMin(length, this.__takeCount__); - - if (!isArr || (!isRight && arrLength == length && takeCount == length)) { - return baseWrapperValue(array, this.__actions__); - } - var result = []; - - outer: - while (length-- && resIndex < takeCount) { - index += dir; - - var iterIndex = -1, - value = array[index]; - - while (++iterIndex < iterLength) { - var data = iteratees[iterIndex], - iteratee = data.iteratee, - type = data.type, - computed = iteratee(value); - - if (type == LAZY_MAP_FLAG) { - value = computed; - } else if (!computed) { - if (type == LAZY_FILTER_FLAG) { - continue outer; - } else { - break outer; - } - } - } - result[resIndex++] = value; - } - return result; - } - - // Ensure `LazyWrapper` is an instance of `baseLodash`. - LazyWrapper.prototype = baseCreate(baseLodash.prototype); - LazyWrapper.prototype.constructor = LazyWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a hash object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Hash(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the hash. - * - * @private - * @name clear - * @memberOf Hash - */ - function hashClear() { - this.__data__ = nativeCreate ? nativeCreate(null) : {}; - this.size = 0; - } - - /** - * Removes `key` and its value from the hash. - * - * @private - * @name delete - * @memberOf Hash - * @param {Object} hash The hash to modify. - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function hashDelete(key) { - var result = this.has(key) && delete this.__data__[key]; - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the hash value for `key`. - * - * @private - * @name get - * @memberOf Hash - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function hashGet(key) { - var data = this.__data__; - if (nativeCreate) { - var result = data[key]; - return result === HASH_UNDEFINED ? undefined : result; - } - return hasOwnProperty.call(data, key) ? data[key] : undefined; - } - - /** - * Checks if a hash value for `key` exists. - * - * @private - * @name has - * @memberOf Hash - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function hashHas(key) { - var data = this.__data__; - return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); - } - - /** - * Sets the hash `key` to `value`. - * - * @private - * @name set - * @memberOf Hash - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the hash instance. - */ - function hashSet(key, value) { - var data = this.__data__; - this.size += this.has(key) ? 0 : 1; - data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; - return this; - } - - // Add methods to `Hash`. - Hash.prototype.clear = hashClear; - Hash.prototype['delete'] = hashDelete; - Hash.prototype.get = hashGet; - Hash.prototype.has = hashHas; - Hash.prototype.set = hashSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an list cache object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function ListCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the list cache. - * - * @private - * @name clear - * @memberOf ListCache - */ - function listCacheClear() { - this.__data__ = []; - this.size = 0; - } - - /** - * Removes `key` and its value from the list cache. - * - * @private - * @name delete - * @memberOf ListCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function listCacheDelete(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - return false; - } - var lastIndex = data.length - 1; - if (index == lastIndex) { - data.pop(); - } else { - splice.call(data, index, 1); - } - --this.size; - return true; - } - - /** - * Gets the list cache value for `key`. - * - * @private - * @name get - * @memberOf ListCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function listCacheGet(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - return index < 0 ? undefined : data[index][1]; - } - - /** - * Checks if a list cache value for `key` exists. - * - * @private - * @name has - * @memberOf ListCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function listCacheHas(key) { - return assocIndexOf(this.__data__, key) > -1; - } - - /** - * Sets the list cache `key` to `value`. - * - * @private - * @name set - * @memberOf ListCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the list cache instance. - */ - function listCacheSet(key, value) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - ++this.size; - data.push([key, value]); - } else { - data[index][1] = value; - } - return this; - } - - // Add methods to `ListCache`. - ListCache.prototype.clear = listCacheClear; - ListCache.prototype['delete'] = listCacheDelete; - ListCache.prototype.get = listCacheGet; - ListCache.prototype.has = listCacheHas; - ListCache.prototype.set = listCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a map cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function MapCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the map. - * - * @private - * @name clear - * @memberOf MapCache - */ - function mapCacheClear() { - this.size = 0; - this.__data__ = { - 'hash': new Hash, - 'map': new (Map || ListCache), - 'string': new Hash - }; - } - - /** - * Removes `key` and its value from the map. - * - * @private - * @name delete - * @memberOf MapCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function mapCacheDelete(key) { - var result = getMapData(this, key)['delete'](key); - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the map value for `key`. - * - * @private - * @name get - * @memberOf MapCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function mapCacheGet(key) { - return getMapData(this, key).get(key); - } - - /** - * Checks if a map value for `key` exists. - * - * @private - * @name has - * @memberOf MapCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function mapCacheHas(key) { - return getMapData(this, key).has(key); - } - - /** - * Sets the map `key` to `value`. - * - * @private - * @name set - * @memberOf MapCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the map cache instance. - */ - function mapCacheSet(key, value) { - var data = getMapData(this, key), - size = data.size; - - data.set(key, value); - this.size += data.size == size ? 0 : 1; - return this; - } - - // Add methods to `MapCache`. - MapCache.prototype.clear = mapCacheClear; - MapCache.prototype['delete'] = mapCacheDelete; - MapCache.prototype.get = mapCacheGet; - MapCache.prototype.has = mapCacheHas; - MapCache.prototype.set = mapCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * - * Creates an array cache object to store unique values. - * - * @private - * @constructor - * @param {Array} [values] The values to cache. - */ - function SetCache(values) { - var index = -1, - length = values == null ? 0 : values.length; - - this.__data__ = new MapCache; - while (++index < length) { - this.add(values[index]); - } - } - - /** - * Adds `value` to the array cache. - * - * @private - * @name add - * @memberOf SetCache - * @alias push - * @param {*} value The value to cache. - * @returns {Object} Returns the cache instance. - */ - function setCacheAdd(value) { - this.__data__.set(value, HASH_UNDEFINED); - return this; - } - - /** - * Checks if `value` is in the array cache. - * - * @private - * @name has - * @memberOf SetCache - * @param {*} value The value to search for. - * @returns {number} Returns `true` if `value` is found, else `false`. - */ - function setCacheHas(value) { - return this.__data__.has(value); - } - - // Add methods to `SetCache`. - SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; - SetCache.prototype.has = setCacheHas; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a stack cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Stack(entries) { - var data = this.__data__ = new ListCache(entries); - this.size = data.size; - } - - /** - * Removes all key-value entries from the stack. - * - * @private - * @name clear - * @memberOf Stack - */ - function stackClear() { - this.__data__ = new ListCache; - this.size = 0; - } - - /** - * Removes `key` and its value from the stack. - * - * @private - * @name delete - * @memberOf Stack - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function stackDelete(key) { - var data = this.__data__, - result = data['delete'](key); - - this.size = data.size; - return result; - } - - /** - * Gets the stack value for `key`. - * - * @private - * @name get - * @memberOf Stack - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function stackGet(key) { - return this.__data__.get(key); - } - - /** - * Checks if a stack value for `key` exists. - * - * @private - * @name has - * @memberOf Stack - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function stackHas(key) { - return this.__data__.has(key); - } - - /** - * Sets the stack `key` to `value`. - * - * @private - * @name set - * @memberOf Stack - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the stack cache instance. - */ - function stackSet(key, value) { - var data = this.__data__; - if (data instanceof ListCache) { - var pairs = data.__data__; - if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { - pairs.push([key, value]); - this.size = ++data.size; - return this; - } - data = this.__data__ = new MapCache(pairs); - } - data.set(key, value); - this.size = data.size; - return this; - } - - // Add methods to `Stack`. - Stack.prototype.clear = stackClear; - Stack.prototype['delete'] = stackDelete; - Stack.prototype.get = stackGet; - Stack.prototype.has = stackHas; - Stack.prototype.set = stackSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of the enumerable property names of the array-like `value`. - * - * @private - * @param {*} value The value to query. - * @param {boolean} inherited Specify returning inherited property names. - * @returns {Array} Returns the array of property names. - */ - function arrayLikeKeys(value, inherited) { - var isArr = isArray(value), - isArg = !isArr && isArguments(value), - isBuff = !isArr && !isArg && isBuffer(value), - isType = !isArr && !isArg && !isBuff && isTypedArray(value), - skipIndexes = isArr || isArg || isBuff || isType, - result = skipIndexes ? baseTimes(value.length, String) : [], - length = result.length; - - for (var key in value) { - if ((inherited || hasOwnProperty.call(value, key)) && - !(skipIndexes && ( - // Safari 9 has enumerable `arguments.length` in strict mode. - key == 'length' || - // Node.js 0.10 has enumerable non-index properties on buffers. - (isBuff && (key == 'offset' || key == 'parent')) || - // PhantomJS 2 has enumerable non-index properties on typed arrays. - (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || - // Skip index properties. - isIndex(key, length) - ))) { - result.push(key); - } - } - return result; - } - - /** - * A specialized version of `_.sample` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @returns {*} Returns the random element. - */ - function arraySample(array) { - var length = array.length; - return length ? array[baseRandom(0, length - 1)] : undefined; - } - - /** - * A specialized version of `_.sampleSize` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function arraySampleSize(array, n) { - return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); - } - - /** - * A specialized version of `_.shuffle` for arrays. - * - * @private - * @param {Array} array The array to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function arrayShuffle(array) { - return shuffleSelf(copyArray(array)); - } - - /** - * This function is like `assignValue` except that it doesn't assign - * `undefined` values. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignMergeValue(object, key, value) { - if ((value !== undefined && !eq(object[key], value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Assigns `value` to `key` of `object` if the existing value is not equivalent - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignValue(object, key, value) { - var objValue = object[key]; - if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Gets the index at which the `key` is found in `array` of key-value pairs. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} key The key to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function assocIndexOf(array, key) { - var length = array.length; - while (length--) { - if (eq(array[length][0], key)) { - return length; - } - } - return -1; - } - - /** - * Aggregates elements of `collection` on `accumulator` with keys transformed - * by `iteratee` and values set by `setter`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function baseAggregator(collection, setter, iteratee, accumulator) { - baseEach(collection, function(value, key, collection) { - setter(accumulator, value, iteratee(value), collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.assign` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssign(object, source) { - return object && copyObject(source, keys(source), object); - } - - /** - * The base implementation of `_.assignIn` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssignIn(object, source) { - return object && copyObject(source, keysIn(source), object); - } - - /** - * The base implementation of `assignValue` and `assignMergeValue` without - * value checks. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function baseAssignValue(object, key, value) { - if (key == '__proto__' && defineProperty) { - defineProperty(object, key, { - 'configurable': true, - 'enumerable': true, - 'value': value, - 'writable': true - }); - } else { - object[key] = value; - } - } - - /** - * The base implementation of `_.at` without support for individual paths. - * - * @private - * @param {Object} object The object to iterate over. - * @param {string[]} paths The property paths to pick. - * @returns {Array} Returns the picked elements. - */ - function baseAt(object, paths) { - var index = -1, - length = paths.length, - result = Array(length), - skip = object == null; - - while (++index < length) { - result[index] = skip ? undefined : get(object, paths[index]); - } - return result; - } - - /** - * The base implementation of `_.clamp` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - */ - function baseClamp(number, lower, upper) { - if (number === number) { - if (upper !== undefined) { - number = number <= upper ? number : upper; - } - if (lower !== undefined) { - number = number >= lower ? number : lower; - } - } - return number; - } - - /** - * The base implementation of `_.clone` and `_.cloneDeep` which tracks - * traversed objects. - * - * @private - * @param {*} value The value to clone. - * @param {boolean} bitmask The bitmask flags. - * 1 - Deep clone - * 2 - Flatten inherited properties - * 4 - Clone symbols - * @param {Function} [customizer] The function to customize cloning. - * @param {string} [key] The key of `value`. - * @param {Object} [object] The parent object of `value`. - * @param {Object} [stack] Tracks traversed objects and their clone counterparts. - * @returns {*} Returns the cloned value. - */ - function baseClone(value, bitmask, customizer, key, object, stack) { - var result, - isDeep = bitmask & CLONE_DEEP_FLAG, - isFlat = bitmask & CLONE_FLAT_FLAG, - isFull = bitmask & CLONE_SYMBOLS_FLAG; - - if (customizer) { - result = object ? customizer(value, key, object, stack) : customizer(value); - } - if (result !== undefined) { - return result; - } - if (!isObject(value)) { - return value; - } - var isArr = isArray(value); - if (isArr) { - result = initCloneArray(value); - if (!isDeep) { - return copyArray(value, result); - } - } else { - var tag = getTag(value), - isFunc = tag == funcTag || tag == genTag; - - if (isBuffer(value)) { - return cloneBuffer(value, isDeep); - } - if (tag == objectTag || tag == argsTag || (isFunc && !object)) { - result = (isFlat || isFunc) ? {} : initCloneObject(value); - if (!isDeep) { - return isFlat - ? copySymbolsIn(value, baseAssignIn(result, value)) - : copySymbols(value, baseAssign(result, value)); - } - } else { - if (!cloneableTags[tag]) { - return object ? value : {}; - } - result = initCloneByTag(value, tag, isDeep); - } - } - // Check for circular references and return its corresponding clone. - stack || (stack = new Stack); - var stacked = stack.get(value); - if (stacked) { - return stacked; - } - stack.set(value, result); - - if (isSet(value)) { - value.forEach(function(subValue) { - result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); - }); - - return result; - } - - if (isMap(value)) { - value.forEach(function(subValue, key) { - result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - - return result; - } - - var keysFunc = isFull - ? (isFlat ? getAllKeysIn : getAllKeys) - : (isFlat ? keysIn : keys); - - var props = isArr ? undefined : keysFunc(value); - arrayEach(props || value, function(subValue, key) { - if (props) { - key = subValue; - subValue = value[key]; - } - // Recursively populate clone (susceptible to call stack limits). - assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - return result; - } - - /** - * The base implementation of `_.conforms` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property predicates to conform to. - * @returns {Function} Returns the new spec function. - */ - function baseConforms(source) { - var props = keys(source); - return function(object) { - return baseConformsTo(object, source, props); - }; - } - - /** - * The base implementation of `_.conformsTo` which accepts `props` to check. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - */ - function baseConformsTo(object, source, props) { - var length = props.length; - if (object == null) { - return !length; - } - object = Object(object); - while (length--) { - var key = props[length], - predicate = source[key], - value = object[key]; - - if ((value === undefined && !(key in object)) || !predicate(value)) { - return false; - } - } - return true; - } - - /** - * The base implementation of `_.delay` and `_.defer` which accepts `args` - * to provide to `func`. - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {Array} args The arguments to provide to `func`. - * @returns {number|Object} Returns the timer id or timeout object. - */ - function baseDelay(func, wait, args) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return setTimeout(function() { func.apply(undefined, args); }, wait); - } - - /** - * The base implementation of methods like `_.difference` without support - * for excluding multiple arrays or iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Array} values The values to exclude. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - */ - function baseDifference(array, values, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - isCommon = true, - length = array.length, - result = [], - valuesLength = values.length; - - if (!length) { - return result; - } - if (iteratee) { - values = arrayMap(values, baseUnary(iteratee)); - } - if (comparator) { - includes = arrayIncludesWith; - isCommon = false; - } - else if (values.length >= LARGE_ARRAY_SIZE) { - includes = cacheHas; - isCommon = false; - values = new SetCache(values); - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee == null ? value : iteratee(value); - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var valuesIndex = valuesLength; - while (valuesIndex--) { - if (values[valuesIndex] === computed) { - continue outer; - } - } - result.push(value); - } - else if (!includes(values, computed, comparator)) { - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.forEach` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEach = createBaseEach(baseForOwn); - - /** - * The base implementation of `_.forEachRight` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEachRight = createBaseEach(baseForOwnRight, true); - - /** - * The base implementation of `_.every` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false` - */ - function baseEvery(collection, predicate) { - var result = true; - baseEach(collection, function(value, index, collection) { - result = !!predicate(value, index, collection); - return result; - }); - return result; - } - - /** - * The base implementation of methods like `_.max` and `_.min` which accepts a - * `comparator` to determine the extremum value. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The iteratee invoked per iteration. - * @param {Function} comparator The comparator used to compare values. - * @returns {*} Returns the extremum value. - */ - function baseExtremum(array, iteratee, comparator) { - var index = -1, - length = array.length; - - while (++index < length) { - var value = array[index], - current = iteratee(value); - - if (current != null && (computed === undefined - ? (current === current && !isSymbol(current)) - : comparator(current, computed) - )) { - var computed = current, - result = value; - } - } - return result; - } - - /** - * The base implementation of `_.fill` without an iteratee call guard. - * - * @private - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - */ - function baseFill(array, value, start, end) { - var length = array.length; - - start = toInteger(start); - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = (end === undefined || end > length) ? length : toInteger(end); - if (end < 0) { - end += length; - } - end = start > end ? 0 : toLength(end); - while (start < end) { - array[start++] = value; - } - return array; - } - - /** - * The base implementation of `_.filter` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function baseFilter(collection, predicate) { - var result = []; - baseEach(collection, function(value, index, collection) { - if (predicate(value, index, collection)) { - result.push(value); - } - }); - return result; - } - - /** - * The base implementation of `_.flatten` with support for restricting flattening. - * - * @private - * @param {Array} array The array to flatten. - * @param {number} depth The maximum recursion depth. - * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. - * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. - * @param {Array} [result=[]] The initial result value. - * @returns {Array} Returns the new flattened array. - */ - function baseFlatten(array, depth, predicate, isStrict, result) { - var index = -1, - length = array.length; - - predicate || (predicate = isFlattenable); - result || (result = []); - - while (++index < length) { - var value = array[index]; - if (depth > 0 && predicate(value)) { - if (depth > 1) { - // Recursively flatten arrays (susceptible to call stack limits). - baseFlatten(value, depth - 1, predicate, isStrict, result); - } else { - arrayPush(result, value); - } - } else if (!isStrict) { - result[result.length] = value; - } - } - return result; - } - - /** - * The base implementation of `baseForOwn` which iterates over `object` - * properties returned by `keysFunc` and invokes `iteratee` for each property. - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseFor = createBaseFor(); - - /** - * This function is like `baseFor` except that it iterates over properties - * in the opposite order. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseForRight = createBaseFor(true); - - /** - * The base implementation of `_.forOwn` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwn(object, iteratee) { - return object && baseFor(object, iteratee, keys); - } - - /** - * The base implementation of `_.forOwnRight` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwnRight(object, iteratee) { - return object && baseForRight(object, iteratee, keys); - } - - /** - * The base implementation of `_.functions` which creates an array of - * `object` function property names filtered from `props`. - * - * @private - * @param {Object} object The object to inspect. - * @param {Array} props The property names to filter. - * @returns {Array} Returns the function names. - */ - function baseFunctions(object, props) { - return arrayFilter(props, function(key) { - return isFunction(object[key]); - }); - } - - /** - * The base implementation of `_.get` without support for default values. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @returns {*} Returns the resolved value. - */ - function baseGet(object, path) { - path = castPath(path, object); - - var index = 0, - length = path.length; - - while (object != null && index < length) { - object = object[toKey(path[index++])]; - } - return (index && index == length) ? object : undefined; - } - - /** - * The base implementation of `getAllKeys` and `getAllKeysIn` which uses - * `keysFunc` and `symbolsFunc` to get the enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Function} keysFunc The function to get the keys of `object`. - * @param {Function} symbolsFunc The function to get the symbols of `object`. - * @returns {Array} Returns the array of property names and symbols. - */ - function baseGetAllKeys(object, keysFunc, symbolsFunc) { - var result = keysFunc(object); - return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); - } - - /** - * The base implementation of `getTag` without fallbacks for buggy environments. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - function baseGetTag(value) { - if (value == null) { - return value === undefined ? undefinedTag : nullTag; - } - return (symToStringTag && symToStringTag in Object(value)) - ? getRawTag(value) - : objectToString(value); - } - - /** - * The base implementation of `_.gt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - */ - function baseGt(value, other) { - return value > other; - } - - /** - * The base implementation of `_.has` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHas(object, key) { - return object != null && hasOwnProperty.call(object, key); - } - - /** - * The base implementation of `_.hasIn` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHasIn(object, key) { - return object != null && key in Object(object); - } - - /** - * The base implementation of `_.inRange` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to check. - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - */ - function baseInRange(number, start, end) { - return number >= nativeMin(start, end) && number < nativeMax(start, end); - } - - /** - * The base implementation of methods like `_.intersection`, without support - * for iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of shared values. - */ - function baseIntersection(arrays, iteratee, comparator) { - var includes = comparator ? arrayIncludesWith : arrayIncludes, - length = arrays[0].length, - othLength = arrays.length, - othIndex = othLength, - caches = Array(othLength), - maxLength = Infinity, - result = []; - - while (othIndex--) { - var array = arrays[othIndex]; - if (othIndex && iteratee) { - array = arrayMap(array, baseUnary(iteratee)); - } - maxLength = nativeMin(array.length, maxLength); - caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) - ? new SetCache(othIndex && array) - : undefined; - } - array = arrays[0]; - - var index = -1, - seen = caches[0]; - - outer: - while (++index < length && result.length < maxLength) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (!(seen - ? cacheHas(seen, computed) - : includes(result, computed, comparator) - )) { - othIndex = othLength; - while (--othIndex) { - var cache = caches[othIndex]; - if (!(cache - ? cacheHas(cache, computed) - : includes(arrays[othIndex], computed, comparator)) - ) { - continue outer; - } - } - if (seen) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.invert` and `_.invertBy` which inverts - * `object` with values transformed by `iteratee` and set by `setter`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform values. - * @param {Object} accumulator The initial inverted object. - * @returns {Function} Returns `accumulator`. - */ - function baseInverter(object, setter, iteratee, accumulator) { - baseForOwn(object, function(value, key, object) { - setter(accumulator, iteratee(value), key, object); - }); - return accumulator; - } - - /** - * The base implementation of `_.invoke` without support for individual - * method arguments. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {Array} args The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - */ - function baseInvoke(object, path, args) { - path = castPath(path, object); - object = parent(object, path); - var func = object == null ? object : object[toKey(last(path))]; - return func == null ? undefined : apply(func, object, args); - } - - /** - * The base implementation of `_.isArguments`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - */ - function baseIsArguments(value) { - return isObjectLike(value) && baseGetTag(value) == argsTag; - } - - /** - * The base implementation of `_.isArrayBuffer` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - */ - function baseIsArrayBuffer(value) { - return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; - } - - /** - * The base implementation of `_.isDate` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - */ - function baseIsDate(value) { - return isObjectLike(value) && baseGetTag(value) == dateTag; - } - - /** - * The base implementation of `_.isEqual` which supports partial comparisons - * and tracks traversed objects. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {boolean} bitmask The bitmask flags. - * 1 - Unordered comparison - * 2 - Partial comparison - * @param {Function} [customizer] The function to customize comparisons. - * @param {Object} [stack] Tracks traversed `value` and `other` objects. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - */ - function baseIsEqual(value, other, bitmask, customizer, stack) { - if (value === other) { - return true; - } - if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { - return value !== value && other !== other; - } - return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); - } - - /** - * A specialized version of `baseIsEqual` for arrays and objects which performs - * deep comparisons and tracks traversed objects enabling objects with circular - * references to be compared. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} [stack] Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { - var objIsArr = isArray(object), - othIsArr = isArray(other), - objTag = objIsArr ? arrayTag : getTag(object), - othTag = othIsArr ? arrayTag : getTag(other); - - objTag = objTag == argsTag ? objectTag : objTag; - othTag = othTag == argsTag ? objectTag : othTag; - - var objIsObj = objTag == objectTag, - othIsObj = othTag == objectTag, - isSameTag = objTag == othTag; - - if (isSameTag && isBuffer(object)) { - if (!isBuffer(other)) { - return false; - } - objIsArr = true; - objIsObj = false; - } - if (isSameTag && !objIsObj) { - stack || (stack = new Stack); - return (objIsArr || isTypedArray(object)) - ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) - : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); - } - if (!(bitmask & COMPARE_PARTIAL_FLAG)) { - var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), - othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); - - if (objIsWrapped || othIsWrapped) { - var objUnwrapped = objIsWrapped ? object.value() : object, - othUnwrapped = othIsWrapped ? other.value() : other; - - stack || (stack = new Stack); - return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); - } - } - if (!isSameTag) { - return false; - } - stack || (stack = new Stack); - return equalObjects(object, other, bitmask, customizer, equalFunc, stack); - } - - /** - * The base implementation of `_.isMap` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - */ - function baseIsMap(value) { - return isObjectLike(value) && getTag(value) == mapTag; - } - - /** - * The base implementation of `_.isMatch` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Array} matchData The property names, values, and compare flags to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - */ - function baseIsMatch(object, source, matchData, customizer) { - var index = matchData.length, - length = index, - noCustomizer = !customizer; - - if (object == null) { - return !length; - } - object = Object(object); - while (index--) { - var data = matchData[index]; - if ((noCustomizer && data[2]) - ? data[1] !== object[data[0]] - : !(data[0] in object) - ) { - return false; - } - } - while (++index < length) { - data = matchData[index]; - var key = data[0], - objValue = object[key], - srcValue = data[1]; - - if (noCustomizer && data[2]) { - if (objValue === undefined && !(key in object)) { - return false; - } - } else { - var stack = new Stack; - if (customizer) { - var result = customizer(objValue, srcValue, key, object, source, stack); - } - if (!(result === undefined - ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) - : result - )) { - return false; - } - } - } - return true; - } - - /** - * The base implementation of `_.isNative` without bad shim checks. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - */ - function baseIsNative(value) { - if (!isObject(value) || isMasked(value)) { - return false; - } - var pattern = isFunction(value) ? reIsNative : reIsHostCtor; - return pattern.test(toSource(value)); - } - - /** - * The base implementation of `_.isRegExp` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - */ - function baseIsRegExp(value) { - return isObjectLike(value) && baseGetTag(value) == regexpTag; - } - - /** - * The base implementation of `_.isSet` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - */ - function baseIsSet(value) { - return isObjectLike(value) && getTag(value) == setTag; - } - - /** - * The base implementation of `_.isTypedArray` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - */ - function baseIsTypedArray(value) { - return isObjectLike(value) && - isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; - } - - /** - * The base implementation of `_.iteratee`. - * - * @private - * @param {*} [value=_.identity] The value to convert to an iteratee. - * @returns {Function} Returns the iteratee. - */ - function baseIteratee(value) { - // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. - // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. - if (typeof value == 'function') { - return value; - } - if (value == null) { - return identity; - } - if (typeof value == 'object') { - return isArray(value) - ? baseMatchesProperty(value[0], value[1]) - : baseMatches(value); - } - return property(value); - } - - /** - * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeys(object) { - if (!isPrototype(object)) { - return nativeKeys(object); - } - var result = []; - for (var key in Object(object)) { - if (hasOwnProperty.call(object, key) && key != 'constructor') { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeysIn(object) { - if (!isObject(object)) { - return nativeKeysIn(object); - } - var isProto = isPrototype(object), - result = []; - - for (var key in object) { - if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.lt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - */ - function baseLt(value, other) { - return value < other; - } - - /** - * The base implementation of `_.map` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function baseMap(collection, iteratee) { - var index = -1, - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value, key, collection) { - result[++index] = iteratee(value, key, collection); - }); - return result; - } - - /** - * The base implementation of `_.matches` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property values to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatches(source) { - var matchData = getMatchData(source); - if (matchData.length == 1 && matchData[0][2]) { - return matchesStrictComparable(matchData[0][0], matchData[0][1]); - } - return function(object) { - return object === source || baseIsMatch(object, source, matchData); - }; - } - - /** - * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. - * - * @private - * @param {string} path The path of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatchesProperty(path, srcValue) { - if (isKey(path) && isStrictComparable(srcValue)) { - return matchesStrictComparable(toKey(path), srcValue); - } - return function(object) { - var objValue = get(object, path); - return (objValue === undefined && objValue === srcValue) - ? hasIn(object, path) - : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); - }; - } - - /** - * The base implementation of `_.merge` without support for multiple sources. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {number} srcIndex The index of `source`. - * @param {Function} [customizer] The function to customize merged values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMerge(object, source, srcIndex, customizer, stack) { - if (object === source) { - return; - } - baseFor(source, function(srcValue, key) { - if (isObject(srcValue)) { - stack || (stack = new Stack); - baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); - } - else { - var newValue = customizer - ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) - : undefined; - - if (newValue === undefined) { - newValue = srcValue; - } - assignMergeValue(object, key, newValue); - } - }, keysIn); - } - - /** - * A specialized version of `baseMerge` for arrays and objects which performs - * deep merges and tracks traversed objects enabling objects with circular - * references to be merged. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {string} key The key of the value to merge. - * @param {number} srcIndex The index of `source`. - * @param {Function} mergeFunc The function to merge values. - * @param {Function} [customizer] The function to customize assigned values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { - var objValue = safeGet(object, key), - srcValue = safeGet(source, key), - stacked = stack.get(srcValue); - - if (stacked) { - assignMergeValue(object, key, stacked); - return; - } - var newValue = customizer - ? customizer(objValue, srcValue, (key + ''), object, source, stack) - : undefined; - - var isCommon = newValue === undefined; - - if (isCommon) { - var isArr = isArray(srcValue), - isBuff = !isArr && isBuffer(srcValue), - isTyped = !isArr && !isBuff && isTypedArray(srcValue); - - newValue = srcValue; - if (isArr || isBuff || isTyped) { - if (isArray(objValue)) { - newValue = objValue; - } - else if (isArrayLikeObject(objValue)) { - newValue = copyArray(objValue); - } - else if (isBuff) { - isCommon = false; - newValue = cloneBuffer(srcValue, true); - } - else if (isTyped) { - isCommon = false; - newValue = cloneTypedArray(srcValue, true); - } - else { - newValue = []; - } - } - else if (isPlainObject(srcValue) || isArguments(srcValue)) { - newValue = objValue; - if (isArguments(objValue)) { - newValue = toPlainObject(objValue); - } - else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { - newValue = initCloneObject(srcValue); - } - } - else { - isCommon = false; - } - } - if (isCommon) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, newValue); - mergeFunc(newValue, srcValue, srcIndex, customizer, stack); - stack['delete'](srcValue); - } - assignMergeValue(object, key, newValue); - } - - /** - * The base implementation of `_.nth` which doesn't coerce arguments. - * - * @private - * @param {Array} array The array to query. - * @param {number} n The index of the element to return. - * @returns {*} Returns the nth element of `array`. - */ - function baseNth(array, n) { - var length = array.length; - if (!length) { - return; - } - n += n < 0 ? length : 0; - return isIndex(n, length) ? array[n] : undefined; - } - - /** - * The base implementation of `_.orderBy` without param guards. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. - * @param {string[]} orders The sort orders of `iteratees`. - * @returns {Array} Returns the new sorted array. - */ - function baseOrderBy(collection, iteratees, orders) { - var index = -1; - iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); - - var result = baseMap(collection, function(value, key, collection) { - var criteria = arrayMap(iteratees, function(iteratee) { - return iteratee(value); - }); - return { 'criteria': criteria, 'index': ++index, 'value': value }; - }); - - return baseSortBy(result, function(object, other) { - return compareMultiple(object, other, orders); - }); - } - - /** - * The base implementation of `_.pick` without support for individual - * property identifiers. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @returns {Object} Returns the new object. - */ - function basePick(object, paths) { - return basePickBy(object, paths, function(value, path) { - return hasIn(object, path); - }); - } - - /** - * The base implementation of `_.pickBy` without support for iteratee shorthands. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @param {Function} predicate The function invoked per property. - * @returns {Object} Returns the new object. - */ - function basePickBy(object, paths, predicate) { - var index = -1, - length = paths.length, - result = {}; - - while (++index < length) { - var path = paths[index], - value = baseGet(object, path); - - if (predicate(value, path)) { - baseSet(result, castPath(path, object), value); - } - } - return result; - } - - /** - * A specialized version of `baseProperty` which supports deep paths. - * - * @private - * @param {Array|string} path The path of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyDeep(path) { - return function(object) { - return baseGet(object, path); - }; - } - - /** - * The base implementation of `_.pullAllBy` without support for iteratee - * shorthands. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - */ - function basePullAll(array, values, iteratee, comparator) { - var indexOf = comparator ? baseIndexOfWith : baseIndexOf, - index = -1, - length = values.length, - seen = array; - - if (array === values) { - values = copyArray(values); - } - if (iteratee) { - seen = arrayMap(array, baseUnary(iteratee)); - } - while (++index < length) { - var fromIndex = 0, - value = values[index], - computed = iteratee ? iteratee(value) : value; - - while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { - if (seen !== array) { - splice.call(seen, fromIndex, 1); - } - splice.call(array, fromIndex, 1); - } - } - return array; - } - - /** - * The base implementation of `_.pullAt` without support for individual - * indexes or capturing the removed elements. - * - * @private - * @param {Array} array The array to modify. - * @param {number[]} indexes The indexes of elements to remove. - * @returns {Array} Returns `array`. - */ - function basePullAt(array, indexes) { - var length = array ? indexes.length : 0, - lastIndex = length - 1; - - while (length--) { - var index = indexes[length]; - if (length == lastIndex || index !== previous) { - var previous = index; - if (isIndex(index)) { - splice.call(array, index, 1); - } else { - baseUnset(array, index); - } - } - } - return array; - } - - /** - * The base implementation of `_.random` without support for returning - * floating-point numbers. - * - * @private - * @param {number} lower The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the random number. - */ - function baseRandom(lower, upper) { - return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); - } - - /** - * The base implementation of `_.range` and `_.rangeRight` which doesn't - * coerce arguments. - * - * @private - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @param {number} step The value to increment or decrement by. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the range of numbers. - */ - function baseRange(start, end, step, fromRight) { - var index = -1, - length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), - result = Array(length); - - while (length--) { - result[fromRight ? length : ++index] = start; - start += step; - } - return result; - } - - /** - * The base implementation of `_.repeat` which doesn't coerce arguments. - * - * @private - * @param {string} string The string to repeat. - * @param {number} n The number of times to repeat the string. - * @returns {string} Returns the repeated string. - */ - function baseRepeat(string, n) { - var result = ''; - if (!string || n < 1 || n > MAX_SAFE_INTEGER) { - return result; - } - // Leverage the exponentiation by squaring algorithm for a faster repeat. - // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. - do { - if (n % 2) { - result += string; - } - n = nativeFloor(n / 2); - if (n) { - string += string; - } - } while (n); - - return result; - } - - /** - * The base implementation of `_.rest` which doesn't validate or coerce arguments. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - */ - function baseRest(func, start) { - return setToString(overRest(func, start, identity), func + ''); - } - - /** - * The base implementation of `_.sample`. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - */ - function baseSample(collection) { - return arraySample(values(collection)); - } - - /** - * The base implementation of `_.sampleSize` without param guards. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function baseSampleSize(collection, n) { - var array = values(collection); - return shuffleSelf(array, baseClamp(n, 0, array.length)); - } - - /** - * The base implementation of `_.set`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseSet(object, path, value, customizer) { - if (!isObject(object)) { - return object; - } - path = castPath(path, object); - - var index = -1, - length = path.length, - lastIndex = length - 1, - nested = object; - - while (nested != null && ++index < length) { - var key = toKey(path[index]), - newValue = value; - - if (index != lastIndex) { - var objValue = nested[key]; - newValue = customizer ? customizer(objValue, key, nested) : undefined; - if (newValue === undefined) { - newValue = isObject(objValue) - ? objValue - : (isIndex(path[index + 1]) ? [] : {}); - } - } - assignValue(nested, key, newValue); - nested = nested[key]; - } - return object; - } - - /** - * The base implementation of `setData` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var baseSetData = !metaMap ? identity : function(func, data) { - metaMap.set(func, data); - return func; - }; - - /** - * The base implementation of `setToString` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var baseSetToString = !defineProperty ? identity : function(func, string) { - return defineProperty(func, 'toString', { - 'configurable': true, - 'enumerable': false, - 'value': constant(string), - 'writable': true - }); - }; - - /** - * The base implementation of `_.shuffle`. - * - * @private - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function baseShuffle(collection) { - return shuffleSelf(values(collection)); - } - - /** - * The base implementation of `_.slice` without an iteratee call guard. - * - * @private - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function baseSlice(array, start, end) { - var index = -1, - length = array.length; - - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = end > length ? length : end; - if (end < 0) { - end += length; - } - length = start > end ? 0 : ((end - start) >>> 0); - start >>>= 0; - - var result = Array(length); - while (++index < length) { - result[index] = array[index + start]; - } - return result; - } - - /** - * The base implementation of `_.some` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function baseSome(collection, predicate) { - var result; - - baseEach(collection, function(value, index, collection) { - result = predicate(value, index, collection); - return !result; - }); - return !!result; - } - - /** - * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which - * performs a binary search of `array` to determine the index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndex(array, value, retHighest) { - var low = 0, - high = array == null ? low : array.length; - - if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { - while (low < high) { - var mid = (low + high) >>> 1, - computed = array[mid]; - - if (computed !== null && !isSymbol(computed) && - (retHighest ? (computed <= value) : (computed < value))) { - low = mid + 1; - } else { - high = mid; - } - } - return high; - } - return baseSortedIndexBy(array, value, identity, retHighest); - } - - /** - * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` - * which invokes `iteratee` for `value` and each element of `array` to compute - * their sort ranking. The iteratee is invoked with one argument; (value). - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} iteratee The iteratee invoked per element. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndexBy(array, value, iteratee, retHighest) { - value = iteratee(value); - - var low = 0, - high = array == null ? 0 : array.length, - valIsNaN = value !== value, - valIsNull = value === null, - valIsSymbol = isSymbol(value), - valIsUndefined = value === undefined; - - while (low < high) { - var mid = nativeFloor((low + high) / 2), - computed = iteratee(array[mid]), - othIsDefined = computed !== undefined, - othIsNull = computed === null, - othIsReflexive = computed === computed, - othIsSymbol = isSymbol(computed); - - if (valIsNaN) { - var setLow = retHighest || othIsReflexive; - } else if (valIsUndefined) { - setLow = othIsReflexive && (retHighest || othIsDefined); - } else if (valIsNull) { - setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); - } else if (valIsSymbol) { - setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); - } else if (othIsNull || othIsSymbol) { - setLow = false; - } else { - setLow = retHighest ? (computed <= value) : (computed < value); - } - if (setLow) { - low = mid + 1; - } else { - high = mid; - } - } - return nativeMin(high, MAX_ARRAY_INDEX); - } - - /** - * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseSortedUniq(array, iteratee) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - if (!index || !eq(computed, seen)) { - var seen = computed; - result[resIndex++] = value === 0 ? 0 : value; - } - } - return result; - } - - /** - * The base implementation of `_.toNumber` which doesn't ensure correct - * conversions of binary, hexadecimal, or octal string values. - * - * @private - * @param {*} value The value to process. - * @returns {number} Returns the number. - */ - function baseToNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - return +value; - } - - /** - * The base implementation of `_.toString` which doesn't convert nullish - * values to empty strings. - * - * @private - * @param {*} value The value to process. - * @returns {string} Returns the string. - */ - function baseToString(value) { - // Exit early for strings to avoid a performance hit in some environments. - if (typeof value == 'string') { - return value; - } - if (isArray(value)) { - // Recursively convert values (susceptible to call stack limits). - return arrayMap(value, baseToString) + ''; - } - if (isSymbol(value)) { - return symbolToString ? symbolToString.call(value) : ''; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * The base implementation of `_.uniqBy` without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseUniq(array, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - length = array.length, - isCommon = true, - result = [], - seen = result; - - if (comparator) { - isCommon = false; - includes = arrayIncludesWith; - } - else if (length >= LARGE_ARRAY_SIZE) { - var set = iteratee ? null : createSet(array); - if (set) { - return setToArray(set); - } - isCommon = false; - includes = cacheHas; - seen = new SetCache; - } - else { - seen = iteratee ? [] : result; - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var seenIndex = seen.length; - while (seenIndex--) { - if (seen[seenIndex] === computed) { - continue outer; - } - } - if (iteratee) { - seen.push(computed); - } - result.push(value); - } - else if (!includes(seen, computed, comparator)) { - if (seen !== result) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.unset`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The property path to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - */ - function baseUnset(object, path) { - path = castPath(path, object); - object = parent(object, path); - return object == null || delete object[toKey(last(path))]; - } - - /** - * The base implementation of `_.update`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to update. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseUpdate(object, path, updater, customizer) { - return baseSet(object, path, updater(baseGet(object, path)), customizer); - } - - /** - * The base implementation of methods like `_.dropWhile` and `_.takeWhile` - * without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to query. - * @param {Function} predicate The function invoked per iteration. - * @param {boolean} [isDrop] Specify dropping elements instead of taking them. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the slice of `array`. - */ - function baseWhile(array, predicate, isDrop, fromRight) { - var length = array.length, - index = fromRight ? length : -1; - - while ((fromRight ? index-- : ++index < length) && - predicate(array[index], index, array)) {} - - return isDrop - ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) - : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); - } - - /** - * The base implementation of `wrapperValue` which returns the result of - * performing a sequence of actions on the unwrapped `value`, where each - * successive action is supplied the return value of the previous. - * - * @private - * @param {*} value The unwrapped value. - * @param {Array} actions Actions to perform to resolve the unwrapped value. - * @returns {*} Returns the resolved value. - */ - function baseWrapperValue(value, actions) { - var result = value; - if (result instanceof LazyWrapper) { - result = result.value(); - } - return arrayReduce(actions, function(result, action) { - return action.func.apply(action.thisArg, arrayPush([result], action.args)); - }, result); - } - - /** - * The base implementation of methods like `_.xor`, without support for - * iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of values. - */ - function baseXor(arrays, iteratee, comparator) { - var length = arrays.length; - if (length < 2) { - return length ? baseUniq(arrays[0]) : []; - } - var index = -1, - result = Array(length); - - while (++index < length) { - var array = arrays[index], - othIndex = -1; - - while (++othIndex < length) { - if (othIndex != index) { - result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); - } - } - } - return baseUniq(baseFlatten(result, 1), iteratee, comparator); - } - - /** - * This base implementation of `_.zipObject` which assigns values using `assignFunc`. - * - * @private - * @param {Array} props The property identifiers. - * @param {Array} values The property values. - * @param {Function} assignFunc The function to assign values. - * @returns {Object} Returns the new object. - */ - function baseZipObject(props, values, assignFunc) { - var index = -1, - length = props.length, - valsLength = values.length, - result = {}; - - while (++index < length) { - var value = index < valsLength ? values[index] : undefined; - assignFunc(result, props[index], value); - } - return result; - } - - /** - * Casts `value` to an empty array if it's not an array like object. - * - * @private - * @param {*} value The value to inspect. - * @returns {Array|Object} Returns the cast array-like object. - */ - function castArrayLikeObject(value) { - return isArrayLikeObject(value) ? value : []; - } - - /** - * Casts `value` to `identity` if it's not a function. - * - * @private - * @param {*} value The value to inspect. - * @returns {Function} Returns cast function. - */ - function castFunction(value) { - return typeof value == 'function' ? value : identity; - } - - /** - * Casts `value` to a path array if it's not one. - * - * @private - * @param {*} value The value to inspect. - * @param {Object} [object] The object to query keys on. - * @returns {Array} Returns the cast property path array. - */ - function castPath(value, object) { - if (isArray(value)) { - return value; - } - return isKey(value, object) ? [value] : stringToPath(toString(value)); - } - - /** - * A `baseRest` alias which can be replaced with `identity` by module - * replacement plugins. - * - * @private - * @type {Function} - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - var castRest = baseRest; - - /** - * Casts `array` to a slice if it's needed. - * - * @private - * @param {Array} array The array to inspect. - * @param {number} start The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the cast slice. - */ - function castSlice(array, start, end) { - var length = array.length; - end = end === undefined ? length : end; - return (!start && end >= length) ? array : baseSlice(array, start, end); - } - - /** - * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). - * - * @private - * @param {number|Object} id The timer id or timeout object of the timer to clear. - */ - var clearTimeout = ctxClearTimeout || function(id) { - return root.clearTimeout(id); - }; - - /** - * Creates a clone of `buffer`. - * - * @private - * @param {Buffer} buffer The buffer to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Buffer} Returns the cloned buffer. - */ - function cloneBuffer(buffer, isDeep) { - if (isDeep) { - return buffer.slice(); - } - var length = buffer.length, - result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); - - buffer.copy(result); - return result; - } - - /** - * Creates a clone of `arrayBuffer`. - * - * @private - * @param {ArrayBuffer} arrayBuffer The array buffer to clone. - * @returns {ArrayBuffer} Returns the cloned array buffer. - */ - function cloneArrayBuffer(arrayBuffer) { - var result = new arrayBuffer.constructor(arrayBuffer.byteLength); - new Uint8Array(result).set(new Uint8Array(arrayBuffer)); - return result; - } - - /** - * Creates a clone of `dataView`. - * - * @private - * @param {Object} dataView The data view to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned data view. - */ - function cloneDataView(dataView, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; - return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); - } - - /** - * Creates a clone of `regexp`. - * - * @private - * @param {Object} regexp The regexp to clone. - * @returns {Object} Returns the cloned regexp. - */ - function cloneRegExp(regexp) { - var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); - result.lastIndex = regexp.lastIndex; - return result; - } - - /** - * Creates a clone of the `symbol` object. - * - * @private - * @param {Object} symbol The symbol object to clone. - * @returns {Object} Returns the cloned symbol object. - */ - function cloneSymbol(symbol) { - return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; - } - - /** - * Creates a clone of `typedArray`. - * - * @private - * @param {Object} typedArray The typed array to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned typed array. - */ - function cloneTypedArray(typedArray, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; - return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); - } - - /** - * Compares values to sort them in ascending order. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {number} Returns the sort order indicator for `value`. - */ - function compareAscending(value, other) { - if (value !== other) { - var valIsDefined = value !== undefined, - valIsNull = value === null, - valIsReflexive = value === value, - valIsSymbol = isSymbol(value); - - var othIsDefined = other !== undefined, - othIsNull = other === null, - othIsReflexive = other === other, - othIsSymbol = isSymbol(other); - - if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || - (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || - (valIsNull && othIsDefined && othIsReflexive) || - (!valIsDefined && othIsReflexive) || - !valIsReflexive) { - return 1; - } - if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || - (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || - (othIsNull && valIsDefined && valIsReflexive) || - (!othIsDefined && valIsReflexive) || - !othIsReflexive) { - return -1; - } - } - return 0; - } - - /** - * Used by `_.orderBy` to compare multiple properties of a value to another - * and stable sort them. - * - * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, - * specify an order of "desc" for descending or "asc" for ascending sort order - * of corresponding values. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {boolean[]|string[]} orders The order to sort by for each property. - * @returns {number} Returns the sort order indicator for `object`. - */ - function compareMultiple(object, other, orders) { - var index = -1, - objCriteria = object.criteria, - othCriteria = other.criteria, - length = objCriteria.length, - ordersLength = orders.length; - - while (++index < length) { - var result = compareAscending(objCriteria[index], othCriteria[index]); - if (result) { - if (index >= ordersLength) { - return result; - } - var order = orders[index]; - return result * (order == 'desc' ? -1 : 1); - } - } - // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications - // that causes it, under certain circumstances, to provide the same value for - // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 - // for more details. - // - // This also ensures a stable sort in V8 and other engines. - // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. - return object.index - other.index; - } - - /** - * Creates an array that is the composition of partially applied arguments, - * placeholders, and provided arguments into a single array of arguments. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to prepend to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgs(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersLength = holders.length, - leftIndex = -1, - leftLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(leftLength + rangeLength), - isUncurried = !isCurried; - - while (++leftIndex < leftLength) { - result[leftIndex] = partials[leftIndex]; - } - while (++argsIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[holders[argsIndex]] = args[argsIndex]; - } - } - while (rangeLength--) { - result[leftIndex++] = args[argsIndex++]; - } - return result; - } - - /** - * This function is like `composeArgs` except that the arguments composition - * is tailored for `_.partialRight`. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to append to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgsRight(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersIndex = -1, - holdersLength = holders.length, - rightIndex = -1, - rightLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(rangeLength + rightLength), - isUncurried = !isCurried; - - while (++argsIndex < rangeLength) { - result[argsIndex] = args[argsIndex]; - } - var offset = argsIndex; - while (++rightIndex < rightLength) { - result[offset + rightIndex] = partials[rightIndex]; - } - while (++holdersIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[offset + holders[holdersIndex]] = args[argsIndex++]; - } - } - return result; - } - - /** - * Copies the values of `source` to `array`. - * - * @private - * @param {Array} source The array to copy values from. - * @param {Array} [array=[]] The array to copy values to. - * @returns {Array} Returns `array`. - */ - function copyArray(source, array) { - var index = -1, - length = source.length; - - array || (array = Array(length)); - while (++index < length) { - array[index] = source[index]; - } - return array; - } - - /** - * Copies properties of `source` to `object`. - * - * @private - * @param {Object} source The object to copy properties from. - * @param {Array} props The property identifiers to copy. - * @param {Object} [object={}] The object to copy properties to. - * @param {Function} [customizer] The function to customize copied values. - * @returns {Object} Returns `object`. - */ - function copyObject(source, props, object, customizer) { - var isNew = !object; - object || (object = {}); - - var index = -1, - length = props.length; - - while (++index < length) { - var key = props[index]; - - var newValue = customizer - ? customizer(object[key], source[key], key, object, source) - : undefined; - - if (newValue === undefined) { - newValue = source[key]; - } - if (isNew) { - baseAssignValue(object, key, newValue); - } else { - assignValue(object, key, newValue); - } - } - return object; - } - - /** - * Copies own symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbols(source, object) { - return copyObject(source, getSymbols(source), object); - } - - /** - * Copies own and inherited symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbolsIn(source, object) { - return copyObject(source, getSymbolsIn(source), object); - } - - /** - * Creates a function like `_.groupBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} [initializer] The accumulator object initializer. - * @returns {Function} Returns the new aggregator function. - */ - function createAggregator(setter, initializer) { - return function(collection, iteratee) { - var func = isArray(collection) ? arrayAggregator : baseAggregator, - accumulator = initializer ? initializer() : {}; - - return func(collection, setter, getIteratee(iteratee, 2), accumulator); - }; - } - - /** - * Creates a function like `_.assign`. - * - * @private - * @param {Function} assigner The function to assign values. - * @returns {Function} Returns the new assigner function. - */ - function createAssigner(assigner) { - return baseRest(function(object, sources) { - var index = -1, - length = sources.length, - customizer = length > 1 ? sources[length - 1] : undefined, - guard = length > 2 ? sources[2] : undefined; - - customizer = (assigner.length > 3 && typeof customizer == 'function') - ? (length--, customizer) - : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - customizer = length < 3 ? undefined : customizer; - length = 1; - } - object = Object(object); - while (++index < length) { - var source = sources[index]; - if (source) { - assigner(object, source, index, customizer); - } - } - return object; - }); - } - - /** - * Creates a `baseEach` or `baseEachRight` function. - * - * @private - * @param {Function} eachFunc The function to iterate over a collection. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseEach(eachFunc, fromRight) { - return function(collection, iteratee) { - if (collection == null) { - return collection; - } - if (!isArrayLike(collection)) { - return eachFunc(collection, iteratee); - } - var length = collection.length, - index = fromRight ? length : -1, - iterable = Object(collection); - - while ((fromRight ? index-- : ++index < length)) { - if (iteratee(iterable[index], index, iterable) === false) { - break; - } - } - return collection; - }; - } - - /** - * Creates a base function for methods like `_.forIn` and `_.forOwn`. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseFor(fromRight) { - return function(object, iteratee, keysFunc) { - var index = -1, - iterable = Object(object), - props = keysFunc(object), - length = props.length; - - while (length--) { - var key = props[fromRight ? length : ++index]; - if (iteratee(iterable[key], key, iterable) === false) { - break; - } - } - return object; - }; - } - - /** - * Creates a function that wraps `func` to invoke it with the optional `this` - * binding of `thisArg`. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createBind(func, bitmask, thisArg) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return fn.apply(isBind ? thisArg : this, arguments); - } - return wrapper; - } - - /** - * Creates a function like `_.lowerFirst`. - * - * @private - * @param {string} methodName The name of the `String` case method to use. - * @returns {Function} Returns the new case function. - */ - function createCaseFirst(methodName) { - return function(string) { - string = toString(string); - - var strSymbols = hasUnicode(string) - ? stringToArray(string) - : undefined; - - var chr = strSymbols - ? strSymbols[0] - : string.charAt(0); - - var trailing = strSymbols - ? castSlice(strSymbols, 1).join('') - : string.slice(1); - - return chr[methodName]() + trailing; - }; - } - - /** - * Creates a function like `_.camelCase`. - * - * @private - * @param {Function} callback The function to combine each word. - * @returns {Function} Returns the new compounder function. - */ - function createCompounder(callback) { - return function(string) { - return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); - }; - } - - /** - * Creates a function that produces an instance of `Ctor` regardless of - * whether it was invoked as part of a `new` expression or by `call` or `apply`. - * - * @private - * @param {Function} Ctor The constructor to wrap. - * @returns {Function} Returns the new wrapped function. - */ - function createCtor(Ctor) { - return function() { - // Use a `switch` statement to work with class constructors. See - // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist - // for more details. - var args = arguments; - switch (args.length) { - case 0: return new Ctor; - case 1: return new Ctor(args[0]); - case 2: return new Ctor(args[0], args[1]); - case 3: return new Ctor(args[0], args[1], args[2]); - case 4: return new Ctor(args[0], args[1], args[2], args[3]); - case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); - case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); - case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); - } - var thisBinding = baseCreate(Ctor.prototype), - result = Ctor.apply(thisBinding, args); - - // Mimic the constructor's `return` behavior. - // See https://es5.github.io/#x13.2.2 for more details. - return isObject(result) ? result : thisBinding; - }; - } - - /** - * Creates a function that wraps `func` to enable currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {number} arity The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createCurry(func, bitmask, arity) { - var Ctor = createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length, - placeholder = getHolder(wrapper); - - while (index--) { - args[index] = arguments[index]; - } - var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) - ? [] - : replaceHolders(args, placeholder); - - length -= holders.length; - if (length < arity) { - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, undefined, - args, holders, undefined, undefined, arity - length); - } - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return apply(fn, this, args); - } - return wrapper; - } - - /** - * Creates a `_.find` or `_.findLast` function. - * - * @private - * @param {Function} findIndexFunc The function to find the collection index. - * @returns {Function} Returns the new find function. - */ - function createFind(findIndexFunc) { - return function(collection, predicate, fromIndex) { - var iterable = Object(collection); - if (!isArrayLike(collection)) { - var iteratee = getIteratee(predicate, 3); - collection = keys(collection); - predicate = function(key) { return iteratee(iterable[key], key, iterable); }; - } - var index = findIndexFunc(collection, predicate, fromIndex); - return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; - }; - } - - /** - * Creates a `_.flow` or `_.flowRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new flow function. - */ - function createFlow(fromRight) { - return flatRest(function(funcs) { - var length = funcs.length, - index = length, - prereq = LodashWrapper.prototype.thru; - - if (fromRight) { - funcs.reverse(); - } - while (index--) { - var func = funcs[index]; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (prereq && !wrapper && getFuncName(func) == 'wrapper') { - var wrapper = new LodashWrapper([], true); - } - } - index = wrapper ? index : length; - while (++index < length) { - func = funcs[index]; - - var funcName = getFuncName(func), - data = funcName == 'wrapper' ? getData(func) : undefined; - - if (data && isLaziable(data[0]) && - data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && - !data[4].length && data[9] == 1 - ) { - wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); - } else { - wrapper = (func.length == 1 && isLaziable(func)) - ? wrapper[funcName]() - : wrapper.thru(func); - } - } - return function() { - var args = arguments, - value = args[0]; - - if (wrapper && args.length == 1 && isArray(value)) { - return wrapper.plant(value).value(); - } - var index = 0, - result = length ? funcs[index].apply(this, args) : value; - - while (++index < length) { - result = funcs[index].call(this, result); - } - return result; - }; - }); - } - - /** - * Creates a function that wraps `func` to invoke it with optional `this` - * binding of `thisArg`, partial application, and currying. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [partialsRight] The arguments to append to those provided - * to the new function. - * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { - var isAry = bitmask & WRAP_ARY_FLAG, - isBind = bitmask & WRAP_BIND_FLAG, - isBindKey = bitmask & WRAP_BIND_KEY_FLAG, - isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), - isFlip = bitmask & WRAP_FLIP_FLAG, - Ctor = isBindKey ? undefined : createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length; - - while (index--) { - args[index] = arguments[index]; - } - if (isCurried) { - var placeholder = getHolder(wrapper), - holdersCount = countHolders(args, placeholder); - } - if (partials) { - args = composeArgs(args, partials, holders, isCurried); - } - if (partialsRight) { - args = composeArgsRight(args, partialsRight, holdersRight, isCurried); - } - length -= holdersCount; - if (isCurried && length < arity) { - var newHolders = replaceHolders(args, placeholder); - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, thisArg, - args, newHolders, argPos, ary, arity - length - ); - } - var thisBinding = isBind ? thisArg : this, - fn = isBindKey ? thisBinding[func] : func; - - length = args.length; - if (argPos) { - args = reorder(args, argPos); - } else if (isFlip && length > 1) { - args.reverse(); - } - if (isAry && ary < length) { - args.length = ary; - } - if (this && this !== root && this instanceof wrapper) { - fn = Ctor || createCtor(fn); - } - return fn.apply(thisBinding, args); - } - return wrapper; - } - - /** - * Creates a function like `_.invertBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} toIteratee The function to resolve iteratees. - * @returns {Function} Returns the new inverter function. - */ - function createInverter(setter, toIteratee) { - return function(object, iteratee) { - return baseInverter(object, setter, toIteratee(iteratee), {}); - }; - } - - /** - * Creates a function that performs a mathematical operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @param {number} [defaultValue] The value used for `undefined` arguments. - * @returns {Function} Returns the new mathematical operation function. - */ - function createMathOperation(operator, defaultValue) { - return function(value, other) { - var result; - if (value === undefined && other === undefined) { - return defaultValue; - } - if (value !== undefined) { - result = value; - } - if (other !== undefined) { - if (result === undefined) { - return other; - } - if (typeof value == 'string' || typeof other == 'string') { - value = baseToString(value); - other = baseToString(other); - } else { - value = baseToNumber(value); - other = baseToNumber(other); - } - result = operator(value, other); - } - return result; - }; - } - - /** - * Creates a function like `_.over`. - * - * @private - * @param {Function} arrayFunc The function to iterate over iteratees. - * @returns {Function} Returns the new over function. - */ - function createOver(arrayFunc) { - return flatRest(function(iteratees) { - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - return baseRest(function(args) { - var thisArg = this; - return arrayFunc(iteratees, function(iteratee) { - return apply(iteratee, thisArg, args); - }); - }); - }); - } - - /** - * Creates the padding for `string` based on `length`. The `chars` string - * is truncated if the number of characters exceeds `length`. - * - * @private - * @param {number} length The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padding for `string`. - */ - function createPadding(length, chars) { - chars = chars === undefined ? ' ' : baseToString(chars); - - var charsLength = chars.length; - if (charsLength < 2) { - return charsLength ? baseRepeat(chars, length) : chars; - } - var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); - return hasUnicode(chars) - ? castSlice(stringToArray(result), 0, length).join('') - : result.slice(0, length); - } - - /** - * Creates a function that wraps `func` to invoke it with the `this` binding - * of `thisArg` and `partials` prepended to the arguments it receives. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} partials The arguments to prepend to those provided to - * the new function. - * @returns {Function} Returns the new wrapped function. - */ - function createPartial(func, bitmask, thisArg, partials) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var argsIndex = -1, - argsLength = arguments.length, - leftIndex = -1, - leftLength = partials.length, - args = Array(leftLength + argsLength), - fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - - while (++leftIndex < leftLength) { - args[leftIndex] = partials[leftIndex]; - } - while (argsLength--) { - args[leftIndex++] = arguments[++argsIndex]; - } - return apply(fn, isBind ? thisArg : this, args); - } - return wrapper; - } - - /** - * Creates a `_.range` or `_.rangeRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new range function. - */ - function createRange(fromRight) { - return function(start, end, step) { - if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { - end = step = undefined; - } - // Ensure the sign of `-0` is preserved. - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); - return baseRange(start, end, step, fromRight); - }; - } - - /** - * Creates a function that performs a relational operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @returns {Function} Returns the new relational operation function. - */ - function createRelationalOperation(operator) { - return function(value, other) { - if (!(typeof value == 'string' && typeof other == 'string')) { - value = toNumber(value); - other = toNumber(other); - } - return operator(value, other); - }; - } - - /** - * Creates a function that wraps `func` to continue currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {Function} wrapFunc The function to create the `func` wrapper. - * @param {*} placeholder The placeholder value. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { - var isCurry = bitmask & WRAP_CURRY_FLAG, - newHolders = isCurry ? holders : undefined, - newHoldersRight = isCurry ? undefined : holders, - newPartials = isCurry ? partials : undefined, - newPartialsRight = isCurry ? undefined : partials; - - bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); - bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); - - if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { - bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); - } - var newData = [ - func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, - newHoldersRight, argPos, ary, arity - ]; - - var result = wrapFunc.apply(undefined, newData); - if (isLaziable(func)) { - setData(result, newData); - } - result.placeholder = placeholder; - return setWrapToString(result, func, bitmask); - } - - /** - * Creates a function like `_.round`. - * - * @private - * @param {string} methodName The name of the `Math` method to use when rounding. - * @returns {Function} Returns the new round function. - */ - function createRound(methodName) { - var func = Math[methodName]; - return function(number, precision) { - number = toNumber(number); - precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); - if (precision) { - // Shift with exponential notation to avoid floating-point issues. - // See [MDN](https://mdn.io/round#Examples) for more details. - var pair = (toString(number) + 'e').split('e'), - value = func(pair[0] + 'e' + (+pair[1] + precision)); - - pair = (toString(value) + 'e').split('e'); - return +(pair[0] + 'e' + (+pair[1] - precision)); - } - return func(number); - }; - } - - /** - * Creates a set object of `values`. - * - * @private - * @param {Array} values The values to add to the set. - * @returns {Object} Returns the new set. - */ - var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { - return new Set(values); - }; - - /** - * Creates a `_.toPairs` or `_.toPairsIn` function. - * - * @private - * @param {Function} keysFunc The function to get the keys of a given object. - * @returns {Function} Returns the new pairs function. - */ - function createToPairs(keysFunc) { - return function(object) { - var tag = getTag(object); - if (tag == mapTag) { - return mapToArray(object); - } - if (tag == setTag) { - return setToPairs(object); - } - return baseToPairs(object, keysFunc(object)); - }; - } - - /** - * Creates a function that either curries or invokes `func` with optional - * `this` binding and partially applied arguments. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. - * 1 - `_.bind` - * 2 - `_.bindKey` - * 4 - `_.curry` or `_.curryRight` of a bound function - * 8 - `_.curry` - * 16 - `_.curryRight` - * 32 - `_.partial` - * 64 - `_.partialRight` - * 128 - `_.rearg` - * 256 - `_.ary` - * 512 - `_.flip` - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to be partially applied. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { - var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; - if (!isBindKey && typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - var length = partials ? partials.length : 0; - if (!length) { - bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); - partials = holders = undefined; - } - ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); - arity = arity === undefined ? arity : toInteger(arity); - length -= holders ? holders.length : 0; - - if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { - var partialsRight = partials, - holdersRight = holders; - - partials = holders = undefined; - } - var data = isBindKey ? undefined : getData(func); - - var newData = [ - func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, - argPos, ary, arity - ]; - - if (data) { - mergeData(newData, data); - } - func = newData[0]; - bitmask = newData[1]; - thisArg = newData[2]; - partials = newData[3]; - holders = newData[4]; - arity = newData[9] = newData[9] === undefined - ? (isBindKey ? 0 : func.length) - : nativeMax(newData[9] - length, 0); - - if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { - bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); - } - if (!bitmask || bitmask == WRAP_BIND_FLAG) { - var result = createBind(func, bitmask, thisArg); - } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { - result = createCurry(func, bitmask, arity); - } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { - result = createPartial(func, bitmask, thisArg, partials); - } else { - result = createHybrid.apply(undefined, newData); - } - var setter = data ? baseSetData : setData; - return setWrapToString(setter(result, newData), func, bitmask); - } - - /** - * Used by `_.defaults` to customize its `_.assignIn` use to assign properties - * of source objects to the destination object for all destination properties - * that resolve to `undefined`. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to assign. - * @param {Object} object The parent object of `objValue`. - * @returns {*} Returns the value to assign. - */ - function customDefaultsAssignIn(objValue, srcValue, key, object) { - if (objValue === undefined || - (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { - return srcValue; - } - return objValue; - } - - /** - * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source - * objects into destination objects that are passed thru. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to merge. - * @param {Object} object The parent object of `objValue`. - * @param {Object} source The parent object of `srcValue`. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - * @returns {*} Returns the value to assign. - */ - function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { - if (isObject(objValue) && isObject(srcValue)) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, objValue); - baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); - stack['delete'](srcValue); - } - return objValue; - } - - /** - * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain - * objects. - * - * @private - * @param {*} value The value to inspect. - * @param {string} key The key of the property to inspect. - * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. - */ - function customOmitClone(value) { - return isPlainObject(value) ? undefined : value; - } - - /** - * A specialized version of `baseIsEqualDeep` for arrays with support for - * partial deep comparisons. - * - * @private - * @param {Array} array The array to compare. - * @param {Array} other The other array to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `array` and `other` objects. - * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. - */ - function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - arrLength = array.length, - othLength = other.length; - - if (arrLength != othLength && !(isPartial && othLength > arrLength)) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(array); - if (stacked && stack.get(other)) { - return stacked == other; - } - var index = -1, - result = true, - seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; - - stack.set(array, other); - stack.set(other, array); - - // Ignore non-index properties. - while (++index < arrLength) { - var arrValue = array[index], - othValue = other[index]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, arrValue, index, other, array, stack) - : customizer(arrValue, othValue, index, array, other, stack); - } - if (compared !== undefined) { - if (compared) { - continue; - } - result = false; - break; - } - // Recursively compare arrays (susceptible to call stack limits). - if (seen) { - if (!arraySome(other, function(othValue, othIndex) { - if (!cacheHas(seen, othIndex) && - (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { - return seen.push(othIndex); - } - })) { - result = false; - break; - } - } else if (!( - arrValue === othValue || - equalFunc(arrValue, othValue, bitmask, customizer, stack) - )) { - result = false; - break; - } - } - stack['delete'](array); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseIsEqualDeep` for comparing objects of - * the same `toStringTag`. - * - * **Note:** This function only supports comparing values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {string} tag The `toStringTag` of the objects to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { - switch (tag) { - case dataViewTag: - if ((object.byteLength != other.byteLength) || - (object.byteOffset != other.byteOffset)) { - return false; - } - object = object.buffer; - other = other.buffer; - - case arrayBufferTag: - if ((object.byteLength != other.byteLength) || - !equalFunc(new Uint8Array(object), new Uint8Array(other))) { - return false; - } - return true; - - case boolTag: - case dateTag: - case numberTag: - // Coerce booleans to `1` or `0` and dates to milliseconds. - // Invalid dates are coerced to `NaN`. - return eq(+object, +other); - - case errorTag: - return object.name == other.name && object.message == other.message; - - case regexpTag: - case stringTag: - // Coerce regexes to strings and treat strings, primitives and objects, - // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring - // for more details. - return object == (other + ''); - - case mapTag: - var convert = mapToArray; - - case setTag: - var isPartial = bitmask & COMPARE_PARTIAL_FLAG; - convert || (convert = setToArray); - - if (object.size != other.size && !isPartial) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked) { - return stacked == other; - } - bitmask |= COMPARE_UNORDERED_FLAG; - - // Recursively compare objects (susceptible to call stack limits). - stack.set(object, other); - var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); - stack['delete'](object); - return result; - - case symbolTag: - if (symbolValueOf) { - return symbolValueOf.call(object) == symbolValueOf.call(other); - } - } - return false; - } - - /** - * A specialized version of `baseIsEqualDeep` for objects with support for - * partial deep comparisons. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - objProps = getAllKeys(object), - objLength = objProps.length, - othProps = getAllKeys(other), - othLength = othProps.length; - - if (objLength != othLength && !isPartial) { - return false; - } - var index = objLength; - while (index--) { - var key = objProps[index]; - if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { - return false; - } - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked && stack.get(other)) { - return stacked == other; - } - var result = true; - stack.set(object, other); - stack.set(other, object); - - var skipCtor = isPartial; - while (++index < objLength) { - key = objProps[index]; - var objValue = object[key], - othValue = other[key]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, objValue, key, other, object, stack) - : customizer(objValue, othValue, key, object, other, stack); - } - // Recursively compare objects (susceptible to call stack limits). - if (!(compared === undefined - ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) - : compared - )) { - result = false; - break; - } - skipCtor || (skipCtor = key == 'constructor'); - } - if (result && !skipCtor) { - var objCtor = object.constructor, - othCtor = other.constructor; - - // Non `Object` object instances with different constructors are not equal. - if (objCtor != othCtor && - ('constructor' in object && 'constructor' in other) && - !(typeof objCtor == 'function' && objCtor instanceof objCtor && - typeof othCtor == 'function' && othCtor instanceof othCtor)) { - result = false; - } - } - stack['delete'](object); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseRest` which flattens the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - function flatRest(func) { - return setToString(overRest(func, undefined, flatten), func + ''); - } - - /** - * Creates an array of own enumerable property names and symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeys(object) { - return baseGetAllKeys(object, keys, getSymbols); - } - - /** - * Creates an array of own and inherited enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeysIn(object) { - return baseGetAllKeys(object, keysIn, getSymbolsIn); - } - - /** - * Gets metadata for `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {*} Returns the metadata for `func`. - */ - var getData = !metaMap ? noop : function(func) { - return metaMap.get(func); - }; - - /** - * Gets the name of `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {string} Returns the function name. - */ - function getFuncName(func) { - var result = (func.name + ''), - array = realNames[result], - length = hasOwnProperty.call(realNames, result) ? array.length : 0; - - while (length--) { - var data = array[length], - otherFunc = data.func; - if (otherFunc == null || otherFunc == func) { - return data.name; - } - } - return result; - } - - /** - * Gets the argument placeholder value for `func`. - * - * @private - * @param {Function} func The function to inspect. - * @returns {*} Returns the placeholder value. - */ - function getHolder(func) { - var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; - return object.placeholder; - } - - /** - * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, - * this function returns the custom method, otherwise it returns `baseIteratee`. - * If arguments are provided, the chosen function is invoked with them and - * its result is returned. - * - * @private - * @param {*} [value] The value to convert to an iteratee. - * @param {number} [arity] The arity of the created iteratee. - * @returns {Function} Returns the chosen function or its result. - */ - function getIteratee() { - var result = lodash.iteratee || iteratee; - result = result === iteratee ? baseIteratee : result; - return arguments.length ? result(arguments[0], arguments[1]) : result; - } - - /** - * Gets the data for `map`. - * - * @private - * @param {Object} map The map to query. - * @param {string} key The reference key. - * @returns {*} Returns the map data. - */ - function getMapData(map, key) { - var data = map.__data__; - return isKeyable(key) - ? data[typeof key == 'string' ? 'string' : 'hash'] - : data.map; - } - - /** - * Gets the property names, values, and compare flags of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the match data of `object`. - */ - function getMatchData(object) { - var result = keys(object), - length = result.length; - - while (length--) { - var key = result[length], - value = object[key]; - - result[length] = [key, value, isStrictComparable(value)]; - } - return result; - } - - /** - * Gets the native function at `key` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the method to get. - * @returns {*} Returns the function if it's native, else `undefined`. - */ - function getNative(object, key) { - var value = getValue(object, key); - return baseIsNative(value) ? value : undefined; - } - - /** - * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the raw `toStringTag`. - */ - function getRawTag(value) { - var isOwn = hasOwnProperty.call(value, symToStringTag), - tag = value[symToStringTag]; - - try { - value[symToStringTag] = undefined; - var unmasked = true; - } catch (e) {} - - var result = nativeObjectToString.call(value); - if (unmasked) { - if (isOwn) { - value[symToStringTag] = tag; - } else { - delete value[symToStringTag]; - } - } - return result; - } - - /** - * Creates an array of the own enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbols = !nativeGetSymbols ? stubArray : function(object) { - if (object == null) { - return []; - } - object = Object(object); - return arrayFilter(nativeGetSymbols(object), function(symbol) { - return propertyIsEnumerable.call(object, symbol); - }); - }; - - /** - * Creates an array of the own and inherited enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { - var result = []; - while (object) { - arrayPush(result, getSymbols(object)); - object = getPrototype(object); - } - return result; - }; - - /** - * Gets the `toStringTag` of `value`. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - var getTag = baseGetTag; - - // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. - if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || - (Map && getTag(new Map) != mapTag) || - (Promise && getTag(Promise.resolve()) != promiseTag) || - (Set && getTag(new Set) != setTag) || - (WeakMap && getTag(new WeakMap) != weakMapTag)) { - getTag = function(value) { - var result = baseGetTag(value), - Ctor = result == objectTag ? value.constructor : undefined, - ctorString = Ctor ? toSource(Ctor) : ''; - - if (ctorString) { - switch (ctorString) { - case dataViewCtorString: return dataViewTag; - case mapCtorString: return mapTag; - case promiseCtorString: return promiseTag; - case setCtorString: return setTag; - case weakMapCtorString: return weakMapTag; - } - } - return result; - }; - } - - /** - * Gets the view, applying any `transforms` to the `start` and `end` positions. - * - * @private - * @param {number} start The start of the view. - * @param {number} end The end of the view. - * @param {Array} transforms The transformations to apply to the view. - * @returns {Object} Returns an object containing the `start` and `end` - * positions of the view. - */ - function getView(start, end, transforms) { - var index = -1, - length = transforms.length; - - while (++index < length) { - var data = transforms[index], - size = data.size; - - switch (data.type) { - case 'drop': start += size; break; - case 'dropRight': end -= size; break; - case 'take': end = nativeMin(end, start + size); break; - case 'takeRight': start = nativeMax(start, end - size); break; - } - } - return { 'start': start, 'end': end }; - } - - /** - * Extracts wrapper details from the `source` body comment. - * - * @private - * @param {string} source The source to inspect. - * @returns {Array} Returns the wrapper details. - */ - function getWrapDetails(source) { - var match = source.match(reWrapDetails); - return match ? match[1].split(reSplitDetails) : []; - } - - /** - * Checks if `path` exists on `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @param {Function} hasFunc The function to check properties. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - */ - function hasPath(object, path, hasFunc) { - path = castPath(path, object); - - var index = -1, - length = path.length, - result = false; - - while (++index < length) { - var key = toKey(path[index]); - if (!(result = object != null && hasFunc(object, key))) { - break; - } - object = object[key]; - } - if (result || ++index != length) { - return result; - } - length = object == null ? 0 : object.length; - return !!length && isLength(length) && isIndex(key, length) && - (isArray(object) || isArguments(object)); - } - - /** - * Initializes an array clone. - * - * @private - * @param {Array} array The array to clone. - * @returns {Array} Returns the initialized clone. - */ - function initCloneArray(array) { - var length = array.length, - result = new array.constructor(length); - - // Add properties assigned by `RegExp#exec`. - if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { - result.index = array.index; - result.input = array.input; - } - return result; - } - - /** - * Initializes an object clone. - * - * @private - * @param {Object} object The object to clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneObject(object) { - return (typeof object.constructor == 'function' && !isPrototype(object)) - ? baseCreate(getPrototype(object)) - : {}; - } - - /** - * Initializes an object clone based on its `toStringTag`. - * - * **Note:** This function only supports cloning values with tags of - * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. - * - * @private - * @param {Object} object The object to clone. - * @param {string} tag The `toStringTag` of the object to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneByTag(object, tag, isDeep) { - var Ctor = object.constructor; - switch (tag) { - case arrayBufferTag: - return cloneArrayBuffer(object); - - case boolTag: - case dateTag: - return new Ctor(+object); - - case dataViewTag: - return cloneDataView(object, isDeep); - - case float32Tag: case float64Tag: - case int8Tag: case int16Tag: case int32Tag: - case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: - return cloneTypedArray(object, isDeep); - - case mapTag: - return new Ctor; - - case numberTag: - case stringTag: - return new Ctor(object); - - case regexpTag: - return cloneRegExp(object); - - case setTag: - return new Ctor; - - case symbolTag: - return cloneSymbol(object); - } - } - - /** - * Inserts wrapper `details` in a comment at the top of the `source` body. - * - * @private - * @param {string} source The source to modify. - * @returns {Array} details The details to insert. - * @returns {string} Returns the modified source. - */ - function insertWrapDetails(source, details) { - var length = details.length; - if (!length) { - return source; - } - var lastIndex = length - 1; - details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; - details = details.join(length > 2 ? ', ' : ' '); - return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); - } - - /** - * Checks if `value` is a flattenable `arguments` object or array. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. - */ - function isFlattenable(value) { - return isArray(value) || isArguments(value) || - !!(spreadableSymbol && value && value[spreadableSymbol]); - } - - /** - * Checks if `value` is a valid array-like index. - * - * @private - * @param {*} value The value to check. - * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. - * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. - */ - function isIndex(value, length) { - var type = typeof value; - length = length == null ? MAX_SAFE_INTEGER : length; - - return !!length && - (type == 'number' || - (type != 'symbol' && reIsUint.test(value))) && - (value > -1 && value % 1 == 0 && value < length); - } - - /** - * Checks if the given arguments are from an iteratee call. - * - * @private - * @param {*} value The potential iteratee value argument. - * @param {*} index The potential iteratee index or key argument. - * @param {*} object The potential iteratee object argument. - * @returns {boolean} Returns `true` if the arguments are from an iteratee call, - * else `false`. - */ - function isIterateeCall(value, index, object) { - if (!isObject(object)) { - return false; - } - var type = typeof index; - if (type == 'number' - ? (isArrayLike(object) && isIndex(index, object.length)) - : (type == 'string' && index in object) - ) { - return eq(object[index], value); - } - return false; - } - - /** - * Checks if `value` is a property name and not a property path. - * - * @private - * @param {*} value The value to check. - * @param {Object} [object] The object to query keys on. - * @returns {boolean} Returns `true` if `value` is a property name, else `false`. - */ - function isKey(value, object) { - if (isArray(value)) { - return false; - } - var type = typeof value; - if (type == 'number' || type == 'symbol' || type == 'boolean' || - value == null || isSymbol(value)) { - return true; - } - return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || - (object != null && value in Object(object)); - } - - /** - * Checks if `value` is suitable for use as unique object key. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is suitable, else `false`. - */ - function isKeyable(value) { - var type = typeof value; - return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') - ? (value !== '__proto__') - : (value === null); - } - - /** - * Checks if `func` has a lazy counterpart. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` has a lazy counterpart, - * else `false`. - */ - function isLaziable(func) { - var funcName = getFuncName(func), - other = lodash[funcName]; - - if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { - return false; - } - if (func === other) { - return true; - } - var data = getData(other); - return !!data && func === data[0]; - } - - /** - * Checks if `func` has its source masked. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` is masked, else `false`. - */ - function isMasked(func) { - return !!maskSrcKey && (maskSrcKey in func); - } - - /** - * Checks if `func` is capable of being masked. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `func` is maskable, else `false`. - */ - var isMaskable = coreJsData ? isFunction : stubFalse; - - /** - * Checks if `value` is likely a prototype object. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. - */ - function isPrototype(value) { - var Ctor = value && value.constructor, - proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; - - return value === proto; - } - - /** - * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` if suitable for strict - * equality comparisons, else `false`. - */ - function isStrictComparable(value) { - return value === value && !isObject(value); - } - - /** - * A specialized version of `matchesProperty` for source values suitable - * for strict equality comparisons, i.e. `===`. - * - * @private - * @param {string} key The key of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function matchesStrictComparable(key, srcValue) { - return function(object) { - if (object == null) { - return false; - } - return object[key] === srcValue && - (srcValue !== undefined || (key in Object(object))); - }; - } - - /** - * A specialized version of `_.memoize` which clears the memoized function's - * cache when it exceeds `MAX_MEMOIZE_SIZE`. - * - * @private - * @param {Function} func The function to have its output memoized. - * @returns {Function} Returns the new memoized function. - */ - function memoizeCapped(func) { - var result = memoize(func, function(key) { - if (cache.size === MAX_MEMOIZE_SIZE) { - cache.clear(); - } - return key; - }); - - var cache = result.cache; - return result; - } - - /** - * Merges the function metadata of `source` into `data`. - * - * Merging metadata reduces the number of wrappers used to invoke a function. - * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` - * may be applied regardless of execution order. Methods like `_.ary` and - * `_.rearg` modify function arguments, making the order in which they are - * executed important, preventing the merging of metadata. However, we make - * an exception for a safe combined case where curried functions have `_.ary` - * and or `_.rearg` applied. - * - * @private - * @param {Array} data The destination metadata. - * @param {Array} source The source metadata. - * @returns {Array} Returns `data`. - */ - function mergeData(data, source) { - var bitmask = data[1], - srcBitmask = source[1], - newBitmask = bitmask | srcBitmask, - isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); - - var isCombo = - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || - ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); - - // Exit early if metadata can't be merged. - if (!(isCommon || isCombo)) { - return data; - } - // Use source `thisArg` if available. - if (srcBitmask & WRAP_BIND_FLAG) { - data[2] = source[2]; - // Set when currying a bound function. - newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; - } - // Compose partial arguments. - var value = source[3]; - if (value) { - var partials = data[3]; - data[3] = partials ? composeArgs(partials, value, source[4]) : value; - data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; - } - // Compose partial right arguments. - value = source[5]; - if (value) { - partials = data[5]; - data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; - data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; - } - // Use source `argPos` if available. - value = source[7]; - if (value) { - data[7] = value; - } - // Use source `ary` if it's smaller. - if (srcBitmask & WRAP_ARY_FLAG) { - data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); - } - // Use source `arity` if one is not provided. - if (data[9] == null) { - data[9] = source[9]; - } - // Use source `func` and merge bitmasks. - data[0] = source[0]; - data[1] = newBitmask; - - return data; - } - - /** - * This function is like - * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * except that it includes inherited enumerable properties. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function nativeKeysIn(object) { - var result = []; - if (object != null) { - for (var key in Object(object)) { - result.push(key); - } - } - return result; - } - - /** - * Converts `value` to a string using `Object.prototype.toString`. - * - * @private - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - */ - function objectToString(value) { - return nativeObjectToString.call(value); - } - - /** - * A specialized version of `baseRest` which transforms the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @param {Function} transform The rest array transform. - * @returns {Function} Returns the new function. - */ - function overRest(func, start, transform) { - start = nativeMax(start === undefined ? (func.length - 1) : start, 0); - return function() { - var args = arguments, - index = -1, - length = nativeMax(args.length - start, 0), - array = Array(length); - - while (++index < length) { - array[index] = args[start + index]; - } - index = -1; - var otherArgs = Array(start + 1); - while (++index < start) { - otherArgs[index] = args[index]; - } - otherArgs[start] = transform(array); - return apply(func, this, otherArgs); - }; - } - - /** - * Gets the parent value at `path` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} path The path to get the parent value of. - * @returns {*} Returns the parent value. - */ - function parent(object, path) { - return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); - } - - /** - * Reorder `array` according to the specified indexes where the element at - * the first index is assigned as the first element, the element at - * the second index is assigned as the second element, and so on. - * - * @private - * @param {Array} array The array to reorder. - * @param {Array} indexes The arranged array indexes. - * @returns {Array} Returns `array`. - */ - function reorder(array, indexes) { - var arrLength = array.length, - length = nativeMin(indexes.length, arrLength), - oldArray = copyArray(array); - - while (length--) { - var index = indexes[length]; - array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; - } - return array; - } - - /** - * Sets metadata for `func`. - * - * **Note:** If this function becomes hot, i.e. is invoked a lot in a short - * period of time, it will trip its breaker and transition to an identity - * function to avoid garbage collection pauses in V8. See - * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) - * for more details. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var setData = shortOut(baseSetData); - - /** - * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @returns {number|Object} Returns the timer id or timeout object. - */ - var setTimeout = ctxSetTimeout || function(func, wait) { - return root.setTimeout(func, wait); - }; - - /** - * Sets the `toString` method of `func` to return `string`. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var setToString = shortOut(baseSetToString); - - /** - * Sets the `toString` method of `wrapper` to mimic the source of `reference` - * with wrapper details in a comment at the top of the source body. - * - * @private - * @param {Function} wrapper The function to modify. - * @param {Function} reference The reference function. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Function} Returns `wrapper`. - */ - function setWrapToString(wrapper, reference, bitmask) { - var source = (reference + ''); - return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); - } - - /** - * Creates a function that'll short out and invoke `identity` instead - * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` - * milliseconds. - * - * @private - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new shortable function. - */ - function shortOut(func) { - var count = 0, - lastCalled = 0; - - return function() { - var stamp = nativeNow(), - remaining = HOT_SPAN - (stamp - lastCalled); - - lastCalled = stamp; - if (remaining > 0) { - if (++count >= HOT_COUNT) { - return arguments[0]; - } - } else { - count = 0; - } - return func.apply(undefined, arguments); - }; - } - - /** - * A specialized version of `_.shuffle` which mutates and sets the size of `array`. - * - * @private - * @param {Array} array The array to shuffle. - * @param {number} [size=array.length] The size of `array`. - * @returns {Array} Returns `array`. - */ - function shuffleSelf(array, size) { - var index = -1, - length = array.length, - lastIndex = length - 1; - - size = size === undefined ? length : size; - while (++index < size) { - var rand = baseRandom(index, lastIndex), - value = array[rand]; - - array[rand] = array[index]; - array[index] = value; - } - array.length = size; - return array; - } - - /** - * Converts `string` to a property path array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the property path array. - */ - var stringToPath = memoizeCapped(function(string) { - var result = []; - if (string.charCodeAt(0) === 46 /* . */) { - result.push(''); - } - string.replace(rePropName, function(match, number, quote, subString) { - result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); - }); - return result; - }); - - /** - * Converts `value` to a string key if it's not a string or symbol. - * - * @private - * @param {*} value The value to inspect. - * @returns {string|symbol} Returns the key. - */ - function toKey(value) { - if (typeof value == 'string' || isSymbol(value)) { - return value; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * Converts `func` to its source code. - * - * @private - * @param {Function} func The function to convert. - * @returns {string} Returns the source code. - */ - function toSource(func) { - if (func != null) { - try { - return funcToString.call(func); - } catch (e) {} - try { - return (func + ''); - } catch (e) {} - } - return ''; - } - - /** - * Updates wrapper `details` based on `bitmask` flags. - * - * @private - * @returns {Array} details The details to modify. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Array} Returns `details`. - */ - function updateWrapDetails(details, bitmask) { - arrayEach(wrapFlags, function(pair) { - var value = '_.' + pair[0]; - if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { - details.push(value); - } - }); - return details.sort(); - } - - /** - * Creates a clone of `wrapper`. - * - * @private - * @param {Object} wrapper The wrapper to clone. - * @returns {Object} Returns the cloned wrapper. - */ - function wrapperClone(wrapper) { - if (wrapper instanceof LazyWrapper) { - return wrapper.clone(); - } - var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); - result.__actions__ = copyArray(wrapper.__actions__); - result.__index__ = wrapper.__index__; - result.__values__ = wrapper.__values__; - return result; - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of elements split into groups the length of `size`. - * If `array` can't be split evenly, the final chunk will be the remaining - * elements. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to process. - * @param {number} [size=1] The length of each chunk - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the new array of chunks. - * @example - * - * _.chunk(['a', 'b', 'c', 'd'], 2); - * // => [['a', 'b'], ['c', 'd']] - * - * _.chunk(['a', 'b', 'c', 'd'], 3); - * // => [['a', 'b', 'c'], ['d']] - */ - function chunk(array, size, guard) { - if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { - size = 1; - } else { - size = nativeMax(toInteger(size), 0); - } - var length = array == null ? 0 : array.length; - if (!length || size < 1) { - return []; - } - var index = 0, - resIndex = 0, - result = Array(nativeCeil(length / size)); - - while (index < length) { - result[resIndex++] = baseSlice(array, index, (index += size)); - } - return result; - } - - /** - * Creates an array with all falsey values removed. The values `false`, `null`, - * `0`, `""`, `undefined`, and `NaN` are falsey. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to compact. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] - */ - function compact(array) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * Creates a new array concatenating `array` with any additional arrays - * and/or values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to concatenate. - * @param {...*} [values] The values to concatenate. - * @returns {Array} Returns the new concatenated array. - * @example - * - * var array = [1]; - * var other = _.concat(array, 2, [3], [[4]]); - * - * console.log(other); - * // => [1, 2, 3, [4]] - * - * console.log(array); - * // => [1] - */ - function concat() { - var length = arguments.length; - if (!length) { - return []; - } - var args = Array(length - 1), - array = arguments[0], - index = length; - - while (index--) { - args[index - 1] = arguments[index]; - } - return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); - } - - /** - * Creates an array of `array` values not included in the other given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * **Note:** Unlike `_.pullAll`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.without, _.xor - * @example - * - * _.difference([2, 1], [2, 3]); - * // => [1] - */ - var difference = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `iteratee` which - * is invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * **Note:** Unlike `_.pullAllBy`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2] - * - * // The `_.property` iteratee shorthand. - * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var differenceBy = baseRest(function(array, values) { - var iteratee = last(values); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `comparator` - * which is invoked to compare elements of `array` to `values`. The order and - * references of result values are determined by the first array. The comparator - * is invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.pullAllWith`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * - * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); - * // => [{ 'x': 2, 'y': 1 }] - */ - var differenceWith = baseRest(function(array, values) { - var comparator = last(values); - if (isArrayLikeObject(comparator)) { - comparator = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) - : []; - }); - - /** - * Creates a slice of `array` with `n` elements dropped from the beginning. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.drop([1, 2, 3]); - * // => [2, 3] - * - * _.drop([1, 2, 3], 2); - * // => [3] - * - * _.drop([1, 2, 3], 5); - * // => [] - * - * _.drop([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function drop(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with `n` elements dropped from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.dropRight([1, 2, 3]); - * // => [1, 2] - * - * _.dropRight([1, 2, 3], 2); - * // => [1] - * - * _.dropRight([1, 2, 3], 5); - * // => [] - * - * _.dropRight([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function dropRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` excluding elements dropped from the end. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.dropRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney'] - * - * // The `_.matches` iteratee shorthand. - * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropRightWhile(users, ['active', false]); - * // => objects for ['barney'] - * - * // The `_.property` iteratee shorthand. - * _.dropRightWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true, true) - : []; - } - - /** - * Creates a slice of `array` excluding elements dropped from the beginning. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.dropWhile(users, function(o) { return !o.active; }); - * // => objects for ['pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.dropWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropWhile(users, ['active', false]); - * // => objects for ['pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.dropWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true) - : []; - } - - /** - * Fills elements of `array` with `value` from `start` up to, but not - * including, `end`. - * - * **Note:** This method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Array - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.fill(array, 'a'); - * console.log(array); - * // => ['a', 'a', 'a'] - * - * _.fill(Array(3), 2); - * // => [2, 2, 2] - * - * _.fill([4, 6, 8, 10], '*', 1, 3); - * // => [4, '*', '*', 10] - */ - function fill(array, value, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { - start = 0; - end = length; - } - return baseFill(array, value, start, end); - } - - /** - * This method is like `_.find` except that it returns the index of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.findIndex(users, function(o) { return o.user == 'barney'; }); - * // => 0 - * - * // The `_.matches` iteratee shorthand. - * _.findIndex(users, { 'user': 'fred', 'active': false }); - * // => 1 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findIndex(users, ['active', false]); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.findIndex(users, 'active'); - * // => 2 - */ - function findIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseFindIndex(array, getIteratee(predicate, 3), index); - } - - /** - * This method is like `_.findIndex` except that it iterates over elements - * of `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); - * // => 2 - * - * // The `_.matches` iteratee shorthand. - * _.findLastIndex(users, { 'user': 'barney', 'active': true }); - * // => 0 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastIndex(users, ['active', false]); - * // => 2 - * - * // The `_.property` iteratee shorthand. - * _.findLastIndex(users, 'active'); - * // => 0 - */ - function findLastIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length - 1; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = fromIndex < 0 - ? nativeMax(length + index, 0) - : nativeMin(index, length - 1); - } - return baseFindIndex(array, getIteratee(predicate, 3), index, true); - } - - /** - * Flattens `array` a single level deep. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flatten([1, [2, [3, [4]], 5]]); - * // => [1, 2, [3, [4]], 5] - */ - function flatten(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, 1) : []; - } - - /** - * Recursively flattens `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flattenDeep([1, [2, [3, [4]], 5]]); - * // => [1, 2, 3, 4, 5] - */ - function flattenDeep(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, INFINITY) : []; - } - - /** - * Recursively flatten `array` up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Array - * @param {Array} array The array to flatten. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * var array = [1, [2, [3, [4]], 5]]; - * - * _.flattenDepth(array, 1); - * // => [1, 2, [3, [4]], 5] - * - * _.flattenDepth(array, 2); - * // => [1, 2, 3, [4], 5] - */ - function flattenDepth(array, depth) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(array, depth); - } - - /** - * The inverse of `_.toPairs`; this method returns an object composed - * from key-value `pairs`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} pairs The key-value pairs. - * @returns {Object} Returns the new object. - * @example - * - * _.fromPairs([['a', 1], ['b', 2]]); - * // => { 'a': 1, 'b': 2 } - */ - function fromPairs(pairs) { - var index = -1, - length = pairs == null ? 0 : pairs.length, - result = {}; - - while (++index < length) { - var pair = pairs[index]; - result[pair[0]] = pair[1]; - } - return result; - } - - /** - * Gets the first element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias first - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the first element of `array`. - * @example - * - * _.head([1, 2, 3]); - * // => 1 - * - * _.head([]); - * // => undefined - */ - function head(array) { - return (array && array.length) ? array[0] : undefined; - } - - /** - * Gets the index at which the first occurrence of `value` is found in `array` - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. If `fromIndex` is negative, it's used as the - * offset from the end of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.indexOf([1, 2, 1, 2], 2); - * // => 1 - * - * // Search from the `fromIndex`. - * _.indexOf([1, 2, 1, 2], 2, 2); - * // => 3 - */ - function indexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseIndexOf(array, value, index); - } - - /** - * Gets all but the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.initial([1, 2, 3]); - * // => [1, 2] - */ - function initial(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 0, -1) : []; - } - - /** - * Creates an array of unique values that are included in all given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersection([2, 1], [2, 3]); - * // => [2] - */ - var intersection = baseRest(function(arrays) { - var mapped = arrayMap(arrays, castArrayLikeObject); - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `iteratee` - * which is invoked for each element of each `arrays` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [2.1] - * - * // The `_.property` iteratee shorthand. - * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }] - */ - var intersectionBy = baseRest(function(arrays) { - var iteratee = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - if (iteratee === last(mapped)) { - iteratee = undefined; - } else { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `comparator` - * which is invoked to compare elements of `arrays`. The order and references - * of result values are determined by the first array. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.intersectionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }] - */ - var intersectionWith = baseRest(function(arrays) { - var comparator = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - comparator = typeof comparator == 'function' ? comparator : undefined; - if (comparator) { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, undefined, comparator) - : []; - }); - - /** - * Converts all elements in `array` into a string separated by `separator`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to convert. - * @param {string} [separator=','] The element separator. - * @returns {string} Returns the joined string. - * @example - * - * _.join(['a', 'b', 'c'], '~'); - * // => 'a~b~c' - */ - function join(array, separator) { - return array == null ? '' : nativeJoin.call(array, separator); - } - - /** - * Gets the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the last element of `array`. - * @example - * - * _.last([1, 2, 3]); - * // => 3 - */ - function last(array) { - var length = array == null ? 0 : array.length; - return length ? array[length - 1] : undefined; - } - - /** - * This method is like `_.indexOf` except that it iterates over elements of - * `array` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.lastIndexOf([1, 2, 1, 2], 2); - * // => 3 - * - * // Search from the `fromIndex`. - * _.lastIndexOf([1, 2, 1, 2], 2, 2); - * // => 1 - */ - function lastIndexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); - } - return value === value - ? strictLastIndexOf(array, value, index) - : baseFindIndex(array, baseIsNaN, index, true); - } - - /** - * Gets the element at index `n` of `array`. If `n` is negative, the nth - * element from the end is returned. - * - * @static - * @memberOf _ - * @since 4.11.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=0] The index of the element to return. - * @returns {*} Returns the nth element of `array`. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * - * _.nth(array, 1); - * // => 'b' - * - * _.nth(array, -2); - * // => 'c'; - */ - function nth(array, n) { - return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; - } - - /** - * Removes all given values from `array` using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` - * to remove elements from an array by predicate. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...*} [values] The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pull(array, 'a', 'c'); - * console.log(array); - * // => ['b', 'b'] - */ - var pull = baseRest(pullAll); - - /** - * This method is like `_.pull` except that it accepts an array of values to remove. - * - * **Note:** Unlike `_.difference`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pullAll(array, ['a', 'c']); - * console.log(array); - * // => ['b', 'b'] - */ - function pullAll(array, values) { - return (array && array.length && values && values.length) - ? basePullAll(array, values) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `iteratee` which is - * invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The iteratee is invoked with one argument: (value). - * - * **Note:** Unlike `_.differenceBy`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; - * - * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); - * console.log(array); - * // => [{ 'x': 2 }] - */ - function pullAllBy(array, values, iteratee) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, getIteratee(iteratee, 2)) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `comparator` which - * is invoked to compare elements of `array` to `values`. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.differenceWith`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; - * - * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); - * console.log(array); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] - */ - function pullAllWith(array, values, comparator) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, undefined, comparator) - : array; - } - - /** - * Removes elements from `array` corresponding to `indexes` and returns an - * array of removed elements. - * - * **Note:** Unlike `_.at`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...(number|number[])} [indexes] The indexes of elements to remove. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * var pulled = _.pullAt(array, [1, 3]); - * - * console.log(array); - * // => ['a', 'c'] - * - * console.log(pulled); - * // => ['b', 'd'] - */ - var pullAt = flatRest(function(array, indexes) { - var length = array == null ? 0 : array.length, - result = baseAt(array, indexes); - - basePullAt(array, arrayMap(indexes, function(index) { - return isIndex(index, length) ? +index : index; - }).sort(compareAscending)); - - return result; - }); - - /** - * Removes all elements from `array` that `predicate` returns truthy for - * and returns an array of the removed elements. The predicate is invoked - * with three arguments: (value, index, array). - * - * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` - * to pull elements from an array by value. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = [1, 2, 3, 4]; - * var evens = _.remove(array, function(n) { - * return n % 2 == 0; - * }); - * - * console.log(array); - * // => [1, 3] - * - * console.log(evens); - * // => [2, 4] - */ - function remove(array, predicate) { - var result = []; - if (!(array && array.length)) { - return result; - } - var index = -1, - indexes = [], - length = array.length; - - predicate = getIteratee(predicate, 3); - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result.push(value); - indexes.push(index); - } - } - basePullAt(array, indexes); - return result; - } - - /** - * Reverses `array` so that the first element becomes the last, the second - * element becomes the second to last, and so on. - * - * **Note:** This method mutates `array` and is based on - * [`Array#reverse`](https://mdn.io/Array/reverse). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.reverse(array); - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function reverse(array) { - return array == null ? array : nativeReverse.call(array); - } - - /** - * Creates a slice of `array` from `start` up to, but not including, `end`. - * - * **Note:** This method is used instead of - * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are - * returned. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function slice(array, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { - start = 0; - end = length; - } - else { - start = start == null ? 0 : toInteger(start); - end = end === undefined ? length : toInteger(end); - } - return baseSlice(array, start, end); - } - - /** - * Uses a binary search to determine the lowest index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedIndex([30, 50], 40); - * // => 1 - */ - function sortedIndex(array, value) { - return baseSortedIndex(array, value); - } - - /** - * This method is like `_.sortedIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); - * // => 0 - */ - function sortedIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); - } - - /** - * This method is like `_.indexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedIndexOf([4, 5, 5, 5, 6], 5); - * // => 1 - */ - function sortedIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value); - if (index < length && eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.sortedIndex` except that it returns the highest - * index at which `value` should be inserted into `array` in order to - * maintain its sort order. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedLastIndex([4, 5, 5, 5, 6], 5); - * // => 4 - */ - function sortedLastIndex(array, value) { - return baseSortedIndex(array, value, true); - } - - /** - * This method is like `_.sortedLastIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 1 - * - * // The `_.property` iteratee shorthand. - * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); - * // => 1 - */ - function sortedLastIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); - } - - /** - * This method is like `_.lastIndexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); - * // => 3 - */ - function sortedLastIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value, true) - 1; - if (eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.uniq` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniq([1, 1, 2]); - * // => [1, 2] - */ - function sortedUniq(array) { - return (array && array.length) - ? baseSortedUniq(array) - : []; - } - - /** - * This method is like `_.uniqBy` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); - * // => [1.1, 2.3] - */ - function sortedUniqBy(array, iteratee) { - return (array && array.length) - ? baseSortedUniq(array, getIteratee(iteratee, 2)) - : []; - } - - /** - * Gets all but the first element of `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.tail([1, 2, 3]); - * // => [2, 3] - */ - function tail(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 1, length) : []; - } - - /** - * Creates a slice of `array` with `n` elements taken from the beginning. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.take([1, 2, 3]); - * // => [1] - * - * _.take([1, 2, 3], 2); - * // => [1, 2] - * - * _.take([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.take([1, 2, 3], 0); - * // => [] - */ - function take(array, n, guard) { - if (!(array && array.length)) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` with `n` elements taken from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.takeRight([1, 2, 3]); - * // => [3] - * - * _.takeRight([1, 2, 3], 2); - * // => [2, 3] - * - * _.takeRight([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.takeRight([1, 2, 3], 0); - * // => [] - */ - function takeRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with elements taken from the end. Elements are - * taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.takeRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeRightWhile(users, ['active', false]); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.takeRightWhile(users, 'active'); - * // => [] - */ - function takeRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), false, true) - : []; - } - - /** - * Creates a slice of `array` with elements taken from the beginning. Elements - * are taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.takeWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matches` iteratee shorthand. - * _.takeWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeWhile(users, ['active', false]); - * // => objects for ['barney', 'fred'] - * - * // The `_.property` iteratee shorthand. - * _.takeWhile(users, 'active'); - * // => [] - */ - function takeWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3)) - : []; - } - - /** - * Creates an array of unique values, in order, from all given arrays using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.union([2], [1, 2]); - * // => [2, 1] - */ - var union = baseRest(function(arrays) { - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); - }); - - /** - * This method is like `_.union` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which uniqueness is computed. Result values are chosen from the first - * array in which the value occurs. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.unionBy([2.1], [1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - var unionBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.union` except that it accepts `comparator` which - * is invoked to compare elements of `arrays`. Result values are chosen from - * the first array in which the value occurs. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.unionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var unionWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); - }); - - /** - * Creates a duplicate-free version of an array, using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons, in which only the first occurrence of each element - * is kept. The order of result values is determined by the order they occur - * in the array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniq([2, 1, 2]); - * // => [2, 1] - */ - function uniq(array) { - return (array && array.length) ? baseUniq(array) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `iteratee` which is - * invoked for each element in `array` to generate the criterion by which - * uniqueness is computed. The order of result values is determined by the - * order they occur in the array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniqBy([2.1, 1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - function uniqBy(array, iteratee) { - return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `comparator` which - * is invoked to compare elements of `array`. The order of result values is - * determined by the order they occur in the array.The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.uniqWith(objects, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] - */ - function uniqWith(array, comparator) { - comparator = typeof comparator == 'function' ? comparator : undefined; - return (array && array.length) ? baseUniq(array, undefined, comparator) : []; - } - - /** - * This method is like `_.zip` except that it accepts an array of grouped - * elements and creates an array regrouping the elements to their pre-zip - * configuration. - * - * @static - * @memberOf _ - * @since 1.2.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - * - * _.unzip(zipped); - * // => [['a', 'b'], [1, 2], [true, false]] - */ - function unzip(array) { - if (!(array && array.length)) { - return []; - } - var length = 0; - array = arrayFilter(array, function(group) { - if (isArrayLikeObject(group)) { - length = nativeMax(group.length, length); - return true; - } - }); - return baseTimes(length, function(index) { - return arrayMap(array, baseProperty(index)); - }); - } - - /** - * This method is like `_.unzip` except that it accepts `iteratee` to specify - * how regrouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @param {Function} [iteratee=_.identity] The function to combine - * regrouped values. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip([1, 2], [10, 20], [100, 200]); - * // => [[1, 10, 100], [2, 20, 200]] - * - * _.unzipWith(zipped, _.add); - * // => [3, 30, 300] - */ - function unzipWith(array, iteratee) { - if (!(array && array.length)) { - return []; - } - var result = unzip(array); - if (iteratee == null) { - return result; - } - return arrayMap(result, function(group) { - return apply(iteratee, undefined, group); - }); - } - - /** - * Creates an array excluding all given values using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.pull`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...*} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.xor - * @example - * - * _.without([2, 1, 2, 3], 1, 2); - * // => [3] - */ - var without = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, values) - : []; - }); - - /** - * Creates an array of unique values that is the - * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) - * of the given arrays. The order of result values is determined by the order - * they occur in the arrays. - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.without - * @example - * - * _.xor([2, 1], [2, 3]); - * // => [1, 3] - */ - var xor = baseRest(function(arrays) { - return baseXor(arrayFilter(arrays, isArrayLikeObject)); - }); - - /** - * This method is like `_.xor` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which by which they're compared. The order of result values is determined - * by the order they occur in the arrays. The iteratee is invoked with one - * argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2, 3.4] - * - * // The `_.property` iteratee shorthand. - * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var xorBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.xor` except that it accepts `comparator` which is - * invoked to compare elements of `arrays`. The order of result values is - * determined by the order they occur in the arrays. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.xorWith(objects, others, _.isEqual); - * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var xorWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); - }); - - /** - * Creates an array of grouped elements, the first of which contains the - * first elements of the given arrays, the second of which contains the - * second elements of the given arrays, and so on. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - */ - var zip = baseRest(unzip); - - /** - * This method is like `_.fromPairs` except that it accepts two arrays, - * one of property identifiers and one of corresponding values. - * - * @static - * @memberOf _ - * @since 0.4.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObject(['a', 'b'], [1, 2]); - * // => { 'a': 1, 'b': 2 } - */ - function zipObject(props, values) { - return baseZipObject(props || [], values || [], assignValue); - } - - /** - * This method is like `_.zipObject` except that it supports property paths. - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); - * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } - */ - function zipObjectDeep(props, values) { - return baseZipObject(props || [], values || [], baseSet); - } - - /** - * This method is like `_.zip` except that it accepts `iteratee` to specify - * how grouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @param {Function} [iteratee=_.identity] The function to combine - * grouped values. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { - * return a + b + c; - * }); - * // => [111, 222] - */ - var zipWith = baseRest(function(arrays) { - var length = arrays.length, - iteratee = length > 1 ? arrays[length - 1] : undefined; - - iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; - return unzipWith(arrays, iteratee); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` wrapper instance that wraps `value` with explicit method - * chain sequences enabled. The result of such sequences must be unwrapped - * with `_#value`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Seq - * @param {*} value The value to wrap. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'pebbles', 'age': 1 } - * ]; - * - * var youngest = _ - * .chain(users) - * .sortBy('age') - * .map(function(o) { - * return o.user + ' is ' + o.age; - * }) - * .head() - * .value(); - * // => 'pebbles is 1' - */ - function chain(value) { - var result = lodash(value); - result.__chain__ = true; - return result; - } - - /** - * This method invokes `interceptor` and returns `value`. The interceptor - * is invoked with one argument; (value). The purpose of this method is to - * "tap into" a method chain sequence in order to modify intermediate results. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns `value`. - * @example - * - * _([1, 2, 3]) - * .tap(function(array) { - * // Mutate input array. - * array.pop(); - * }) - * .reverse() - * .value(); - * // => [2, 1] - */ - function tap(value, interceptor) { - interceptor(value); - return value; - } - - /** - * This method is like `_.tap` except that it returns the result of `interceptor`. - * The purpose of this method is to "pass thru" values replacing intermediate - * results in a method chain sequence. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns the result of `interceptor`. - * @example - * - * _(' abc ') - * .chain() - * .trim() - * .thru(function(value) { - * return [value]; - * }) - * .value(); - * // => ['abc'] - */ - function thru(value, interceptor) { - return interceptor(value); - } - - /** - * This method is the wrapper version of `_.at`. - * - * @name at - * @memberOf _ - * @since 1.0.0 - * @category Seq - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _(object).at(['a[0].b.c', 'a[1]']).value(); - * // => [3, 4] - */ - var wrapperAt = flatRest(function(paths) { - var length = paths.length, - start = length ? paths[0] : 0, - value = this.__wrapped__, - interceptor = function(object) { return baseAt(object, paths); }; - - if (length > 1 || this.__actions__.length || - !(value instanceof LazyWrapper) || !isIndex(start)) { - return this.thru(interceptor); - } - value = value.slice(start, +start + (length ? 1 : 0)); - value.__actions__.push({ - 'func': thru, - 'args': [interceptor], - 'thisArg': undefined - }); - return new LodashWrapper(value, this.__chain__).thru(function(array) { - if (length && !array.length) { - array.push(undefined); - } - return array; - }); - }); - - /** - * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. - * - * @name chain - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 } - * ]; - * - * // A sequence without explicit chaining. - * _(users).head(); - * // => { 'user': 'barney', 'age': 36 } - * - * // A sequence with explicit chaining. - * _(users) - * .chain() - * .head() - * .pick('user') - * .value(); - * // => { 'user': 'barney' } - */ - function wrapperChain() { - return chain(this); - } - - /** - * Executes the chain sequence and returns the wrapped result. - * - * @name commit - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2]; - * var wrapped = _(array).push(3); - * - * console.log(array); - * // => [1, 2] - * - * wrapped = wrapped.commit(); - * console.log(array); - * // => [1, 2, 3] - * - * wrapped.last(); - * // => 3 - * - * console.log(array); - * // => [1, 2, 3] - */ - function wrapperCommit() { - return new LodashWrapper(this.value(), this.__chain__); - } - - /** - * Gets the next value on a wrapped object following the - * [iterator protocol](https://mdn.io/iteration_protocols#iterator). - * - * @name next - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the next iterator value. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped.next(); - * // => { 'done': false, 'value': 1 } - * - * wrapped.next(); - * // => { 'done': false, 'value': 2 } - * - * wrapped.next(); - * // => { 'done': true, 'value': undefined } - */ - function wrapperNext() { - if (this.__values__ === undefined) { - this.__values__ = toArray(this.value()); - } - var done = this.__index__ >= this.__values__.length, - value = done ? undefined : this.__values__[this.__index__++]; - - return { 'done': done, 'value': value }; - } - - /** - * Enables the wrapper to be iterable. - * - * @name Symbol.iterator - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the wrapper object. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped[Symbol.iterator]() === wrapped; - * // => true - * - * Array.from(wrapped); - * // => [1, 2] - */ - function wrapperToIterator() { - return this; - } - - /** - * Creates a clone of the chain sequence planting `value` as the wrapped value. - * - * @name plant - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @param {*} value The value to plant. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2]).map(square); - * var other = wrapped.plant([3, 4]); - * - * other.value(); - * // => [9, 16] - * - * wrapped.value(); - * // => [1, 4] - */ - function wrapperPlant(value) { - var result, - parent = this; - - while (parent instanceof baseLodash) { - var clone = wrapperClone(parent); - clone.__index__ = 0; - clone.__values__ = undefined; - if (result) { - previous.__wrapped__ = clone; - } else { - result = clone; - } - var previous = clone; - parent = parent.__wrapped__; - } - previous.__wrapped__ = value; - return result; - } - - /** - * This method is the wrapper version of `_.reverse`. - * - * **Note:** This method mutates the wrapped array. - * - * @name reverse - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2, 3]; - * - * _(array).reverse().value() - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function wrapperReverse() { - var value = this.__wrapped__; - if (value instanceof LazyWrapper) { - var wrapped = value; - if (this.__actions__.length) { - wrapped = new LazyWrapper(this); - } - wrapped = wrapped.reverse(); - wrapped.__actions__.push({ - 'func': thru, - 'args': [reverse], - 'thisArg': undefined - }); - return new LodashWrapper(wrapped, this.__chain__); - } - return this.thru(reverse); - } - - /** - * Executes the chain sequence to resolve the unwrapped value. - * - * @name value - * @memberOf _ - * @since 0.1.0 - * @alias toJSON, valueOf - * @category Seq - * @returns {*} Returns the resolved unwrapped value. - * @example - * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] - */ - function wrapperValue() { - return baseWrapperValue(this.__wrapped__, this.__actions__); - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the number of times the key was returned by `iteratee`. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.countBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': 1, '6': 2 } - * - * // The `_.property` iteratee shorthand. - * _.countBy(['one', 'two', 'three'], 'length'); - * // => { '3': 2, '5': 1 } - */ - var countBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - ++result[key]; - } else { - baseAssignValue(result, key, 1); - } - }); - - /** - * Checks if `predicate` returns truthy for **all** elements of `collection`. - * Iteration is stopped once `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * **Note:** This method returns `true` for - * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because - * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of - * elements of empty collections. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.every(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.every(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.every(users, 'active'); - * // => false - */ - function every(collection, predicate, guard) { - var func = isArray(collection) ? arrayEvery : baseEvery; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning an array of all elements - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * **Note:** Unlike `_.remove`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.reject - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * _.filter(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.filter(users, { 'age': 36, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.filter(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.filter(users, 'active'); - * // => objects for ['barney'] - */ - function filter(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning the first element - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false }, - * { 'user': 'pebbles', 'age': 1, 'active': true } - * ]; - * - * _.find(users, function(o) { return o.age < 40; }); - * // => object for 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.find(users, { 'age': 1, 'active': true }); - * // => object for 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.find(users, ['active', false]); - * // => object for 'fred' - * - * // The `_.property` iteratee shorthand. - * _.find(users, 'active'); - * // => object for 'barney' - */ - var find = createFind(findIndex); - - /** - * This method is like `_.find` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=collection.length-1] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * _.findLast([1, 2, 3, 4], function(n) { - * return n % 2 == 1; - * }); - * // => 3 - */ - var findLast = createFind(findLastIndex); - - /** - * Creates a flattened array of values by running each element in `collection` - * thru `iteratee` and flattening the mapped results. The iteratee is invoked - * with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [n, n]; - * } - * - * _.flatMap([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMap(collection, iteratee) { - return baseFlatten(map(collection, iteratee), 1); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDeep([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMapDeep(collection, iteratee) { - return baseFlatten(map(collection, iteratee), INFINITY); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDepth([1, 2], duplicate, 2); - * // => [[1, 1], [2, 2]] - */ - function flatMapDepth(collection, iteratee, depth) { - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(map(collection, iteratee), depth); - } - - /** - * Iterates over elements of `collection` and invokes `iteratee` for each element. - * The iteratee is invoked with three arguments: (value, index|key, collection). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * **Note:** As with other "Collections" methods, objects with a "length" - * property are iterated like arrays. To avoid this behavior use `_.forIn` - * or `_.forOwn` for object iteration. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias each - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEachRight - * @example - * - * _.forEach([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `1` then `2`. - * - * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forEach(collection, iteratee) { - var func = isArray(collection) ? arrayEach : baseEach; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forEach` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @alias eachRight - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEach - * @example - * - * _.forEachRight([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `2` then `1`. - */ - function forEachRight(collection, iteratee) { - var func = isArray(collection) ? arrayEachRight : baseEachRight; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The order of grouped values - * is determined by the order they occur in `collection`. The corresponding - * value of each key is an array of elements responsible for generating the - * key. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.groupBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': [4.2], '6': [6.1, 6.3] } - * - * // The `_.property` iteratee shorthand. - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } - */ - var groupBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - result[key].push(value); - } else { - baseAssignValue(result, key, [value]); - } - }); - - /** - * Checks if `value` is in `collection`. If `collection` is a string, it's - * checked for a substring of `value`, otherwise - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * is used for equality comparisons. If `fromIndex` is negative, it's used as - * the offset from the end of `collection`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {boolean} Returns `true` if `value` is found, else `false`. - * @example - * - * _.includes([1, 2, 3], 1); - * // => true - * - * _.includes([1, 2, 3], 1, 2); - * // => false - * - * _.includes({ 'a': 1, 'b': 2 }, 1); - * // => true - * - * _.includes('abcd', 'bc'); - * // => true - */ - function includes(collection, value, fromIndex, guard) { - collection = isArrayLike(collection) ? collection : values(collection); - fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; - - var length = collection.length; - if (fromIndex < 0) { - fromIndex = nativeMax(length + fromIndex, 0); - } - return isString(collection) - ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) - : (!!length && baseIndexOf(collection, value, fromIndex) > -1); - } - - /** - * Invokes the method at `path` of each element in `collection`, returning - * an array of the results of each invoked method. Any additional arguments - * are provided to each invoked method. If `path` is a function, it's invoked - * for, and `this` bound to, each element in `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array|Function|string} path The path of the method to invoke or - * the function invoked per iteration. - * @param {...*} [args] The arguments to invoke each method with. - * @returns {Array} Returns the array of results. - * @example - * - * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] - * - * _.invokeMap([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] - */ - var invokeMap = baseRest(function(collection, path, args) { - var index = -1, - isFunc = typeof path == 'function', - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value) { - result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); - }); - return result; - }); - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the last element responsible for generating the key. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * var array = [ - * { 'dir': 'left', 'code': 97 }, - * { 'dir': 'right', 'code': 100 } - * ]; - * - * _.keyBy(array, function(o) { - * return String.fromCharCode(o.code); - * }); - * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } - * - * _.keyBy(array, 'dir'); - * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } - */ - var keyBy = createAggregator(function(result, value, key) { - baseAssignValue(result, key, value); - }); - - /** - * Creates an array of values by running each element in `collection` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. - * - * The guarded methods are: - * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, - * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, - * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, - * `template`, `trim`, `trimEnd`, `trimStart`, and `words` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - * @example - * - * function square(n) { - * return n * n; - * } - * - * _.map([4, 8], square); - * // => [16, 64] - * - * _.map({ 'a': 4, 'b': 8 }, square); - * // => [16, 64] (iteration order is not guaranteed) - * - * var users = [ - * { 'user': 'barney' }, - * { 'user': 'fred' } - * ]; - * - * // The `_.property` iteratee shorthand. - * _.map(users, 'user'); - * // => ['barney', 'fred'] - */ - function map(collection, iteratee) { - var func = isArray(collection) ? arrayMap : baseMap; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.sortBy` except that it allows specifying the sort - * orders of the iteratees to sort by. If `orders` is unspecified, all values - * are sorted in ascending order. Otherwise, specify an order of "desc" for - * descending or "asc" for ascending sort order of corresponding values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] - * The iteratees to sort by. - * @param {string[]} [orders] The sort orders of `iteratees`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 34 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 36 } - * ]; - * - * // Sort by `user` in ascending order and by `age` in descending order. - * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - */ - function orderBy(collection, iteratees, orders, guard) { - if (collection == null) { - return []; - } - if (!isArray(iteratees)) { - iteratees = iteratees == null ? [] : [iteratees]; - } - orders = guard ? undefined : orders; - if (!isArray(orders)) { - orders = orders == null ? [] : [orders]; - } - return baseOrderBy(collection, iteratees, orders); - } - - /** - * Creates an array of elements split into two groups, the first of which - * contains elements `predicate` returns truthy for, the second of which - * contains elements `predicate` returns falsey for. The predicate is - * invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the array of grouped elements. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true }, - * { 'user': 'pebbles', 'age': 1, 'active': false } - * ]; - * - * _.partition(users, function(o) { return o.active; }); - * // => objects for [['fred'], ['barney', 'pebbles']] - * - * // The `_.matches` iteratee shorthand. - * _.partition(users, { 'age': 1, 'active': false }); - * // => objects for [['pebbles'], ['barney', 'fred']] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.partition(users, ['active', false]); - * // => objects for [['barney', 'pebbles'], ['fred']] - * - * // The `_.property` iteratee shorthand. - * _.partition(users, 'active'); - * // => objects for [['fred'], ['barney', 'pebbles']] - */ - var partition = createAggregator(function(result, value, key) { - result[key ? 0 : 1].push(value); - }, function() { return [[], []]; }); - - /** - * Reduces `collection` to a value which is the accumulated result of running - * each element in `collection` thru `iteratee`, where each successive - * invocation is supplied the return value of the previous. If `accumulator` - * is not given, the first element of `collection` is used as the initial - * value. The iteratee is invoked with four arguments: - * (accumulator, value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.reduce`, `_.reduceRight`, and `_.transform`. - * - * The guarded methods are: - * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, - * and `sortBy` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduceRight - * @example - * - * _.reduce([1, 2], function(sum, n) { - * return sum + n; - * }, 0); - * // => 3 - * - * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * return result; - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) - */ - function reduce(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduce : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); - } - - /** - * This method is like `_.reduce` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduce - * @example - * - * var array = [[0, 1], [2, 3], [4, 5]]; - * - * _.reduceRight(array, function(flattened, other) { - * return flattened.concat(other); - * }, []); - * // => [4, 5, 2, 3, 0, 1] - */ - function reduceRight(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduceRight : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); - } - - /** - * The opposite of `_.filter`; this method returns the elements of `collection` - * that `predicate` does **not** return truthy for. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.filter - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true } - * ]; - * - * _.reject(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.reject(users, { 'age': 40, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.reject(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.reject(users, 'active'); - * // => objects for ['barney'] - */ - function reject(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, negate(getIteratee(predicate, 3))); - } - - /** - * Gets a random element from `collection`. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - * @example - * - * _.sample([1, 2, 3, 4]); - * // => 2 - */ - function sample(collection) { - var func = isArray(collection) ? arraySample : baseSample; - return func(collection); - } - - /** - * Gets `n` random elements at unique keys from `collection` up to the - * size of `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @param {number} [n=1] The number of elements to sample. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the random elements. - * @example - * - * _.sampleSize([1, 2, 3], 2); - * // => [3, 1] - * - * _.sampleSize([1, 2, 3], 4); - * // => [2, 3, 1] - */ - function sampleSize(collection, n, guard) { - if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - var func = isArray(collection) ? arraySampleSize : baseSampleSize; - return func(collection, n); - } - - /** - * Creates an array of shuffled values, using a version of the - * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - * @example - * - * _.shuffle([1, 2, 3, 4]); - * // => [4, 1, 3, 2] - */ - function shuffle(collection) { - var func = isArray(collection) ? arrayShuffle : baseShuffle; - return func(collection); - } - - /** - * Gets the size of `collection` by returning its length for array-like - * values or the number of own enumerable string keyed properties for objects. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @returns {number} Returns the collection size. - * @example - * - * _.size([1, 2, 3]); - * // => 3 - * - * _.size({ 'a': 1, 'b': 2 }); - * // => 2 - * - * _.size('pebbles'); - * // => 7 - */ - function size(collection) { - if (collection == null) { - return 0; - } - if (isArrayLike(collection)) { - return isString(collection) ? stringSize(collection) : collection.length; - } - var tag = getTag(collection); - if (tag == mapTag || tag == setTag) { - return collection.size; - } - return baseKeys(collection).length; - } - - /** - * Checks if `predicate` returns truthy for **any** element of `collection`. - * Iteration is stopped once `predicate` returns truthy. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - * @example - * - * _.some([null, 0, 'yes', false], Boolean); - * // => true - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.some(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.some(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.some(users, 'active'); - * // => true - */ - function some(collection, predicate, guard) { - var func = isArray(collection) ? arraySome : baseSome; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Creates an array of elements, sorted in ascending order by the results of - * running each element in a collection thru each iteratee. This method - * performs a stable sort, that is, it preserves the original sort order of - * equal elements. The iteratees are invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {...(Function|Function[])} [iteratees=[_.identity]] - * The iteratees to sort by. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 34 } - * ]; - * - * _.sortBy(users, [function(o) { return o.user; }]); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - * - * _.sortBy(users, ['user', 'age']); - * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] - */ - var sortBy = baseRest(function(collection, iteratees) { - if (collection == null) { - return []; - } - var length = iteratees.length; - if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { - iteratees = []; - } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { - iteratees = [iteratees[0]]; - } - return baseOrderBy(collection, baseFlatten(iteratees, 1), []); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Gets the timestamp of the number of milliseconds that have elapsed since - * the Unix epoch (1 January 1970 00:00:00 UTC). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Date - * @returns {number} Returns the timestamp. - * @example - * - * _.defer(function(stamp) { - * console.log(_.now() - stamp); - * }, _.now()); - * // => Logs the number of milliseconds it took for the deferred invocation. - */ - var now = ctxNow || function() { - return root.Date.now(); - }; - - /*------------------------------------------------------------------------*/ - - /** - * The opposite of `_.before`; this method creates a function that invokes - * `func` once it's called `n` or more times. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {number} n The number of calls before `func` is invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var saves = ['profile', 'settings']; - * - * var done = _.after(saves.length, function() { - * console.log('done saving!'); - * }); - * - * _.forEach(saves, function(type) { - * asyncSave({ 'type': type, 'complete': done }); - * }); - * // => Logs 'done saving!' after the two async saves have completed. - */ - function after(n, func) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; - } - - /** - * Creates a function that invokes `func`, with up to `n` arguments, - * ignoring any additional arguments. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @param {number} [n=func.length] The arity cap. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.ary(parseInt, 1)); - * // => [6, 8, 10] - */ - function ary(func, n, guard) { - n = guard ? undefined : n; - n = (func && n == null) ? func.length : n; - return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); - } - - /** - * Creates a function that invokes `func`, with the `this` binding and arguments - * of the created function, while it's called less than `n` times. Subsequent - * calls to the created function return the result of the last `func` invocation. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {number} n The number of calls at which `func` is no longer invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * jQuery(element).on('click', _.before(5, addContactToList)); - * // => Allows adding up to 4 contacts to the list. - */ - function before(n, func) { - var result; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n > 0) { - result = func.apply(this, arguments); - } - if (n <= 1) { - func = undefined; - } - return result; - }; - } - - /** - * Creates a function that invokes `func` with the `this` binding of `thisArg` - * and `partials` prepended to the arguments it receives. - * - * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for partially applied arguments. - * - * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" - * property of bound functions. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to bind. - * @param {*} thisArg The `this` binding of `func`. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * function greet(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * - * var object = { 'user': 'fred' }; - * - * var bound = _.bind(greet, object, 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * // Bound with placeholders. - * var bound = _.bind(greet, object, _, '!'); - * bound('hi'); - * // => 'hi fred!' - */ - var bind = baseRest(function(func, thisArg, partials) { - var bitmask = WRAP_BIND_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bind)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(func, bitmask, thisArg, partials, holders); - }); - - /** - * Creates a function that invokes the method at `object[key]` with `partials` - * prepended to the arguments it receives. - * - * This method differs from `_.bind` by allowing bound functions to reference - * methods that may be redefined or don't yet exist. See - * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) - * for more details. - * - * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Function - * @param {Object} object The object to invoke the method on. - * @param {string} key The key of the method. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * var object = { - * 'user': 'fred', - * 'greet': function(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * }; - * - * var bound = _.bindKey(object, 'greet', 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * object.greet = function(greeting, punctuation) { - * return greeting + 'ya ' + this.user + punctuation; - * }; - * - * bound('!'); - * // => 'hiya fred!' - * - * // Bound with placeholders. - * var bound = _.bindKey(object, 'greet', _, '!'); - * bound('hi'); - * // => 'hiya fred!' - */ - var bindKey = baseRest(function(object, key, partials) { - var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bindKey)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(key, bitmask, object, partials, holders); - }); - - /** - * Creates a function that accepts arguments of `func` and either invokes - * `func` returning its result, if at least `arity` number of arguments have - * been provided, or returns a function that accepts the remaining `func` - * arguments, and so on. The arity of `func` may be specified if `func.length` - * is not sufficient. - * - * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curry(abc); - * - * curried(1)(2)(3); - * // => [1, 2, 3] - * - * curried(1, 2)(3); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(1)(_, 3)(2); - * // => [1, 2, 3] - */ - function curry(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curry.placeholder; - return result; - } - - /** - * This method is like `_.curry` except that arguments are applied to `func` - * in the manner of `_.partialRight` instead of `_.partial`. - * - * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curryRight(abc); - * - * curried(3)(2)(1); - * // => [1, 2, 3] - * - * curried(2, 3)(1); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(3)(1, _)(2); - * // => [1, 2, 3] - */ - function curryRight(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curryRight.placeholder; - return result; - } - - /** - * Creates a debounced function that delays invoking `func` until after `wait` - * milliseconds have elapsed since the last time the debounced function was - * invoked. The debounced function comes with a `cancel` method to cancel - * delayed `func` invocations and a `flush` method to immediately invoke them. - * Provide `options` to indicate whether `func` should be invoked on the - * leading and/or trailing edge of the `wait` timeout. The `func` is invoked - * with the last arguments provided to the debounced function. Subsequent - * calls to the debounced function return the result of the last `func` - * invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the debounced function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.debounce` and `_.throttle`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to debounce. - * @param {number} [wait=0] The number of milliseconds to delay. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=false] - * Specify invoking on the leading edge of the timeout. - * @param {number} [options.maxWait] - * The maximum time `func` is allowed to be delayed before it's invoked. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new debounced function. - * @example - * - * // Avoid costly calculations while the window size is in flux. - * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); - * - * // Invoke `sendMail` when clicked, debouncing subsequent calls. - * jQuery(element).on('click', _.debounce(sendMail, 300, { - * 'leading': true, - * 'trailing': false - * })); - * - * // Ensure `batchLog` is invoked once after 1 second of debounced calls. - * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); - * var source = new EventSource('/stream'); - * jQuery(source).on('message', debounced); - * - * // Cancel the trailing debounced invocation. - * jQuery(window).on('popstate', debounced.cancel); - */ - function debounce(func, wait, options) { - var lastArgs, - lastThis, - maxWait, - result, - timerId, - lastCallTime, - lastInvokeTime = 0, - leading = false, - maxing = false, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - wait = toNumber(wait) || 0; - if (isObject(options)) { - leading = !!options.leading; - maxing = 'maxWait' in options; - maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - - function invokeFunc(time) { - var args = lastArgs, - thisArg = lastThis; - - lastArgs = lastThis = undefined; - lastInvokeTime = time; - result = func.apply(thisArg, args); - return result; - } - - function leadingEdge(time) { - // Reset any `maxWait` timer. - lastInvokeTime = time; - // Start the timer for the trailing edge. - timerId = setTimeout(timerExpired, wait); - // Invoke the leading edge. - return leading ? invokeFunc(time) : result; - } - - function remainingWait(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime, - timeWaiting = wait - timeSinceLastCall; - - return maxing - ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) - : timeWaiting; - } - - function shouldInvoke(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime; - - // Either this is the first call, activity has stopped and we're at the - // trailing edge, the system time has gone backwards and we're treating - // it as the trailing edge, or we've hit the `maxWait` limit. - return (lastCallTime === undefined || (timeSinceLastCall >= wait) || - (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); - } - - function timerExpired() { - var time = now(); - if (shouldInvoke(time)) { - return trailingEdge(time); - } - // Restart the timer. - timerId = setTimeout(timerExpired, remainingWait(time)); - } - - function trailingEdge(time) { - timerId = undefined; - - // Only invoke if we have `lastArgs` which means `func` has been - // debounced at least once. - if (trailing && lastArgs) { - return invokeFunc(time); - } - lastArgs = lastThis = undefined; - return result; - } - - function cancel() { - if (timerId !== undefined) { - clearTimeout(timerId); - } - lastInvokeTime = 0; - lastArgs = lastCallTime = lastThis = timerId = undefined; - } - - function flush() { - return timerId === undefined ? result : trailingEdge(now()); - } - - function debounced() { - var time = now(), - isInvoking = shouldInvoke(time); - - lastArgs = arguments; - lastThis = this; - lastCallTime = time; - - if (isInvoking) { - if (timerId === undefined) { - return leadingEdge(lastCallTime); - } - if (maxing) { - // Handle invocations in a tight loop. - timerId = setTimeout(timerExpired, wait); - return invokeFunc(lastCallTime); - } - } - if (timerId === undefined) { - timerId = setTimeout(timerExpired, wait); - } - return result; - } - debounced.cancel = cancel; - debounced.flush = flush; - return debounced; - } - - /** - * Defers invoking the `func` until the current call stack has cleared. Any - * additional arguments are provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to defer. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.defer(function(text) { - * console.log(text); - * }, 'deferred'); - * // => Logs 'deferred' after one millisecond. - */ - var defer = baseRest(function(func, args) { - return baseDelay(func, 1, args); - }); - - /** - * Invokes `func` after `wait` milliseconds. Any additional arguments are - * provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.delay(function(text) { - * console.log(text); - * }, 1000, 'later'); - * // => Logs 'later' after one second. - */ - var delay = baseRest(function(func, wait, args) { - return baseDelay(func, toNumber(wait) || 0, args); - }); - - /** - * Creates a function that invokes `func` with arguments reversed. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to flip arguments for. - * @returns {Function} Returns the new flipped function. - * @example - * - * var flipped = _.flip(function() { - * return _.toArray(arguments); - * }); - * - * flipped('a', 'b', 'c', 'd'); - * // => ['d', 'c', 'b', 'a'] - */ - function flip(func) { - return createWrap(func, WRAP_FLIP_FLAG); - } - - /** - * Creates a function that memoizes the result of `func`. If `resolver` is - * provided, it determines the cache key for storing the result based on the - * arguments provided to the memoized function. By default, the first argument - * provided to the memoized function is used as the map cache key. The `func` - * is invoked with the `this` binding of the memoized function. - * - * **Note:** The cache is exposed as the `cache` property on the memoized - * function. Its creation may be customized by replacing the `_.memoize.Cache` - * constructor with one whose instances implement the - * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) - * method interface of `clear`, `delete`, `get`, `has`, and `set`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] The function to resolve the cache key. - * @returns {Function} Returns the new memoized function. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * var other = { 'c': 3, 'd': 4 }; - * - * var values = _.memoize(_.values); - * values(object); - * // => [1, 2] - * - * values(other); - * // => [3, 4] - * - * object.a = 2; - * values(object); - * // => [1, 2] - * - * // Modify the result cache. - * values.cache.set(object, ['a', 'b']); - * values(object); - * // => ['a', 'b'] - * - * // Replace `_.memoize.Cache`. - * _.memoize.Cache = WeakMap; - */ - function memoize(func, resolver) { - if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { - throw new TypeError(FUNC_ERROR_TEXT); - } - var memoized = function() { - var args = arguments, - key = resolver ? resolver.apply(this, args) : args[0], - cache = memoized.cache; - - if (cache.has(key)) { - return cache.get(key); - } - var result = func.apply(this, args); - memoized.cache = cache.set(key, result) || cache; - return result; - }; - memoized.cache = new (memoize.Cache || MapCache); - return memoized; - } - - // Expose `MapCache`. - memoize.Cache = MapCache; - - /** - * Creates a function that negates the result of the predicate `func`. The - * `func` predicate is invoked with the `this` binding and arguments of the - * created function. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} predicate The predicate to negate. - * @returns {Function} Returns the new negated function. - * @example - * - * function isEven(n) { - * return n % 2 == 0; - * } - * - * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); - * // => [1, 3, 5] - */ - function negate(predicate) { - if (typeof predicate != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return function() { - var args = arguments; - switch (args.length) { - case 0: return !predicate.call(this); - case 1: return !predicate.call(this, args[0]); - case 2: return !predicate.call(this, args[0], args[1]); - case 3: return !predicate.call(this, args[0], args[1], args[2]); - } - return !predicate.apply(this, args); - }; - } - - /** - * Creates a function that is restricted to invoking `func` once. Repeat calls - * to the function return the value of the first invocation. The `func` is - * invoked with the `this` binding and arguments of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // => `createApplication` is invoked once - */ - function once(func) { - return before(2, func); - } - - /** - * Creates a function that invokes `func` with its arguments transformed. - * - * @static - * @since 4.0.0 - * @memberOf _ - * @category Function - * @param {Function} func The function to wrap. - * @param {...(Function|Function[])} [transforms=[_.identity]] - * The argument transforms. - * @returns {Function} Returns the new function. - * @example - * - * function doubled(n) { - * return n * 2; - * } - * - * function square(n) { - * return n * n; - * } - * - * var func = _.overArgs(function(x, y) { - * return [x, y]; - * }, [square, doubled]); - * - * func(9, 3); - * // => [81, 6] - * - * func(10, 5); - * // => [100, 10] - */ - var overArgs = castRest(function(func, transforms) { - transforms = (transforms.length == 1 && isArray(transforms[0])) - ? arrayMap(transforms[0], baseUnary(getIteratee())) - : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); - - var funcsLength = transforms.length; - return baseRest(function(args) { - var index = -1, - length = nativeMin(args.length, funcsLength); - - while (++index < length) { - args[index] = transforms[index].call(this, args[index]); - } - return apply(func, this, args); - }); - }); - - /** - * Creates a function that invokes `func` with `partials` prepended to the - * arguments it receives. This method is like `_.bind` except it does **not** - * alter the `this` binding. - * - * The `_.partial.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 0.2.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var sayHelloTo = _.partial(greet, 'hello'); - * sayHelloTo('fred'); - * // => 'hello fred' - * - * // Partially applied with placeholders. - * var greetFred = _.partial(greet, _, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - */ - var partial = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partial)); - return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); - }); - - /** - * This method is like `_.partial` except that partially applied arguments - * are appended to the arguments it receives. - * - * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var greetFred = _.partialRight(greet, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - * - * // Partially applied with placeholders. - * var sayHelloTo = _.partialRight(greet, 'hello', _); - * sayHelloTo('fred'); - * // => 'hello fred' - */ - var partialRight = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partialRight)); - return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); - }); - - /** - * Creates a function that invokes `func` with arguments arranged according - * to the specified `indexes` where the argument value at the first index is - * provided as the first argument, the argument value at the second index is - * provided as the second argument, and so on. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to rearrange arguments for. - * @param {...(number|number[])} indexes The arranged argument indexes. - * @returns {Function} Returns the new function. - * @example - * - * var rearged = _.rearg(function(a, b, c) { - * return [a, b, c]; - * }, [2, 0, 1]); - * - * rearged('b', 'c', 'a') - * // => ['a', 'b', 'c'] - */ - var rearg = flatRest(function(func, indexes) { - return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); - }); - - /** - * Creates a function that invokes `func` with the `this` binding of the - * created function and arguments from `start` and beyond provided as - * an array. - * - * **Note:** This method is based on the - * [rest parameter](https://mdn.io/rest_parameters). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.rest(function(what, names) { - * return what + ' ' + _.initial(names).join(', ') + - * (_.size(names) > 1 ? ', & ' : '') + _.last(names); - * }); - * - * say('hello', 'fred', 'barney', 'pebbles'); - * // => 'hello fred, barney, & pebbles' - */ - function rest(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start === undefined ? start : toInteger(start); - return baseRest(func, start); - } - - /** - * Creates a function that invokes `func` with the `this` binding of the - * create function and an array of arguments much like - * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). - * - * **Note:** This method is based on the - * [spread operator](https://mdn.io/spread_operator). - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Function - * @param {Function} func The function to spread arguments over. - * @param {number} [start=0] The start position of the spread. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.spread(function(who, what) { - * return who + ' says ' + what; - * }); - * - * say(['fred', 'hello']); - * // => 'fred says hello' - * - * var numbers = Promise.all([ - * Promise.resolve(40), - * Promise.resolve(36) - * ]); - * - * numbers.then(_.spread(function(x, y) { - * return x + y; - * })); - * // => a Promise of 76 - */ - function spread(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start == null ? 0 : nativeMax(toInteger(start), 0); - return baseRest(function(args) { - var array = args[start], - otherArgs = castSlice(args, 0, start); - - if (array) { - arrayPush(otherArgs, array); - } - return apply(func, this, otherArgs); - }); - } - - /** - * Creates a throttled function that only invokes `func` at most once per - * every `wait` milliseconds. The throttled function comes with a `cancel` - * method to cancel delayed `func` invocations and a `flush` method to - * immediately invoke them. Provide `options` to indicate whether `func` - * should be invoked on the leading and/or trailing edge of the `wait` - * timeout. The `func` is invoked with the last arguments provided to the - * throttled function. Subsequent calls to the throttled function return the - * result of the last `func` invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the throttled function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.throttle` and `_.debounce`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to throttle. - * @param {number} [wait=0] The number of milliseconds to throttle invocations to. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=true] - * Specify invoking on the leading edge of the timeout. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new throttled function. - * @example - * - * // Avoid excessively updating the position while scrolling. - * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); - * - * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. - * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); - * jQuery(element).on('click', throttled); - * - * // Cancel the trailing throttled invocation. - * jQuery(window).on('popstate', throttled.cancel); - */ - function throttle(func, wait, options) { - var leading = true, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (isObject(options)) { - leading = 'leading' in options ? !!options.leading : leading; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - return debounce(func, wait, { - 'leading': leading, - 'maxWait': wait, - 'trailing': trailing - }); - } - - /** - * Creates a function that accepts up to one argument, ignoring any - * additional arguments. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.unary(parseInt)); - * // => [6, 8, 10] - */ - function unary(func) { - return ary(func, 1); - } - - /** - * Creates a function that provides `value` to `wrapper` as its first - * argument. Any additional arguments provided to the function are appended - * to those provided to the `wrapper`. The wrapper is invoked with the `this` - * binding of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {*} value The value to wrap. - * @param {Function} [wrapper=identity] The wrapper function. - * @returns {Function} Returns the new function. - * @example - * - * var p = _.wrap(_.escape, function(func, text) { - * return '

' + func(text) + '

'; - * }); - * - * p('fred, barney, & pebbles'); - * // => '

fred, barney, & pebbles

' - */ - function wrap(value, wrapper) { - return partial(castFunction(wrapper), value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Casts `value` as an array if it's not one. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Lang - * @param {*} value The value to inspect. - * @returns {Array} Returns the cast array. - * @example - * - * _.castArray(1); - * // => [1] - * - * _.castArray({ 'a': 1 }); - * // => [{ 'a': 1 }] - * - * _.castArray('abc'); - * // => ['abc'] - * - * _.castArray(null); - * // => [null] - * - * _.castArray(undefined); - * // => [undefined] - * - * _.castArray(); - * // => [] - * - * var array = [1, 2, 3]; - * console.log(_.castArray(array) === array); - * // => true - */ - function castArray() { - if (!arguments.length) { - return []; - } - var value = arguments[0]; - return isArray(value) ? value : [value]; - } - - /** - * Creates a shallow clone of `value`. - * - * **Note:** This method is loosely based on the - * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) - * and supports cloning arrays, array buffers, booleans, date objects, maps, - * numbers, `Object` objects, regexes, sets, strings, symbols, and typed - * arrays. The own enumerable properties of `arguments` objects are cloned - * as plain objects. An empty object is returned for uncloneable values such - * as error objects, functions, DOM nodes, and WeakMaps. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to clone. - * @returns {*} Returns the cloned value. - * @see _.cloneDeep - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var shallow = _.clone(objects); - * console.log(shallow[0] === objects[0]); - * // => true - */ - function clone(value) { - return baseClone(value, CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.clone` except that it accepts `customizer` which - * is invoked to produce the cloned value. If `customizer` returns `undefined`, - * cloning is handled by the method instead. The `customizer` is invoked with - * up to four arguments; (value [, index|key, object, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the cloned value. - * @see _.cloneDeepWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(false); - * } - * } - * - * var el = _.cloneWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 0 - */ - function cloneWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * This method is like `_.clone` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @returns {*} Returns the deep cloned value. - * @see _.clone - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var deep = _.cloneDeep(objects); - * console.log(deep[0] === objects[0]); - * // => false - */ - function cloneDeep(value) { - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.cloneWith` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the deep cloned value. - * @see _.cloneWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(true); - * } - * } - * - * var el = _.cloneDeepWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 20 - */ - function cloneDeepWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * Checks if `object` conforms to `source` by invoking the predicate - * properties of `source` with the corresponding property values of `object`. - * - * **Note:** This method is equivalent to `_.conforms` when `source` is - * partially applied. - * - * @static - * @memberOf _ - * @since 4.14.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); - * // => true - * - * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); - * // => false - */ - function conformsTo(object, source) { - return source == null || baseConformsTo(object, source, keys(source)); - } - - /** - * Performs a - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * comparison between two values to determine if they are equivalent. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.eq(object, object); - * // => true - * - * _.eq(object, other); - * // => false - * - * _.eq('a', 'a'); - * // => true - * - * _.eq('a', Object('a')); - * // => false - * - * _.eq(NaN, NaN); - * // => true - */ - function eq(value, other) { - return value === other || (value !== value && other !== other); - } - - /** - * Checks if `value` is greater than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - * @see _.lt - * @example - * - * _.gt(3, 1); - * // => true - * - * _.gt(3, 3); - * // => false - * - * _.gt(1, 3); - * // => false - */ - var gt = createRelationalOperation(baseGt); - - /** - * Checks if `value` is greater than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than or equal to - * `other`, else `false`. - * @see _.lte - * @example - * - * _.gte(3, 1); - * // => true - * - * _.gte(3, 3); - * // => true - * - * _.gte(1, 3); - * // => false - */ - var gte = createRelationalOperation(function(value, other) { - return value >= other; - }); - - /** - * Checks if `value` is likely an `arguments` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - * else `false`. - * @example - * - * _.isArguments(function() { return arguments; }()); - * // => true - * - * _.isArguments([1, 2, 3]); - * // => false - */ - var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { - return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && - !propertyIsEnumerable.call(value, 'callee'); - }; - - /** - * Checks if `value` is classified as an `Array` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array, else `false`. - * @example - * - * _.isArray([1, 2, 3]); - * // => true - * - * _.isArray(document.body.children); - * // => false - * - * _.isArray('abc'); - * // => false - * - * _.isArray(_.noop); - * // => false - */ - var isArray = Array.isArray; - - /** - * Checks if `value` is classified as an `ArrayBuffer` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - * @example - * - * _.isArrayBuffer(new ArrayBuffer(2)); - * // => true - * - * _.isArrayBuffer(new Array(2)); - * // => false - */ - var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; - - /** - * Checks if `value` is array-like. A value is considered array-like if it's - * not a function and has a `value.length` that's an integer greater than or - * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is array-like, else `false`. - * @example - * - * _.isArrayLike([1, 2, 3]); - * // => true - * - * _.isArrayLike(document.body.children); - * // => true - * - * _.isArrayLike('abc'); - * // => true - * - * _.isArrayLike(_.noop); - * // => false - */ - function isArrayLike(value) { - return value != null && isLength(value.length) && !isFunction(value); - } - - /** - * This method is like `_.isArrayLike` except that it also checks if `value` - * is an object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array-like object, - * else `false`. - * @example - * - * _.isArrayLikeObject([1, 2, 3]); - * // => true - * - * _.isArrayLikeObject(document.body.children); - * // => true - * - * _.isArrayLikeObject('abc'); - * // => false - * - * _.isArrayLikeObject(_.noop); - * // => false - */ - function isArrayLikeObject(value) { - return isObjectLike(value) && isArrayLike(value); - } - - /** - * Checks if `value` is classified as a boolean primitive or object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. - * @example - * - * _.isBoolean(false); - * // => true - * - * _.isBoolean(null); - * // => false - */ - function isBoolean(value) { - return value === true || value === false || - (isObjectLike(value) && baseGetTag(value) == boolTag); - } - - /** - * Checks if `value` is a buffer. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. - * @example - * - * _.isBuffer(new Buffer(2)); - * // => true - * - * _.isBuffer(new Uint8Array(2)); - * // => false - */ - var isBuffer = nativeIsBuffer || stubFalse; - - /** - * Checks if `value` is classified as a `Date` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - * - * _.isDate('Mon April 23 2012'); - * // => false - */ - var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; - - /** - * Checks if `value` is likely a DOM element. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. - * @example - * - * _.isElement(document.body); - * // => true - * - * _.isElement(''); - * // => false - */ - function isElement(value) { - return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); - } - - /** - * Checks if `value` is an empty object, collection, map, or set. - * - * Objects are considered empty if they have no own enumerable string keyed - * properties. - * - * Array-like values such as `arguments` objects, arrays, buffers, strings, or - * jQuery-like collections are considered empty if they have a `length` of `0`. - * Similarly, maps and sets are considered empty if they have a `size` of `0`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is empty, else `false`. - * @example - * - * _.isEmpty(null); - * // => true - * - * _.isEmpty(true); - * // => true - * - * _.isEmpty(1); - * // => true - * - * _.isEmpty([1, 2, 3]); - * // => false - * - * _.isEmpty({ 'a': 1 }); - * // => false - */ - function isEmpty(value) { - if (value == null) { - return true; - } - if (isArrayLike(value) && - (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || - isBuffer(value) || isTypedArray(value) || isArguments(value))) { - return !value.length; - } - var tag = getTag(value); - if (tag == mapTag || tag == setTag) { - return !value.size; - } - if (isPrototype(value)) { - return !baseKeys(value).length; - } - for (var key in value) { - if (hasOwnProperty.call(value, key)) { - return false; - } - } - return true; - } - - /** - * Performs a deep comparison between two values to determine if they are - * equivalent. - * - * **Note:** This method supports comparing arrays, array buffers, booleans, - * date objects, error objects, maps, numbers, `Object` objects, regexes, - * sets, strings, symbols, and typed arrays. `Object` objects are compared - * by their own, not inherited, enumerable properties. Functions and DOM - * nodes are compared by strict equality, i.e. `===`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.isEqual(object, other); - * // => true - * - * object === other; - * // => false - */ - function isEqual(value, other) { - return baseIsEqual(value, other); - } - - /** - * This method is like `_.isEqual` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with up to - * six arguments: (objValue, othValue [, index|key, object, other, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, othValue) { - * if (isGreeting(objValue) && isGreeting(othValue)) { - * return true; - * } - * } - * - * var array = ['hello', 'goodbye']; - * var other = ['hi', 'goodbye']; - * - * _.isEqualWith(array, other, customizer); - * // => true - */ - function isEqualWith(value, other, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - var result = customizer ? customizer(value, other) : undefined; - return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; - } - - /** - * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, - * `SyntaxError`, `TypeError`, or `URIError` object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an error object, else `false`. - * @example - * - * _.isError(new Error); - * // => true - * - * _.isError(Error); - * // => false - */ - function isError(value) { - if (!isObjectLike(value)) { - return false; - } - var tag = baseGetTag(value); - return tag == errorTag || tag == domExcTag || - (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); - } - - /** - * Checks if `value` is a finite primitive number. - * - * **Note:** This method is based on - * [`Number.isFinite`](https://mdn.io/Number/isFinite). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. - * @example - * - * _.isFinite(3); - * // => true - * - * _.isFinite(Number.MIN_VALUE); - * // => true - * - * _.isFinite(Infinity); - * // => false - * - * _.isFinite('3'); - * // => false - */ - function isFinite(value) { - return typeof value == 'number' && nativeIsFinite(value); - } - - /** - * Checks if `value` is classified as a `Function` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a function, else `false`. - * @example - * - * _.isFunction(_); - * // => true - * - * _.isFunction(/abc/); - * // => false - */ - function isFunction(value) { - if (!isObject(value)) { - return false; - } - // The use of `Object#toString` avoids issues with the `typeof` operator - // in Safari 9 which returns 'object' for typed arrays and other constructors. - var tag = baseGetTag(value); - return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; - } - - /** - * Checks if `value` is an integer. - * - * **Note:** This method is based on - * [`Number.isInteger`](https://mdn.io/Number/isInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an integer, else `false`. - * @example - * - * _.isInteger(3); - * // => true - * - * _.isInteger(Number.MIN_VALUE); - * // => false - * - * _.isInteger(Infinity); - * // => false - * - * _.isInteger('3'); - * // => false - */ - function isInteger(value) { - return typeof value == 'number' && value == toInteger(value); - } - - /** - * Checks if `value` is a valid array-like length. - * - * **Note:** This method is loosely based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. - * @example - * - * _.isLength(3); - * // => true - * - * _.isLength(Number.MIN_VALUE); - * // => false - * - * _.isLength(Infinity); - * // => false - * - * _.isLength('3'); - * // => false - */ - function isLength(value) { - return typeof value == 'number' && - value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is the - * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) - * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an object, else `false`. - * @example - * - * _.isObject({}); - * // => true - * - * _.isObject([1, 2, 3]); - * // => true - * - * _.isObject(_.noop); - * // => true - * - * _.isObject(null); - * // => false - */ - function isObject(value) { - var type = typeof value; - return value != null && (type == 'object' || type == 'function'); - } - - /** - * Checks if `value` is object-like. A value is object-like if it's not `null` - * and has a `typeof` result of "object". - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is object-like, else `false`. - * @example - * - * _.isObjectLike({}); - * // => true - * - * _.isObjectLike([1, 2, 3]); - * // => true - * - * _.isObjectLike(_.noop); - * // => false - * - * _.isObjectLike(null); - * // => false - */ - function isObjectLike(value) { - return value != null && typeof value == 'object'; - } - - /** - * Checks if `value` is classified as a `Map` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - * @example - * - * _.isMap(new Map); - * // => true - * - * _.isMap(new WeakMap); - * // => false - */ - var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; - - /** - * Performs a partial deep comparison between `object` and `source` to - * determine if `object` contains equivalent property values. - * - * **Note:** This method is equivalent to `_.matches` when `source` is - * partially applied. - * - * Partial comparisons will match empty array and empty object `source` - * values against any array or object value, respectively. See `_.isEqual` - * for a list of supported value comparisons. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.isMatch(object, { 'b': 2 }); - * // => true - * - * _.isMatch(object, { 'b': 1 }); - * // => false - */ - function isMatch(object, source) { - return object === source || baseIsMatch(object, source, getMatchData(source)); - } - - /** - * This method is like `_.isMatch` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with five - * arguments: (objValue, srcValue, index|key, object, source). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, srcValue) { - * if (isGreeting(objValue) && isGreeting(srcValue)) { - * return true; - * } - * } - * - * var object = { 'greeting': 'hello' }; - * var source = { 'greeting': 'hi' }; - * - * _.isMatchWith(object, source, customizer); - * // => true - */ - function isMatchWith(object, source, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseIsMatch(object, source, getMatchData(source), customizer); - } - - /** - * Checks if `value` is `NaN`. - * - * **Note:** This method is based on - * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as - * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for - * `undefined` and other non-number values. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - * @example - * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true - * - * _.isNaN(undefined); - * // => false - */ - function isNaN(value) { - // An `NaN` primitive is the only value that is not equal to itself. - // Perform the `toStringTag` check first to avoid errors with some - // ActiveX objects in IE. - return isNumber(value) && value != +value; - } - - /** - * Checks if `value` is a pristine native function. - * - * **Note:** This method can't reliably detect native functions in the presence - * of the core-js package because core-js circumvents this kind of detection. - * Despite multiple requests, the core-js maintainer has made it clear: any - * attempt to fix the detection will be obstructed. As a result, we're left - * with little choice but to throw an error. Unfortunately, this also affects - * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), - * which rely on core-js. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - * @example - * - * _.isNative(Array.prototype.push); - * // => true - * - * _.isNative(_); - * // => false - */ - function isNative(value) { - if (isMaskable(value)) { - throw new Error(CORE_ERROR_TEXT); - } - return baseIsNative(value); - } - - /** - * Checks if `value` is `null`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `null`, else `false`. - * @example - * - * _.isNull(null); - * // => true - * - * _.isNull(void 0); - * // => false - */ - function isNull(value) { - return value === null; - } - - /** - * Checks if `value` is `null` or `undefined`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is nullish, else `false`. - * @example - * - * _.isNil(null); - * // => true - * - * _.isNil(void 0); - * // => true - * - * _.isNil(NaN); - * // => false - */ - function isNil(value) { - return value == null; - } - - /** - * Checks if `value` is classified as a `Number` primitive or object. - * - * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are - * classified as numbers, use the `_.isFinite` method. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a number, else `false`. - * @example - * - * _.isNumber(3); - * // => true - * - * _.isNumber(Number.MIN_VALUE); - * // => true - * - * _.isNumber(Infinity); - * // => true - * - * _.isNumber('3'); - * // => false - */ - function isNumber(value) { - return typeof value == 'number' || - (isObjectLike(value) && baseGetTag(value) == numberTag); - } - - /** - * Checks if `value` is a plain object, that is, an object created by the - * `Object` constructor or one with a `[[Prototype]]` of `null`. - * - * @static - * @memberOf _ - * @since 0.8.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * _.isPlainObject(new Foo); - * // => false - * - * _.isPlainObject([1, 2, 3]); - * // => false - * - * _.isPlainObject({ 'x': 0, 'y': 0 }); - * // => true - * - * _.isPlainObject(Object.create(null)); - * // => true - */ - function isPlainObject(value) { - if (!isObjectLike(value) || baseGetTag(value) != objectTag) { - return false; - } - var proto = getPrototype(value); - if (proto === null) { - return true; - } - var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; - return typeof Ctor == 'function' && Ctor instanceof Ctor && - funcToString.call(Ctor) == objectCtorString; - } - - /** - * Checks if `value` is classified as a `RegExp` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - * @example - * - * _.isRegExp(/abc/); - * // => true - * - * _.isRegExp('/abc/'); - * // => false - */ - var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; - - /** - * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 - * double precision number which isn't the result of a rounded unsafe integer. - * - * **Note:** This method is based on - * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. - * @example - * - * _.isSafeInteger(3); - * // => true - * - * _.isSafeInteger(Number.MIN_VALUE); - * // => false - * - * _.isSafeInteger(Infinity); - * // => false - * - * _.isSafeInteger('3'); - * // => false - */ - function isSafeInteger(value) { - return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is classified as a `Set` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - * @example - * - * _.isSet(new Set); - * // => true - * - * _.isSet(new WeakSet); - * // => false - */ - var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; - - /** - * Checks if `value` is classified as a `String` primitive or object. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a string, else `false`. - * @example - * - * _.isString('abc'); - * // => true - * - * _.isString(1); - * // => false - */ - function isString(value) { - return typeof value == 'string' || - (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); - } - - /** - * Checks if `value` is classified as a `Symbol` primitive or object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. - * @example - * - * _.isSymbol(Symbol.iterator); - * // => true - * - * _.isSymbol('abc'); - * // => false - */ - function isSymbol(value) { - return typeof value == 'symbol' || - (isObjectLike(value) && baseGetTag(value) == symbolTag); - } - - /** - * Checks if `value` is classified as a typed array. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - * @example - * - * _.isTypedArray(new Uint8Array); - * // => true - * - * _.isTypedArray([]); - * // => false - */ - var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; - - /** - * Checks if `value` is `undefined`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. - * @example - * - * _.isUndefined(void 0); - * // => true - * - * _.isUndefined(null); - * // => false - */ - function isUndefined(value) { - return value === undefined; - } - - /** - * Checks if `value` is classified as a `WeakMap` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. - * @example - * - * _.isWeakMap(new WeakMap); - * // => true - * - * _.isWeakMap(new Map); - * // => false - */ - function isWeakMap(value) { - return isObjectLike(value) && getTag(value) == weakMapTag; - } - - /** - * Checks if `value` is classified as a `WeakSet` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. - * @example - * - * _.isWeakSet(new WeakSet); - * // => true - * - * _.isWeakSet(new Set); - * // => false - */ - function isWeakSet(value) { - return isObjectLike(value) && baseGetTag(value) == weakSetTag; - } - - /** - * Checks if `value` is less than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - * @see _.gt - * @example - * - * _.lt(1, 3); - * // => true - * - * _.lt(3, 3); - * // => false - * - * _.lt(3, 1); - * // => false - */ - var lt = createRelationalOperation(baseLt); - - /** - * Checks if `value` is less than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than or equal to - * `other`, else `false`. - * @see _.gte - * @example - * - * _.lte(1, 3); - * // => true - * - * _.lte(3, 3); - * // => true - * - * _.lte(3, 1); - * // => false - */ - var lte = createRelationalOperation(function(value, other) { - return value <= other; - }); - - /** - * Converts `value` to an array. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to convert. - * @returns {Array} Returns the converted array. - * @example - * - * _.toArray({ 'a': 1, 'b': 2 }); - * // => [1, 2] - * - * _.toArray('abc'); - * // => ['a', 'b', 'c'] - * - * _.toArray(1); - * // => [] - * - * _.toArray(null); - * // => [] - */ - function toArray(value) { - if (!value) { - return []; - } - if (isArrayLike(value)) { - return isString(value) ? stringToArray(value) : copyArray(value); - } - if (symIterator && value[symIterator]) { - return iteratorToArray(value[symIterator]()); - } - var tag = getTag(value), - func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); - - return func(value); - } - - /** - * Converts `value` to a finite number. - * - * @static - * @memberOf _ - * @since 4.12.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted number. - * @example - * - * _.toFinite(3.2); - * // => 3.2 - * - * _.toFinite(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toFinite(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toFinite('3.2'); - * // => 3.2 - */ - function toFinite(value) { - if (!value) { - return value === 0 ? value : 0; - } - value = toNumber(value); - if (value === INFINITY || value === -INFINITY) { - var sign = (value < 0 ? -1 : 1); - return sign * MAX_INTEGER; - } - return value === value ? value : 0; - } - - /** - * Converts `value` to an integer. - * - * **Note:** This method is loosely based on - * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toInteger(3.2); - * // => 3 - * - * _.toInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toInteger(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toInteger('3.2'); - * // => 3 - */ - function toInteger(value) { - var result = toFinite(value), - remainder = result % 1; - - return result === result ? (remainder ? result - remainder : result) : 0; - } - - /** - * Converts `value` to an integer suitable for use as the length of an - * array-like object. - * - * **Note:** This method is based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toLength(3.2); - * // => 3 - * - * _.toLength(Number.MIN_VALUE); - * // => 0 - * - * _.toLength(Infinity); - * // => 4294967295 - * - * _.toLength('3.2'); - * // => 3 - */ - function toLength(value) { - return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; - } - - /** - * Converts `value` to a number. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to process. - * @returns {number} Returns the number. - * @example - * - * _.toNumber(3.2); - * // => 3.2 - * - * _.toNumber(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toNumber(Infinity); - * // => Infinity - * - * _.toNumber('3.2'); - * // => 3.2 - */ - function toNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - if (isObject(value)) { - var other = typeof value.valueOf == 'function' ? value.valueOf() : value; - value = isObject(other) ? (other + '') : other; - } - if (typeof value != 'string') { - return value === 0 ? value : +value; - } - value = value.replace(reTrim, ''); - var isBinary = reIsBinary.test(value); - return (isBinary || reIsOctal.test(value)) - ? freeParseInt(value.slice(2), isBinary ? 2 : 8) - : (reIsBadHex.test(value) ? NAN : +value); - } - - /** - * Converts `value` to a plain object flattening inherited enumerable string - * keyed properties of `value` to own properties of the plain object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {Object} Returns the converted plain object. - * @example - * - * function Foo() { - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.assign({ 'a': 1 }, new Foo); - * // => { 'a': 1, 'b': 2 } - * - * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); - * // => { 'a': 1, 'b': 2, 'c': 3 } - */ - function toPlainObject(value) { - return copyObject(value, keysIn(value)); - } - - /** - * Converts `value` to a safe integer. A safe integer can be compared and - * represented correctly. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toSafeInteger(3.2); - * // => 3 - * - * _.toSafeInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toSafeInteger(Infinity); - * // => 9007199254740991 - * - * _.toSafeInteger('3.2'); - * // => 3 - */ - function toSafeInteger(value) { - return value - ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) - : (value === 0 ? value : 0); - } - - /** - * Converts `value` to a string. An empty string is returned for `null` - * and `undefined` values. The sign of `-0` is preserved. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.toString(null); - * // => '' - * - * _.toString(-0); - * // => '-0' - * - * _.toString([1, 2, 3]); - * // => '1,2,3' - */ - function toString(value) { - return value == null ? '' : baseToString(value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Assigns own enumerable string keyed properties of source objects to the - * destination object. Source objects are applied from left to right. - * Subsequent sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object` and is loosely based on - * [`Object.assign`](https://mdn.io/Object/assign). - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assignIn - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assign({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'c': 3 } - */ - var assign = createAssigner(function(object, source) { - if (isPrototype(source) || isArrayLike(source)) { - copyObject(source, keys(source), object); - return; - } - for (var key in source) { - if (hasOwnProperty.call(source, key)) { - assignValue(object, key, source[key]); - } - } - }); - - /** - * This method is like `_.assign` except that it iterates over own and - * inherited source properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extend - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assign - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assignIn({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } - */ - var assignIn = createAssigner(function(object, source) { - copyObject(source, keysIn(source), object); - }); - - /** - * This method is like `_.assignIn` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extendWith - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignInWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keysIn(source), object, customizer); - }); - - /** - * This method is like `_.assign` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignInWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keys(source), object, customizer); - }); - - /** - * Creates an array of values corresponding to `paths` of `object`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Array} Returns the picked values. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _.at(object, ['a[0].b.c', 'a[1]']); - * // => [3, 4] - */ - var at = flatRest(baseAt); - - /** - * Creates an object that inherits from the `prototype` object. If a - * `properties` object is given, its own enumerable string keyed properties - * are assigned to the created object. - * - * @static - * @memberOf _ - * @since 2.3.0 - * @category Object - * @param {Object} prototype The object to inherit from. - * @param {Object} [properties] The properties to assign to the object. - * @returns {Object} Returns the new object. - * @example - * - * function Shape() { - * this.x = 0; - * this.y = 0; - * } - * - * function Circle() { - * Shape.call(this); - * } - * - * Circle.prototype = _.create(Shape.prototype, { - * 'constructor': Circle - * }); - * - * var circle = new Circle; - * circle instanceof Circle; - * // => true - * - * circle instanceof Shape; - * // => true - */ - function create(prototype, properties) { - var result = baseCreate(prototype); - return properties == null ? result : baseAssign(result, properties); - } - - /** - * Assigns own and inherited enumerable string keyed properties of source - * objects to the destination object for all destination properties that - * resolve to `undefined`. Source objects are applied from left to right. - * Once a property is set, additional values of the same property are ignored. - * - * **Note:** This method mutates `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaultsDeep - * @example - * - * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var defaults = baseRest(function(object, sources) { - object = Object(object); - - var index = -1; - var length = sources.length; - var guard = length > 2 ? sources[2] : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - length = 1; - } - - while (++index < length) { - var source = sources[index]; - var props = keysIn(source); - var propsIndex = -1; - var propsLength = props.length; - - while (++propsIndex < propsLength) { - var key = props[propsIndex]; - var value = object[key]; - - if (value === undefined || - (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { - object[key] = source[key]; - } - } - } - - return object; - }); - - /** - * This method is like `_.defaults` except that it recursively assigns - * default properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaults - * @example - * - * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); - * // => { 'a': { 'b': 2, 'c': 3 } } - */ - var defaultsDeep = baseRest(function(args) { - args.push(undefined, customDefaultsMerge); - return apply(mergeWith, undefined, args); - }); - - /** - * This method is like `_.find` except that it returns the key of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findKey(users, function(o) { return o.age < 40; }); - * // => 'barney' (iteration order is not guaranteed) - * - * // The `_.matches` iteratee shorthand. - * _.findKey(users, { 'age': 1, 'active': true }); - * // => 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findKey(users, 'active'); - * // => 'barney' - */ - function findKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); - } - - /** - * This method is like `_.findKey` except that it iterates over elements of - * a collection in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findLastKey(users, function(o) { return o.age < 40; }); - * // => returns 'pebbles' assuming `_.findKey` returns 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.findLastKey(users, { 'age': 36, 'active': true }); - * // => 'barney' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findLastKey(users, 'active'); - * // => 'pebbles' - */ - function findLastKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); - } - - /** - * Iterates over own and inherited enumerable string keyed properties of an - * object and invokes `iteratee` for each property. The iteratee is invoked - * with three arguments: (value, key, object). Iteratee functions may exit - * iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forInRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forIn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). - */ - function forIn(object, iteratee) { - return object == null - ? object - : baseFor(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * This method is like `_.forIn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forIn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forInRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. - */ - function forInRight(object, iteratee) { - return object == null - ? object - : baseForRight(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * Iterates over own enumerable string keyed properties of an object and - * invokes `iteratee` for each property. The iteratee is invoked with three - * arguments: (value, key, object). Iteratee functions may exit iteration - * early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwnRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forOwn(object, iteratee) { - return object && baseForOwn(object, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forOwn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwnRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. - */ - function forOwnRight(object, iteratee) { - return object && baseForOwnRight(object, getIteratee(iteratee, 3)); - } - - /** - * Creates an array of function property names from own enumerable properties - * of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functionsIn - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functions(new Foo); - * // => ['a', 'b'] - */ - function functions(object) { - return object == null ? [] : baseFunctions(object, keys(object)); - } - - /** - * Creates an array of function property names from own and inherited - * enumerable properties of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functions - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functionsIn(new Foo); - * // => ['a', 'b', 'c'] - */ - function functionsIn(object) { - return object == null ? [] : baseFunctions(object, keysIn(object)); - } - - /** - * Gets the value at `path` of `object`. If the resolved value is - * `undefined`, the `defaultValue` is returned in its place. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.get(object, 'a[0].b.c'); - * // => 3 - * - * _.get(object, ['a', '0', 'b', 'c']); - * // => 3 - * - * _.get(object, 'a.b.c', 'default'); - * // => 'default' - */ - function get(object, path, defaultValue) { - var result = object == null ? undefined : baseGet(object, path); - return result === undefined ? defaultValue : result; - } - - /** - * Checks if `path` is a direct property of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = { 'a': { 'b': 2 } }; - * var other = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.has(object, 'a'); - * // => true - * - * _.has(object, 'a.b'); - * // => true - * - * _.has(object, ['a', 'b']); - * // => true - * - * _.has(other, 'a'); - * // => false - */ - function has(object, path) { - return object != null && hasPath(object, path, baseHas); - } - - /** - * Checks if `path` is a direct or inherited property of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.hasIn(object, 'a'); - * // => true - * - * _.hasIn(object, 'a.b'); - * // => true - * - * _.hasIn(object, ['a', 'b']); - * // => true - * - * _.hasIn(object, 'b'); - * // => false - */ - function hasIn(object, path) { - return object != null && hasPath(object, path, baseHasIn); - } - - /** - * Creates an object composed of the inverted keys and values of `object`. - * If `object` contains duplicate values, subsequent values overwrite - * property assignments of previous values. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Object - * @param {Object} object The object to invert. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invert(object); - * // => { '1': 'c', '2': 'b' } - */ - var invert = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - result[value] = key; - }, constant(identity)); - - /** - * This method is like `_.invert` except that the inverted object is generated - * from the results of running each element of `object` thru `iteratee`. The - * corresponding inverted value of each inverted key is an array of keys - * responsible for generating the inverted value. The iteratee is invoked - * with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Object - * @param {Object} object The object to invert. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invertBy(object); - * // => { '1': ['a', 'c'], '2': ['b'] } - * - * _.invertBy(object, function(value) { - * return 'group' + value; - * }); - * // => { 'group1': ['a', 'c'], 'group2': ['b'] } - */ - var invertBy = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - if (hasOwnProperty.call(result, value)) { - result[value].push(key); - } else { - result[value] = [key]; - } - }, getIteratee); - - /** - * Invokes the method at `path` of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {...*} [args] The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - * @example - * - * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; - * - * _.invoke(object, 'a[0].b.c.slice', 1, 3); - * // => [2, 3] - */ - var invoke = baseRest(baseInvoke); - - /** - * Creates an array of the own enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. See the - * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * for more details. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keys(new Foo); - * // => ['a', 'b'] (iteration order is not guaranteed) - * - * _.keys('hi'); - * // => ['0', '1'] - */ - function keys(object) { - return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); - } - - /** - * Creates an array of the own and inherited enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keysIn(new Foo); - * // => ['a', 'b', 'c'] (iteration order is not guaranteed) - */ - function keysIn(object) { - return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); - } - - /** - * The opposite of `_.mapValues`; this method creates an object with the - * same values as `object` and keys generated by running each own enumerable - * string keyed property of `object` thru `iteratee`. The iteratee is invoked - * with three arguments: (value, key, object). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapValues - * @example - * - * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { - * return key + value; - * }); - * // => { 'a1': 1, 'b2': 2 } - */ - function mapKeys(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, iteratee(value, key, object), value); - }); - return result; - } - - /** - * Creates an object with the same keys as `object` and values generated - * by running each own enumerable string keyed property of `object` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, key, object). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapKeys - * @example - * - * var users = { - * 'fred': { 'user': 'fred', 'age': 40 }, - * 'pebbles': { 'user': 'pebbles', 'age': 1 } - * }; - * - * _.mapValues(users, function(o) { return o.age; }); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - * - * // The `_.property` iteratee shorthand. - * _.mapValues(users, 'age'); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - */ - function mapValues(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, key, iteratee(value, key, object)); - }); - return result; - } - - /** - * This method is like `_.assign` except that it recursively merges own and - * inherited enumerable string keyed properties of source objects into the - * destination object. Source properties that resolve to `undefined` are - * skipped if a destination value exists. Array and plain object properties - * are merged recursively. Other objects and value types are overridden by - * assignment. Source objects are applied from left to right. Subsequent - * sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @example - * - * var object = { - * 'a': [{ 'b': 2 }, { 'd': 4 }] - * }; - * - * var other = { - * 'a': [{ 'c': 3 }, { 'e': 5 }] - * }; - * - * _.merge(object, other); - * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } - */ - var merge = createAssigner(function(object, source, srcIndex) { - baseMerge(object, source, srcIndex); - }); - - /** - * This method is like `_.merge` except that it accepts `customizer` which - * is invoked to produce the merged values of the destination and source - * properties. If `customizer` returns `undefined`, merging is handled by the - * method instead. The `customizer` is invoked with six arguments: - * (objValue, srcValue, key, object, source, stack). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} customizer The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * function customizer(objValue, srcValue) { - * if (_.isArray(objValue)) { - * return objValue.concat(srcValue); - * } - * } - * - * var object = { 'a': [1], 'b': [2] }; - * var other = { 'a': [3], 'b': [4] }; - * - * _.mergeWith(object, other, customizer); - * // => { 'a': [1, 3], 'b': [2, 4] } - */ - var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { - baseMerge(object, source, srcIndex, customizer); - }); - - /** - * The opposite of `_.pick`; this method creates an object composed of the - * own and inherited enumerable property paths of `object` that are not omitted. - * - * **Note:** This method is considerably slower than `_.pick`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to omit. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omit(object, ['a', 'c']); - * // => { 'b': '2' } - */ - var omit = flatRest(function(object, paths) { - var result = {}; - if (object == null) { - return result; - } - var isDeep = false; - paths = arrayMap(paths, function(path) { - path = castPath(path, object); - isDeep || (isDeep = path.length > 1); - return path; - }); - copyObject(object, getAllKeysIn(object), result); - if (isDeep) { - result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); - } - var length = paths.length; - while (length--) { - baseUnset(result, paths[length]); - } - return result; - }); - - /** - * The opposite of `_.pickBy`; this method creates an object composed of - * the own and inherited enumerable string keyed properties of `object` that - * `predicate` doesn't return truthy for. The predicate is invoked with two - * arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omitBy(object, _.isNumber); - * // => { 'b': '2' } - */ - function omitBy(object, predicate) { - return pickBy(object, negate(getIteratee(predicate))); - } - - /** - * Creates an object composed of the picked `object` properties. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pick(object, ['a', 'c']); - * // => { 'a': 1, 'c': 3 } - */ - var pick = flatRest(function(object, paths) { - return object == null ? {} : basePick(object, paths); - }); - - /** - * Creates an object composed of the `object` properties `predicate` returns - * truthy for. The predicate is invoked with two arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pickBy(object, _.isNumber); - * // => { 'a': 1, 'c': 3 } - */ - function pickBy(object, predicate) { - if (object == null) { - return {}; - } - var props = arrayMap(getAllKeysIn(object), function(prop) { - return [prop]; - }); - predicate = getIteratee(predicate); - return basePickBy(object, props, function(value, path) { - return predicate(value, path[0]); - }); - } - - /** - * This method is like `_.get` except that if the resolved value is a - * function it's invoked with the `this` binding of its parent object and - * its result is returned. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to resolve. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; - * - * _.result(object, 'a[0].b.c1'); - * // => 3 - * - * _.result(object, 'a[0].b.c2'); - * // => 4 - * - * _.result(object, 'a[0].b.c3', 'default'); - * // => 'default' - * - * _.result(object, 'a[0].b.c3', _.constant('default')); - * // => 'default' - */ - function result(object, path, defaultValue) { - path = castPath(path, object); - - var index = -1, - length = path.length; - - // Ensure the loop is entered when path is empty. - if (!length) { - length = 1; - object = undefined; - } - while (++index < length) { - var value = object == null ? undefined : object[toKey(path[index])]; - if (value === undefined) { - index = length; - value = defaultValue; - } - object = isFunction(value) ? value.call(object) : value; - } - return object; - } - - /** - * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, - * it's created. Arrays are created for missing index properties while objects - * are created for all other missing properties. Use `_.setWith` to customize - * `path` creation. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.set(object, 'a[0].b.c', 4); - * console.log(object.a[0].b.c); - * // => 4 - * - * _.set(object, ['x', '0', 'y', 'z'], 5); - * console.log(object.x[0].y.z); - * // => 5 - */ - function set(object, path, value) { - return object == null ? object : baseSet(object, path, value); - } - - /** - * This method is like `_.set` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.setWith(object, '[0][1]', 'a', Object); - * // => { '0': { '1': 'a' } } - */ - function setWith(object, path, value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseSet(object, path, value, customizer); - } - - /** - * Creates an array of own enumerable string keyed-value pairs for `object` - * which can be consumed by `_.fromPairs`. If `object` is a map or set, its - * entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entries - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairs(new Foo); - * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) - */ - var toPairs = createToPairs(keys); - - /** - * Creates an array of own and inherited enumerable string keyed-value pairs - * for `object` which can be consumed by `_.fromPairs`. If `object` is a map - * or set, its entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entriesIn - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairsIn(new Foo); - * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) - */ - var toPairsIn = createToPairs(keysIn); - - /** - * An alternative to `_.reduce`; this method transforms `object` to a new - * `accumulator` object which is the result of running each of its own - * enumerable string keyed properties thru `iteratee`, with each invocation - * potentially mutating the `accumulator` object. If `accumulator` is not - * provided, a new object with the same `[[Prototype]]` will be used. The - * iteratee is invoked with four arguments: (accumulator, value, key, object). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The custom accumulator value. - * @returns {*} Returns the accumulated value. - * @example - * - * _.transform([2, 3, 4], function(result, n) { - * result.push(n *= n); - * return n % 2 == 0; - * }, []); - * // => [4, 9] - * - * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } - */ - function transform(object, iteratee, accumulator) { - var isArr = isArray(object), - isArrLike = isArr || isBuffer(object) || isTypedArray(object); - - iteratee = getIteratee(iteratee, 4); - if (accumulator == null) { - var Ctor = object && object.constructor; - if (isArrLike) { - accumulator = isArr ? new Ctor : []; - } - else if (isObject(object)) { - accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; - } - else { - accumulator = {}; - } - } - (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { - return iteratee(accumulator, value, index, object); - }); - return accumulator; - } - - /** - * Removes the property at `path` of `object`. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 7 } }] }; - * _.unset(object, 'a[0].b.c'); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - * - * _.unset(object, ['a', '0', 'b', 'c']); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - */ - function unset(object, path) { - return object == null ? true : baseUnset(object, path); - } - - /** - * This method is like `_.set` except that accepts `updater` to produce the - * value to set. Use `_.updateWith` to customize `path` creation. The `updater` - * is invoked with one argument: (value). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.update(object, 'a[0].b.c', function(n) { return n * n; }); - * console.log(object.a[0].b.c); - * // => 9 - * - * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); - * console.log(object.x[0].y.z); - * // => 0 - */ - function update(object, path, updater) { - return object == null ? object : baseUpdate(object, path, castFunction(updater)); - } - - /** - * This method is like `_.update` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.updateWith(object, '[0][1]', _.constant('a'), Object); - * // => { '0': { '1': 'a' } } - */ - function updateWith(object, path, updater, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); - } - - /** - * Creates an array of the own enumerable string keyed property values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.values(new Foo); - * // => [1, 2] (iteration order is not guaranteed) - * - * _.values('hi'); - * // => ['h', 'i'] - */ - function values(object) { - return object == null ? [] : baseValues(object, keys(object)); - } - - /** - * Creates an array of the own and inherited enumerable string keyed property - * values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.valuesIn(new Foo); - * // => [1, 2, 3] (iteration order is not guaranteed) - */ - function valuesIn(object) { - return object == null ? [] : baseValues(object, keysIn(object)); - } - - /*------------------------------------------------------------------------*/ - - /** - * Clamps `number` within the inclusive `lower` and `upper` bounds. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Number - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - * @example - * - * _.clamp(-10, -5, 5); - * // => -5 - * - * _.clamp(10, -5, 5); - * // => 5 - */ - function clamp(number, lower, upper) { - if (upper === undefined) { - upper = lower; - lower = undefined; - } - if (upper !== undefined) { - upper = toNumber(upper); - upper = upper === upper ? upper : 0; - } - if (lower !== undefined) { - lower = toNumber(lower); - lower = lower === lower ? lower : 0; - } - return baseClamp(toNumber(number), lower, upper); - } - - /** - * Checks if `n` is between `start` and up to, but not including, `end`. If - * `end` is not specified, it's set to `start` with `start` then set to `0`. - * If `start` is greater than `end` the params are swapped to support - * negative ranges. - * - * @static - * @memberOf _ - * @since 3.3.0 - * @category Number - * @param {number} number The number to check. - * @param {number} [start=0] The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - * @see _.range, _.rangeRight - * @example - * - * _.inRange(3, 2, 4); - * // => true - * - * _.inRange(4, 8); - * // => true - * - * _.inRange(4, 2); - * // => false - * - * _.inRange(2, 2); - * // => false - * - * _.inRange(1.2, 2); - * // => true - * - * _.inRange(5.2, 4); - * // => false - * - * _.inRange(-3, -2, -6); - * // => true - */ - function inRange(number, start, end) { - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - number = toNumber(number); - return baseInRange(number, start, end); - } - - /** - * Produces a random number between the inclusive `lower` and `upper` bounds. - * If only one argument is provided a number between `0` and the given number - * is returned. If `floating` is `true`, or either `lower` or `upper` are - * floats, a floating-point number is returned instead of an integer. - * - * **Note:** JavaScript follows the IEEE-754 standard for resolving - * floating-point values which can produce unexpected results. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Number - * @param {number} [lower=0] The lower bound. - * @param {number} [upper=1] The upper bound. - * @param {boolean} [floating] Specify returning a floating-point number. - * @returns {number} Returns the random number. - * @example - * - * _.random(0, 5); - * // => an integer between 0 and 5 - * - * _.random(5); - * // => also an integer between 0 and 5 - * - * _.random(5, true); - * // => a floating-point number between 0 and 5 - * - * _.random(1.2, 5.2); - * // => a floating-point number between 1.2 and 5.2 - */ - function random(lower, upper, floating) { - if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { - upper = floating = undefined; - } - if (floating === undefined) { - if (typeof upper == 'boolean') { - floating = upper; - upper = undefined; - } - else if (typeof lower == 'boolean') { - floating = lower; - lower = undefined; - } - } - if (lower === undefined && upper === undefined) { - lower = 0; - upper = 1; - } - else { - lower = toFinite(lower); - if (upper === undefined) { - upper = lower; - lower = 0; - } else { - upper = toFinite(upper); - } - } - if (lower > upper) { - var temp = lower; - lower = upper; - upper = temp; - } - if (floating || lower % 1 || upper % 1) { - var rand = nativeRandom(); - return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); - } - return baseRandom(lower, upper); - } - - /*------------------------------------------------------------------------*/ - - /** - * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the camel cased string. - * @example - * - * _.camelCase('Foo Bar'); - * // => 'fooBar' - * - * _.camelCase('--foo-bar--'); - * // => 'fooBar' - * - * _.camelCase('__FOO_BAR__'); - * // => 'fooBar' - */ - var camelCase = createCompounder(function(result, word, index) { - word = word.toLowerCase(); - return result + (index ? capitalize(word) : word); - }); - - /** - * Converts the first character of `string` to upper case and the remaining - * to lower case. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to capitalize. - * @returns {string} Returns the capitalized string. - * @example - * - * _.capitalize('FRED'); - * // => 'Fred' - */ - function capitalize(string) { - return upperFirst(toString(string).toLowerCase()); - } - - /** - * Deburrs `string` by converting - * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) - * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) - * letters to basic Latin letters and removing - * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to deburr. - * @returns {string} Returns the deburred string. - * @example - * - * _.deburr('déjà vu'); - * // => 'deja vu' - */ - function deburr(string) { - string = toString(string); - return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); - } - - /** - * Checks if `string` ends with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=string.length] The position to search up to. - * @returns {boolean} Returns `true` if `string` ends with `target`, - * else `false`. - * @example - * - * _.endsWith('abc', 'c'); - * // => true - * - * _.endsWith('abc', 'b'); - * // => false - * - * _.endsWith('abc', 'b', 2); - * // => true - */ - function endsWith(string, target, position) { - string = toString(string); - target = baseToString(target); - - var length = string.length; - position = position === undefined - ? length - : baseClamp(toInteger(position), 0, length); - - var end = position; - position -= target.length; - return position >= 0 && string.slice(position, end) == target; - } - - /** - * Converts the characters "&", "<", ">", '"', and "'" in `string` to their - * corresponding HTML entities. - * - * **Note:** No other characters are escaped. To escape additional - * characters use a third-party library like [_he_](https://mths.be/he). - * - * Though the ">" character is escaped for symmetry, characters like - * ">" and "/" don't need escaping in HTML and have no special meaning - * unless they're part of a tag or unquoted attribute value. See - * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) - * (under "semi-related fun fact") for more details. - * - * When working with HTML you should always - * [quote attribute values](http://wonko.com/post/html-escaping) to reduce - * XSS vectors. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escape('fred, barney, & pebbles'); - * // => 'fred, barney, & pebbles' - */ - function escape(string) { - string = toString(string); - return (string && reHasUnescapedHtml.test(string)) - ? string.replace(reUnescapedHtml, escapeHtmlChar) - : string; - } - - /** - * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", - * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escapeRegExp('[lodash](https://lodash.com/)'); - * // => '\[lodash\]\(https://lodash\.com/\)' - */ - function escapeRegExp(string) { - string = toString(string); - return (string && reHasRegExpChar.test(string)) - ? string.replace(reRegExpChar, '\\$&') - : string; - } - - /** - * Converts `string` to - * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the kebab cased string. - * @example - * - * _.kebabCase('Foo Bar'); - * // => 'foo-bar' - * - * _.kebabCase('fooBar'); - * // => 'foo-bar' - * - * _.kebabCase('__FOO_BAR__'); - * // => 'foo-bar' - */ - var kebabCase = createCompounder(function(result, word, index) { - return result + (index ? '-' : '') + word.toLowerCase(); - }); - - /** - * Converts `string`, as space separated words, to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the lower cased string. - * @example - * - * _.lowerCase('--Foo-Bar--'); - * // => 'foo bar' - * - * _.lowerCase('fooBar'); - * // => 'foo bar' - * - * _.lowerCase('__FOO_BAR__'); - * // => 'foo bar' - */ - var lowerCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + word.toLowerCase(); - }); - - /** - * Converts the first character of `string` to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.lowerFirst('Fred'); - * // => 'fred' - * - * _.lowerFirst('FRED'); - * // => 'fRED' - */ - var lowerFirst = createCaseFirst('toLowerCase'); - - /** - * Pads `string` on the left and right sides if it's shorter than `length`. - * Padding characters are truncated if they can't be evenly divided by `length`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.pad('abc', 8); - * // => ' abc ' - * - * _.pad('abc', 8, '_-'); - * // => '_-abc_-_' - * - * _.pad('abc', 3); - * // => 'abc' - */ - function pad(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - if (!length || strLength >= length) { - return string; - } - var mid = (length - strLength) / 2; - return ( - createPadding(nativeFloor(mid), chars) + - string + - createPadding(nativeCeil(mid), chars) - ); - } - - /** - * Pads `string` on the right side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padEnd('abc', 6); - * // => 'abc ' - * - * _.padEnd('abc', 6, '_-'); - * // => 'abc_-_' - * - * _.padEnd('abc', 3); - * // => 'abc' - */ - function padEnd(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (string + createPadding(length - strLength, chars)) - : string; - } - - /** - * Pads `string` on the left side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padStart('abc', 6); - * // => ' abc' - * - * _.padStart('abc', 6, '_-'); - * // => '_-_abc' - * - * _.padStart('abc', 3); - * // => 'abc' - */ - function padStart(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (createPadding(length - strLength, chars) + string) - : string; - } - - /** - * Converts `string` to an integer of the specified radix. If `radix` is - * `undefined` or `0`, a `radix` of `10` is used unless `value` is a - * hexadecimal, in which case a `radix` of `16` is used. - * - * **Note:** This method aligns with the - * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category String - * @param {string} string The string to convert. - * @param {number} [radix=10] The radix to interpret `value` by. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {number} Returns the converted integer. - * @example - * - * _.parseInt('08'); - * // => 8 - * - * _.map(['6', '08', '10'], _.parseInt); - * // => [6, 8, 10] - */ - function parseInt(string, radix, guard) { - if (guard || radix == null) { - radix = 0; - } else if (radix) { - radix = +radix; - } - return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); - } - - /** - * Repeats the given string `n` times. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to repeat. - * @param {number} [n=1] The number of times to repeat the string. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {string} Returns the repeated string. - * @example - * - * _.repeat('*', 3); - * // => '***' - * - * _.repeat('abc', 2); - * // => 'abcabc' - * - * _.repeat('abc', 0); - * // => '' - */ - function repeat(string, n, guard) { - if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - return baseRepeat(toString(string), n); - } - - /** - * Replaces matches for `pattern` in `string` with `replacement`. - * - * **Note:** This method is based on - * [`String#replace`](https://mdn.io/String/replace). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to modify. - * @param {RegExp|string} pattern The pattern to replace. - * @param {Function|string} replacement The match replacement. - * @returns {string} Returns the modified string. - * @example - * - * _.replace('Hi Fred', 'Fred', 'Barney'); - * // => 'Hi Barney' - */ - function replace() { - var args = arguments, - string = toString(args[0]); - - return args.length < 3 ? string : string.replace(args[1], args[2]); - } - - /** - * Converts `string` to - * [snake case](https://en.wikipedia.org/wiki/Snake_case). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the snake cased string. - * @example - * - * _.snakeCase('Foo Bar'); - * // => 'foo_bar' - * - * _.snakeCase('fooBar'); - * // => 'foo_bar' - * - * _.snakeCase('--FOO-BAR--'); - * // => 'foo_bar' - */ - var snakeCase = createCompounder(function(result, word, index) { - return result + (index ? '_' : '') + word.toLowerCase(); - }); - - /** - * Splits `string` by `separator`. - * - * **Note:** This method is based on - * [`String#split`](https://mdn.io/String/split). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to split. - * @param {RegExp|string} separator The separator pattern to split by. - * @param {number} [limit] The length to truncate results to. - * @returns {Array} Returns the string segments. - * @example - * - * _.split('a-b-c', '-', 2); - * // => ['a', 'b'] - */ - function split(string, separator, limit) { - if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { - separator = limit = undefined; - } - limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; - if (!limit) { - return []; - } - string = toString(string); - if (string && ( - typeof separator == 'string' || - (separator != null && !isRegExp(separator)) - )) { - separator = baseToString(separator); - if (!separator && hasUnicode(string)) { - return castSlice(stringToArray(string), 0, limit); - } - } - return string.split(separator, limit); - } - - /** - * Converts `string` to - * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). - * - * @static - * @memberOf _ - * @since 3.1.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the start cased string. - * @example - * - * _.startCase('--foo-bar--'); - * // => 'Foo Bar' - * - * _.startCase('fooBar'); - * // => 'Foo Bar' - * - * _.startCase('__FOO_BAR__'); - * // => 'FOO BAR' - */ - var startCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + upperFirst(word); - }); - - /** - * Checks if `string` starts with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=0] The position to search from. - * @returns {boolean} Returns `true` if `string` starts with `target`, - * else `false`. - * @example - * - * _.startsWith('abc', 'a'); - * // => true - * - * _.startsWith('abc', 'b'); - * // => false - * - * _.startsWith('abc', 'b', 1); - * // => true - */ - function startsWith(string, target, position) { - string = toString(string); - position = position == null - ? 0 - : baseClamp(toInteger(position), 0, string.length); - - target = baseToString(target); - return string.slice(position, position + target.length) == target; - } - - /** - * Creates a compiled template function that can interpolate data properties - * in "interpolate" delimiters, HTML-escape interpolated data properties in - * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data - * properties may be accessed as free variables in the template. If a setting - * object is given, it takes precedence over `_.templateSettings` values. - * - * **Note:** In the development build `_.template` utilizes - * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) - * for easier debugging. - * - * For more information on precompiling templates see - * [lodash's custom builds documentation](https://lodash.com/custom-builds). - * - * For more information on Chrome extension sandboxes see - * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The template string. - * @param {Object} [options={}] The options object. - * @param {RegExp} [options.escape=_.templateSettings.escape] - * The HTML "escape" delimiter. - * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] - * The "evaluate" delimiter. - * @param {Object} [options.imports=_.templateSettings.imports] - * An object to import into the template as free variables. - * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] - * The "interpolate" delimiter. - * @param {string} [options.sourceURL='lodash.templateSources[n]'] - * The sourceURL of the compiled template. - * @param {string} [options.variable='obj'] - * The data object variable name. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the compiled template function. - * @example - * - * // Use the "interpolate" delimiter to create a compiled template. - * var compiled = _.template('hello <%= user %>!'); - * compiled({ 'user': 'fred' }); - * // => 'hello fred!' - * - * // Use the HTML "escape" delimiter to escape data property values. - * var compiled = _.template('<%- value %>'); - * compiled({ 'value': '